feat: add examples/compile-php-to-wasm

4 files changed, 8395 insertions, 0 deletions

diff --git a/examples/compile-php-to-wasm/Dockerfile b/examples/compile-php-to-wasm/Dockerfile
new file mode 100644
index 0000000..1bdef61
--- /dev/null
+++ b/examples/compile-php-to-wasm/Dockerfile
@@ -0,0 +1,65 @@
+FROM emscripten/emsdk:3.1.46
+
+RUN git clone --depth=1 --branch=php-8.2.10 https://github.com/php/php-src
+
+RUN apt-get update && \
+    apt-get install -y --no-install-recommends \
+        autoconf \
+        bison \
+        pkg-config \
+        re2c \
+        && \
+    :
+
+RUN cd php-src && \
+    ./buildconf --force && \
+    emconfigure ./configure \
+        --disable-all \
+        --disable-mbregex \
+        --disable-fiber-asm \
+        --disable-cli \
+        --disable-cgi \
+        --disable-phpdbg \
+        --enable-embed=static \
+        --enable-mbstring \
+        --without-iconv \
+        --without-libxml \
+        --without-pcre-jit \
+        --without-pdo-sqlite \
+        --without-sqlite3 \
+        && \
+    EMCC_CFLAGS='-s ERROR_ON_UNDEFINED_SYMBOLS=0' emmake make -j$(nproc) && \
+    mv libs/libphp.a .. && \
+    make clean && \
+    git clean -fd && \
+    :
+
+COPY php-wasm.c /src/
+
+RUN cd php-src && \
+    emcc \
+        -c \
+        -o php-wasm.o \
+        -I . \
+        -I TSRM \
+        -I Zend \
+        -I main \
+        ../php-wasm.c \
+        && \
+    mv php-wasm.o .. && \
+    make clean && \
+    git clean -fd && \
+    :
+
+RUN emcc \
+    -s ENVIRONMENT=node \
+    -s ERROR_ON_UNDEFINED_SYMBOLS=0 \
+    -s EXPORTED_RUNTIME_METHODS='["ccall"]' \
+    -s EXPORT_ES6=1 \
+    -s INITIAL_MEMORY=16777216 \
+    -s INVOKE_RUN=0 \
+    -s MODULARIZE=1 \
+    -o php-wasm.js \
+    php-wasm.o \
+    libphp.a \
+    ;
diff --git a/examples/compile-php-to-wasm/php-wasm.c b/examples/compile-php-to-wasm/php-wasm.c
new file mode 100644
index 0000000..9c71ca1
--- /dev/null
+++ b/examples/compile-php-to-wasm/php-wasm.c
@@ -0,0 +1,22 @@
+#include <stdio.h>
+#include <emscripten.h>
+#include <Zend/zend_execute.h>
+#include <sapi/embed/php_embed.h>
+
+int EMSCRIPTEN_KEEPALIVE php_wasm_run(const char* code) {
+    zend_result result;
+
+    int argc = 1;
+    char* argv[] = { "php.wasm", NULL };
+
+    PHP_EMBED_START_BLOCK(argc, argv);
+
+    result = zend_eval_string_ex(code, NULL, "php.wasm code", 1);
+
+    PHP_EMBED_END_BLOCK();
+
+    fflush(stdout);
+    fflush(stderr);
+
+    return result == SUCCESS ? 0 : 1;
+}
diff --git a/examples/compile-php-to-wasm/php-wasm.js b/examples/compile-php-to-wasm/php-wasm.js
new file mode 100644
index 0000000..92ba924
--- /dev/null
+++ b/examples/compile-php-to-wasm/php-wasm.js
@@ -0,0 +1,8308 @@
+
+import { createRequire } from 'module';
+const require = createRequire(import.meta.url);
+
+var Module = (() => {
+  var _scriptDir = import.meta.url;
+  
+  return (
+function(moduleArg = {}) {
+
+// include: shell.js
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define   var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = moduleArg;
+
+// Set up the promise that indicates the Module is initialized
+var readyPromiseResolve, readyPromiseReject;
+Module['ready'] = new Promise((resolve, reject) => {
+  readyPromiseResolve = resolve;
+  readyPromiseReject = reject;
+});
+["_main","_memory","_php_wasm_run","_fflush","___indirect_function_table","onRuntimeInitialized"].forEach((prop) => {
+  if (!Object.getOwnPropertyDescriptor(Module['ready'], prop)) {
+    Object.defineProperty(Module['ready'], prop, {
+      get: () => abort('You are getting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
+      set: () => abort('You are setting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
+    });
+  }
+});
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = Object.assign({}, Module);
+
+var arguments_ = [];
+var thisProgram = './this.program';
+var quit_ = (status, toThrow) => {
+  throw toThrow;
+};
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = true;
+var ENVIRONMENT_IS_SHELL = false;
+
+if (Module['ENVIRONMENT']) {
+  throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)');
+}
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+  if (Module['locateFile']) {
+    return Module['locateFile'](path, scriptDirectory);
+  }
+  return scriptDirectory + path;
+}
+
+// Hooks that are implemented differently in different runtime environments.
+var read_,
+    readAsync,
+    readBinary;
+
+if (ENVIRONMENT_IS_NODE) {
+  if (typeof process == 'undefined' || !process.release || process.release.name !== 'node') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');
+
+  var nodeVersion = process.versions.node;
+  var numericVersion = nodeVersion.split('.').slice(0, 3);
+  numericVersion = (numericVersion[0] * 10000) + (numericVersion[1] * 100) + (numericVersion[2].split('-')[0] * 1);
+  var minVersion = 160000;
+  if (numericVersion < 160000) {
+    throw new Error('This emscripten-generated code requires node v16.0.0 (detected v' + nodeVersion + ')');
+  }
+
+  // `require()` is no-op in an ESM module, use `createRequire()` to construct
+  // the require()` function.  This is only necessary for multi-environment
+  // builds, `-sENVIRONMENT=node` emits a static import declaration instead.
+  // TODO: Swap all `require()`'s with `import()`'s?
+  // These modules will usually be used on Node.js. Load them eagerly to avoid
+  // the complexity of lazy-loading.
+  var fs = require('fs');
+  var nodePath = require('path');
+
+  if (ENVIRONMENT_IS_WORKER) {
+    scriptDirectory = nodePath.dirname(scriptDirectory) + '/';
+  } else {
+    // EXPORT_ES6 + ENVIRONMENT_IS_NODE always requires use of import.meta.url,
+    // since there's no way getting the current absolute path of the module when
+    // support for that is not available.
+    scriptDirectory = require('url').fileURLToPath(new URL('./', import.meta.url)); // includes trailing slash
+  }
+
+// include: node_shell_read.js
+read_ = (filename, binary) => {
+  // We need to re-wrap `file://` strings to URLs. Normalizing isn't
+  // necessary in that case, the path should already be absolute.
+  filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+  return fs.readFileSync(filename, binary ? undefined : 'utf8');
+};
+
+readBinary = (filename) => {
+  var ret = read_(filename, true);
+  if (!ret.buffer) {
+    ret = new Uint8Array(ret);
+  }
+  assert(ret.buffer);
+  return ret;
+};
+
+readAsync = (filename, onload, onerror, binary = true) => {
+  // See the comment in the `read_` function.
+  filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+  fs.readFile(filename, binary ? undefined : 'utf8', (err, data) => {
+    if (err) onerror(err);
+    else onload(binary ? data.buffer : data);
+  });
+};
+// end include: node_shell_read.js
+  if (!Module['thisProgram'] && process.argv.length > 1) {
+    thisProgram = process.argv[1].replace(/\\/g, '/');
+  }
+
+  arguments_ = process.argv.slice(2);
+
+  // MODULARIZE will export the module in the proper place outside, we don't need to export here
+
+  quit_ = (status, toThrow) => {
+    process.exitCode = status;
+    throw toThrow;
+  };
+
+  Module['inspect'] = () => '[Emscripten Module object]';
+
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+  if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');
+
+  if (typeof read != 'undefined') {
+    read_ = read;
+  }
+
+  readBinary = (f) => {
+    if (typeof readbuffer == 'function') {
+      return new Uint8Array(readbuffer(f));
+    }
+    let data = read(f, 'binary');
+    assert(typeof data == 'object');
+    return data;
+  };
+
+  readAsync = (f, onload, onerror) => {
+    setTimeout(() => onload(readBinary(f)));
+  };
+
+  if (typeof clearTimeout == 'undefined') {
+    globalThis.clearTimeout = (id) => {};
+  }
+
+  if (typeof setTimeout == 'undefined') {
+    // spidermonkey lacks setTimeout but we use it above in readAsync.
+    globalThis.setTimeout = (f) => (typeof f == 'function') ? f() : abort();
+  }
+
+  if (typeof scriptArgs != 'undefined') {
+    arguments_ = scriptArgs;
+  } else if (typeof arguments != 'undefined') {
+    arguments_ = arguments;
+  }
+
+  if (typeof quit == 'function') {
+    quit_ = (status, toThrow) => {
+      // Unlike node which has process.exitCode, d8 has no such mechanism. So we
+      // have no way to set the exit code and then let the program exit with
+      // that code when it naturally stops running (say, when all setTimeouts
+      // have completed). For that reason, we must call `quit` - the only way to
+      // set the exit code - but quit also halts immediately.  To increase
+      // consistency with node (and the web) we schedule the actual quit call
+      // using a setTimeout to give the current stack and any exception handlers
+      // a chance to run.  This enables features such as addOnPostRun (which
+      // expected to be able to run code after main returns).
+      setTimeout(() => {
+        if (!(toThrow instanceof ExitStatus)) {
+          let toLog = toThrow;
+          if (toThrow && typeof toThrow == 'object' && toThrow.stack) {
+            toLog = [toThrow, toThrow.stack];
+          }
+          err(`exiting due to exception: ${toLog}`);
+        }
+        quit(status);
+      });
+      throw toThrow;
+    };
+  }
+
+  if (typeof print != 'undefined') {
+    // Prefer to use print/printErr where they exist, as they usually work better.
+    if (typeof console == 'undefined') console = /** @type{!Console} */({});
+    console.log = /** @type{!function(this:Console, ...*): undefined} */ (print);
+    console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print);
+  }
+
+} else
+
+// Note that this includes Node.js workers when relevant (pthreads is enabled).
+// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
+// ENVIRONMENT_IS_NODE.
+{
+  throw new Error('environment detection error');
+}
+
+var out = Module['print'] || console.log.bind(console);
+var err = Module['printErr'] || console.error.bind(console);
+
+// Merge back in the overrides
+Object.assign(Module, moduleOverrides);
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = null;
+checkIncomingModuleAPI();
+
+// Emit code to handle expected values on the Module object. This applies Module.x
+// to the proper local x. This has two benefits: first, we only emit it if it is
+// expected to arrive, and second, by using a local everywhere else that can be
+// minified.
+
+if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_');
+
+if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram');
+
+if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_');
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+// Assertions on removed incoming Module JS APIs.
+assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)');
+assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)');
+assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)');
+assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify emscripten_set_window_title in JS)');
+assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY');
+legacyModuleProp('asm', 'wasmExports');
+legacyModuleProp('read', 'read_');
+legacyModuleProp('readAsync', 'readAsync');
+legacyModuleProp('readBinary', 'readBinary');
+legacyModuleProp('setWindowTitle', 'setWindowTitle');
+var IDBFS = 'IDBFS is no longer included by default; build with -lidbfs.js';
+var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js';
+var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js';
+var FETCHFS = 'FETCHFS is no longer included by default; build with -lfetchfs.js';
+var ICASEFS = 'ICASEFS is no longer included by default; build with -licasefs.js';
+var JSFILEFS = 'JSFILEFS is no longer included by default; build with -ljsfilefs.js';
+var OPFS = 'OPFS is no longer included by default; build with -lopfs.js';
+
+var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js';
+
+assert(!ENVIRONMENT_IS_WEB, "web environment detected but not enabled at build time.  Add 'web' to `-sENVIRONMENT` to enable.");
+
+assert(!ENVIRONMENT_IS_WORKER, "worker environment detected but not enabled at build time.  Add 'worker' to `-sENVIRONMENT` to enable.");
+
+assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time.  Add 'shell' to `-sENVIRONMENT` to enable.");
+
+
+// end include: shell.js
+// include: preamble.js
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+//    site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+//    site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+var wasmBinary;
+if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary');
+var noExitRuntime = Module['noExitRuntime'] || true;legacyModuleProp('noExitRuntime', 'noExitRuntime');
+
+if (typeof WebAssembly != 'object') {
+  abort('no native wasm support detected');
+}
+
+// Wasm globals
+
+var wasmMemory;
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort().  Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+  if (!condition) {
+    abort('Assertion failed' + (text ? ': ' + text : ''));
+  }
+}
+
+// We used to include malloc/free by default in the past. Show a helpful error in
+// builds with assertions.
+
+// Memory management
+
+var HEAP,
+/** @type {!Int8Array} */
+  HEAP8,
+/** @type {!Uint8Array} */
+  HEAPU8,
+/** @type {!Int16Array} */
+  HEAP16,
+/** @type {!Uint16Array} */
+  HEAPU16,
+/** @type {!Int32Array} */
+  HEAP32,
+/** @type {!Uint32Array} */
+  HEAPU32,
+/** @type {!Float32Array} */
+  HEAPF32,
+/** @type {!Float64Array} */
+  HEAPF64;
+
+function updateMemoryViews() {
+  var b = wasmMemory.buffer;
+  Module['HEAP8'] = HEAP8 = new Int8Array(b);
+  Module['HEAP16'] = HEAP16 = new Int16Array(b);
+  Module['HEAPU8'] = HEAPU8 = new Uint8Array(b);
+  Module['HEAPU16'] = HEAPU16 = new Uint16Array(b);
+  Module['HEAP32'] = HEAP32 = new Int32Array(b);
+  Module['HEAPU32'] = HEAPU32 = new Uint32Array(b);
+  Module['HEAPF32'] = HEAPF32 = new Float32Array(b);
+  Module['HEAPF64'] = HEAPF64 = new Float64Array(b);
+}
+
+assert(!Module['STACK_SIZE'], 'STACK_SIZE can no longer be set at runtime.  Use -sSTACK_SIZE at link time')
+
+assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined,
+       'JS engine does not provide full typed array support');
+
+// If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY
+assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected.  Use -sIMPORTED_MEMORY to define wasmMemory externally');
+assert(!Module['INITIAL_MEMORY'], 'Detected runtime INITIAL_MEMORY setting.  Use -sIMPORTED_MEMORY to define wasmMemory dynamically');
+
+// include: runtime_stack_check.js
+// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+function writeStackCookie() {
+  var max = _emscripten_stack_get_end();
+  assert((max & 3) == 0);
+  // If the stack ends at address zero we write our cookies 4 bytes into the
+  // stack.  This prevents interference with SAFE_HEAP and ASAN which also
+  // monitor writes to address zero.
+  if (max == 0) {
+    max += 4;
+  }
+  // The stack grow downwards towards _emscripten_stack_get_end.
+  // We write cookies to the final two words in the stack and detect if they are
+  // ever overwritten.
+  HEAPU32[((max)>>2)] = 0x02135467;
+  HEAPU32[(((max)+(4))>>2)] = 0x89BACDFE;
+  // Also test the global address 0 for integrity.
+  HEAPU32[((0)>>2)] = 1668509029;
+}
+
+function checkStackCookie() {
+  if (ABORT) return;
+  var max = _emscripten_stack_get_end();
+  // See writeStackCookie().
+  if (max == 0) {
+    max += 4;
+  }
+  var cookie1 = HEAPU32[((max)>>2)];
+  var cookie2 = HEAPU32[(((max)+(4))>>2)];
+  if (cookie1 != 0x02135467 || cookie2 != 0x89BACDFE) {
+    abort(`Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`);
+  }
+  // Also test the global address 0 for integrity.
+  if (HEAPU32[((0)>>2)] != 0x63736d65 /* 'emsc' */) {
+    abort('Runtime error: The application has corrupted its heap memory area (address zero)!');
+  }
+}
+// end include: runtime_stack_check.js
+// include: runtime_assertions.js
+// Endianness check
+(function() {
+  var h16 = new Int16Array(1);
+  var h8 = new Int8Array(h16.buffer);
+  h16[0] = 0x6373;
+  if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)';
+})();
+
+// end include: runtime_assertions.js
+var __ATPRERUN__  = []; // functions called before the runtime is initialized
+var __ATINIT__    = []; // functions called during startup
+var __ATEXIT__    = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+
+var runtimeKeepaliveCounter = 0;
+
+function keepRuntimeAlive() {
+  return noExitRuntime || runtimeKeepaliveCounter > 0;
+}
+
+function preRun() {
+  if (Module['preRun']) {
+    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+    while (Module['preRun'].length) {
+      addOnPreRun(Module['preRun'].shift());
+    }
+  }
+  callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function initRuntime() {
+  assert(!runtimeInitialized);
+  runtimeInitialized = true;
+
+  checkStackCookie();
+
+  
+if (!Module["noFSInit"] && !FS.init.initialized)
+  FS.init();
+FS.ignorePermissions = false;
+
+TTY.init();
+SOCKFS.root = FS.mount(SOCKFS, {}, null);
+PIPEFS.root = FS.mount(PIPEFS, {}, null);
+  callRuntimeCallbacks(__ATINIT__);
+}
+
+function postRun() {
+  checkStackCookie();
+
+  if (Module['postRun']) {
+    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+    while (Module['postRun'].length) {
+      addOnPostRun(Module['postRun'].shift());
+    }
+  }
+
+  callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+  __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+  __ATINIT__.unshift(cb);
+}
+
+function addOnExit(cb) {
+}
+
+function addOnPostRun(cb) {
+  __ATPOSTRUN__.unshift(cb);
+}
+
+// include: runtime_math.js
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
+
+assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+// end include: runtime_math.js
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+  var orig = id;
+  while (1) {
+    if (!runDependencyTracking[id]) return id;
+    id = orig + Math.random();
+  }
+}
+
+function addRunDependency(id) {
+  runDependencies++;
+
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+
+  if (id) {
+    assert(!runDependencyTracking[id]);
+    runDependencyTracking[id] = 1;
+    if (runDependencyWatcher === null && typeof setInterval != 'undefined') {
+      // Check for missing dependencies every few seconds
+      runDependencyWatcher = setInterval(() => {
+        if (ABORT) {
+          clearInterval(runDependencyWatcher);
+          runDependencyWatcher = null;
+          return;
+        }
+        var shown = false;
+        for (var dep in runDependencyTracking) {
+          if (!shown) {
+            shown = true;
+            err('still waiting on run dependencies:');
+          }
+          err(`dependency: ${dep}`);
+        }
+        if (shown) {
+          err('(end of list)');
+        }
+      }, 10000);
+    }
+  } else {
+    err('warning: run dependency added without ID');
+  }
+}
+
+function removeRunDependency(id) {
+  runDependencies--;
+
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+
+  if (id) {
+    assert(runDependencyTracking[id]);
+    delete runDependencyTracking[id];
+  } else {
+    err('warning: run dependency removed without ID');
+  }
+  if (runDependencies == 0) {
+    if (runDependencyWatcher !== null) {
+      clearInterval(runDependencyWatcher);
+      runDependencyWatcher = null;
+    }
+    if (dependenciesFulfilled) {
+      var callback = dependenciesFulfilled;
+      dependenciesFulfilled = null;
+      callback(); // can add another dependenciesFulfilled
+    }
+  }
+}
+
+/** @param {string|number=} what */
+function abort(what) {
+  if (Module['onAbort']) {
+    Module['onAbort'](what);
+  }
+
+  what = 'Aborted(' + what + ')';
+  // TODO(sbc): Should we remove printing and leave it up to whoever
+  // catches the exception?
+  err(what);
+
+  ABORT = true;
+  EXITSTATUS = 1;
+
+  // Use a wasm runtime error, because a JS error might be seen as a foreign
+  // exception, which means we'd run destructors on it. We need the error to
+  // simply make the program stop.
+  // FIXME This approach does not work in Wasm EH because it currently does not assume
+  // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
+  // a trap or not based on a hidden field within the object. So at the moment
+  // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
+  // allows this in the wasm spec.
+
+  // Suppress closure compiler warning here. Closure compiler's builtin extern
+  // defintion for WebAssembly.RuntimeError claims it takes no arguments even
+  // though it can.
+  // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
+  /** @suppress {checkTypes} */
+  var e = new WebAssembly.RuntimeError(what);
+
+  readyPromiseReject(e);
+  // Throw the error whether or not MODULARIZE is set because abort is used
+  // in code paths apart from instantiation where an exception is expected
+  // to be thrown when abort is called.
+  throw e;
+}
+
+// include: memoryprofiler.js
+// end include: memoryprofiler.js
+// include: URIUtils.js
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+  // Prefix of data URIs emitted by SINGLE_FILE and related options.
+  return filename.startsWith(dataURIPrefix);
+}
+
+// Indicates whether filename is delivered via file protocol (as opposed to http/https)
+function isFileURI(filename) {
+  return filename.startsWith('file://');
+}
+// end include: URIUtils.js
+function createExportWrapper(name) {
+  return function() {
+    assert(runtimeInitialized, `native function \`${name}\` called before runtime initialization`);
+    var f = wasmExports[name];
+    assert(f, `exported native function \`${name}\` not found`);
+    return f.apply(null, arguments);
+  };
+}
+
+// include: runtime_exceptions.js
+// end include: runtime_exceptions.js
+var wasmBinaryFile;
+if (Module['locateFile']) {
+  wasmBinaryFile = 'php-wasm.wasm';
+  if (!isDataURI(wasmBinaryFile)) {
+    wasmBinaryFile = locateFile(wasmBinaryFile);
+  }
+} else {
+  // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too.
+  wasmBinaryFile = new URL('php-wasm.wasm', import.meta.url).href;
+}
+
+function getBinarySync(file) {
+  if (file == wasmBinaryFile && wasmBinary) {
+    return new Uint8Array(wasmBinary);
+  }
+  if (readBinary) {
+    return readBinary(file);
+  }
+  throw "both async and sync fetching of the wasm failed";
+}
+
+function getBinaryPromise(binaryFile) {
+  // If we don't have the binary yet, try to load it asynchronously.
+  // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
+  // See https://github.com/github/fetch/pull/92#issuecomment-140665932
+  // Cordova or Electron apps are typically loaded from a file:// url.
+  // So use fetch if it is available and the url is not a file, otherwise fall back to XHR.
+  if (!wasmBinary
+      && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
+    if (typeof fetch == 'function'
+    ) {
+      return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
+        if (!response['ok']) {
+          throw "failed to load wasm binary file at '" + binaryFile + "'";
+        }
+        return response['arrayBuffer']();
+      }).catch(() => getBinarySync(binaryFile));
+    }
+  }
+
+  // Otherwise, getBinarySync should be able to get it synchronously
+  return Promise.resolve().then(() => getBinarySync(binaryFile));
+}
+
+function instantiateArrayBuffer(binaryFile, imports, receiver) {
+  return getBinaryPromise(binaryFile).then((binary) => {
+    return WebAssembly.instantiate(binary, imports);
+  }).then((instance) => {
+    return instance;
+  }).then(receiver, (reason) => {
+    err(`failed to asynchronously prepare wasm: ${reason}`);
+
+    // Warn on some common problems.
+    if (isFileURI(wasmBinaryFile)) {
+      err(`warning: Loading from a file URI (${wasmBinaryFile}) is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing`);
+    }
+    abort(reason);
+  });
+}
+
+function instantiateAsync(binary, binaryFile, imports, callback) {
+  if (!binary &&
+      typeof WebAssembly.instantiateStreaming == 'function' &&
+      !isDataURI(binaryFile) &&
+      // Avoid instantiateStreaming() on Node.js environment for now, as while
+      // Node.js v18.1.0 implements it, it does not have a full fetch()
+      // implementation yet.
+      //
+      // Reference:
+      //   https://github.com/emscripten-core/emscripten/pull/16917
+      !ENVIRONMENT_IS_NODE &&
+      typeof fetch == 'function') {
+    return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
+      // Suppress closure warning here since the upstream definition for
+      // instantiateStreaming only allows Promise<Repsponse> rather than
+      // an actual Response.
+      // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
+      /** @suppress {checkTypes} */
+      var result = WebAssembly.instantiateStreaming(response, imports);
+
+      return result.then(
+        callback,
+        function(reason) {
+          // We expect the most common failure cause to be a bad MIME type for the binary,
+          // in which case falling back to ArrayBuffer instantiation should work.
+          err(`wasm streaming compile failed: ${reason}`);
+          err('falling back to ArrayBuffer instantiation');
+          return instantiateArrayBuffer(binaryFile, imports, callback);
+        });
+    });
+  }
+  return instantiateArrayBuffer(binaryFile, imports, callback);
+}
+
+// Create the wasm instance.
+// Receives the wasm imports, returns the exports.
+function createWasm() {
+  // prepare imports
+  var info = {
+    'env': wasmImports,
+    'wasi_snapshot_preview1': wasmImports,
+  };
+  // Load the wasm module and create an instance of using native support in the JS engine.
+  // handle a generated wasm instance, receiving its exports and
+  // performing other necessary setup
+  /** @param {WebAssembly.Module=} module*/
+  function receiveInstance(instance, module) {
+    wasmExports = instance.exports;
+
+    
+
+    wasmMemory = wasmExports['memory'];
+    
+    assert(wasmMemory, "memory not found in wasm exports");
+    // This assertion doesn't hold when emscripten is run in --post-link
+    // mode.
+    // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode.
+    //assert(wasmMemory.buffer.byteLength === 16777216);
+    updateMemoryViews();
+
+    wasmTable = wasmExports['__indirect_function_table'];
+    
+    assert(wasmTable, "table not found in wasm exports");
+
+    addOnInit(wasmExports['__wasm_call_ctors']);
+
+    removeRunDependency('wasm-instantiate');
+    return wasmExports;
+  }
+  // wait for the pthread pool (if any)
+  addRunDependency('wasm-instantiate');
+
+  // Prefer streaming instantiation if available.
+  // Async compilation can be confusing when an error on the page overwrites Module
+  // (for example, if the order of elements is wrong, and the one defining Module is
+  // later), so we save Module and check it later.
+  var trueModule = Module;
+  function receiveInstantiationResult(result) {
+    // 'result' is a ResultObject object which has both the module and instance.
+    // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+    assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?');
+    trueModule = null;
+    // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
+    // When the regression is fixed, can restore the above PTHREADS-enabled path.
+    receiveInstance(result['instance']);
+  }
+
+  // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+  // to manually instantiate the Wasm module themselves. This allows pages to
+  // run the instantiation parallel to any other async startup actions they are
+  // performing.
+  // Also pthreads and wasm workers initialize the wasm instance through this
+  // path.
+  if (Module['instantiateWasm']) {
+
+    try {
+      return Module['instantiateWasm'](info, receiveInstance);
+    } catch(e) {
+      err(`Module.instantiateWasm callback failed with error: ${e}`);
+        // If instantiation fails, reject the module ready promise.
+        readyPromiseReject(e);
+    }
+  }
+
+  // If instantiation fails, reject the module ready promise.
+  instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject);
+  return {}; // no exports yet; we'll fill them in later
+}
+
+// Globals used by JS i64 conversions (see makeSetValue)
+var tempDouble;
+var tempI64;
+
+// include: runtime_debug.js
+function legacyModuleProp(prop, newName, incomming=true) {
+  if (!Object.getOwnPropertyDescriptor(Module, prop)) {
+    Object.defineProperty(Module, prop, {
+      configurable: true,
+      get() {
+        let extra = incomming ? ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)' : '';
+        abort(`\`Module.${prop}\` has been replaced by \`${newName}\`` + extra);
+
+      }
+    });
+  }
+}
+
+function ignoredModuleProp(prop) {
+  if (Object.getOwnPropertyDescriptor(Module, prop)) {
+    abort(`\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`);
+  }
+}
+
+// forcing the filesystem exports a few things by default
+function isExportedByForceFilesystem(name) {
+  return name === 'FS_createPath' ||
+         name === 'FS_createDataFile' ||
+         name === 'FS_createPreloadedFile' ||
+         name === 'FS_unlink' ||
+         name === 'addRunDependency' ||
+         // The old FS has some functionality that WasmFS lacks.
+         name === 'FS_createLazyFile' ||
+         name === 'FS_createDevice' ||
+         name === 'removeRunDependency';
+}
+
+function missingGlobal(sym, msg) {
+  if (typeof globalThis !== 'undefined') {
+    Object.defineProperty(globalThis, sym, {
+      configurable: true,
+      get() {
+        warnOnce('`' + sym + '` is not longer defined by emscripten. ' + msg);
+        return undefined;
+      }
+    });
+  }
+}
+
+missingGlobal('buffer', 'Please use HEAP8.buffer or wasmMemory.buffer');
+missingGlobal('asm', 'Please use wasmExports instead');
+
+function missingLibrarySymbol(sym) {
+  if (typeof globalThis !== 'undefined' && !Object.getOwnPropertyDescriptor(globalThis, sym)) {
+    Object.defineProperty(globalThis, sym, {
+      configurable: true,
+      get() {
+        // Can't `abort()` here because it would break code that does runtime
+        // checks.  e.g. `if (typeof SDL === 'undefined')`.
+        var msg = '`' + sym + '` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line';
+        // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in
+        // library.js, which means $name for a JS name with no prefix, or name
+        // for a JS name like _name.
+        var librarySymbol = sym;
+        if (!librarySymbol.startsWith('_')) {
+          librarySymbol = '$' + sym;
+        }
+        msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='" + librarySymbol + "')";
+        if (isExportedByForceFilesystem(sym)) {
+          msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
+        }
+        warnOnce(msg);
+        return undefined;
+      }
+    });
+  }
+  // Any symbol that is not included from the JS libary is also (by definition)
+  // not exported on the Module object.
+  unexportedRuntimeSymbol(sym);
+}
+
+function unexportedRuntimeSymbol(sym) {
+  if (!Object.getOwnPropertyDescriptor(Module, sym)) {
+    Object.defineProperty(Module, sym, {
+      configurable: true,
+      get() {
+        var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)";
+        if (isExportedByForceFilesystem(sym)) {
+          msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
+        }
+        abort(msg);
+      }
+    });
+  }
+}
+
+// Used by XXXXX_DEBUG settings to output debug messages.
+function dbg(text) {
+  // TODO(sbc): Make this configurable somehow.  Its not always convenient for
+  // logging to show up as warnings.
+  console.warn.apply(console, arguments);
+}
+// end include: runtime_debug.js
+// === Body ===
+
+// end include: preamble.js
+
+  /** @constructor */
+  function ExitStatus(status) {
+      this.name = 'ExitStatus';
+      this.message = `Program terminated with exit(${status})`;
+      this.status = status;
+    }
+
+  var callRuntimeCallbacks = (callbacks) => {
+      while (callbacks.length > 0) {
+        // Pass the module as the first argument.
+        callbacks.shift()(Module);
+      }
+    };
+
+  
+    /**
+     * @param {number} ptr
+     * @param {string} type
+     */
+  function getValue(ptr, type = 'i8') {
+    if (type.endsWith('*')) type = '*';
+    switch (type) {
+      case 'i1': return HEAP8[((ptr)>>0)];
+      case 'i8': return HEAP8[((ptr)>>0)];
+      case 'i16': return HEAP16[((ptr)>>1)];
+      case 'i32': return HEAP32[((ptr)>>2)];
+      case 'i64': abort('to do getValue(i64) use WASM_BIGINT');
+      case 'float': return HEAPF32[((ptr)>>2)];
+      case 'double': return HEAPF64[((ptr)>>3)];
+      case '*': return HEAPU32[((ptr)>>2)];
+      default: abort(`invalid type for getValue: ${type}`);
+    }
+  }
+
+  var ptrToString = (ptr) => {
+      assert(typeof ptr === 'number');
+      // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+      ptr >>>= 0;
+      return '0x' + ptr.toString(16).padStart(8, '0');
+    };
+
+  
+    /**
+     * @param {number} ptr
+     * @param {number} value
+     * @param {string} type
+     */
+  function setValue(ptr, value, type = 'i8') {
+    if (type.endsWith('*')) type = '*';
+    switch (type) {
+      case 'i1': HEAP8[((ptr)>>0)] = value; break;
+      case 'i8': HEAP8[((ptr)>>0)] = value; break;
+      case 'i16': HEAP16[((ptr)>>1)] = value; break;
+      case 'i32': HEAP32[((ptr)>>2)] = value; break;
+      case 'i64': abort('to do setValue(i64) use WASM_BIGINT');
+      case 'float': HEAPF32[((ptr)>>2)] = value; break;
+      case 'double': HEAPF64[((ptr)>>3)] = value; break;
+      case '*': HEAPU32[((ptr)>>2)] = value; break;
+      default: abort(`invalid type for setValue: ${type}`);
+    }
+  }
+
+  var warnOnce = (text) => {
+      if (!warnOnce.shown) warnOnce.shown = {};
+      if (!warnOnce.shown[text]) {
+        warnOnce.shown[text] = 1;
+        if (ENVIRONMENT_IS_NODE) text = 'warning: ' + text;
+        err(text);
+      }
+    };
+
+  var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined;
+  
+    /**
+     * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
+     * array that contains uint8 values, returns a copy of that string as a
+     * Javascript String object.
+     * heapOrArray is either a regular array, or a JavaScript typed array view.
+     * @param {number} idx
+     * @param {number=} maxBytesToRead
+     * @return {string}
+     */
+  var UTF8ArrayToString = (heapOrArray, idx, maxBytesToRead) => {
+      var endIdx = idx + maxBytesToRead;
+      var endPtr = idx;
+      // TextDecoder needs to know the byte length in advance, it doesn't stop on
+      // null terminator by itself.  Also, use the length info to avoid running tiny
+      // strings through TextDecoder, since .subarray() allocates garbage.
+      // (As a tiny code save trick, compare endPtr against endIdx using a negation,
+      // so that undefined means Infinity)
+      while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+  
+      if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+        return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
+      }
+      var str = '';
+      // If building with TextDecoder, we have already computed the string length
+      // above, so test loop end condition against that
+      while (idx < endPtr) {
+        // For UTF8 byte structure, see:
+        // http://en.wikipedia.org/wiki/UTF-8#Description
+        // https://www.ietf.org/rfc/rfc2279.txt
+        // https://tools.ietf.org/html/rfc3629
+        var u0 = heapOrArray[idx++];
+        if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+        var u1 = heapOrArray[idx++] & 63;
+        if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+        var u2 = heapOrArray[idx++] & 63;
+        if ((u0 & 0xF0) == 0xE0) {
+          u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+        } else {
+          if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte ' + ptrToString(u0) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!');
+          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
+        }
+  
+        if (u0 < 0x10000) {
+          str += String.fromCharCode(u0);
+        } else {
+          var ch = u0 - 0x10000;
+          str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+        }
+      }
+      return str;
+    };
+  
+    /**
+     * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
+     * emscripten HEAP, returns a copy of that string as a Javascript String object.
+     *
+     * @param {number} ptr
+     * @param {number=} maxBytesToRead - An optional length that specifies the
+     *   maximum number of bytes to read. You can omit this parameter to scan the
+     *   string until the first 0 byte. If maxBytesToRead is passed, and the string
+     *   at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
+     *   string will cut short at that byte index (i.e. maxBytesToRead will not
+     *   produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
+     *   frequent uses of UTF8ToString() with and without maxBytesToRead may throw
+     *   JS JIT optimizations off, so it is worth to consider consistently using one
+     * @return {string}
+     */
+  var UTF8ToString = (ptr, maxBytesToRead) => {
+      assert(typeof ptr == 'number');
+      return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
+    };
+  var ___assert_fail = (condition, filename, line, func) => {
+      abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
+    };
+
+  var wasmTableMirror = [];
+  
+  var wasmTable;
+  var getWasmTableEntry = (funcPtr) => {
+      var func = wasmTableMirror[funcPtr];
+      if (!func) {
+        if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
+        wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+      }
+      assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!");
+      return func;
+    };
+  var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig);
+
+  var PATH = {
+  isAbs:(path) => path.charAt(0) === '/',
+  splitPath:(filename) => {
+        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+        return splitPathRe.exec(filename).slice(1);
+      },
+  normalizeArray:(parts, allowAboveRoot) => {
+        // if the path tries to go above the root, `up` ends up > 0
+        var up = 0;
+        for (var i = parts.length - 1; i >= 0; i--) {
+          var last = parts[i];
+          if (last === '.') {
+            parts.splice(i, 1);
+          } else if (last === '..') {
+            parts.splice(i, 1);
+            up++;
+          } else if (up) {
+            parts.splice(i, 1);
+            up--;
+          }
+        }
+        // if the path is allowed to go above the root, restore leading ..s
+        if (allowAboveRoot) {
+          for (; up; up--) {
+            parts.unshift('..');
+          }
+        }
+        return parts;
+      },
+  normalize:(path) => {
+        var isAbsolute = PATH.isAbs(path),
+            trailingSlash = path.substr(-1) === '/';
+        // Normalize the path
+        path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/');
+        if (!path && !isAbsolute) {
+          path = '.';
+        }
+        if (path && trailingSlash) {
+          path += '/';
+        }
+        return (isAbsolute ? '/' : '') + path;
+      },
+  dirname:(path) => {
+        var result = PATH.splitPath(path),
+            root = result[0],
+            dir = result[1];
+        if (!root && !dir) {
+          // No dirname whatsoever
+          return '.';
+        }
+        if (dir) {
+          // It has a dirname, strip trailing slash
+          dir = dir.substr(0, dir.length - 1);
+        }
+        return root + dir;
+      },
+  basename:(path) => {
+        // EMSCRIPTEN return '/'' for '/', not an empty string
+        if (path === '/') return '/';
+        path = PATH.normalize(path);
+        path = path.replace(/\/$/, "");
+        var lastSlash = path.lastIndexOf('/');
+        if (lastSlash === -1) return path;
+        return path.substr(lastSlash+1);
+      },
+  join:function() {
+        var paths = Array.prototype.slice.call(arguments);
+        return PATH.normalize(paths.join('/'));
+      },
+  join2:(l, r) => {
+        return PATH.normalize(l + '/' + r);
+      },
+  };
+  
+  var initRandomFill = () => {
+      if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') {
+        // for modern web browsers
+        return (view) => crypto.getRandomValues(view);
+      } else
+      if (ENVIRONMENT_IS_NODE) {
+        // for nodejs with or without crypto support included
+        try {
+          var crypto_module = require('crypto');
+          var randomFillSync = crypto_module['randomFillSync'];
+          if (randomFillSync) {
+            // nodejs with LTS crypto support
+            return (view) => crypto_module['randomFillSync'](view);
+          }
+          // very old nodejs with the original crypto API
+          var randomBytes = crypto_module['randomBytes'];
+          return (view) => (
+            view.set(randomBytes(view.byteLength)),
+            // Return the original view to match modern native implementations.
+            view
+          );
+        } catch (e) {
+          // nodejs doesn't have crypto support
+        }
+      }
+      // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+      abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };");
+    };
+  var randomFill = (view) => {
+      // Lazily init on the first invocation.
+      return (randomFill = initRandomFill())(view);
+    };
+  
+  
+  
+  var PATH_FS = {
+  resolve:function() {
+        var resolvedPath = '',
+          resolvedAbsolute = false;
+        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+          var path = (i >= 0) ? arguments[i] : FS.cwd();
+          // Skip empty and invalid entries
+          if (typeof path != 'string') {
+            throw new TypeError('Arguments to path.resolve must be strings');
+          } else if (!path) {
+            return ''; // an invalid portion invalidates the whole thing
+          }
+          resolvedPath = path + '/' + resolvedPath;
+          resolvedAbsolute = PATH.isAbs(path);
+        }
+        // At this point the path should be resolved to a full absolute path, but
+        // handle relative paths to be safe (might happen when process.cwd() fails)
+        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/');
+        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+      },
+  relative:(from, to) => {
+        from = PATH_FS.resolve(from).substr(1);
+        to = PATH_FS.resolve(to).substr(1);
+        function trim(arr) {
+          var start = 0;
+          for (; start < arr.length; start++) {
+            if (arr[start] !== '') break;
+          }
+          var end = arr.length - 1;
+          for (; end >= 0; end--) {
+            if (arr[end] !== '') break;
+          }
+          if (start > end) return [];
+          return arr.slice(start, end - start + 1);
+        }
+        var fromParts = trim(from.split('/'));
+        var toParts = trim(to.split('/'));
+        var length = Math.min(fromParts.length, toParts.length);
+        var samePartsLength = length;
+        for (var i = 0; i < length; i++) {
+          if (fromParts[i] !== toParts[i]) {
+            samePartsLength = i;
+            break;
+          }
+        }
+        var outputParts = [];
+        for (var i = samePartsLength; i < fromParts.length; i++) {
+          outputParts.push('..');
+        }
+        outputParts = outputParts.concat(toParts.slice(samePartsLength));
+        return outputParts.join('/');
+      },
+  };
+  
+  
+  
+  var FS_stdin_getChar_buffer = [];
+  
+  var lengthBytesUTF8 = (str) => {
+      var len = 0;
+      for (var i = 0; i < str.length; ++i) {
+        // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+        // unit, not a Unicode code point of the character! So decode
+        // UTF16->UTF32->UTF8.
+        // See http://unicode.org/faq/utf_bom.html#utf16-3
+        var c = str.charCodeAt(i); // possibly a lead surrogate
+        if (c <= 0x7F) {
+          len++;
+        } else if (c <= 0x7FF) {
+          len += 2;
+        } else if (c >= 0xD800 && c <= 0xDFFF) {
+          len += 4; ++i;
+        } else {
+          len += 3;
+        }
+      }
+      return len;
+    };
+  
+  var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
+      assert(typeof str === 'string');
+      // Parameter maxBytesToWrite is not optional. Negative values, 0, null,
+      // undefined and false each don't write out any bytes.
+      if (!(maxBytesToWrite > 0))
+        return 0;
+  
+      var startIdx = outIdx;
+      var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+      for (var i = 0; i < str.length; ++i) {
+        // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+        // unit, not a Unicode code point of the character! So decode
+        // UTF16->UTF32->UTF8.
+        // See http://unicode.org/faq/utf_bom.html#utf16-3
+        // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
+        // and https://www.ietf.org/rfc/rfc2279.txt
+        // and https://tools.ietf.org/html/rfc3629
+        var u = str.charCodeAt(i); // possibly a lead surrogate
+        if (u >= 0xD800 && u <= 0xDFFF) {
+          var u1 = str.charCodeAt(++i);
+          u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+        }
+        if (u <= 0x7F) {
+          if (outIdx >= endIdx) break;
+          heap[outIdx++] = u;
+        } else if (u <= 0x7FF) {
+          if (outIdx + 1 >= endIdx) break;
+          heap[outIdx++] = 0xC0 | (u >> 6);
+          heap[outIdx++] = 0x80 | (u & 63);
+        } else if (u <= 0xFFFF) {
+          if (outIdx + 2 >= endIdx) break;
+          heap[outIdx++] = 0xE0 | (u >> 12);
+          heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+          heap[outIdx++] = 0x80 | (u & 63);
+        } else {
+          if (outIdx + 3 >= endIdx) break;
+          if (u > 0x10FFFF) warnOnce('Invalid Unicode code point ' + ptrToString(u) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).');
+          heap[outIdx++] = 0xF0 | (u >> 18);
+          heap[outIdx++] = 0x80 | ((u >> 12) & 63);
+          heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+          heap[outIdx++] = 0x80 | (u & 63);
+        }
+      }
+      // Null-terminate the pointer to the buffer.
+      heap[outIdx] = 0;
+      return outIdx - startIdx;
+    };
+  /** @type {function(string, boolean=, number=)} */
+  function intArrayFromString(stringy, dontAddNull, length) {
+    var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+    var u8array = new Array(len);
+    var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+    if (dontAddNull) u8array.length = numBytesWritten;
+    return u8array;
+  }
+  var FS_stdin_getChar = () => {
+      if (!FS_stdin_getChar_buffer.length) {
+        var result = null;
+        if (ENVIRONMENT_IS_NODE) {
+          // we will read data by chunks of BUFSIZE
+          var BUFSIZE = 256;
+          var buf = Buffer.alloc(BUFSIZE);
+          var bytesRead = 0;
+  
+          // For some reason we must suppress a closure warning here, even though
+          // fd definitely exists on process.stdin, and is even the proper way to
+          // get the fd of stdin,
+          // https://github.com/nodejs/help/issues/2136#issuecomment-523649904
+          // This started to happen after moving this logic out of library_tty.js,
+          // so it is related to the surrounding code in some unclear manner.
+          /** @suppress {missingProperties} */
+          var fd = process.stdin.fd;
+  
+          try {
+            bytesRead = fs.readSync(fd, buf);
+          } catch(e) {
+            // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+            // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+            if (e.toString().includes('EOF')) bytesRead = 0;
+            else throw e;
+          }
+  
+          if (bytesRead > 0) {
+            result = buf.slice(0, bytesRead).toString('utf-8');
+          } else {
+            result = null;
+          }
+        } else
+        if (typeof window != 'undefined' &&
+          typeof window.prompt == 'function') {
+          // Browser.
+          result = window.prompt('Input: ');  // returns null on cancel
+          if (result !== null) {
+            result += '\n';
+          }
+        } else if (typeof readline == 'function') {
+          // Command line.
+          result = readline();
+          if (result !== null) {
+            result += '\n';
+          }
+        }
+        if (!result) {
+          return null;
+        }
+        FS_stdin_getChar_buffer = intArrayFromString(result, true);
+      }
+      return FS_stdin_getChar_buffer.shift();
+    };
+  var TTY = {
+  ttys:[],
+  init() {
+        // https://github.com/emscripten-core/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
+        //   // device, it always assumes it's a TTY device. because of this, we're forcing
+        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
+        //   // with text files until FS.init can be refactored.
+        //   process.stdin.setEncoding('utf8');
+        // }
+      },
+  shutdown() {
+        // https://github.com/emscripten-core/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+        //   process.stdin.pause();
+        // }
+      },
+  register(dev, ops) {
+        TTY.ttys[dev] = { input: [], output: [], ops: ops };
+        FS.registerDevice(dev, TTY.stream_ops);
+      },
+  stream_ops:{
+  open(stream) {
+          var tty = TTY.ttys[stream.node.rdev];
+          if (!tty) {
+            throw new FS.ErrnoError(43);
+          }
+          stream.tty = tty;
+          stream.seekable = false;
+        },
+  close(stream) {
+          // flush any pending line data
+          stream.tty.ops.fsync(stream.tty);
+        },
+  fsync(stream) {
+          stream.tty.ops.fsync(stream.tty);
+        },
+  read(stream, buffer, offset, length, pos /* ignored */) {
+          if (!stream.tty || !stream.tty.ops.get_char) {
+            throw new FS.ErrnoError(60);
+          }
+          var bytesRead = 0;
+          for (var i = 0; i < length; i++) {
+            var result;
+            try {
+              result = stream.tty.ops.get_char(stream.tty);
+            } catch (e) {
+              throw new FS.ErrnoError(29);
+            }
+            if (result === undefined && bytesRead === 0) {
+              throw new FS.ErrnoError(6);
+            }
+            if (result === null || result === undefined) break;
+            bytesRead++;
+            buffer[offset+i] = result;
+          }
+          if (bytesRead) {
+            stream.node.timestamp = Date.now();
+          }
+          return bytesRead;
+        },
+  write(stream, buffer, offset, length, pos) {
+          if (!stream.tty || !stream.tty.ops.put_char) {
+            throw new FS.ErrnoError(60);
+          }
+          try {
+            for (var i = 0; i < length; i++) {
+              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+            }
+          } catch (e) {
+            throw new FS.ErrnoError(29);
+          }
+          if (length) {
+            stream.node.timestamp = Date.now();
+          }
+          return i;
+        },
+  },
+  default_tty_ops:{
+  get_char(tty) {
+          return FS_stdin_getChar();
+        },
+  put_char(tty, val) {
+          if (val === null || val === 10) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+          }
+        },
+  fsync(tty) {
+          if (tty.output && tty.output.length > 0) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        },
+  ioctl_tcgets(tty) {
+          // typical setting
+          return {
+            c_iflag: 25856,
+            c_oflag: 5,
+            c_cflag: 191,
+            c_lflag: 35387,
+            c_cc: [
+              0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, 0x00,
+              0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+              0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+            ]
+          };
+        },
+  ioctl_tcsets(tty, optional_actions, data) {
+          // currently just ignore
+          return 0;
+        },
+  ioctl_tiocgwinsz(tty) {
+          return [24, 80];
+        },
+  },
+  default_tty1_ops:{
+  put_char(tty, val) {
+          if (val === null || val === 10) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val);
+          }
+        },
+  fsync(tty) {
+          if (tty.output && tty.output.length > 0) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        },
+  },
+  };
+  
+  
+  var zeroMemory = (address, size) => {
+      HEAPU8.fill(0, address, address + size);
+      return address;
+    };
+  
+  var alignMemory = (size, alignment) => {
+      assert(alignment, "alignment argument is required");
+      return Math.ceil(size / alignment) * alignment;
+    };
+  var mmapAlloc = (size) => {
+      size = alignMemory(size, 65536);
+      var ptr = _emscripten_builtin_memalign(65536, size);
+      if (!ptr) return 0;
+      return zeroMemory(ptr, size);
+    };
+  var MEMFS = {
+  ops_table:null,
+  mount(mount) {
+        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+      },
+  createNode(parent, name, mode, dev) {
+        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+          // no supported
+          throw new FS.ErrnoError(63);
+        }
+        if (!MEMFS.ops_table) {
+          MEMFS.ops_table = {
+            dir: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                lookup: MEMFS.node_ops.lookup,
+                mknod: MEMFS.node_ops.mknod,
+                rename: MEMFS.node_ops.rename,
+                unlink: MEMFS.node_ops.unlink,
+                rmdir: MEMFS.node_ops.rmdir,
+                readdir: MEMFS.node_ops.readdir,
+                symlink: MEMFS.node_ops.symlink
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek
+              }
+            },
+            file: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek,
+                read: MEMFS.stream_ops.read,
+                write: MEMFS.stream_ops.write,
+                allocate: MEMFS.stream_ops.allocate,
+                mmap: MEMFS.stream_ops.mmap,
+                msync: MEMFS.stream_ops.msync
+              }
+            },
+            link: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                readlink: MEMFS.node_ops.readlink
+              },
+              stream: {}
+            },
+            chrdev: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: FS.chrdev_stream_ops
+            }
+          };
+        }
+        var node = FS.createNode(parent, name, mode, dev);
+        if (FS.isDir(node.mode)) {
+          node.node_ops = MEMFS.ops_table.dir.node;
+          node.stream_ops = MEMFS.ops_table.dir.stream;
+          node.contents = {};
+        } else if (FS.isFile(node.mode)) {
+          node.node_ops = MEMFS.ops_table.file.node;
+          node.stream_ops = MEMFS.ops_table.file.stream;
+          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+          node.contents = null; 
+        } else if (FS.isLink(node.mode)) {
+          node.node_ops = MEMFS.ops_table.link.node;
+          node.stream_ops = MEMFS.ops_table.link.stream;
+        } else if (FS.isChrdev(node.mode)) {
+          node.node_ops = MEMFS.ops_table.chrdev.node;
+          node.stream_ops = MEMFS.ops_table.chrdev.stream;
+        }
+        node.timestamp = Date.now();
+        // add the new node to the parent
+        if (parent) {
+          parent.contents[name] = node;
+          parent.timestamp = node.timestamp;
+        }
+        return node;
+      },
+  getFileDataAsTypedArray(node) {
+        if (!node.contents) return new Uint8Array(0);
+        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+        return new Uint8Array(node.contents);
+      },
+  expandFileStorage(node, newCapacity) {
+        var prevCapacity = node.contents ? node.contents.length : 0;
+        if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+        // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+        // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+        // avoid overshooting the allocation cap by a very large margin.
+        var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+        newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0);
+        if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+        var oldContents = node.contents;
+        node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+        if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+      },
+  resizeFileStorage(node, newSize) {
+        if (node.usedBytes == newSize) return;
+        if (newSize == 0) {
+          node.contents = null; // Fully decommit when requesting a resize to zero.
+          node.usedBytes = 0;
+        } else {
+          var oldContents = node.contents;
+          node.contents = new Uint8Array(newSize); // Allocate new storage.
+          if (oldContents) {
+            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+          }
+          node.usedBytes = newSize;
+        }
+      },
+  node_ops:{
+  getattr(node) {
+          var attr = {};
+          // device numbers reuse inode numbers.
+          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+          attr.ino = node.id;
+          attr.mode = node.mode;
+          attr.nlink = 1;
+          attr.uid = 0;
+          attr.gid = 0;
+          attr.rdev = node.rdev;
+          if (FS.isDir(node.mode)) {
+            attr.size = 4096;
+          } else if (FS.isFile(node.mode)) {
+            attr.size = node.usedBytes;
+          } else if (FS.isLink(node.mode)) {
+            attr.size = node.link.length;
+          } else {
+            attr.size = 0;
+          }
+          attr.atime = new Date(node.timestamp);
+          attr.mtime = new Date(node.timestamp);
+          attr.ctime = new Date(node.timestamp);
+          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+          //       but this is not required by the standard.
+          attr.blksize = 4096;
+          attr.blocks = Math.ceil(attr.size / attr.blksize);
+          return attr;
+        },
+  setattr(node, attr) {
+          if (attr.mode !== undefined) {
+            node.mode = attr.mode;
+          }
+          if (attr.timestamp !== undefined) {
+            node.timestamp = attr.timestamp;
+          }
+          if (attr.size !== undefined) {
+            MEMFS.resizeFileStorage(node, attr.size);
+          }
+        },
+  lookup(parent, name) {
+          throw FS.genericErrors[44];
+        },
+  mknod(parent, name, mode, dev) {
+          return MEMFS.createNode(parent, name, mode, dev);
+        },
+  rename(old_node, new_dir, new_name) {
+          // if we're overwriting a directory at new_name, make sure it's empty.
+          if (FS.isDir(old_node.mode)) {
+            var new_node;
+            try {
+              new_node = FS.lookupNode(new_dir, new_name);
+            } catch (e) {
+            }
+            if (new_node) {
+              for (var i in new_node.contents) {
+                throw new FS.ErrnoError(55);
+              }
+            }
+          }
+          // do the internal rewiring
+          delete old_node.parent.contents[old_node.name];
+          old_node.parent.timestamp = Date.now()
+          old_node.name = new_name;
+          new_dir.contents[new_name] = old_node;
+          new_dir.timestamp = old_node.parent.timestamp;
+          old_node.parent = new_dir;
+        },
+  unlink(parent, name) {
+          delete parent.contents[name];
+          parent.timestamp = Date.now();
+        },
+  rmdir(parent, name) {
+          var node = FS.lookupNode(parent, name);
+          for (var i in node.contents) {
+            throw new FS.ErrnoError(55);
+          }
+          delete parent.contents[name];
+          parent.timestamp = Date.now();
+        },
+  readdir(node) {
+          var entries = ['.', '..'];
+          for (var key in node.contents) {
+            if (!node.contents.hasOwnProperty(key)) {
+              continue;
+            }
+            entries.push(key);
+          }
+          return entries;
+        },
+  symlink(parent, newname, oldpath) {
+          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+          node.link = oldpath;
+          return node;
+        },
+  readlink(node) {
+          if (!FS.isLink(node.mode)) {
+            throw new FS.ErrnoError(28);
+          }
+          return node.link;
+        },
+  },
+  stream_ops:{
+  read(stream, buffer, offset, length, position) {
+          var contents = stream.node.contents;
+          if (position >= stream.node.usedBytes) return 0;
+          var size = Math.min(stream.node.usedBytes - position, length);
+          assert(size >= 0);
+          if (size > 8 && contents.subarray) { // non-trivial, and typed array
+            buffer.set(contents.subarray(position, position + size), offset);
+          } else {
+            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+          }
+          return size;
+        },
+  write(stream, buffer, offset, length, position, canOwn) {
+          // The data buffer should be a typed array view
+          assert(!(buffer instanceof ArrayBuffer));
+  
+          if (!length) return 0;
+          var node = stream.node;
+          node.timestamp = Date.now();
+  
+          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+            if (canOwn) {
+              assert(position === 0, 'canOwn must imply no weird position inside the file');
+              node.contents = buffer.subarray(offset, offset + length);
+              node.usedBytes = length;
+              return length;
+            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+              node.contents = buffer.slice(offset, offset + length);
+              node.usedBytes = length;
+              return length;
+            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+              node.contents.set(buffer.subarray(offset, offset + length), position);
+              return length;
+            }
+          }
+  
+          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+          MEMFS.expandFileStorage(node, position+length);
+          if (node.contents.subarray && buffer.subarray) {
+            // Use typed array write which is available.
+            node.contents.set(buffer.subarray(offset, offset + length), position);
+          } else {
+            for (var i = 0; i < length; i++) {
+             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+            }
+          }
+          node.usedBytes = Math.max(node.usedBytes, position + length);
+          return length;
+        },
+  llseek(stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {
+            position += stream.position;
+          } else if (whence === 2) {
+            if (FS.isFile(stream.node.mode)) {
+              position += stream.node.usedBytes;
+            }
+          }
+          if (position < 0) {
+            throw new FS.ErrnoError(28);
+          }
+          return position;
+        },
+  allocate(stream, offset, length) {
+          MEMFS.expandFileStorage(stream.node, offset + length);
+          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+        },
+  mmap(stream, length, position, prot, flags) {
+          if (!FS.isFile(stream.node.mode)) {
+            throw new FS.ErrnoError(43);
+          }
+          var ptr;
+          var allocated;
+          var contents = stream.node.contents;
+          // Only make a new copy when MAP_PRIVATE is specified.
+          if (!(flags & 2) && contents.buffer === HEAP8.buffer) {
+            // We can't emulate MAP_SHARED when the file is not backed by the
+            // buffer we're mapping to (e.g. the HEAP buffer).
+            allocated = false;
+            ptr = contents.byteOffset;
+          } else {
+            // Try to avoid unnecessary slices.
+            if (position > 0 || position + length < contents.length) {
+              if (contents.subarray) {
+                contents = contents.subarray(position, position + length);
+              } else {
+                contents = Array.prototype.slice.call(contents, position, position + length);
+              }
+            }
+            allocated = true;
+            ptr = mmapAlloc(length);
+            if (!ptr) {
+              throw new FS.ErrnoError(48);
+            }
+            HEAP8.set(contents, ptr);
+          }
+          return { ptr, allocated };
+        },
+  msync(stream, buffer, offset, length, mmapFlags) {
+          MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+          // should we check if bytesWritten and length are the same?
+          return 0;
+        },
+  },
+  };
+  
+  /** @param {boolean=} noRunDep */
+  var asyncLoad = (url, onload, onerror, noRunDep) => {
+      var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : '';
+      readAsync(url, (arrayBuffer) => {
+        assert(arrayBuffer, `Loading data file "${url}" failed (no arrayBuffer).`);
+        onload(new Uint8Array(arrayBuffer));
+        if (dep) removeRunDependency(dep);
+      }, (event) => {
+        if (onerror) {
+          onerror();
+        } else {
+          throw `Loading data file "${url}" failed.`;
+        }
+      });
+      if (dep) addRunDependency(dep);
+    };
+  
+  
+  var FS_createDataFile = (parent, name, fileData, canRead, canWrite, canOwn) => {
+      return FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn);
+    };
+  
+  var preloadPlugins = Module['preloadPlugins'] || [];
+  var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => {
+      // Ensure plugins are ready.
+      if (typeof Browser != 'undefined') Browser.init();
+  
+      var handled = false;
+      preloadPlugins.forEach((plugin) => {
+        if (handled) return;
+        if (plugin['canHandle'](fullname)) {
+          plugin['handle'](byteArray, fullname, finish, onerror);
+          handled = true;
+        }
+      });
+      return handled;
+    };
+  var FS_createPreloadedFile = (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => {
+      // TODO we should allow people to just pass in a complete filename instead
+      // of parent and name being that we just join them anyways
+      var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+      var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname
+      function processData(byteArray) {
+        function finish(byteArray) {
+          if (preFinish) preFinish();
+          if (!dontCreateFile) {
+            FS_createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+          }
+          if (onload) onload();
+          removeRunDependency(dep);
+        }
+        if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
+          if (onerror) onerror();
+          removeRunDependency(dep);
+        })) {
+          return;
+        }
+        finish(byteArray);
+      }
+      addRunDependency(dep);
+      if (typeof url == 'string') {
+        asyncLoad(url, (byteArray) => processData(byteArray), onerror);
+      } else {
+        processData(url);
+      }
+    };
+  
+  var FS_modeStringToFlags = (str) => {
+      var flagModes = {
+        'r': 0,
+        'r+': 2,
+        'w': 512 | 64 | 1,
+        'w+': 512 | 64 | 2,
+        'a': 1024 | 64 | 1,
+        'a+': 1024 | 64 | 2,
+      };
+      var flags = flagModes[str];
+      if (typeof flags == 'undefined') {
+        throw new Error(`Unknown file open mode: ${str}`);
+      }
+      return flags;
+    };
+  
+  var FS_getMode = (canRead, canWrite) => {
+      var mode = 0;
+      if (canRead) mode |= 292 | 73;
+      if (canWrite) mode |= 146;
+      return mode;
+    };
+  
+  
+  
+  
+  var ERRNO_MESSAGES = {
+  0:"Success",
+  1:"Arg list too long",
+  2:"Permission denied",
+  3:"Address already in use",
+  4:"Address not available",
+  5:"Address family not supported by protocol family",
+  6:"No more processes",
+  7:"Socket already connected",
+  8:"Bad file number",
+  9:"Trying to read unreadable message",
+  10:"Mount device busy",
+  11:"Operation canceled",
+  12:"No children",
+  13:"Connection aborted",
+  14:"Connection refused",
+  15:"Connection reset by peer",
+  16:"File locking deadlock error",
+  17:"Destination address required",
+  18:"Math arg out of domain of func",
+  19:"Quota exceeded",
+  20:"File exists",
+  21:"Bad address",
+  22:"File too large",
+  23:"Host is unreachable",
+  24:"Identifier removed",
+  25:"Illegal byte sequence",
+  26:"Connection already in progress",
+  27:"Interrupted system call",
+  28:"Invalid argument",
+  29:"I/O error",
+  30:"Socket is already connected",
+  31:"Is a directory",
+  32:"Too many symbolic links",
+  33:"Too many open files",
+  34:"Too many links",
+  35:"Message too long",
+  36:"Multihop attempted",
+  37:"File or path name too long",
+  38:"Network interface is not configured",
+  39:"Connection reset by network",
+  40:"Network is unreachable",
+  41:"Too many open files in system",
+  42:"No buffer space available",
+  43:"No such device",
+  44:"No such file or directory",
+  45:"Exec format error",
+  46:"No record locks available",
+  47:"The link has been severed",
+  48:"Not enough core",
+  49:"No message of desired type",
+  50:"Protocol not available",
+  51:"No space left on device",
+  52:"Function not implemented",
+  53:"Socket is not connected",
+  54:"Not a directory",
+  55:"Directory not empty",
+  56:"State not recoverable",
+  57:"Socket operation on non-socket",
+  59:"Not a typewriter",
+  60:"No such device or address",
+  61:"Value too large for defined data type",
+  62:"Previous owner died",
+  63:"Not super-user",
+  64:"Broken pipe",
+  65:"Protocol error",
+  66:"Unknown protocol",
+  67:"Protocol wrong type for socket",
+  68:"Math result not representable",
+  69:"Read only file system",
+  70:"Illegal seek",
+  71:"No such process",
+  72:"Stale file handle",
+  73:"Connection timed out",
+  74:"Text file busy",
+  75:"Cross-device link",
+  100:"Device not a stream",
+  101:"Bad font file fmt",
+  102:"Invalid slot",
+  103:"Invalid request code",
+  104:"No anode",
+  105:"Block device required",
+  106:"Channel number out of range",
+  107:"Level 3 halted",
+  108:"Level 3 reset",
+  109:"Link number out of range",
+  110:"Protocol driver not attached",
+  111:"No CSI structure available",
+  112:"Level 2 halted",
+  113:"Invalid exchange",
+  114:"Invalid request descriptor",
+  115:"Exchange full",
+  116:"No data (for no delay io)",
+  117:"Timer expired",
+  118:"Out of streams resources",
+  119:"Machine is not on the network",
+  120:"Package not installed",
+  121:"The object is remote",
+  122:"Advertise error",
+  123:"Srmount error",
+  124:"Communication error on send",
+  125:"Cross mount point (not really error)",
+  126:"Given log. name not unique",
+  127:"f.d. invalid for this operation",
+  128:"Remote address changed",
+  129:"Can   access a needed shared lib",
+  130:"Accessing a corrupted shared lib",
+  131:".lib section in a.out corrupted",
+  132:"Attempting to link in too many libs",
+  133:"Attempting to exec a shared library",
+  135:"Streams pipe error",
+  136:"Too many users",
+  137:"Socket type not supported",
+  138:"Not supported",
+  139:"Protocol family not supported",
+  140:"Can't send after socket shutdown",
+  141:"Too many references",
+  142:"Host is down",
+  148:"No medium (in tape drive)",
+  156:"Level 2 not synchronized",
+  };
+  
+  var ERRNO_CODES = {
+  };
+  
+  var demangle = (func) => {
+      warnOnce('warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling');
+      return func;
+    };
+  var demangleAll = (text) => {
+      var regex =
+        /\b_Z[\w\d_]+/g;
+      return text.replace(regex,
+        function(x) {
+          var y = demangle(x);
+          return x === y ? x : (y + ' [' + x + ']');
+        });
+    };
+  var FS = {
+  root:null,
+  mounts:[],
+  devices:{
+  },
+  streams:[],
+  nextInode:1,
+  nameTable:null,
+  currentPath:"/",
+  initialized:false,
+  ignorePermissions:true,
+  ErrnoError:null,
+  genericErrors:{
+  },
+  filesystems:null,
+  syncFSRequests:0,
+  lookupPath(path, opts = {}) {
+        path = PATH_FS.resolve(path);
+  
+        if (!path) return { path: '', node: null };
+  
+        var defaults = {
+          follow_mount: true,
+          recurse_count: 0
+        };
+        opts = Object.assign(defaults, opts)
+  
+        if (opts.recurse_count > 8) {  // max recursive lookup of 8
+          throw new FS.ErrnoError(32);
+        }
+  
+        // split the absolute path
+        var parts = path.split('/').filter((p) => !!p);
+  
+        // start at the root
+        var current = FS.root;
+        var current_path = '/';
+  
+        for (var i = 0; i < parts.length; i++) {
+          var islast = (i === parts.length-1);
+          if (islast && opts.parent) {
+            // stop resolving
+            break;
+          }
+  
+          current = FS.lookupNode(current, parts[i]);
+          current_path = PATH.join2(current_path, parts[i]);
+  
+          // jump to the mount's root node if this is a mountpoint
+          if (FS.isMountpoint(current)) {
+            if (!islast || (islast && opts.follow_mount)) {
+              current = current.mounted.root;
+            }
+          }
+  
+          // by default, lookupPath will not follow a symlink if it is the final path component.
+          // setting opts.follow = true will override this behavior.
+          if (!islast || opts.follow) {
+            var count = 0;
+            while (FS.isLink(current.mode)) {
+              var link = FS.readlink(current_path);
+              current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
+  
+              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 });
+              current = lookup.node;
+  
+              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+                throw new FS.ErrnoError(32);
+              }
+            }
+          }
+        }
+  
+        return { path: current_path, node: current };
+      },
+  getPath(node) {
+        var path;
+        while (true) {
+          if (FS.isRoot(node)) {
+            var mount = node.mount.mountpoint;
+            if (!path) return mount;
+            return mount[mount.length-1] !== '/' ? `${mount}/${path}` : mount + path;
+          }
+          path = path ? `${node.name}/${path}` : node.name;
+          node = node.parent;
+        }
+      },
+  hashName(parentid, name) {
+        var hash = 0;
+  
+        for (var i = 0; i < name.length; i++) {
+          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+        }
+        return ((parentid + hash) >>> 0) % FS.nameTable.length;
+      },
+  hashAddNode(node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        node.name_next = FS.nameTable[hash];
+        FS.nameTable[hash] = node;
+      },
+  hashRemoveNode(node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        if (FS.nameTable[hash] === node) {
+          FS.nameTable[hash] = node.name_next;
+        } else {
+          var current = FS.nameTable[hash];
+          while (current) {
+            if (current.name_next === node) {
+              current.name_next = node.name_next;
+              break;
+            }
+            current = current.name_next;
+          }
+        }
+      },
+  lookupNode(parent, name) {
+        var errCode = FS.mayLookup(parent);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode, parent);
+        }
+        var hash = FS.hashName(parent.id, name);
+        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+          var nodeName = node.name;
+          if (node.parent.id === parent.id && nodeName === name) {
+            return node;
+          }
+        }
+        // if we failed to find it in the cache, call into the VFS
+        return FS.lookup(parent, name);
+      },
+  createNode(parent, name, mode, rdev) {
+        assert(typeof parent == 'object')
+        var node = new FS.FSNode(parent, name, mode, rdev);
+  
+        FS.hashAddNode(node);
+  
+        return node;
+      },
+  destroyNode(node) {
+        FS.hashRemoveNode(node);
+      },
+  isRoot(node) {
+        return node === node.parent;
+      },
+  isMountpoint(node) {
+        return !!node.mounted;
+      },
+  isFile(mode) {
+        return (mode & 61440) === 32768;
+      },
+  isDir(mode) {
+        return (mode & 61440) === 16384;
+      },
+  isLink(mode) {
+        return (mode & 61440) === 40960;
+      },
+  isChrdev(mode) {
+        return (mode & 61440) === 8192;
+      },
+  isBlkdev(mode) {
+        return (mode & 61440) === 24576;
+      },
+  isFIFO(mode) {
+        return (mode & 61440) === 4096;
+      },
+  isSocket(mode) {
+        return (mode & 49152) === 49152;
+      },
+  flagsToPermissionString(flag) {
+        var perms = ['r', 'w', 'rw'][flag & 3];
+        if ((flag & 512)) {
+          perms += 'w';
+        }
+        return perms;
+      },
+  nodePermissions(node, perms) {
+        if (FS.ignorePermissions) {
+          return 0;
+        }
+        // return 0 if any user, group or owner bits are set.
+        if (perms.includes('r') && !(node.mode & 292)) {
+          return 2;
+        } else if (perms.includes('w') && !(node.mode & 146)) {
+          return 2;
+        } else if (perms.includes('x') && !(node.mode & 73)) {
+          return 2;
+        }
+        return 0;
+      },
+  mayLookup(dir) {
+        var errCode = FS.nodePermissions(dir, 'x');
+        if (errCode) return errCode;
+        if (!dir.node_ops.lookup) return 2;
+        return 0;
+      },
+  mayCreate(dir, name) {
+        try {
+          var node = FS.lookupNode(dir, name);
+          return 20;
+        } catch (e) {
+        }
+        return FS.nodePermissions(dir, 'wx');
+      },
+  mayDelete(dir, name, isdir) {
+        var node;
+        try {
+          node = FS.lookupNode(dir, name);
+        } catch (e) {
+          return e.errno;
+        }
+        var errCode = FS.nodePermissions(dir, 'wx');
+        if (errCode) {
+          return errCode;
+        }
+        if (isdir) {
+          if (!FS.isDir(node.mode)) {
+            return 54;
+          }
+          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+            return 10;
+          }
+        } else {
+          if (FS.isDir(node.mode)) {
+            return 31;
+          }
+        }
+        return 0;
+      },
+  mayOpen(node, flags) {
+        if (!node) {
+          return 44;
+        }
+        if (FS.isLink(node.mode)) {
+          return 32;
+        } else if (FS.isDir(node.mode)) {
+          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+            return 31;
+          }
+        }
+        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+      },
+  MAX_OPEN_FDS:4096,
+  nextfd() {
+        for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
+          if (!FS.streams[fd]) {
+            return fd;
+          }
+        }
+        throw new FS.ErrnoError(33);
+      },
+  getStreamChecked(fd) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(8);
+        }
+        return stream;
+      },
+  getStream:(fd) => FS.streams[fd],
+  createStream(stream, fd = -1) {
+        if (!FS.FSStream) {
+          FS.FSStream = /** @constructor */ function() {
+            this.shared = { };
+          };
+          FS.FSStream.prototype = {};
+          Object.defineProperties(FS.FSStream.prototype, {
+            object: {
+              /** @this {FS.FSStream} */
+              get() { return this.node; },
+              /** @this {FS.FSStream} */
+              set(val) { this.node = val; }
+            },
+            isRead: {
+              /** @this {FS.FSStream} */
+              get() { return (this.flags & 2097155) !== 1; }
+            },
+            isWrite: {
+              /** @this {FS.FSStream} */
+              get() { return (this.flags & 2097155) !== 0; }
+            },
+            isAppend: {
+              /** @this {FS.FSStream} */
+              get() { return (this.flags & 1024); }
+            },
+            flags: {
+              /** @this {FS.FSStream} */
+              get() { return this.shared.flags; },
+              /** @this {FS.FSStream} */
+              set(val) { this.shared.flags = val; },
+            },
+            position : {
+              /** @this {FS.FSStream} */
+              get() { return this.shared.position; },
+              /** @this {FS.FSStream} */
+              set(val) { this.shared.position = val; },
+            },
+          });
+        }
+        // clone it, so we can return an instance of FSStream
+        stream = Object.assign(new FS.FSStream(), stream);
+        if (fd == -1) {
+          fd = FS.nextfd();
+        }
+        stream.fd = fd;
+        FS.streams[fd] = stream;
+        return stream;
+      },
+  closeStream(fd) {
+        FS.streams[fd] = null;
+      },
+  chrdev_stream_ops:{
+  open(stream) {
+          var device = FS.getDevice(stream.node.rdev);
+          // override node's stream ops with the device's
+          stream.stream_ops = device.stream_ops;
+          // forward the open call
+          if (stream.stream_ops.open) {
+            stream.stream_ops.open(stream);
+          }
+        },
+  llseek() {
+          throw new FS.ErrnoError(70);
+        },
+  },
+  major:(dev) => ((dev) >> 8),
+  minor:(dev) => ((dev) & 0xff),
+  makedev:(ma, mi) => ((ma) << 8 | (mi)),
+  registerDevice(dev, ops) {
+        FS.devices[dev] = { stream_ops: ops };
+      },
+  getDevice:(dev) => FS.devices[dev],
+  getMounts(mount) {
+        var mounts = [];
+        var check = [mount];
+  
+        while (check.length) {
+          var m = check.pop();
+  
+          mounts.push(m);
+  
+          check.push.apply(check, m.mounts);
+        }
+  
+        return mounts;
+      },
+  syncfs(populate, callback) {
+        if (typeof populate == 'function') {
+          callback = populate;
+          populate = false;
+        }
+  
+        FS.syncFSRequests++;
+  
+        if (FS.syncFSRequests > 1) {
+          err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
+        }
+  
+        var mounts = FS.getMounts(FS.root.mount);
+        var completed = 0;
+  
+        function doCallback(errCode) {
+          assert(FS.syncFSRequests > 0);
+          FS.syncFSRequests--;
+          return callback(errCode);
+        }
+  
+        function done(errCode) {
+          if (errCode) {
+            if (!done.errored) {
+              done.errored = true;
+              return doCallback(errCode);
+            }
+            return;
+          }
+          if (++completed >= mounts.length) {
+            doCallback(null);
+          }
+        };
+  
+        // sync all mounts
+        mounts.forEach((mount) => {
+          if (!mount.type.syncfs) {
+            return done(null);
+          }
+          mount.type.syncfs(mount, populate, done);
+        });
+      },
+  mount(type, opts, mountpoint) {
+        if (typeof type == 'string') {
+          // The filesystem was not included, and instead we have an error
+          // message stored in the variable.
+          throw type;
+        }
+        var root = mountpoint === '/';
+        var pseudo = !mountpoint;
+        var node;
+  
+        if (root && FS.root) {
+          throw new FS.ErrnoError(10);
+        } else if (!root && !pseudo) {
+          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+          mountpoint = lookup.path;  // use the absolute path
+          node = lookup.node;
+  
+          if (FS.isMountpoint(node)) {
+            throw new FS.ErrnoError(10);
+          }
+  
+          if (!FS.isDir(node.mode)) {
+            throw new FS.ErrnoError(54);
+          }
+        }
+  
+        var mount = {
+          type,
+          opts,
+          mountpoint,
+          mounts: []
+        };
+  
+        // create a root node for the fs
+        var mountRoot = type.mount(mount);
+        mountRoot.mount = mount;
+        mount.root = mountRoot;
+  
+        if (root) {
+          FS.root = mountRoot;
+        } else if (node) {
+          // set as a mountpoint
+          node.mounted = mount;
+  
+          // add the new mount to the current mount's children
+          if (node.mount) {
+            node.mount.mounts.push(mount);
+          }
+        }
+  
+        return mountRoot;
+      },
+  unmount(mountpoint) {
+        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+        if (!FS.isMountpoint(lookup.node)) {
+          throw new FS.ErrnoError(28);
+        }
+  
+        // destroy the nodes for this mount, and all its child mounts
+        var node = lookup.node;
+        var mount = node.mounted;
+        var mounts = FS.getMounts(mount);
+  
+        Object.keys(FS.nameTable).forEach((hash) => {
+          var current = FS.nameTable[hash];
+  
+          while (current) {
+            var next = current.name_next;
+  
+            if (mounts.includes(current.mount)) {
+              FS.destroyNode(current);
+            }
+  
+            current = next;
+          }
+        });
+  
+        // no longer a mountpoint
+        node.mounted = null;
+  
+        // remove this mount from the child mounts
+        var idx = node.mount.mounts.indexOf(mount);
+        assert(idx !== -1);
+        node.mount.mounts.splice(idx, 1);
+      },
+  lookup(parent, name) {
+        return parent.node_ops.lookup(parent, name);
+      },
+  mknod(path, mode, dev) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        if (!name || name === '.' || name === '..') {
+          throw new FS.ErrnoError(28);
+        }
+        var errCode = FS.mayCreate(parent, name);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        if (!parent.node_ops.mknod) {
+          throw new FS.ErrnoError(63);
+        }
+        return parent.node_ops.mknod(parent, name, mode, dev);
+      },
+  create(path, mode) {
+        mode = mode !== undefined ? mode : 438 /* 0666 */;
+        mode &= 4095;
+        mode |= 32768;
+        return FS.mknod(path, mode, 0);
+      },
+  mkdir(path, mode) {
+        mode = mode !== undefined ? mode : 511 /* 0777 */;
+        mode &= 511 | 512;
+        mode |= 16384;
+        return FS.mknod(path, mode, 0);
+      },
+  mkdirTree(path, mode) {
+        var dirs = path.split('/');
+        var d = '';
+        for (var i = 0; i < dirs.length; ++i) {
+          if (!dirs[i]) continue;
+          d += '/' + dirs[i];
+          try {
+            FS.mkdir(d, mode);
+          } catch(e) {
+            if (e.errno != 20) throw e;
+          }
+        }
+      },
+  mkdev(path, mode, dev) {
+        if (typeof dev == 'undefined') {
+          dev = mode;
+          mode = 438 /* 0666 */;
+        }
+        mode |= 8192;
+        return FS.mknod(path, mode, dev);
+      },
+  symlink(oldpath, newpath) {
+        if (!PATH_FS.resolve(oldpath)) {
+          throw new FS.ErrnoError(44);
+        }
+        var lookup = FS.lookupPath(newpath, { parent: true });
+        var parent = lookup.node;
+        if (!parent) {
+          throw new FS.ErrnoError(44);
+        }
+        var newname = PATH.basename(newpath);
+        var errCode = FS.mayCreate(parent, newname);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        if (!parent.node_ops.symlink) {
+          throw new FS.ErrnoError(63);
+        }
+        return parent.node_ops.symlink(parent, newname, oldpath);
+      },
+  rename(old_path, new_path) {
+        var old_dirname = PATH.dirname(old_path);
+        var new_dirname = PATH.dirname(new_path);
+        var old_name = PATH.basename(old_path);
+        var new_name = PATH.basename(new_path);
+        // parents must exist
+        var lookup, old_dir, new_dir;
+  
+        // let the errors from non existant directories percolate up
+        lookup = FS.lookupPath(old_path, { parent: true });
+        old_dir = lookup.node;
+        lookup = FS.lookupPath(new_path, { parent: true });
+        new_dir = lookup.node;
+  
+        if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+        // need to be part of the same mount
+        if (old_dir.mount !== new_dir.mount) {
+          throw new FS.ErrnoError(75);
+        }
+        // source must exist
+        var old_node = FS.lookupNode(old_dir, old_name);
+        // old path should not be an ancestor of the new path
+        var relative = PATH_FS.relative(old_path, new_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(28);
+        }
+        // new path should not be an ancestor of the old path
+        relative = PATH_FS.relative(new_path, old_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(55);
+        }
+        // see if the new path already exists
+        var new_node;
+        try {
+          new_node = FS.lookupNode(new_dir, new_name);
+        } catch (e) {
+          // not fatal
+        }
+        // early out if nothing needs to change
+        if (old_node === new_node) {
+          return;
+        }
+        // we'll need to delete the old entry
+        var isdir = FS.isDir(old_node.mode);
+        var errCode = FS.mayDelete(old_dir, old_name, isdir);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        // need delete permissions if we'll be overwriting.
+        // need create permissions if new doesn't already exist.
+        errCode = new_node ?
+          FS.mayDelete(new_dir, new_name, isdir) :
+          FS.mayCreate(new_dir, new_name);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        if (!old_dir.node_ops.rename) {
+          throw new FS.ErrnoError(63);
+        }
+        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+          throw new FS.ErrnoError(10);
+        }
+        // if we are going to change the parent, check write permissions
+        if (new_dir !== old_dir) {
+          errCode = FS.nodePermissions(old_dir, 'w');
+          if (errCode) {
+            throw new FS.ErrnoError(errCode);
+          }
+        }
+        // remove the node from the lookup hash
+        FS.hashRemoveNode(old_node);
+        // do the underlying fs rename
+        try {
+          old_dir.node_ops.rename(old_node, new_dir, new_name);
+        } catch (e) {
+          throw e;
+        } finally {
+          // add the node back to the hash (in case node_ops.rename
+          // changed its name)
+          FS.hashAddNode(old_node);
+        }
+      },
+  rmdir(path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var errCode = FS.mayDelete(parent, name, true);
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        if (!parent.node_ops.rmdir) {
+          throw new FS.ErrnoError(63);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(10);
+        }
+        parent.node_ops.rmdir(parent, name);
+        FS.destroyNode(node);
+      },
+  readdir(path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        if (!node.node_ops.readdir) {
+          throw new FS.ErrnoError(54);
+        }
+        return node.node_ops.readdir(node);
+      },
+  unlink(path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        if (!parent) {
+          throw new FS.ErrnoError(44);
+        }
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var errCode = FS.mayDelete(parent, name, false);
+        if (errCode) {
+          // According to POSIX, we should map EISDIR to EPERM, but
+          // we instead do what Linux does (and we must, as we use
+          // the musl linux libc).
+          throw new FS.ErrnoError(errCode);
+        }
+        if (!parent.node_ops.unlink) {
+          throw new FS.ErrnoError(63);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(10);
+        }
+        parent.node_ops.unlink(parent, name);
+        FS.destroyNode(node);
+      },
+  readlink(path) {
+        var lookup = FS.lookupPath(path);
+        var link = lookup.node;
+        if (!link) {
+          throw new FS.ErrnoError(44);
+        }
+        if (!link.node_ops.readlink) {
+          throw new FS.ErrnoError(28);
+        }
+        return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+      },
+  stat(path, dontFollow) {
+        var lookup = FS.lookupPath(path, { follow: !dontFollow });
+        var node = lookup.node;
+        if (!node) {
+          throw new FS.ErrnoError(44);
+        }
+        if (!node.node_ops.getattr) {
+          throw new FS.ErrnoError(63);
+        }
+        return node.node_ops.getattr(node);
+      },
+  lstat(path) {
+        return FS.stat(path, true);
+      },
+  chmod(path, mode, dontFollow) {
+        var node;
+        if (typeof path == 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(63);
+        }
+        node.node_ops.setattr(node, {
+          mode: (mode & 4095) | (node.mode & ~4095),
+          timestamp: Date.now()
+        });
+      },
+  lchmod(path, mode) {
+        FS.chmod(path, mode, true);
+      },
+  fchmod(fd, mode) {
+        var stream = FS.getStreamChecked(fd);
+        FS.chmod(stream.node, mode);
+      },
+  chown(path, uid, gid, dontFollow) {
+        var node;
+        if (typeof path == 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(63);
+        }
+        node.node_ops.setattr(node, {
+          timestamp: Date.now()
+          // we ignore the uid / gid for now
+        });
+      },
+  lchown(path, uid, gid) {
+        FS.chown(path, uid, gid, true);
+      },
+  fchown(fd, uid, gid) {
+        var stream = FS.getStreamChecked(fd);
+        FS.chown(stream.node, uid, gid);
+      },
+  truncate(path, len) {
+        if (len < 0) {
+          throw new FS.ErrnoError(28);
+        }
+        var node;
+        if (typeof path == 'string') {
+          var lookup = FS.lookupPath(path, { follow: true });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(63);
+        }
+        if (FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(31);
+        }
+        if (!FS.isFile(node.mode)) {
+          throw new FS.ErrnoError(28);
+        }
+        var errCode = FS.nodePermissions(node, 'w');
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        node.node_ops.setattr(node, {
+          size: len,
+          timestamp: Date.now()
+        });
+      },
+  ftruncate(fd, len) {
+        var stream = FS.getStreamChecked(fd);
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(28);
+        }
+        FS.truncate(stream.node, len);
+      },
+  utime(path, atime, mtime) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        node.node_ops.setattr(node, {
+          timestamp: Math.max(atime, mtime)
+        });
+      },
+  open(path, flags, mode) {
+        if (path === "") {
+          throw new FS.ErrnoError(44);
+        }
+        flags = typeof flags == 'string' ? FS_modeStringToFlags(flags) : flags;
+        mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode;
+        if ((flags & 64)) {
+          mode = (mode & 4095) | 32768;
+        } else {
+          mode = 0;
+        }
+        var node;
+        if (typeof path == 'object') {
+          node = path;
+        } else {
+          path = PATH.normalize(path);
+          try {
+            var lookup = FS.lookupPath(path, {
+              follow: !(flags & 131072)
+            });
+            node = lookup.node;
+          } catch (e) {
+            // ignore
+          }
+        }
+        // perhaps we need to create the node
+        var created = false;
+        if ((flags & 64)) {
+          if (node) {
+            // if O_CREAT and O_EXCL are set, error out if the node already exists
+            if ((flags & 128)) {
+              throw new FS.ErrnoError(20);
+            }
+          } else {
+            // node doesn't exist, try to create it
+            node = FS.mknod(path, mode, 0);
+            created = true;
+          }
+        }
+        if (!node) {
+          throw new FS.ErrnoError(44);
+        }
+        // can't truncate a device
+        if (FS.isChrdev(node.mode)) {
+          flags &= ~512;
+        }
+        // if asked only for a directory, then this must be one
+        if ((flags & 65536) && !FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(54);
+        }
+        // check permissions, if this is not a file we just created now (it is ok to
+        // create and write to a file with read-only permissions; it is read-only
+        // for later use)
+        if (!created) {
+          var errCode = FS.mayOpen(node, flags);
+          if (errCode) {
+            throw new FS.ErrnoError(errCode);
+          }
+        }
+        // do truncation if necessary
+        if ((flags & 512) && !created) {
+          FS.truncate(node, 0);
+        }
+        // we've already handled these, don't pass down to the underlying vfs
+        flags &= ~(128 | 512 | 131072);
+  
+        // register the stream with the filesystem
+        var stream = FS.createStream({
+          node,
+          path: FS.getPath(node),  // we want the absolute path to the node
+          flags,
+          seekable: true,
+          position: 0,
+          stream_ops: node.stream_ops,
+          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+          ungotten: [],
+          error: false
+        });
+        // call the new stream's open function
+        if (stream.stream_ops.open) {
+          stream.stream_ops.open(stream);
+        }
+        if (Module['logReadFiles'] && !(flags & 1)) {
+          if (!FS.readFiles) FS.readFiles = {};
+          if (!(path in FS.readFiles)) {
+            FS.readFiles[path] = 1;
+          }
+        }
+        return stream;
+      },
+  close(stream) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(8);
+        }
+        if (stream.getdents) stream.getdents = null; // free readdir state
+        try {
+          if (stream.stream_ops.close) {
+            stream.stream_ops.close(stream);
+          }
+        } catch (e) {
+          throw e;
+        } finally {
+          FS.closeStream(stream.fd);
+        }
+        stream.fd = null;
+      },
+  isClosed(stream) {
+        return stream.fd === null;
+      },
+  llseek(stream, offset, whence) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(8);
+        }
+        if (!stream.seekable || !stream.stream_ops.llseek) {
+          throw new FS.ErrnoError(70);
+        }
+        if (whence != 0 && whence != 1 && whence != 2) {
+          throw new FS.ErrnoError(28);
+        }
+        stream.position = stream.stream_ops.llseek(stream, offset, whence);
+        stream.ungotten = [];
+        return stream.position;
+      },
+  read(stream, buffer, offset, length, position) {
+        assert(offset >= 0);
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(28);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(8);
+        }
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(8);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(31);
+        }
+        if (!stream.stream_ops.read) {
+          throw new FS.ErrnoError(28);
+        }
+        var seeking = typeof position != 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(70);
+        }
+        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+        if (!seeking) stream.position += bytesRead;
+        return bytesRead;
+      },
+  write(stream, buffer, offset, length, position, canOwn) {
+        assert(offset >= 0);
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(28);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(8);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(8);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(31);
+        }
+        if (!stream.stream_ops.write) {
+          throw new FS.ErrnoError(28);
+        }
+        if (stream.seekable && stream.flags & 1024) {
+          // seek to the end before writing in append mode
+          FS.llseek(stream, 0, 2);
+        }
+        var seeking = typeof position != 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(70);
+        }
+        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+        if (!seeking) stream.position += bytesWritten;
+        return bytesWritten;
+      },
+  allocate(stream, offset, length) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(8);
+        }
+        if (offset < 0 || length <= 0) {
+          throw new FS.ErrnoError(28);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(8);
+        }
+        if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(43);
+        }
+        if (!stream.stream_ops.allocate) {
+          throw new FS.ErrnoError(138);
+        }
+        stream.stream_ops.allocate(stream, offset, length);
+      },
+  mmap(stream, length, position, prot, flags) {
+        // User requests writing to file (prot & PROT_WRITE != 0).
+        // Checking if we have permissions to write to the file unless
+        // MAP_PRIVATE flag is set. According to POSIX spec it is possible
+        // to write to file opened in read-only mode with MAP_PRIVATE flag,
+        // as all modifications will be visible only in the memory of
+        // the current process.
+        if ((prot & 2) !== 0
+            && (flags & 2) === 0
+            && (stream.flags & 2097155) !== 2) {
+          throw new FS.ErrnoError(2);
+        }
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(2);
+        }
+        if (!stream.stream_ops.mmap) {
+          throw new FS.ErrnoError(43);
+        }
+        return stream.stream_ops.mmap(stream, length, position, prot, flags);
+      },
+  msync(stream, buffer, offset, length, mmapFlags) {
+        assert(offset >= 0);
+        if (!stream.stream_ops.msync) {
+          return 0;
+        }
+        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+      },
+  munmap:(stream) => 0,
+  ioctl(stream, cmd, arg) {
+        if (!stream.stream_ops.ioctl) {
+          throw new FS.ErrnoError(59);
+        }
+        return stream.stream_ops.ioctl(stream, cmd, arg);
+      },
+  readFile(path, opts = {}) {
+        opts.flags = opts.flags || 0;
+        opts.encoding = opts.encoding || 'binary';
+        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+          throw new Error(`Invalid encoding type "${opts.encoding}"`);
+        }
+        var ret;
+        var stream = FS.open(path, opts.flags);
+        var stat = FS.stat(path);
+        var length = stat.size;
+        var buf = new Uint8Array(length);
+        FS.read(stream, buf, 0, length, 0);
+        if (opts.encoding === 'utf8') {
+          ret = UTF8ArrayToString(buf, 0);
+        } else if (opts.encoding === 'binary') {
+          ret = buf;
+        }
+        FS.close(stream);
+        return ret;
+      },
+  writeFile(path, data, opts = {}) {
+        opts.flags = opts.flags || 577;
+        var stream = FS.open(path, opts.flags, opts.mode);
+        if (typeof data == 'string') {
+          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+          FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+        } else if (ArrayBuffer.isView(data)) {
+          FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+        } else {
+          throw new Error('Unsupported data type');
+        }
+        FS.close(stream);
+      },
+  cwd:() => FS.currentPath,
+  chdir(path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        if (lookup.node === null) {
+          throw new FS.ErrnoError(44);
+        }
+        if (!FS.isDir(lookup.node.mode)) {
+          throw new FS.ErrnoError(54);
+        }
+        var errCode = FS.nodePermissions(lookup.node, 'x');
+        if (errCode) {
+          throw new FS.ErrnoError(errCode);
+        }
+        FS.currentPath = lookup.path;
+      },
+  createDefaultDirectories() {
+        FS.mkdir('/tmp');
+        FS.mkdir('/home');
+        FS.mkdir('/home/web_user');
+      },
+  createDefaultDevices() {
+        // create /dev
+        FS.mkdir('/dev');
+        // setup /dev/null
+        FS.registerDevice(FS.makedev(1, 3), {
+          read: () => 0,
+          write: (stream, buffer, offset, length, pos) => length,
+        });
+        FS.mkdev('/dev/null', FS.makedev(1, 3));
+        // setup /dev/tty and /dev/tty1
+        // stderr needs to print output using err() rather than out()
+        // so we register a second tty just for it.
+        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+        FS.mkdev('/dev/tty', FS.makedev(5, 0));
+        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+        // setup /dev/[u]random
+        // use a buffer to avoid overhead of individual crypto calls per byte
+        var randomBuffer = new Uint8Array(1024), randomLeft = 0;
+        var randomByte = () => {
+          if (randomLeft === 0) {
+            randomLeft = randomFill(randomBuffer).byteLength;
+          }
+          return randomBuffer[--randomLeft];
+        };
+        FS.createDevice('/dev', 'random', randomByte);
+        FS.createDevice('/dev', 'urandom', randomByte);
+        // we're not going to emulate the actual shm device,
+        // just create the tmp dirs that reside in it commonly
+        FS.mkdir('/dev/shm');
+        FS.mkdir('/dev/shm/tmp');
+      },
+  createSpecialDirectories() {
+        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
+        // name of the stream for fd 6 (see test_unistd_ttyname)
+        FS.mkdir('/proc');
+        var proc_self = FS.mkdir('/proc/self');
+        FS.mkdir('/proc/self/fd');
+        FS.mount({
+          mount() {
+            var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73);
+            node.node_ops = {
+              lookup(parent, name) {
+                var fd = +name;
+                var stream = FS.getStreamChecked(fd);
+                var ret = {
+                  parent: null,
+                  mount: { mountpoint: 'fake' },
+                  node_ops: { readlink: () => stream.path },
+                };
+                ret.parent = ret; // make it look like a simple root node
+                return ret;
+              }
+            };
+            return node;
+          }
+        }, {}, '/proc/self/fd');
+      },
+  createStandardStreams() {
+        // TODO deprecate the old functionality of a single
+        // input / output callback and that utilizes FS.createDevice
+        // and instead require a unique set of stream ops
+  
+        // by default, we symlink the standard streams to the
+        // default tty devices. however, if the standard streams
+        // have been overwritten we create a unique device for
+        // them instead.
+        if (Module['stdin']) {
+          FS.createDevice('/dev', 'stdin', Module['stdin']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdin');
+        }
+        if (Module['stdout']) {
+          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdout');
+        }
+        if (Module['stderr']) {
+          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+        } else {
+          FS.symlink('/dev/tty1', '/dev/stderr');
+        }
+  
+        // open default streams for the stdin, stdout and stderr devices
+        var stdin = FS.open('/dev/stdin', 0);
+        var stdout = FS.open('/dev/stdout', 1);
+        var stderr = FS.open('/dev/stderr', 1);
+        assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`);
+        assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`);
+        assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`);
+      },
+  ensureErrnoError() {
+        if (FS.ErrnoError) return;
+        FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) {
+          // We set the `name` property to be able to identify `FS.ErrnoError`
+          // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
+          // - when using PROXYFS, an error can come from an underlying FS
+          // as different FS objects have their own FS.ErrnoError each,
+          // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
+          // we'll use the reliable test `err.name == "ErrnoError"` instead
+          this.name = 'ErrnoError';
+          this.node = node;
+          this.setErrno = /** @this{Object} */ function(errno) {
+            this.errno = errno;
+            for (var key in ERRNO_CODES) {
+              if (ERRNO_CODES[key] === errno) {
+                this.code = key;
+                break;
+              }
+            }
+          };
+          this.setErrno(errno);
+          this.message = ERRNO_MESSAGES[errno];
+  
+          // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack
+          // now ensures it shows what we want.
+          if (this.stack) {
+            // Define the stack property for Node.js 4, which otherwise errors on the next line.
+            Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+            this.stack = demangleAll(this.stack);
+          }
+        };
+        FS.ErrnoError.prototype = new Error();
+        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+        [44].forEach((code) => {
+          FS.genericErrors[code] = new FS.ErrnoError(code);
+          FS.genericErrors[code].stack = '<generic error, no stack>';
+        });
+      },
+  staticInit() {
+        FS.ensureErrnoError();
+  
+        FS.nameTable = new Array(4096);
+  
+        FS.mount(MEMFS, {}, '/');
+  
+        FS.createDefaultDirectories();
+        FS.createDefaultDevices();
+        FS.createSpecialDirectories();
+  
+        FS.filesystems = {
+          'MEMFS': MEMFS,
+        };
+      },
+  init(input, output, error) {
+        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+        FS.init.initialized = true;
+  
+        FS.ensureErrnoError();
+  
+        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+        Module['stdin'] = input || Module['stdin'];
+        Module['stdout'] = output || Module['stdout'];
+        Module['stderr'] = error || Module['stderr'];
+  
+        FS.createStandardStreams();
+      },
+  quit() {
+        FS.init.initialized = false;
+        // force-flush all streams, so we get musl std streams printed out
+        _fflush(0);
+        // close all of our streams
+        for (var i = 0; i < FS.streams.length; i++) {
+          var stream = FS.streams[i];
+          if (!stream) {
+            continue;
+          }
+          FS.close(stream);
+        }
+      },
+  findObject(path, dontResolveLastLink) {
+        var ret = FS.analyzePath(path, dontResolveLastLink);
+        if (!ret.exists) {
+          return null;
+        }
+        return ret.object;
+      },
+  analyzePath(path, dontResolveLastLink) {
+        // operate from within the context of the symlink's target
+        try {
+          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          path = lookup.path;
+        } catch (e) {
+        }
+        var ret = {
+          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+          parentExists: false, parentPath: null, parentObject: null
+        };
+        try {
+          var lookup = FS.lookupPath(path, { parent: true });
+          ret.parentExists = true;
+          ret.parentPath = lookup.path;
+          ret.parentObject = lookup.node;
+          ret.name = PATH.basename(path);
+          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          ret.exists = true;
+          ret.path = lookup.path;
+          ret.object = lookup.node;
+          ret.name = lookup.node.name;
+          ret.isRoot = lookup.path === '/';
+        } catch (e) {
+          ret.error = e.errno;
+        };
+        return ret;
+      },
+  createPath(parent, path, canRead, canWrite) {
+        parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+        var parts = path.split('/').reverse();
+        while (parts.length) {
+          var part = parts.pop();
+          if (!part) continue;
+          var current = PATH.join2(parent, part);
+          try {
+            FS.mkdir(current);
+          } catch (e) {
+            // ignore EEXIST
+          }
+          parent = current;
+        }
+        return current;
+      },
+  createFile(parent, name, properties, canRead, canWrite) {
+        var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS_getMode(canRead, canWrite);
+        return FS.create(path, mode);
+      },
+  createDataFile(parent, name, data, canRead, canWrite, canOwn) {
+        var path = name;
+        if (parent) {
+          parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+          path = name ? PATH.join2(parent, name) : parent;
+        }
+        var mode = FS_getMode(canRead, canWrite);
+        var node = FS.create(path, mode);
+        if (data) {
+          if (typeof data == 'string') {
+            var arr = new Array(data.length);
+            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+            data = arr;
+          }
+          // make sure we can write to the file
+          FS.chmod(node, mode | 146);
+          var stream = FS.open(node, 577);
+          FS.write(stream, data, 0, data.length, 0, canOwn);
+          FS.close(stream);
+          FS.chmod(node, mode);
+        }
+        return node;
+      },
+  createDevice(parent, name, input, output) {
+        var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS_getMode(!!input, !!output);
+        if (!FS.createDevice.major) FS.createDevice.major = 64;
+        var dev = FS.makedev(FS.createDevice.major++, 0);
+        // Create a fake device that a set of stream ops to emulate
+        // the old behavior.
+        FS.registerDevice(dev, {
+          open(stream) {
+            stream.seekable = false;
+          },
+          close(stream) {
+            // flush any pending line data
+            if (output && output.buffer && output.buffer.length) {
+              output(10);
+            }
+          },
+          read(stream, buffer, offset, length, pos /* ignored */) {
+            var bytesRead = 0;
+            for (var i = 0; i < length; i++) {
+              var result;
+              try {
+                result = input();
+              } catch (e) {
+                throw new FS.ErrnoError(29);
+              }
+              if (result === undefined && bytesRead === 0) {
+                throw new FS.ErrnoError(6);
+              }
+              if (result === null || result === undefined) break;
+              bytesRead++;
+              buffer[offset+i] = result;
+            }
+            if (bytesRead) {
+              stream.node.timestamp = Date.now();
+            }
+            return bytesRead;
+          },
+          write(stream, buffer, offset, length, pos) {
+            for (var i = 0; i < length; i++) {
+              try {
+                output(buffer[offset+i]);
+              } catch (e) {
+                throw new FS.ErrnoError(29);
+              }
+            }
+            if (length) {
+              stream.node.timestamp = Date.now();
+            }
+            return i;
+          }
+        });
+        return FS.mkdev(path, mode, dev);
+      },
+  forceLoadFile(obj) {
+        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+        if (typeof XMLHttpRequest != 'undefined') {
+          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+        } else if (read_) {
+          // Command-line.
+          try {
+            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+            //          read() will try to parse UTF8.
+            obj.contents = intArrayFromString(read_(obj.url), true);
+            obj.usedBytes = obj.contents.length;
+          } catch (e) {
+            throw new FS.ErrnoError(29);
+          }
+        } else {
+          throw new Error('Cannot load without read() or XMLHttpRequest.');
+        }
+      },
+  createLazyFile(parent, name, url, canRead, canWrite) {
+        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+        /** @constructor */
+        function LazyUint8Array() {
+          this.lengthKnown = false;
+          this.chunks = []; // Loaded chunks. Index is the chunk number
+        }
+        LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) {
+          if (idx > this.length-1 || idx < 0) {
+            return undefined;
+          }
+          var chunkOffset = idx % this.chunkSize;
+          var chunkNum = (idx / this.chunkSize)|0;
+          return this.getter(chunkNum)[chunkOffset];
+        };
+        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+          this.getter = getter;
+        };
+        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+          // Find length
+          var xhr = new XMLHttpRequest();
+          xhr.open('HEAD', url, false);
+          xhr.send(null);
+          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+          var datalength = Number(xhr.getResponseHeader("Content-length"));
+          var header;
+          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+  
+          var chunkSize = 1024*1024; // Chunk size in bytes
+  
+          if (!hasByteServing) chunkSize = datalength;
+  
+          // Function to get a range from the remote URL.
+          var doXHR = (from, to) => {
+            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+  
+            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+            var xhr = new XMLHttpRequest();
+            xhr.open('GET', url, false);
+            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+  
+            // Some hints to the browser that we want binary data.
+            xhr.responseType = 'arraybuffer';
+            if (xhr.overrideMimeType) {
+              xhr.overrideMimeType('text/plain; charset=x-user-defined');
+            }
+  
+            xhr.send(null);
+            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+            if (xhr.response !== undefined) {
+              return new Uint8Array(/** @type{Array<number>} */(xhr.response || []));
+            }
+            return intArrayFromString(xhr.responseText || '', true);
+          };
+          var lazyArray = this;
+          lazyArray.setDataGetter((chunkNum) => {
+            var start = chunkNum * chunkSize;
+            var end = (chunkNum+1) * chunkSize - 1; // including this byte
+            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+            if (typeof lazyArray.chunks[chunkNum] == 'undefined') {
+              lazyArray.chunks[chunkNum] = doXHR(start, end);
+            }
+            if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!');
+            return lazyArray.chunks[chunkNum];
+          });
+  
+          if (usesGzip || !datalength) {
+            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+            datalength = this.getter(0).length;
+            chunkSize = datalength;
+            out("LazyFiles on gzip forces download of the whole file when length is accessed");
+          }
+  
+          this._length = datalength;
+          this._chunkSize = chunkSize;
+          this.lengthKnown = true;
+        };
+        if (typeof XMLHttpRequest != 'undefined') {
+          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+          var lazyArray = new LazyUint8Array();
+          Object.defineProperties(lazyArray, {
+            length: {
+              get: /** @this{Object} */ function() {
+                if (!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._length;
+              }
+            },
+            chunkSize: {
+              get: /** @this{Object} */ function() {
+                if (!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._chunkSize;
+              }
+            }
+          });
+  
+          var properties = { isDevice: false, contents: lazyArray };
+        } else {
+          var properties = { isDevice: false, url: url };
+        }
+  
+        var node = FS.createFile(parent, name, properties, canRead, canWrite);
+        // This is a total hack, but I want to get this lazy file code out of the
+        // core of MEMFS. If we want to keep this lazy file concept I feel it should
+        // be its own thin LAZYFS proxying calls to MEMFS.
+        if (properties.contents) {
+          node.contents = properties.contents;
+        } else if (properties.url) {
+          node.contents = null;
+          node.url = properties.url;
+        }
+        // Add a function that defers querying the file size until it is asked the first time.
+        Object.defineProperties(node, {
+          usedBytes: {
+            get: /** @this {FSNode} */ function() { return this.contents.length; }
+          }
+        });
+        // override each stream op with one that tries to force load the lazy file first
+        var stream_ops = {};
+        var keys = Object.keys(node.stream_ops);
+        keys.forEach((key) => {
+          var fn = node.stream_ops[key];
+          stream_ops[key] = function forceLoadLazyFile() {
+            FS.forceLoadFile(node);
+            return fn.apply(null, arguments);
+          };
+        });
+        function writeChunks(stream, buffer, offset, length, position) {
+          var contents = stream.node.contents;
+          if (position >= contents.length)
+            return 0;
+          var size = Math.min(contents.length - position, length);
+          assert(size >= 0);
+          if (contents.slice) { // normal array
+            for (var i = 0; i < size; i++) {
+              buffer[offset + i] = contents[position + i];
+            }
+          } else {
+            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+              buffer[offset + i] = contents.get(position + i);
+            }
+          }
+          return size;
+        }
+        // use a custom read function
+        stream_ops.read = (stream, buffer, offset, length, position) => {
+          FS.forceLoadFile(node);
+          return writeChunks(stream, buffer, offset, length, position)
+        };
+        // use a custom mmap function
+        stream_ops.mmap = (stream, length, position, prot, flags) => {
+          FS.forceLoadFile(node);
+          var ptr = mmapAlloc(length);
+          if (!ptr) {
+            throw new FS.ErrnoError(48);
+          }
+          writeChunks(stream, HEAP8, ptr, length, position);
+          return { ptr, allocated: true };
+        };
+        node.stream_ops = stream_ops;
+        return node;
+      },
+  absolutePath() {
+        abort('FS.absolutePath has been removed; use PATH_FS.resolve instead');
+      },
+  createFolder() {
+        abort('FS.createFolder has been removed; use FS.mkdir instead');
+      },
+  createLink() {
+        abort('FS.createLink has been removed; use FS.symlink instead');
+      },
+  joinPath() {
+        abort('FS.joinPath has been removed; use PATH.join instead');
+      },
+  mmapAlloc() {
+        abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc');
+      },
+  standardizePath() {
+        abort('FS.standardizePath has been removed; use PATH.normalize instead');
+      },
+  };
+  
+  var SYSCALLS = {
+  DEFAULT_POLLMASK:5,
+  calculateAt(dirfd, path, allowEmpty) {
+        if (PATH.isAbs(path)) {
+          return path;
+        }
+        // relative path
+        var dir;
+        if (dirfd === -100) {
+          dir = FS.cwd();
+        } else {
+          var dirstream = SYSCALLS.getStreamFromFD(dirfd);
+          dir = dirstream.path;
+        }
+        if (path.length == 0) {
+          if (!allowEmpty) {
+            throw new FS.ErrnoError(44);;
+          }
+          return dir;
+        }
+        return PATH.join2(dir, path);
+      },
+  doStat(func, path, buf) {
+        try {
+          var stat = func(path);
+        } catch (e) {
+          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+            // an error occurred while trying to look up the path; we should just report ENOTDIR
+            return -54;
+          }
+          throw e;
+        }
+        HEAP32[((buf)>>2)] = stat.dev;
+        HEAP32[(((buf)+(4))>>2)] = stat.mode;
+        HEAPU32[(((buf)+(8))>>2)] = stat.nlink;
+        HEAP32[(((buf)+(12))>>2)] = stat.uid;
+        HEAP32[(((buf)+(16))>>2)] = stat.gid;
+        HEAP32[(((buf)+(20))>>2)] = stat.rdev;
+        (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(24))>>2)] = tempI64[0],HEAP32[(((buf)+(28))>>2)] = tempI64[1]);
+        HEAP32[(((buf)+(32))>>2)] = 4096;
+        HEAP32[(((buf)+(36))>>2)] = stat.blocks;
+        var atime = stat.atime.getTime();
+        var mtime = stat.mtime.getTime();
+        var ctime = stat.ctime.getTime();
+        (tempI64 = [Math.floor(atime / 1000)>>>0,(tempDouble=Math.floor(atime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]);
+        HEAPU32[(((buf)+(48))>>2)] = (atime % 1000) * 1000;
+        (tempI64 = [Math.floor(mtime / 1000)>>>0,(tempDouble=Math.floor(mtime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(56))>>2)] = tempI64[0],HEAP32[(((buf)+(60))>>2)] = tempI64[1]);
+        HEAPU32[(((buf)+(64))>>2)] = (mtime % 1000) * 1000;
+        (tempI64 = [Math.floor(ctime / 1000)>>>0,(tempDouble=Math.floor(ctime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(72))>>2)] = tempI64[0],HEAP32[(((buf)+(76))>>2)] = tempI64[1]);
+        HEAPU32[(((buf)+(80))>>2)] = (ctime % 1000) * 1000;
+        (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(88))>>2)] = tempI64[0],HEAP32[(((buf)+(92))>>2)] = tempI64[1]);
+        return 0;
+      },
+  doMsync(addr, stream, len, flags, offset) {
+        if (!FS.isFile(stream.node.mode)) {
+          throw new FS.ErrnoError(43);
+        }
+        if (flags & 2) {
+          // MAP_PRIVATE calls need not to be synced back to underlying fs
+          return 0;
+        }
+        var buffer = HEAPU8.slice(addr, addr + len);
+        FS.msync(stream, buffer, offset, len, flags);
+      },
+  varargs:undefined,
+  get() {
+        assert(SYSCALLS.varargs != undefined);
+        // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number.
+        var ret = HEAP32[((+SYSCALLS.varargs)>>2)];
+        SYSCALLS.varargs += 4;
+        return ret;
+      },
+  getp() { return SYSCALLS.get() },
+  getStr(ptr) {
+        var ret = UTF8ToString(ptr);
+        return ret;
+      },
+  getStreamFromFD(fd) {
+        var stream = FS.getStreamChecked(fd);
+        return stream;
+      },
+  };
+  function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) {
+  try {
+  
+      // readfds are supported,
+      // writefds checks socket open status
+      // exceptfds are supported, although on web, such exceptional conditions never arise in web sockets
+      //                          and so the exceptfds list will always return empty.
+      // timeout is supported, although on SOCKFS and PIPEFS these are ignored and always treated as 0 - fully async
+      assert(nfds <= 64, 'nfds must be less than or equal to 64');  // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers
+  
+      var total = 0;
+  
+      var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0),
+          srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0);
+      var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0),
+          srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0);
+      var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0),
+          srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+  
+      var dstReadLow = 0,
+          dstReadHigh = 0;
+      var dstWriteLow = 0,
+          dstWriteHigh = 0;
+      var dstExceptLow = 0,
+          dstExceptHigh = 0;
+  
+      var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) |
+                   (writefds ? HEAP32[((writefds)>>2)] : 0) |
+                   (exceptfds ? HEAP32[((exceptfds)>>2)] : 0);
+      var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) |
+                    (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) |
+                    (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+  
+      var check = function(fd, low, high, val) {
+        return (fd < 32 ? (low & val) : (high & val));
+      };
+  
+      for (var fd = 0; fd < nfds; fd++) {
+        var mask = 1 << (fd % 32);
+        if (!(check(fd, allLow, allHigh, mask))) {
+          continue;  // index isn't in the set
+        }
+  
+        var stream = SYSCALLS.getStreamFromFD(fd);
+  
+        var flags = SYSCALLS.DEFAULT_POLLMASK;
+  
+        if (stream.stream_ops.poll) {
+          var timeoutInMillis = -1;
+          if (timeout) {
+            var tv_sec = (readfds ? HEAP32[((timeout)>>2)] : 0),
+                tv_usec = (readfds ? HEAP32[(((timeout)+(8))>>2)] : 0);
+            timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000;
+          }
+          flags = stream.stream_ops.poll(stream, timeoutInMillis);
+        }
+  
+        if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) {
+          fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask);
+          total++;
+        }
+        if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) {
+          fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask);
+          total++;
+        }
+        if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) {
+          fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask);
+          total++;
+        }
+      }
+  
+      if (readfds) {
+        HEAP32[((readfds)>>2)] = dstReadLow;
+        HEAP32[(((readfds)+(4))>>2)] = dstReadHigh;
+      }
+      if (writefds) {
+        HEAP32[((writefds)>>2)] = dstWriteLow;
+        HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh;
+      }
+      if (exceptfds) {
+        HEAP32[((exceptfds)>>2)] = dstExceptLow;
+        HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh;
+      }
+  
+      return total;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  var SOCKFS = {
+  mount(mount) {
+        // If Module['websocket'] has already been defined (e.g. for configuring
+        // the subprotocol/url) use that, if not initialise it to a new object.
+        Module['websocket'] = (Module['websocket'] &&
+                               ('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
+  
+        // Add the Event registration mechanism to the exported websocket configuration
+        // object so we can register network callbacks from native JavaScript too.
+        // For more documentation see system/include/emscripten/emscripten.h
+        Module['websocket']._callbacks = {};
+        Module['websocket']['on'] = /** @this{Object} */ function(event, callback) {
+          if ('function' === typeof callback) {
+            this._callbacks[event] = callback;
+          }
+          return this;
+        };
+  
+        Module['websocket'].emit = /** @this{Object} */ function(event, param) {
+          if ('function' === typeof this._callbacks[event]) {
+            this._callbacks[event].call(this, param);
+          }
+        };
+  
+        // If debug is enabled register simple default logging callbacks for each Event.
+  
+        return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+      },
+  createSocket(family, type, protocol) {
+        type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
+        var streaming = type == 1;
+        if (streaming && protocol && protocol != 6) {
+          throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
+        }
+  
+        // create our internal socket structure
+        var sock = {
+          family,
+          type,
+          protocol,
+          server: null,
+          error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+          peers: {},
+          pending: [],
+          recv_queue: [],
+          sock_ops: SOCKFS.websocket_sock_ops
+        };
+  
+        // create the filesystem node to store the socket structure
+        var name = SOCKFS.nextname();
+        var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+        node.sock = sock;
+  
+        // and the wrapping stream that enables library functions such
+        // as read and write to indirectly interact with the socket
+        var stream = FS.createStream({
+          path: name,
+          node,
+          flags: 2,
+          seekable: false,
+          stream_ops: SOCKFS.stream_ops
+        });
+  
+        // map the new stream to the socket structure (sockets have a 1:1
+        // relationship with a stream)
+        sock.stream = stream;
+  
+        return sock;
+      },
+  getSocket(fd) {
+        var stream = FS.getStream(fd);
+        if (!stream || !FS.isSocket(stream.node.mode)) {
+          return null;
+        }
+        return stream.node.sock;
+      },
+  stream_ops:{
+  poll(stream) {
+          var sock = stream.node.sock;
+          return sock.sock_ops.poll(sock);
+        },
+  ioctl(stream, request, varargs) {
+          var sock = stream.node.sock;
+          return sock.sock_ops.ioctl(sock, request, varargs);
+        },
+  read(stream, buffer, offset, length, position /* ignored */) {
+          var sock = stream.node.sock;
+          var msg = sock.sock_ops.recvmsg(sock, length);
+          if (!msg) {
+            // socket is closed
+            return 0;
+          }
+          buffer.set(msg.buffer, offset);
+          return msg.buffer.length;
+        },
+  write(stream, buffer, offset, length, position /* ignored */) {
+          var sock = stream.node.sock;
+          return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+        },
+  close(stream) {
+          var sock = stream.node.sock;
+          sock.sock_ops.close(sock);
+        },
+  },
+  nextname() {
+        if (!SOCKFS.nextname.current) {
+          SOCKFS.nextname.current = 0;
+        }
+        return 'socket[' + (SOCKFS.nextname.current++) + ']';
+      },
+  websocket_sock_ops:{
+  createPeer(sock, addr, port) {
+          var ws;
+  
+          if (typeof addr == 'object') {
+            ws = addr;
+            addr = null;
+            port = null;
+          }
+  
+          if (ws) {
+            // for sockets that've already connected (e.g. we're the server)
+            // we can inspect the _socket property for the address
+            if (ws._socket) {
+              addr = ws._socket.remoteAddress;
+              port = ws._socket.remotePort;
+            }
+            // if we're just now initializing a connection to the remote,
+            // inspect the url property
+            else {
+              var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+              if (!result) {
+                throw new Error('WebSocket URL must be in the format ws(s)://address:port');
+              }
+              addr = result[1];
+              port = parseInt(result[2], 10);
+            }
+          } else {
+            // create the actual websocket object and connect
+            try {
+              // runtimeConfig gets set to true if WebSocket runtime configuration is available.
+              var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
+  
+              // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+              // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+              var url = 'ws:#'.replace('#', '//');
+  
+              if (runtimeConfig) {
+                if ('string' === typeof Module['websocket']['url']) {
+                  url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
+                }
+              }
+  
+              if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
+                var parts = addr.split('/');
+                url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
+              }
+  
+              // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+              var subProtocols = 'binary'; // The default value is 'binary'
+  
+              if (runtimeConfig) {
+                if ('string' === typeof Module['websocket']['subprotocol']) {
+                  subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
+                }
+              }
+  
+              // The default WebSocket options
+              var opts = undefined;
+  
+              if (subProtocols !== 'null') {
+                // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+                // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws.
+                subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
+  
+                opts = subProtocols;
+              }
+  
+              // some webservers (azure) does not support subprotocol header
+              if (runtimeConfig && null === Module['websocket']['subprotocol']) {
+                subProtocols = 'null';
+                opts = undefined;
+              }
+  
+              // If node we use the ws library.
+              var WebSocketConstructor;
+              if (ENVIRONMENT_IS_NODE) {
+                WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws'));
+              } else
+              {
+                WebSocketConstructor = WebSocket;
+              }
+              ws = new WebSocketConstructor(url, opts);
+              ws.binaryType = 'arraybuffer';
+            } catch (e) {
+              throw new FS.ErrnoError(23);
+            }
+          }
+  
+          var peer = {
+            addr,
+            port,
+            socket: ws,
+            dgram_send_queue: []
+          };
+  
+          SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+          SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+  
+          // if this is a bound dgram socket, send the port number first to allow
+          // us to override the ephemeral port reported to us by remotePort on the
+          // remote end.
+          if (sock.type === 2 && typeof sock.sport != 'undefined') {
+            peer.dgram_send_queue.push(new Uint8Array([
+                255, 255, 255, 255,
+                'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
+                ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
+            ]));
+          }
+  
+          return peer;
+        },
+  getPeer(sock, addr, port) {
+          return sock.peers[addr + ':' + port];
+        },
+  addPeer(sock, peer) {
+          sock.peers[peer.addr + ':' + peer.port] = peer;
+        },
+  removePeer(sock, peer) {
+          delete sock.peers[peer.addr + ':' + peer.port];
+        },
+  handlePeerEvents(sock, peer) {
+          var first = true;
+  
+          var handleOpen = function () {
+  
+            Module['websocket'].emit('open', sock.stream.fd);
+  
+            try {
+              var queued = peer.dgram_send_queue.shift();
+              while (queued) {
+                peer.socket.send(queued);
+                queued = peer.dgram_send_queue.shift();
+              }
+            } catch (e) {
+              // not much we can do here in the way of proper error handling as we've already
+              // lied and said this data was sent. shut it down.
+              peer.socket.close();
+            }
+          };
+  
+          function handleMessage(data) {
+            if (typeof data == 'string') {
+              var encoder = new TextEncoder(); // should be utf-8
+              data = encoder.encode(data); // make a typed array from the string
+            } else {
+              assert(data.byteLength !== undefined); // must receive an ArrayBuffer
+              if (data.byteLength == 0) {
+                // An empty ArrayBuffer will emit a pseudo disconnect event
+                // as recv/recvmsg will return zero which indicates that a socket
+                // has performed a shutdown although the connection has not been disconnected yet.
+                return;
+              }
+              data = new Uint8Array(data); // make a typed array view on the array buffer
+            }
+  
+            // if this is the port message, override the peer's port with it
+            var wasfirst = first;
+            first = false;
+            if (wasfirst &&
+                data.length === 10 &&
+                data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
+                data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
+              // update the peer's port and it's key in the peer map
+              var newport = ((data[8] << 8) | data[9]);
+              SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+              peer.port = newport;
+              SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+              return;
+            }
+  
+            sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
+            Module['websocket'].emit('message', sock.stream.fd);
+          };
+  
+          if (ENVIRONMENT_IS_NODE) {
+            peer.socket.on('open', handleOpen);
+            peer.socket.on('message', function(data, isBinary) {
+              if (!isBinary) {
+                return;
+              }
+              handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
+            });
+            peer.socket.on('close', function() {
+              Module['websocket'].emit('close', sock.stream.fd);
+            });
+            peer.socket.on('error', function(error) {
+              // Although the ws library may pass errors that may be more descriptive than
+              // ECONNREFUSED they are not necessarily the expected error code e.g.
+              // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+              // is still probably the most useful thing to do.
+              sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+              Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+              // don't throw
+            });
+          } else {
+            peer.socket.onopen = handleOpen;
+            peer.socket.onclose = function() {
+              Module['websocket'].emit('close', sock.stream.fd);
+            };
+            peer.socket.onmessage = function peer_socket_onmessage(event) {
+              handleMessage(event.data);
+            };
+            peer.socket.onerror = function(error) {
+              // The WebSocket spec only allows a 'simple event' to be thrown on error,
+              // so we only really know as much as ECONNREFUSED.
+              sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+              Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+            };
+          }
+        },
+  poll(sock) {
+          if (sock.type === 1 && sock.server) {
+            // listen sockets should only say they're available for reading
+            // if there are pending clients.
+            return sock.pending.length ? (64 | 1) : 0;
+          }
+  
+          var mask = 0;
+          var dest = sock.type === 1 ?  // we only care about the socket state for connection-based sockets
+            SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
+            null;
+  
+          if (sock.recv_queue.length ||
+              !dest ||  // connection-less sockets are always ready to read
+              (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+              (dest && dest.socket.readyState === dest.socket.CLOSED)) {  // let recv return 0 once closed
+            mask |= (64 | 1);
+          }
+  
+          if (!dest ||  // connection-less sockets are always ready to write
+              (dest && dest.socket.readyState === dest.socket.OPEN)) {
+            mask |= 4;
+          }
+  
+          if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
+              (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+            mask |= 16;
+          }
+  
+          return mask;
+        },
+  ioctl(sock, request, arg) {
+          switch (request) {
+            case 21531:
+              var bytes = 0;
+              if (sock.recv_queue.length) {
+                bytes = sock.recv_queue[0].data.length;
+              }
+              HEAP32[((arg)>>2)] = bytes;
+              return 0;
+            default:
+              return 28;
+          }
+        },
+  close(sock) {
+          // if we've spawned a listen server, close it
+          if (sock.server) {
+            try {
+              sock.server.close();
+            } catch (e) {
+            }
+            sock.server = null;
+          }
+          // close any peer connections
+          var peers = Object.keys(sock.peers);
+          for (var i = 0; i < peers.length; i++) {
+            var peer = sock.peers[peers[i]];
+            try {
+              peer.socket.close();
+            } catch (e) {
+            }
+            SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+          }
+          return 0;
+        },
+  bind(sock, addr, port) {
+          if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') {
+            throw new FS.ErrnoError(28);  // already bound
+          }
+          sock.saddr = addr;
+          sock.sport = port;
+          // in order to emulate dgram sockets, we need to launch a listen server when
+          // binding on a connection-less socket
+          // note: this is only required on the server side
+          if (sock.type === 2) {
+            // close the existing server if it exists
+            if (sock.server) {
+              sock.server.close();
+              sock.server = null;
+            }
+            // swallow error operation not supported error that occurs when binding in the
+            // browser where this isn't supported
+            try {
+              sock.sock_ops.listen(sock, 0);
+            } catch (e) {
+              if (!(e.name === 'ErrnoError')) throw e;
+              if (e.errno !== 138) throw e;
+            }
+          }
+        },
+  connect(sock, addr, port) {
+          if (sock.server) {
+            throw new FS.ErrnoError(138);
+          }
+  
+          // TODO autobind
+          // if (!sock.addr && sock.type == 2) {
+          // }
+  
+          // early out if we're already connected / in the middle of connecting
+          if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') {
+            var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+            if (dest) {
+              if (dest.socket.readyState === dest.socket.CONNECTING) {
+                throw new FS.ErrnoError(7);
+              } else {
+                throw new FS.ErrnoError(30);
+              }
+            }
+          }
+  
+          // add the socket to our peer list and set our
+          // destination address / port to match
+          var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+          sock.daddr = peer.addr;
+          sock.dport = peer.port;
+  
+          // always "fail" in non-blocking mode
+          throw new FS.ErrnoError(26);
+        },
+  listen(sock, backlog) {
+          if (!ENVIRONMENT_IS_NODE) {
+            throw new FS.ErrnoError(138);
+          }
+          if (sock.server) {
+             throw new FS.ErrnoError(28);  // already listening
+          }
+          var WebSocketServer = require('ws').Server;
+          var host = sock.saddr;
+          sock.server = new WebSocketServer({
+            host,
+            port: sock.sport
+            // TODO support backlog
+          });
+          Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd.
+  
+          sock.server.on('connection', function(ws) {
+            if (sock.type === 1) {
+              var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
+  
+              // create a peer on the new socket
+              var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
+              newsock.daddr = peer.addr;
+              newsock.dport = peer.port;
+  
+              // push to queue for accept to pick up
+              sock.pending.push(newsock);
+              Module['websocket'].emit('connection', newsock.stream.fd);
+            } else {
+              // create a peer on the listen socket so calling sendto
+              // with the listen socket and an address will resolve
+              // to the correct client
+              SOCKFS.websocket_sock_ops.createPeer(sock, ws);
+              Module['websocket'].emit('connection', sock.stream.fd);
+            }
+          });
+          sock.server.on('close', function() {
+            Module['websocket'].emit('close', sock.stream.fd);
+            sock.server = null;
+          });
+          sock.server.on('error', function(error) {
+            // Although the ws library may pass errors that may be more descriptive than
+            // ECONNREFUSED they are not necessarily the expected error code e.g.
+            // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
+            // is still probably the most useful thing to do. This error shouldn't
+            // occur in a well written app as errors should get trapped in the compiled
+            // app's own getaddrinfo call.
+            sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+            Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']);
+            // don't throw
+          });
+        },
+  accept(listensock) {
+          if (!listensock.server || !listensock.pending.length) {
+            throw new FS.ErrnoError(28);
+          }
+          var newsock = listensock.pending.shift();
+          newsock.stream.flags = listensock.stream.flags;
+          return newsock;
+        },
+  getname(sock, peer) {
+          var addr, port;
+          if (peer) {
+            if (sock.daddr === undefined || sock.dport === undefined) {
+              throw new FS.ErrnoError(53);
+            }
+            addr = sock.daddr;
+            port = sock.dport;
+          } else {
+            // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+            // should we be returning for TCP sockets that've been connect()'d?
+            addr = sock.saddr || 0;
+            port = sock.sport || 0;
+          }
+          return { addr, port };
+        },
+  sendmsg(sock, buffer, offset, length, addr, port) {
+          if (sock.type === 2) {
+            // connection-less sockets will honor the message address,
+            // and otherwise fall back to the bound destination address
+            if (addr === undefined || port === undefined) {
+              addr = sock.daddr;
+              port = sock.dport;
+            }
+            // if there was no address to fall back to, error out
+            if (addr === undefined || port === undefined) {
+              throw new FS.ErrnoError(17);
+            }
+          } else {
+            // connection-based sockets will only use the bound
+            addr = sock.daddr;
+            port = sock.dport;
+          }
+  
+          // find the peer for the destination address
+          var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+  
+          // early out if not connected with a connection-based socket
+          if (sock.type === 1) {
+            if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+              throw new FS.ErrnoError(53);
+            } else if (dest.socket.readyState === dest.socket.CONNECTING) {
+              throw new FS.ErrnoError(6);
+            }
+          }
+  
+          // create a copy of the incoming data to send, as the WebSocket API
+          // doesn't work entirely with an ArrayBufferView, it'll just send
+          // the entire underlying buffer
+          if (ArrayBuffer.isView(buffer)) {
+            offset += buffer.byteOffset;
+            buffer = buffer.buffer;
+          }
+  
+          var data;
+            data = buffer.slice(offset, offset + length);
+  
+          // if we're emulating a connection-less dgram socket and don't have
+          // a cached connection, queue the buffer to send upon connect and
+          // lie, saying the data was sent now.
+          if (sock.type === 2) {
+            if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+              // if we're not connected, open a new connection
+              if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+                dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+              }
+              dest.dgram_send_queue.push(data);
+              return length;
+            }
+          }
+  
+          try {
+            // send the actual data
+            dest.socket.send(data);
+            return length;
+          } catch (e) {
+            throw new FS.ErrnoError(28);
+          }
+        },
+  recvmsg(sock, length) {
+          // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+          if (sock.type === 1 && sock.server) {
+            // tcp servers should not be recv()'ing on the listen socket
+            throw new FS.ErrnoError(53);
+          }
+  
+          var queued = sock.recv_queue.shift();
+          if (!queued) {
+            if (sock.type === 1) {
+              var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+  
+              if (!dest) {
+                // if we have a destination address but are not connected, error out
+                throw new FS.ErrnoError(53);
+              }
+              if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+                // return null if the socket has closed
+                return null;
+              }
+              // else, our socket is in a valid state but truly has nothing available
+              throw new FS.ErrnoError(6);
+            }
+            throw new FS.ErrnoError(6);
+          }
+  
+          // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+          // requeued TCP data it'll be an ArrayBufferView
+          var queuedLength = queued.data.byteLength || queued.data.length;
+          var queuedOffset = queued.data.byteOffset || 0;
+          var queuedBuffer = queued.data.buffer || queued.data;
+          var bytesRead = Math.min(length, queuedLength);
+          var res = {
+            buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+            addr: queued.addr,
+            port: queued.port
+          };
+  
+          // push back any unread data for TCP connections
+          if (sock.type === 1 && bytesRead < queuedLength) {
+            var bytesRemaining = queuedLength - bytesRead;
+            queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+            sock.recv_queue.unshift(queued);
+          }
+  
+          return res;
+        },
+  },
+  };
+  
+  var getSocketFromFD = (fd) => {
+      var socket = SOCKFS.getSocket(fd);
+      if (!socket) throw new FS.ErrnoError(8);
+      return socket;
+    };
+  
+  var setErrNo = (value) => {
+      HEAP32[((___errno_location())>>2)] = value;
+      return value;
+    };
+  var Sockets = {
+  BUFFER_SIZE:10240,
+  MAX_BUFFER_SIZE:10485760,
+  nextFd:1,
+  fds:{
+  },
+  nextport:1,
+  maxport:65535,
+  peer:null,
+  connections:{
+  },
+  portmap:{
+  },
+  localAddr:4261412874,
+  addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034],
+  };
+  
+  var inetPton4 = (str) => {
+      var b = str.split('.');
+      for (var i = 0; i < 4; i++) {
+        var tmp = Number(b[i]);
+        if (isNaN(tmp)) return null;
+        b[i] = tmp;
+      }
+      return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+    };
+  
+  
+  /** @suppress {checkTypes} */
+  var jstoi_q = (str) => parseInt(str);
+  var inetPton6 = (str) => {
+      var words;
+      var w, offset, z, i;
+      /* http://home.deds.nl/~aeron/regex/ */
+      var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
+      var parts = [];
+      if (!valid6regx.test(str)) {
+        return null;
+      }
+      if (str === "::") {
+        return [0, 0, 0, 0, 0, 0, 0, 0];
+      }
+      // Z placeholder to keep track of zeros when splitting the string on ":"
+      if (str.startsWith("::")) {
+        str = str.replace("::", "Z:"); // leading zeros case
+      } else {
+        str = str.replace("::", ":Z:");
+      }
+  
+      if (str.indexOf(".") > 0) {
+        // parse IPv4 embedded stress
+        str = str.replace(new RegExp('[.]', 'g'), ":");
+        words = str.split(":");
+        words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256;
+        words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256;
+        words = words.slice(0, words.length-2);
+      } else {
+        words = str.split(":");
+      }
+  
+      offset = 0; z = 0;
+      for (w=0; w < words.length; w++) {
+        if (typeof words[w] == 'string') {
+          if (words[w] === 'Z') {
+            // compressed zeros - write appropriate number of zero words
+            for (z = 0; z < (8 - words.length+1); z++) {
+              parts[w+z] = 0;
+            }
+            offset = z-1;
+          } else {
+            // parse hex to field to 16-bit value and write it in network byte-order
+            parts[w+offset] = _htons(parseInt(words[w],16));
+          }
+        } else {
+          // parsed IPv4 words
+          parts[w+offset] = words[w];
+        }
+      }
+      return [
+        (parts[1] << 16) | parts[0],
+        (parts[3] << 16) | parts[2],
+        (parts[5] << 16) | parts[4],
+        (parts[7] << 16) | parts[6]
+      ];
+    };
+  
+  
+  /** @param {number=} addrlen */
+  var writeSockaddr = (sa, family, addr, port, addrlen) => {
+      switch (family) {
+        case 2:
+          addr = inetPton4(addr);
+          zeroMemory(sa, 16);
+          if (addrlen) {
+            HEAP32[((addrlen)>>2)] = 16;
+          }
+          HEAP16[((sa)>>1)] = family;
+          HEAP32[(((sa)+(4))>>2)] = addr;
+          HEAP16[(((sa)+(2))>>1)] = _htons(port);
+          break;
+        case 10:
+          addr = inetPton6(addr);
+          zeroMemory(sa, 28);
+          if (addrlen) {
+            HEAP32[((addrlen)>>2)] = 28;
+          }
+          HEAP32[((sa)>>2)] = family;
+          HEAP32[(((sa)+(8))>>2)] = addr[0];
+          HEAP32[(((sa)+(12))>>2)] = addr[1];
+          HEAP32[(((sa)+(16))>>2)] = addr[2];
+          HEAP32[(((sa)+(20))>>2)] = addr[3];
+          HEAP16[(((sa)+(2))>>1)] = _htons(port);
+          break;
+        default:
+          return 5;
+      }
+      return 0;
+    };
+  
+  
+  var DNS = {
+  address_map:{
+  id:1,
+  addrs:{
+  },
+  names:{
+  },
+  },
+  lookup_name(name) {
+        // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+        var res = inetPton4(name);
+        if (res !== null) {
+          return name;
+        }
+        res = inetPton6(name);
+        if (res !== null) {
+          return name;
+        }
+  
+        // See if this name is already mapped.
+        var addr;
+  
+        if (DNS.address_map.addrs[name]) {
+          addr = DNS.address_map.addrs[name];
+        } else {
+          var id = DNS.address_map.id++;
+          assert(id < 65535, 'exceeded max address mappings of 65535');
+  
+          addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
+  
+          DNS.address_map.names[addr] = name;
+          DNS.address_map.addrs[name] = addr;
+        }
+  
+        return addr;
+      },
+  lookup_addr(addr) {
+        if (DNS.address_map.names[addr]) {
+          return DNS.address_map.names[addr];
+        }
+  
+        return null;
+      },
+  };
+  
+  function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      var newsock = sock.sock_ops.accept(sock);
+      if (addr) {
+        var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen);
+        assert(!errno);
+      }
+      return newsock.stream.fd;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  var inetNtop4 = (addr) => {
+      return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
+    };
+  
+  
+  var inetNtop6 = (ints) => {
+      //  ref:  http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+      //  Format for IPv4 compatible and mapped  128-bit IPv6 Addresses
+      //  128-bits are split into eight 16-bit words
+      //  stored in network byte order (big-endian)
+      //  |                80 bits               | 16 |      32 bits        |
+      //  +-----------------------------------------------------------------+
+      //  |               10 bytes               |  2 |      4 bytes        |
+      //  +--------------------------------------+--------------------------+
+      //  +               5 words                |  1 |      2 words        |
+      //  +--------------------------------------+--------------------------+
+      //  |0000..............................0000|0000|    IPv4 ADDRESS     | (compatible)
+      //  +--------------------------------------+----+---------------------+
+      //  |0000..............................0000|FFFF|    IPv4 ADDRESS     | (mapped)
+      //  +--------------------------------------+----+---------------------+
+      var str = "";
+      var word = 0;
+      var longest = 0;
+      var lastzero = 0;
+      var zstart = 0;
+      var len = 0;
+      var i = 0;
+      var parts = [
+        ints[0] & 0xffff,
+        (ints[0] >> 16),
+        ints[1] & 0xffff,
+        (ints[1] >> 16),
+        ints[2] & 0xffff,
+        (ints[2] >> 16),
+        ints[3] & 0xffff,
+        (ints[3] >> 16)
+      ];
+  
+      // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+  
+      var hasipv4 = true;
+      var v4part = "";
+      // check if the 10 high-order bytes are all zeros (first 5 words)
+      for (i = 0; i < 5; i++) {
+        if (parts[i] !== 0) { hasipv4 = false; break; }
+      }
+  
+      if (hasipv4) {
+        // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+        v4part = inetNtop4(parts[6] | (parts[7] << 16));
+        // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+        if (parts[5] === -1) {
+          str = "::ffff:";
+          str += v4part;
+          return str;
+        }
+        // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+        if (parts[5] === 0) {
+          str = "::";
+          //special case IPv6 addresses
+          if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
+          if (v4part === "0.0.0.1") v4part = "1";// loopback address
+          str += v4part;
+          return str;
+        }
+      }
+  
+      // Handle all other IPv6 addresses
+  
+      // first run to find the longest contiguous zero words
+      for (word = 0; word < 8; word++) {
+        if (parts[word] === 0) {
+          if (word - lastzero > 1) {
+            len = 0;
+          }
+          lastzero = word;
+          len++;
+        }
+        if (len > longest) {
+          longest = len;
+          zstart = word - longest + 1;
+        }
+      }
+  
+      for (word = 0; word < 8; word++) {
+        if (longest > 1) {
+          // compress contiguous zeros - to produce "::"
+          if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
+            if (word === zstart) {
+              str += ":";
+              if (zstart === 0) str += ":"; //leading zeros case
+            }
+            continue;
+          }
+        }
+        // converts 16-bit words from big-endian to little-endian before converting to hex string
+        str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
+        str += word < 7 ? ":" : "";
+      }
+      return str;
+    };
+  
+  var readSockaddr = (sa, salen) => {
+      // family / port offsets are common to both sockaddr_in and sockaddr_in6
+      var family = HEAP16[((sa)>>1)];
+      var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]);
+      var addr;
+  
+      switch (family) {
+        case 2:
+          if (salen !== 16) {
+            return { errno: 28 };
+          }
+          addr = HEAP32[(((sa)+(4))>>2)];
+          addr = inetNtop4(addr);
+          break;
+        case 10:
+          if (salen !== 28) {
+            return { errno: 28 };
+          }
+          addr = [
+            HEAP32[(((sa)+(8))>>2)],
+            HEAP32[(((sa)+(12))>>2)],
+            HEAP32[(((sa)+(16))>>2)],
+            HEAP32[(((sa)+(20))>>2)]
+          ];
+          addr = inetNtop6(addr);
+          break;
+        default:
+          return { errno: 5 };
+      }
+  
+      return { family: family, addr: addr, port: port };
+    };
+  
+  
+  /** @param {boolean=} allowNull */
+  var getSocketAddress = (addrp, addrlen, allowNull) => {
+      if (allowNull && addrp === 0) return null;
+      var info = readSockaddr(addrp, addrlen);
+      if (info.errno) throw new FS.ErrnoError(info.errno);
+      info.addr = DNS.lookup_addr(info.addr) || info.addr;
+      return info;
+    };
+  
+  function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      var info = getSocketAddress(addr, addrlen);
+      sock.sock_ops.bind(sock, info.addr, info.port);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_chdir(path) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      FS.chdir(path);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_chmod(path, mode) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      FS.chmod(path, mode);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      var info = getSocketAddress(addr, addrlen);
+      sock.sock_ops.connect(sock, info.addr, info.port);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_dup(fd) {
+  try {
+  
+      var old = SYSCALLS.getStreamFromFD(fd);
+      return FS.createStream(old).fd;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_dup3(fd, newfd, flags) {
+  try {
+  
+      var old = SYSCALLS.getStreamFromFD(fd);
+      assert(!flags);
+      if (old.fd === newfd) return -28;
+      var existing = FS.getStream(newfd);
+      if (existing) FS.close(existing);
+      return FS.createStream(old, newfd).fd;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_faccessat(dirfd, path, amode, flags) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      assert(flags === 0);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      if (amode & ~7) {
+        // need a valid mode
+        return -28;
+      }
+      var lookup = FS.lookupPath(path, { follow: true });
+      var node = lookup.node;
+      if (!node) {
+        return -44;
+      }
+      var perms = '';
+      if (amode & 4) perms += 'r';
+      if (amode & 2) perms += 'w';
+      if (amode & 1) perms += 'x';
+      if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+        return -2;
+      }
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_fchownat(dirfd, path, owner, group, flags) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      var nofollow = flags & 256;
+      flags = flags & (~256);
+      assert(flags === 0);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      (nofollow ? FS.lchown : FS.chown)(path, owner, group);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  function ___syscall_fcntl64(fd, cmd, varargs) {
+  SYSCALLS.varargs = varargs;
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      switch (cmd) {
+        case 0: {
+          var arg = SYSCALLS.get();
+          if (arg < 0) {
+            return -28;
+          }
+          while (FS.streams[arg]) {
+            arg++;
+          }
+          var newStream;
+          newStream = FS.createStream(stream, arg);
+          return newStream.fd;
+        }
+        case 1:
+        case 2:
+          return 0;  // FD_CLOEXEC makes no sense for a single process.
+        case 3:
+          return stream.flags;
+        case 4: {
+          var arg = SYSCALLS.get();
+          stream.flags |= arg;
+          return 0;
+        }
+        case 5: {
+          var arg = SYSCALLS.getp();
+          var offset = 0;
+          // We're always unlocked.
+          HEAP16[(((arg)+(offset))>>1)] = 2;
+          return 0;
+        }
+        case 6:
+        case 7:
+          return 0; // Pretend that the locking is successful.
+        case 16:
+        case 8:
+          return -28; // These are for sockets. We don't have them fully implemented yet.
+        case 9:
+          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves.
+          setErrNo(28);
+          return -1;
+        default: {
+          return -28;
+        }
+      }
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_fdatasync(fd) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_fstat64(fd, buf) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      return SYSCALLS.doStat(FS.stat, stream.path, buf);
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  var convertI32PairToI53Checked = (lo, hi) => {
+      assert(lo == (lo >>> 0) || lo == (lo|0)); // lo should either be a i32 or a u32
+      assert(hi === (hi|0));                    // hi should be a i32
+      return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN;
+    };
+  function ___syscall_ftruncate64(fd,length_low, length_high) {
+    var length = convertI32PairToI53Checked(length_low, length_high);;
+  
+    
+  try {
+  
+      if (isNaN(length)) return 61;
+      FS.ftruncate(fd, length);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  ;
+  }
+
+  
+  var stringToUTF8 = (str, outPtr, maxBytesToWrite) => {
+      assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+      return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
+    };
+  
+  function ___syscall_getcwd(buf, size) {
+  try {
+  
+      if (size === 0) return -28;
+      var cwd = FS.cwd();
+      var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
+      if (size < cwdLengthInBytes) return -68;
+      stringToUTF8(cwd, buf, size);
+      return cwdLengthInBytes;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  function ___syscall_getdents64(fd, dirp, count) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd)
+      if (!stream.getdents) {
+        stream.getdents = FS.readdir(stream.path);
+      }
+  
+      var struct_size = 280;
+      var pos = 0;
+      var off = FS.llseek(stream, 0, 1);
+  
+      var idx = Math.floor(off / struct_size);
+  
+      while (idx < stream.getdents.length && pos + struct_size <= count) {
+        var id;
+        var type;
+        var name = stream.getdents[idx];
+        if (name === '.') {
+          id = stream.node.id;
+          type = 4; // DT_DIR
+        }
+        else if (name === '..') {
+          var lookup = FS.lookupPath(stream.path, { parent: true });
+          id = lookup.node.id;
+          type = 4; // DT_DIR
+        }
+        else {
+          var child = FS.lookupNode(stream.node, name);
+          id = child.id;
+          type = FS.isChrdev(child.mode) ? 2 :  // DT_CHR, character device.
+                 FS.isDir(child.mode) ? 4 :     // DT_DIR, directory.
+                 FS.isLink(child.mode) ? 10 :   // DT_LNK, symbolic link.
+                 8;                             // DT_REG, regular file.
+        }
+        assert(id);
+        (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]);
+        (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]);
+        HEAP16[(((dirp + pos)+(16))>>1)] = 280;
+        HEAP8[(((dirp + pos)+(18))>>0)] = type;
+        stringToUTF8(name, dirp + pos + 19, 256);
+        pos += struct_size;
+        idx += 1;
+      }
+      FS.llseek(stream, idx * struct_size, 0);
+      return pos;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  
+  function ___syscall_getpeername(fd, addr, addrlen, d1, d2, d3) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      if (!sock.daddr) {
+        return -53; // The socket is not connected.
+      }
+      var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport, addrlen);
+      assert(!errno);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  
+  function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname
+      var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport, addrlen);
+      assert(!errno);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211
+      // so only supports SOL_SOCKET with SO_ERROR.
+      if (level === 1) {
+        if (optname === 4) {
+          HEAP32[((optval)>>2)] = sock.error;
+          HEAP32[((optlen)>>2)] = 4;
+          sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field).
+          return 0;
+        }
+      }
+      return -50; // The option is unknown at the level indicated.
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_ioctl(fd, op, varargs) {
+  SYSCALLS.varargs = varargs;
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      switch (op) {
+        case 21509: {
+          if (!stream.tty) return -59;
+          return 0;
+        }
+        case 21505: {
+          if (!stream.tty) return -59;
+          if (stream.tty.ops.ioctl_tcgets) {
+            var termios = stream.tty.ops.ioctl_tcgets(stream);
+            var argp = SYSCALLS.getp();
+            HEAP32[((argp)>>2)] = termios.c_iflag || 0;
+            HEAP32[(((argp)+(4))>>2)] = termios.c_oflag || 0;
+            HEAP32[(((argp)+(8))>>2)] = termios.c_cflag || 0;
+            HEAP32[(((argp)+(12))>>2)] = termios.c_lflag || 0;
+            for (var i = 0; i < 32; i++) {
+              HEAP8[(((argp + i)+(17))>>0)] = termios.c_cc[i] || 0;
+            }
+            return 0;
+          }
+          return 0;
+        }
+        case 21510:
+        case 21511:
+        case 21512: {
+          if (!stream.tty) return -59;
+          return 0; // no-op, not actually adjusting terminal settings
+        }
+        case 21506:
+        case 21507:
+        case 21508: {
+          if (!stream.tty) return -59;
+          if (stream.tty.ops.ioctl_tcsets) {
+            var argp = SYSCALLS.getp();
+            var c_iflag = HEAP32[((argp)>>2)];
+            var c_oflag = HEAP32[(((argp)+(4))>>2)];
+            var c_cflag = HEAP32[(((argp)+(8))>>2)];
+            var c_lflag = HEAP32[(((argp)+(12))>>2)];
+            var c_cc = []
+            for (var i = 0; i < 32; i++) {
+              c_cc.push(HEAP8[(((argp + i)+(17))>>0)]);
+            }
+            return stream.tty.ops.ioctl_tcsets(stream.tty, op, { c_iflag, c_oflag, c_cflag, c_lflag, c_cc });
+          }
+          return 0; // no-op, not actually adjusting terminal settings
+        }
+        case 21519: {
+          if (!stream.tty) return -59;
+          var argp = SYSCALLS.getp();
+          HEAP32[((argp)>>2)] = 0;
+          return 0;
+        }
+        case 21520: {
+          if (!stream.tty) return -59;
+          return -28; // not supported
+        }
+        case 21531: {
+          var argp = SYSCALLS.getp();
+          return FS.ioctl(stream, op, argp);
+        }
+        case 21523: {
+          // TODO: in theory we should write to the winsize struct that gets
+          // passed in, but for now musl doesn't read anything on it
+          if (!stream.tty) return -59;
+          if (stream.tty.ops.ioctl_tiocgwinsz) {
+            var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
+            var argp = SYSCALLS.getp();
+            HEAP16[((argp)>>1)] = winsize[0];
+            HEAP16[(((argp)+(2))>>1)] = winsize[1];
+          }
+          return 0;
+        }
+        case 21524: {
+          // TODO: technically, this ioctl call should change the window size.
+          // but, since emscripten doesn't have any concept of a terminal window
+          // yet, we'll just silently throw it away as we do TIOCGWINSZ
+          if (!stream.tty) return -59;
+          return 0;
+        }
+        case 21515: {
+          if (!stream.tty) return -59;
+          return 0;
+        }
+        default: return -28; // not supported
+      }
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  function ___syscall_listen(fd, backlog) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      sock.sock_ops.listen(sock, backlog);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_lstat64(path, buf) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      return SYSCALLS.doStat(FS.lstat, path, buf);
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_mkdirat(dirfd, path, mode) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      // remove a trailing slash, if one - /a/b/ has basename of '', but
+      // we want to create b in the context of this function
+      path = PATH.normalize(path);
+      if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+      FS.mkdir(path, mode, 0);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_newfstatat(dirfd, path, buf, flags) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      var nofollow = flags & 256;
+      var allowEmpty = flags & 4096;
+      flags = flags & (~6400);
+      assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`);
+      path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+      return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_openat(dirfd, path, flags, varargs) {
+  SYSCALLS.varargs = varargs;
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      var mode = varargs ? SYSCALLS.get() : 0;
+      return FS.open(path, flags, mode).fd;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  var PIPEFS = {
+  BUCKET_BUFFER_SIZE:8192,
+  mount(mount) {
+        // Do not pollute the real root directory or its child nodes with pipes
+        // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way
+        return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+      },
+  createPipe() {
+        var pipe = {
+          buckets: [],
+          // refcnt 2 because pipe has a read end and a write end. We need to be
+          // able to read from the read end after write end is closed.
+          refcnt : 2,
+        };
+  
+        pipe.buckets.push({
+          buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+          offset: 0,
+          roffset: 0
+        });
+  
+        var rName = PIPEFS.nextname();
+        var wName = PIPEFS.nextname();
+        var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
+        var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
+  
+        rNode.pipe = pipe;
+        wNode.pipe = pipe;
+  
+        var readableStream = FS.createStream({
+          path: rName,
+          node: rNode,
+          flags: 0,
+          seekable: false,
+          stream_ops: PIPEFS.stream_ops
+        });
+        rNode.stream = readableStream;
+  
+        var writableStream = FS.createStream({
+          path: wName,
+          node: wNode,
+          flags: 1,
+          seekable: false,
+          stream_ops: PIPEFS.stream_ops
+        });
+        wNode.stream = writableStream;
+  
+        return {
+          readable_fd: readableStream.fd,
+          writable_fd: writableStream.fd
+        };
+      },
+  stream_ops:{
+  poll(stream) {
+          var pipe = stream.node.pipe;
+  
+          if ((stream.flags & 2097155) === 1) {
+            return (256 | 4);
+          }
+          if (pipe.buckets.length > 0) {
+            for (var i = 0; i < pipe.buckets.length; i++) {
+              var bucket = pipe.buckets[i];
+              if (bucket.offset - bucket.roffset > 0) {
+                return (64 | 1);
+              }
+            }
+          }
+  
+          return 0;
+        },
+  ioctl(stream, request, varargs) {
+          return 28;
+        },
+  fsync(stream) {
+          return 28;
+        },
+  read(stream, buffer, offset, length, position /* ignored */) {
+          var pipe = stream.node.pipe;
+          var currentLength = 0;
+  
+          for (var i = 0; i < pipe.buckets.length; i++) {
+            var bucket = pipe.buckets[i];
+            currentLength += bucket.offset - bucket.roffset;
+          }
+  
+          assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+          var data = buffer.subarray(offset, offset + length);
+  
+          if (length <= 0) {
+            return 0;
+          }
+          if (currentLength == 0) {
+            // Behave as if the read end is always non-blocking
+            throw new FS.ErrnoError(6);
+          }
+          var toRead = Math.min(currentLength, length);
+  
+          var totalRead = toRead;
+          var toRemove = 0;
+  
+          for (var i = 0; i < pipe.buckets.length; i++) {
+            var currBucket = pipe.buckets[i];
+            var bucketSize = currBucket.offset - currBucket.roffset;
+  
+            if (toRead <= bucketSize) {
+              var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+              if (toRead < bucketSize) {
+                tmpSlice = tmpSlice.subarray(0, toRead);
+                currBucket.roffset += toRead;
+              } else {
+                toRemove++;
+              }
+              data.set(tmpSlice);
+              break;
+            } else {
+              var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+              data.set(tmpSlice);
+              data = data.subarray(tmpSlice.byteLength);
+              toRead -= tmpSlice.byteLength;
+              toRemove++;
+            }
+          }
+  
+          if (toRemove && toRemove == pipe.buckets.length) {
+            // Do not generate excessive garbage in use cases such as
+            // write several bytes, read everything, write several bytes, read everything...
+            toRemove--;
+            pipe.buckets[toRemove].offset = 0;
+            pipe.buckets[toRemove].roffset = 0;
+          }
+  
+          pipe.buckets.splice(0, toRemove);
+  
+          return totalRead;
+        },
+  write(stream, buffer, offset, length, position /* ignored */) {
+          var pipe = stream.node.pipe;
+  
+          assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+          var data = buffer.subarray(offset, offset + length);
+  
+          var dataLen = data.byteLength;
+          if (dataLen <= 0) {
+            return 0;
+          }
+  
+          var currBucket = null;
+  
+          if (pipe.buckets.length == 0) {
+            currBucket = {
+              buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+              offset: 0,
+              roffset: 0
+            };
+            pipe.buckets.push(currBucket);
+          } else {
+            currBucket = pipe.buckets[pipe.buckets.length - 1];
+          }
+  
+          assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
+  
+          var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
+          if (freeBytesInCurrBuffer >= dataLen) {
+            currBucket.buffer.set(data, currBucket.offset);
+            currBucket.offset += dataLen;
+            return dataLen;
+          } else if (freeBytesInCurrBuffer > 0) {
+            currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset);
+            currBucket.offset += freeBytesInCurrBuffer;
+            data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
+          }
+  
+          var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
+          var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
+  
+          for (var i = 0; i < numBuckets; i++) {
+            var newBucket = {
+              buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+              offset: PIPEFS.BUCKET_BUFFER_SIZE,
+              roffset: 0
+            };
+            pipe.buckets.push(newBucket);
+            newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
+            data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
+          }
+  
+          if (remElements > 0) {
+            var newBucket = {
+              buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+              offset: data.byteLength,
+              roffset: 0
+            };
+            pipe.buckets.push(newBucket);
+            newBucket.buffer.set(data);
+          }
+  
+          return dataLen;
+        },
+  close(stream) {
+          var pipe = stream.node.pipe;
+          pipe.refcnt--;
+          if (pipe.refcnt === 0) {
+            pipe.buckets = null;
+          }
+        },
+  },
+  nextname() {
+        if (!PIPEFS.nextname.current) {
+          PIPEFS.nextname.current = 0;
+        }
+        return 'pipe[' + (PIPEFS.nextname.current++) + ']';
+      },
+  };
+  
+  function ___syscall_pipe(fdPtr) {
+  try {
+  
+      if (fdPtr == 0) {
+        throw new FS.ErrnoError(21);
+      }
+  
+      var res = PIPEFS.createPipe();
+  
+      HEAP32[((fdPtr)>>2)] = res.readable_fd;
+      HEAP32[(((fdPtr)+(4))>>2)] = res.writable_fd;
+  
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_poll(fds, nfds, timeout) {
+  try {
+  
+      var nonzero = 0;
+      for (var i = 0; i < nfds; i++) {
+        var pollfd = fds + 8 * i;
+        var fd = HEAP32[((pollfd)>>2)];
+        var events = HEAP16[(((pollfd)+(4))>>1)];
+        var mask = 32;
+        var stream = FS.getStream(fd);
+        if (stream) {
+          mask = SYSCALLS.DEFAULT_POLLMASK;
+          if (stream.stream_ops.poll) {
+            mask = stream.stream_ops.poll(stream, -1);
+          }
+        }
+        mask &= events | 8 | 16;
+        if (mask) nonzero++;
+        HEAP16[(((pollfd)+(6))>>1)] = mask;
+      }
+      return nonzero;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      if (bufsize <= 0) return -28;
+      var ret = FS.readlink(path);
+  
+      var len = Math.min(bufsize, lengthBytesUTF8(ret));
+      var endChar = HEAP8[buf+len];
+      stringToUTF8(ret, buf, bufsize+1);
+      // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+      // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+      HEAP8[buf+len] = endChar;
+      return len;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  
+  function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      var msg = sock.sock_ops.recvmsg(sock, len);
+      if (!msg) return 0; // socket is closed
+      if (addr) {
+        var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
+        assert(!errno);
+      }
+      HEAPU8.set(msg.buffer, buf);
+      return msg.buffer.byteLength;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+  try {
+  
+      oldpath = SYSCALLS.getStr(oldpath);
+      newpath = SYSCALLS.getStr(newpath);
+      oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+      newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+      FS.rename(oldpath, newpath);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_rmdir(path) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      FS.rmdir(path);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  
+  function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+  try {
+  
+      var sock = getSocketFromFD(fd);
+      var dest = getSocketAddress(addr, addr_len, true);
+      if (!dest) {
+        // send, no address provided
+        return FS.write(sock.stream, HEAP8, message, length);
+      }
+      // sendto an address
+      return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port);
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  
+  function ___syscall_socket(domain, type, protocol) {
+  try {
+  
+      var sock = SOCKFS.createSocket(domain, type, protocol);
+      assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63
+      return sock.stream.fd;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_stat64(path, buf) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      return SYSCALLS.doStat(FS.stat, path, buf);
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_statfs64(path, size, buf) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      assert(size === 64);
+      // NOTE: None of the constants here are true. We're just returning safe and
+      //       sane values.
+      HEAP32[(((buf)+(4))>>2)] = 4096;
+      HEAP32[(((buf)+(40))>>2)] = 4096;
+      HEAP32[(((buf)+(8))>>2)] = 1000000;
+      HEAP32[(((buf)+(12))>>2)] = 500000;
+      HEAP32[(((buf)+(16))>>2)] = 500000;
+      HEAP32[(((buf)+(20))>>2)] = FS.nextInode;
+      HEAP32[(((buf)+(24))>>2)] = 1000000;
+      HEAP32[(((buf)+(28))>>2)] = 42;
+      HEAP32[(((buf)+(44))>>2)] = 2;  // ST_NOSUID
+      HEAP32[(((buf)+(36))>>2)] = 255;
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_symlink(target, linkpath) {
+  try {
+  
+      target = SYSCALLS.getStr(target);
+      linkpath = SYSCALLS.getStr(linkpath);
+      FS.symlink(target, linkpath);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  function ___syscall_unlinkat(dirfd, path, flags) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      path = SYSCALLS.calculateAt(dirfd, path);
+      if (flags === 0) {
+        FS.unlink(path);
+      } else if (flags === 512) {
+        FS.rmdir(path);
+      } else {
+        abort('Invalid flags passed to unlinkat');
+      }
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  var readI53FromI64 = (ptr) => {
+      return HEAPU32[((ptr)>>2)] + HEAP32[(((ptr)+(4))>>2)] * 4294967296;
+    };
+  
+  function ___syscall_utimensat(dirfd, path, times, flags) {
+  try {
+  
+      path = SYSCALLS.getStr(path);
+      assert(flags === 0);
+      path = SYSCALLS.calculateAt(dirfd, path, true);
+      if (!times) {
+        var atime = Date.now();
+        var mtime = atime;
+      } else {
+        var seconds = readI53FromI64(times);
+        var nanoseconds = HEAP32[(((times)+(8))>>2)];
+        atime = (seconds*1000) + (nanoseconds/(1000*1000));
+        times += 16;
+        seconds = readI53FromI64(times);
+        nanoseconds = HEAP32[(((times)+(8))>>2)];
+        mtime = (seconds*1000) + (nanoseconds/(1000*1000));
+      }
+      FS.utime(path, atime, mtime);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  }
+
+  var nowIsMonotonic = true;;
+  var __emscripten_get_now_is_monotonic = () => nowIsMonotonic;
+
+  var __emscripten_throw_longjmp = () => {
+      throw Infinity;
+    };
+
+  function __gmtime_js(time_low, time_high,tmPtr) {
+    var time = convertI32PairToI53Checked(time_low, time_high);;
+  
+    
+      var date = new Date(time * 1000);
+      HEAP32[((tmPtr)>>2)] = date.getUTCSeconds();
+      HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes();
+      HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours();
+      HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate();
+      HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth();
+      HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900;
+      HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay();
+      var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
+      var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0;
+      HEAP32[(((tmPtr)+(28))>>2)] = yday;
+    ;
+  }
+
+  var isLeapYear = (year) => {
+        return year%4 === 0 && (year%100 !== 0 || year%400 === 0);
+    };
+  
+  var MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335];
+  
+  var MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334];
+  var ydayFromDate = (date) => {
+      var leap = isLeapYear(date.getFullYear());
+      var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE);
+      var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1
+  
+      return yday;
+    };
+  
+  function __localtime_js(time_low, time_high,tmPtr) {
+    var time = convertI32PairToI53Checked(time_low, time_high);;
+  
+    
+      var date = new Date(time*1000);
+      HEAP32[((tmPtr)>>2)] = date.getSeconds();
+      HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
+      HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
+      HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
+      HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
+      HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900;
+      HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
+  
+      var yday = ydayFromDate(date)|0;
+      HEAP32[(((tmPtr)+(28))>>2)] = yday;
+      HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60);
+  
+      // Attention: DST is in December in South, and some regions don't have DST at all.
+      var start = new Date(date.getFullYear(), 0, 1);
+      var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+      var winterOffset = start.getTimezoneOffset();
+      var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0;
+      HEAP32[(((tmPtr)+(32))>>2)] = dst;
+    ;
+  }
+
+  
+  
+  var __mktime_js = function(tmPtr) {
+  
+    var ret = (() => { 
+      var date = new Date(HEAP32[(((tmPtr)+(20))>>2)] + 1900,
+                          HEAP32[(((tmPtr)+(16))>>2)],
+                          HEAP32[(((tmPtr)+(12))>>2)],
+                          HEAP32[(((tmPtr)+(8))>>2)],
+                          HEAP32[(((tmPtr)+(4))>>2)],
+                          HEAP32[((tmPtr)>>2)],
+                          0);
+  
+      // There's an ambiguous hour when the time goes back; the tm_isdst field is
+      // used to disambiguate it.  Date() basically guesses, so we fix it up if it
+      // guessed wrong, or fill in tm_isdst with the guess if it's -1.
+      var dst = HEAP32[(((tmPtr)+(32))>>2)];
+      var guessedOffset = date.getTimezoneOffset();
+      var start = new Date(date.getFullYear(), 0, 1);
+      var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+      var winterOffset = start.getTimezoneOffset();
+      var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South
+      if (dst < 0) {
+        // Attention: some regions don't have DST at all.
+        HEAP32[(((tmPtr)+(32))>>2)] = Number(summerOffset != winterOffset && dstOffset == guessedOffset);
+      } else if ((dst > 0) != (dstOffset == guessedOffset)) {
+        var nonDstOffset = Math.max(winterOffset, summerOffset);
+        var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
+        // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up.
+        date.setTime(date.getTime() + (trueOffset - guessedOffset)*60000);
+      }
+  
+      HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
+      var yday = ydayFromDate(date)|0;
+      HEAP32[(((tmPtr)+(28))>>2)] = yday;
+      // To match expected behavior, update fields from date
+      HEAP32[((tmPtr)>>2)] = date.getSeconds();
+      HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
+      HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
+      HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
+      HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
+      HEAP32[(((tmPtr)+(20))>>2)] = date.getYear();
+  
+      return date.getTime() / 1000;
+     })();
+    return (setTempRet0((tempDouble=ret,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)), ret>>>0);
+  };
+
+  
+  
+  
+  
+  
+  function __mmap_js(len,prot,flags,fd,offset_low, offset_high,allocated,addr) {
+    var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+  
+    
+  try {
+  
+      if (isNaN(offset)) return 61;
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      var res = FS.mmap(stream, len, offset, prot, flags);
+      var ptr = res.ptr;
+      HEAP32[((allocated)>>2)] = res.allocated;
+      HEAPU32[((addr)>>2)] = ptr;
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  ;
+  }
+
+  
+  
+  
+  function __munmap_js(addr,len,prot,flags,fd,offset_low, offset_high) {
+    var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+  
+    
+  try {
+  
+      if (isNaN(offset)) return 61;
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      if (prot & 2) {
+        SYSCALLS.doMsync(addr, stream, len, flags, offset);
+      }
+      FS.munmap(stream);
+      // implicitly return 0
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return -e.errno;
+  }
+  ;
+  }
+
+  var timers = {
+  };
+  
+  var handleException = (e) => {
+      // Certain exception types we do not treat as errors since they are used for
+      // internal control flow.
+      // 1. ExitStatus, which is thrown by exit()
+      // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
+      //    that wish to return to JS event loop.
+      if (e instanceof ExitStatus || e == 'unwind') {
+        return EXITSTATUS;
+      }
+      checkStackCookie();
+      if (e instanceof WebAssembly.RuntimeError) {
+        if (_emscripten_stack_get_current() <= 0) {
+          err('Stack overflow detected.  You can try increasing -sSTACK_SIZE (currently set to 65536)');
+        }
+      }
+      quit_(1, e);
+    };
+  
+  
+  var _proc_exit = (code) => {
+      EXITSTATUS = code;
+      if (!keepRuntimeAlive()) {
+        if (Module['onExit']) Module['onExit'](code);
+        ABORT = true;
+      }
+      quit_(code, new ExitStatus(code));
+    };
+  /** @suppress {duplicate } */
+  /** @param {boolean|number=} implicit */
+  var exitJS = (status, implicit) => {
+      EXITSTATUS = status;
+  
+      checkUnflushedContent();
+  
+      // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down
+      if (keepRuntimeAlive() && !implicit) {
+        var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`;
+        readyPromiseReject(msg);
+        err(msg);
+      }
+  
+      _proc_exit(status);
+    };
+  var _exit = exitJS;
+  
+  var maybeExit = () => {
+      if (!keepRuntimeAlive()) {
+        try {
+          _exit(EXITSTATUS);
+        } catch (e) {
+          handleException(e);
+        }
+      }
+    };
+  var callUserCallback = (func) => {
+      if (ABORT) {
+        err('user callback triggered after runtime exited or application aborted.  Ignoring.');
+        return;
+      }
+      try {
+        func();
+        maybeExit();
+      } catch (e) {
+        handleException(e);
+      }
+    };
+  
+  
+  var _emscripten_get_now;
+      // Modern environment where performance.now() is supported:
+      // N.B. a shorter form "_emscripten_get_now = performance.now;" is
+      // unfortunately not allowed even in current browsers (e.g. FF Nightly 75).
+      _emscripten_get_now = () => performance.now();
+  ;
+  var __setitimer_js = (which, timeout_ms) => {
+      // First, clear any existing timer.
+      if (timers[which]) {
+        clearTimeout(timers[which].id);
+        delete timers[which];
+      }
+  
+      // A timeout of zero simply cancels the current timeout so we have nothing
+      // more to do.
+      if (!timeout_ms) return 0;
+  
+      var id = setTimeout(() => {
+        assert(which in timers);
+        delete timers[which];
+        callUserCallback(() => __emscripten_timeout(which, _emscripten_get_now()));
+      }, timeout_ms);
+      timers[which] = { id, timeout_ms };
+      return 0;
+    };
+
+  
+  
+  var stringToNewUTF8 = (str) => {
+      var size = lengthBytesUTF8(str) + 1;
+      var ret = _malloc(size);
+      if (ret) stringToUTF8(str, ret, size);
+      return ret;
+    };
+  var __tzset_js = (timezone, daylight, tzname) => {
+      // TODO: Use (malleable) environment variables instead of system settings.
+      var currentYear = new Date().getFullYear();
+      var winter = new Date(currentYear, 0, 1);
+      var summer = new Date(currentYear, 6, 1);
+      var winterOffset = winter.getTimezoneOffset();
+      var summerOffset = summer.getTimezoneOffset();
+  
+      // Local standard timezone offset. Local standard time is not adjusted for daylight savings.
+      // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST).
+      // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST).
+      var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+  
+      // timezone is specified as seconds west of UTC ("The external variable
+      // `timezone` shall be set to the difference, in seconds, between
+      // Coordinated Universal Time (UTC) and local standard time."), the same
+      // as returned by stdTimezoneOffset.
+      // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
+      HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60;
+  
+      HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset);
+  
+      function extractZone(date) {
+        var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
+        return match ? match[1] : "GMT";
+      };
+      var winterName = extractZone(winter);
+      var summerName = extractZone(summer);
+      var winterNamePtr = stringToNewUTF8(winterName);
+      var summerNamePtr = stringToNewUTF8(summerName);
+      if (summerOffset < winterOffset) {
+        // Northern hemisphere
+        HEAPU32[((tzname)>>2)] = winterNamePtr;
+        HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr;
+      } else {
+        HEAPU32[((tzname)>>2)] = summerNamePtr;
+        HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr;
+      }
+    };
+
+  var _abort = () => {
+      abort('native code called abort()');
+    };
+
+  var _emscripten_date_now = () => Date.now();
+
+  var _emscripten_err = (str) => err(UTF8ToString(str));
+
+  var getHeapMax = () =>
+      HEAPU8.length;
+  var _emscripten_get_heap_max = () => getHeapMax();
+
+
+  var _emscripten_memcpy_js = (dest, src, num) => HEAPU8.copyWithin(dest, src, src + num);
+
+  
+  var abortOnCannotGrowMemory = (requestedSize) => {
+      abort(`Cannot enlarge memory arrays to size ${requestedSize} bytes (OOM). Either (1) compile with -sINITIAL_MEMORY=X with X higher than the current value ${HEAP8.length}, (2) compile with -sALLOW_MEMORY_GROWTH which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -sABORTING_MALLOC=0`);
+    };
+  var _emscripten_resize_heap = (requestedSize) => {
+      var oldSize = HEAPU8.length;
+      // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+      requestedSize >>>= 0;
+      abortOnCannotGrowMemory(requestedSize);
+    };
+
+  var ENV = {
+  };
+  
+  var getExecutableName = () => {
+      return thisProgram || './this.program';
+    };
+  var getEnvStrings = () => {
+      if (!getEnvStrings.strings) {
+        // Default values.
+        // Browser language detection #8751
+        var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8';
+        var env = {
+          'USER': 'web_user',
+          'LOGNAME': 'web_user',
+          'PATH': '/',
+          'PWD': '/',
+          'HOME': '/home/web_user',
+          'LANG': lang,
+          '_': getExecutableName()
+        };
+        // Apply the user-provided values, if any.
+        for (var x in ENV) {
+          // x is a key in ENV; if ENV[x] is undefined, that means it was
+          // explicitly set to be so. We allow user code to do that to
+          // force variables with default values to remain unset.
+          if (ENV[x] === undefined) delete env[x];
+          else env[x] = ENV[x];
+        }
+        var strings = [];
+        for (var x in env) {
+          strings.push(`${x}=${env[x]}`);
+        }
+        getEnvStrings.strings = strings;
+      }
+      return getEnvStrings.strings;
+    };
+  
+  var stringToAscii = (str, buffer) => {
+      for (var i = 0; i < str.length; ++i) {
+        assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff));
+        HEAP8[((buffer++)>>0)] = str.charCodeAt(i);
+      }
+      // Null-terminate the string
+      HEAP8[((buffer)>>0)] = 0;
+    };
+  
+  var _environ_get = (__environ, environ_buf) => {
+      var bufSize = 0;
+      getEnvStrings().forEach((string, i) => {
+        var ptr = environ_buf + bufSize;
+        HEAPU32[(((__environ)+(i*4))>>2)] = ptr;
+        stringToAscii(string, ptr);
+        bufSize += string.length + 1;
+      });
+      return 0;
+    };
+
+  
+  var _environ_sizes_get = (penviron_count, penviron_buf_size) => {
+      var strings = getEnvStrings();
+      HEAPU32[((penviron_count)>>2)] = strings.length;
+      var bufSize = 0;
+      strings.forEach((string) => bufSize += string.length + 1);
+      HEAPU32[((penviron_buf_size)>>2)] = bufSize;
+      return 0;
+    };
+
+
+  function _fd_close(fd) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      FS.close(stream);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  }
+
+  function _fd_fdstat_get(fd, pbuf) {
+  try {
+  
+      var rightsBase = 0;
+      var rightsInheriting = 0;
+      var flags = 0;
+      {
+        var stream = SYSCALLS.getStreamFromFD(fd);
+        // All character devices are terminals (other things a Linux system would
+        // assume is a character device, like the mouse, we have special APIs for).
+        var type = stream.tty ? 2 :
+                   FS.isDir(stream.mode) ? 3 :
+                   FS.isLink(stream.mode) ? 7 :
+                   4;
+      }
+      HEAP8[((pbuf)>>0)] = type;
+      HEAP16[(((pbuf)+(2))>>1)] = flags;
+      (tempI64 = [rightsBase>>>0,(tempDouble=rightsBase,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]);
+      (tempI64 = [rightsInheriting>>>0,(tempDouble=rightsInheriting,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]);
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  }
+
+  /** @param {number=} offset */
+  var doReadv = (stream, iov, iovcnt, offset) => {
+      var ret = 0;
+      for (var i = 0; i < iovcnt; i++) {
+        var ptr = HEAPU32[((iov)>>2)];
+        var len = HEAPU32[(((iov)+(4))>>2)];
+        iov += 8;
+        var curr = FS.read(stream, HEAP8, ptr, len, offset);
+        if (curr < 0) return -1;
+        ret += curr;
+        if (curr < len) break; // nothing more to read
+        if (typeof offset !== 'undefined') {
+          offset += curr;
+        }
+      }
+      return ret;
+    };
+  
+  function _fd_read(fd, iov, iovcnt, pnum) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      var num = doReadv(stream, iov, iovcnt);
+      HEAPU32[((pnum)>>2)] = num;
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  }
+
+  
+  function _fd_seek(fd,offset_low, offset_high,whence,newOffset) {
+    var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+  
+    
+  try {
+  
+      if (isNaN(offset)) return 61;
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      FS.llseek(stream, offset, whence);
+      (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]);
+      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  ;
+  }
+
+  function _fd_sync(fd) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      if (stream.stream_ops && stream.stream_ops.fsync) {
+        return stream.stream_ops.fsync(stream);
+      }
+      return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  }
+
+  /** @param {number=} offset */
+  var doWritev = (stream, iov, iovcnt, offset) => {
+      var ret = 0;
+      for (var i = 0; i < iovcnt; i++) {
+        var ptr = HEAPU32[((iov)>>2)];
+        var len = HEAPU32[(((iov)+(4))>>2)];
+        iov += 8;
+        var curr = FS.write(stream, HEAP8, ptr, len, offset);
+        if (curr < 0) return -1;
+        ret += curr;
+        if (typeof offset !== 'undefined') {
+          offset += curr;
+        }
+      }
+      return ret;
+    };
+  
+  function _fd_write(fd, iov, iovcnt, pnum) {
+  try {
+  
+      var stream = SYSCALLS.getStreamFromFD(fd);
+      var num = doWritev(stream, iov, iovcnt);
+      HEAPU32[((pnum)>>2)] = num;
+      return 0;
+    } catch (e) {
+    if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+    return e.errno;
+  }
+  }
+
+  
+  
+  
+  
+  
+  
+  
+  
+  
+  var _getaddrinfo = (node, service, hint, out) => {
+      // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL
+      // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we
+      // really should provide a linked list of suitable addrinfo values.
+      var addrs = [];
+      var canon = null;
+      var addr = 0;
+      var port = 0;
+      var flags = 0;
+      var family = 0;
+      var type = 0;
+      var proto = 0;
+      var ai, last;
+  
+      function allocaddrinfo(family, type, proto, canon, addr, port) {
+        var sa, salen, ai;
+        var errno;
+  
+        salen = family === 10 ?
+          28 :
+          16;
+        addr = family === 10 ?
+          inetNtop6(addr) :
+          inetNtop4(addr);
+        sa = _malloc(salen);
+        errno = writeSockaddr(sa, family, addr, port);
+        assert(!errno);
+  
+        ai = _malloc(32);
+        HEAP32[(((ai)+(4))>>2)] = family;
+        HEAP32[(((ai)+(8))>>2)] = type;
+        HEAP32[(((ai)+(12))>>2)] = proto;
+        HEAPU32[(((ai)+(24))>>2)] = canon;
+        HEAPU32[(((ai)+(20))>>2)] = sa;
+        if (family === 10) {
+          HEAP32[(((ai)+(16))>>2)] = 28;
+        } else {
+          HEAP32[(((ai)+(16))>>2)] = 16;
+        }
+        HEAP32[(((ai)+(28))>>2)] = 0;
+  
+        return ai;
+      }
+  
+      if (hint) {
+        flags = HEAP32[((hint)>>2)];
+        family = HEAP32[(((hint)+(4))>>2)];
+        type = HEAP32[(((hint)+(8))>>2)];
+        proto = HEAP32[(((hint)+(12))>>2)];
+      }
+      if (type && !proto) {
+        proto = type === 2 ? 17 : 6;
+      }
+      if (!type && proto) {
+        type = proto === 17 ? 2 : 1;
+      }
+  
+      // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for
+      // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints.
+      if (proto === 0) {
+        proto = 6;
+      }
+      if (type === 0) {
+        type = 1;
+      }
+  
+      if (!node && !service) {
+        return -2;
+      }
+      if (flags & ~(1|2|4|
+          1024|8|16|32)) {
+        return -1;
+      }
+      if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) {
+        return -1;
+      }
+      if (flags & 32) {
+        // TODO
+        return -2;
+      }
+      if (type !== 0 && type !== 1 && type !== 2) {
+        return -7;
+      }
+      if (family !== 0 && family !== 2 && family !== 10) {
+        return -6;
+      }
+  
+      if (service) {
+        service = UTF8ToString(service);
+        port = parseInt(service, 10);
+  
+        if (isNaN(port)) {
+          if (flags & 1024) {
+            return -2;
+          }
+          // TODO support resolving well-known service names from:
+          // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt
+          return -8;
+        }
+      }
+  
+      if (!node) {
+        if (family === 0) {
+          family = 2;
+        }
+        if ((flags & 1) === 0) {
+          if (family === 2) {
+            addr = _htonl(2130706433);
+          } else {
+            addr = [0, 0, 0, 1];
+          }
+        }
+        ai = allocaddrinfo(family, type, proto, null, addr, port);
+        HEAPU32[((out)>>2)] = ai;
+        return 0;
+      }
+  
+      //
+      // try as a numeric address
+      //
+      node = UTF8ToString(node);
+      addr = inetPton4(node);
+      if (addr !== null) {
+        // incoming node is a valid ipv4 address
+        if (family === 0 || family === 2) {
+          family = 2;
+        }
+        else if (family === 10 && (flags & 8)) {
+          addr = [0, 0, _htonl(0xffff), addr];
+          family = 10;
+        } else {
+          return -2;
+        }
+      } else {
+        addr = inetPton6(node);
+        if (addr !== null) {
+          // incoming node is a valid ipv6 address
+          if (family === 0 || family === 10) {
+            family = 10;
+          } else {
+            return -2;
+          }
+        }
+      }
+      if (addr != null) {
+        ai = allocaddrinfo(family, type, proto, node, addr, port);
+        HEAPU32[((out)>>2)] = ai;
+        return 0;
+      }
+      if (flags & 4) {
+        return -2;
+      }
+  
+      //
+      // try as a hostname
+      //
+      // resolve the hostname to a temporary fake address
+      node = DNS.lookup_name(node);
+      addr = inetPton4(node);
+      if (family === 0) {
+        family = 2;
+      } else if (family === 10) {
+        addr = [0, 0, _htonl(0xffff), addr];
+      }
+      ai = allocaddrinfo(family, type, proto, null, addr, port);
+      HEAPU32[((out)>>2)] = ai;
+      return 0;
+    };
+
+  /** @type {function(...*):?} */
+  function _getcontext(
+  ) {
+  abort('missing function: getcontext');
+  }
+  _getcontext.stub = true;
+
+  /** @type {function(...*):?} */
+  function _getdtablesize(
+  ) {
+  abort('missing function: getdtablesize');
+  }
+  _getdtablesize.stub = true;
+
+  
+  
+  
+  var getHostByName = (name) => {
+      // generate hostent
+      var ret = _malloc(20); // XXX possibly leaked, as are others here
+      var nameBuf = stringToNewUTF8(name);
+      HEAPU32[((ret)>>2)] = nameBuf;
+      var aliasesBuf = _malloc(4);
+      HEAPU32[((aliasesBuf)>>2)] = 0;
+      HEAPU32[(((ret)+(4))>>2)] = aliasesBuf;
+      var afinet = 2;
+      HEAP32[(((ret)+(8))>>2)] = afinet;
+      HEAP32[(((ret)+(12))>>2)] = 4;
+      var addrListBuf = _malloc(12);
+      HEAPU32[((addrListBuf)>>2)] = addrListBuf+8;
+      HEAPU32[(((addrListBuf)+(4))>>2)] = 0;
+      HEAP32[(((addrListBuf)+(8))>>2)] = inetPton4(DNS.lookup_name(name));
+      HEAPU32[(((ret)+(16))>>2)] = addrListBuf;
+      return ret;
+    };
+  
+  var _gethostbyname = (name) => {
+      return getHostByName(UTF8ToString(name));
+    };
+  
+  
+  var _gethostbyname_r = (name, ret, buf, buflen, out, err) => {
+      var data = _gethostbyname(name);
+      _memcpy(ret, data, 20);
+      _free(data);
+      HEAP32[((err)>>2)] = 0;
+      HEAPU32[((out)>>2)] = ret;
+      return 0;
+    };
+
+  
+  
+  
+  var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => {
+      var info = readSockaddr(sa, salen);
+      if (info.errno) {
+        return -6;
+      }
+      var port = info.port;
+      var addr = info.addr;
+  
+      var overflowed = false;
+  
+      if (node && nodelen) {
+        var lookup;
+        if ((flags & 1) || !(lookup = DNS.lookup_addr(addr))) {
+          if (flags & 8) {
+            return -2;
+          }
+        } else {
+          addr = lookup;
+        }
+        var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
+  
+        if (numBytesWrittenExclNull+1 >= nodelen) {
+          overflowed = true;
+        }
+      }
+  
+      if (serv && servlen) {
+        port = '' + port;
+        var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
+  
+        if (numBytesWrittenExclNull+1 >= servlen) {
+          overflowed = true;
+        }
+      }
+  
+      if (overflowed) {
+        // Note: even when we overflow, getnameinfo() is specced to write out the truncated results.
+        return -12;
+      }
+  
+      return 0;
+    };
+
+  var Protocols = {
+  list:[],
+  map:{
+  },
+  };
+  
+  
+  var _setprotoent = (stayopen) => {
+      // void setprotoent(int stayopen);
+  
+      // Allocate and populate a protoent structure given a name, protocol number and array of aliases
+      function allocprotoent(name, proto, aliases) {
+        // write name into buffer
+        var nameBuf = _malloc(name.length + 1);
+        stringToAscii(name, nameBuf);
+  
+        // write aliases into buffer
+        var j = 0;
+        var length = aliases.length;
+        var aliasListBuf = _malloc((length + 1) * 4); // Use length + 1 so we have space for the terminating NULL ptr.
+  
+        for (var i = 0; i < length; i++, j += 4) {
+          var alias = aliases[i];
+          var aliasBuf = _malloc(alias.length + 1);
+          stringToAscii(alias, aliasBuf);
+          HEAPU32[(((aliasListBuf)+(j))>>2)] = aliasBuf;
+        }
+        HEAPU32[(((aliasListBuf)+(j))>>2)] = 0; // Terminating NULL pointer.
+  
+        // generate protoent
+        var pe = _malloc(12);
+        HEAPU32[((pe)>>2)] = nameBuf;
+        HEAPU32[(((pe)+(4))>>2)] = aliasListBuf;
+        HEAP32[(((pe)+(8))>>2)] = proto;
+        return pe;
+      };
+  
+      // Populate the protocol 'database'. The entries are limited to tcp and udp, though it is fairly trivial
+      // to add extra entries from /etc/protocols if desired - though not sure if that'd actually be useful.
+      var list = Protocols.list;
+      var map  = Protocols.map;
+      if (list.length === 0) {
+          var entry = allocprotoent('tcp', 6, ['TCP']);
+          list.push(entry);
+          map['tcp'] = map['6'] = entry;
+          entry = allocprotoent('udp', 17, ['UDP']);
+          list.push(entry);
+          map['udp'] = map['17'] = entry;
+      }
+  
+      _setprotoent.index = 0;
+    };
+  
+  
+  var _getprotobyname = (name) => {
+      // struct protoent *getprotobyname(const char *);
+      name = UTF8ToString(name);
+      _setprotoent(true);
+      var result = Protocols.map[name];
+      return result;
+    };
+
+  
+  var _getprotobynumber = (number) => {
+      // struct protoent *getprotobynumber(int proto);
+      _setprotoent(true);
+      var result = Protocols.map[number];
+      return result;
+    };
+
+  /** @type {function(...*):?} */
+  function _makecontext(
+  ) {
+  abort('missing function: makecontext');
+  }
+  _makecontext.stub = true;
+
+
+  
+  var arraySum = (array, index) => {
+      var sum = 0;
+      for (var i = 0; i <= index; sum += array[i++]) {
+        // no-op
+      }
+      return sum;
+    };
+  
+  
+  var MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31];
+  
+  var MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31];
+  var addDays = (date, days) => {
+      var newDate = new Date(date.getTime());
+      while (days > 0) {
+        var leap = isLeapYear(newDate.getFullYear());
+        var currentMonth = newDate.getMonth();
+        var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth];
+  
+        if (days > daysInCurrentMonth-newDate.getDate()) {
+          // we spill over to next month
+          days -= (daysInCurrentMonth-newDate.getDate()+1);
+          newDate.setDate(1);
+          if (currentMonth < 11) {
+            newDate.setMonth(currentMonth+1)
+          } else {
+            newDate.setMonth(0);
+            newDate.setFullYear(newDate.getFullYear()+1);
+          }
+        } else {
+          // we stay in current month
+          newDate.setDate(newDate.getDate()+days);
+          return newDate;
+        }
+      }
+  
+      return newDate;
+    };
+  
+  
+  
+  
+  var writeArrayToMemory = (array, buffer) => {
+      assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
+      HEAP8.set(array, buffer);
+    };
+  
+  var _strftime = (s, maxsize, format, tm) => {
+      // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr);
+      // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html
+  
+      var tm_zone = HEAPU32[(((tm)+(40))>>2)];
+  
+      var date = {
+        tm_sec: HEAP32[((tm)>>2)],
+        tm_min: HEAP32[(((tm)+(4))>>2)],
+        tm_hour: HEAP32[(((tm)+(8))>>2)],
+        tm_mday: HEAP32[(((tm)+(12))>>2)],
+        tm_mon: HEAP32[(((tm)+(16))>>2)],
+        tm_year: HEAP32[(((tm)+(20))>>2)],
+        tm_wday: HEAP32[(((tm)+(24))>>2)],
+        tm_yday: HEAP32[(((tm)+(28))>>2)],
+        tm_isdst: HEAP32[(((tm)+(32))>>2)],
+        tm_gmtoff: HEAP32[(((tm)+(36))>>2)],
+        tm_zone: tm_zone ? UTF8ToString(tm_zone) : ''
+      };
+  
+      var pattern = UTF8ToString(format);
+  
+      // expand format
+      var EXPANSION_RULES_1 = {
+        '%c': '%a %b %d %H:%M:%S %Y',     // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug  3 14:02:01 2013
+        '%D': '%m/%d/%y',                 // Equivalent to %m / %d / %y
+        '%F': '%Y-%m-%d',                 // Equivalent to %Y - %m - %d
+        '%h': '%b',                       // Equivalent to %b
+        '%r': '%I:%M:%S %p',              // Replaced by the time in a.m. and p.m. notation
+        '%R': '%H:%M',                    // Replaced by the time in 24-hour notation
+        '%T': '%H:%M:%S',                 // Replaced by the time
+        '%x': '%m/%d/%y',                 // Replaced by the locale's appropriate date representation
+        '%X': '%H:%M:%S',                 // Replaced by the locale's appropriate time representation
+        // Modified Conversion Specifiers
+        '%Ec': '%c',                      // Replaced by the locale's alternative appropriate date and time representation.
+        '%EC': '%C',                      // Replaced by the name of the base year (period) in the locale's alternative representation.
+        '%Ex': '%m/%d/%y',                // Replaced by the locale's alternative date representation.
+        '%EX': '%H:%M:%S',                // Replaced by the locale's alternative time representation.
+        '%Ey': '%y',                      // Replaced by the offset from %EC (year only) in the locale's alternative representation.
+        '%EY': '%Y',                      // Replaced by the full alternative year representation.
+        '%Od': '%d',                      // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading <space> characters.
+        '%Oe': '%e',                      // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading <space> characters.
+        '%OH': '%H',                      // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols.
+        '%OI': '%I',                      // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols.
+        '%Om': '%m',                      // Replaced by the month using the locale's alternative numeric symbols.
+        '%OM': '%M',                      // Replaced by the minutes using the locale's alternative numeric symbols.
+        '%OS': '%S',                      // Replaced by the seconds using the locale's alternative numeric symbols.
+        '%Ou': '%u',                      // Replaced by the weekday as a number in the locale's alternative representation (Monday=1).
+        '%OU': '%U',                      // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols.
+        '%OV': '%V',                      // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols.
+        '%Ow': '%w',                      // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols.
+        '%OW': '%W',                      // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols.
+        '%Oy': '%y',                      // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols.
+      };
+      for (var rule in EXPANSION_RULES_1) {
+        pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]);
+      }
+  
+      var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
+      var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
+  
+      function leadingSomething(value, digits, character) {
+        var str = typeof value == 'number' ? value.toString() : (value || '');
+        while (str.length < digits) {
+          str = character[0]+str;
+        }
+        return str;
+      }
+  
+      function leadingNulls(value, digits) {
+        return leadingSomething(value, digits, '0');
+      }
+  
+      function compareByDay(date1, date2) {
+        function sgn(value) {
+          return value < 0 ? -1 : (value > 0 ? 1 : 0);
+        }
+  
+        var compare;
+        if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) {
+          if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) {
+            compare = sgn(date1.getDate()-date2.getDate());
+          }
+        }
+        return compare;
+      }
+  
+      function getFirstWeekStartDate(janFourth) {
+          switch (janFourth.getDay()) {
+            case 0: // Sunday
+              return new Date(janFourth.getFullYear()-1, 11, 29);
+            case 1: // Monday
+              return janFourth;
+            case 2: // Tuesday
+              return new Date(janFourth.getFullYear(), 0, 3);
+            case 3: // Wednesday
+              return new Date(janFourth.getFullYear(), 0, 2);
+            case 4: // Thursday
+              return new Date(janFourth.getFullYear(), 0, 1);
+            case 5: // Friday
+              return new Date(janFourth.getFullYear()-1, 11, 31);
+            case 6: // Saturday
+              return new Date(janFourth.getFullYear()-1, 11, 30);
+          }
+      }
+  
+      function getWeekBasedYear(date) {
+          var thisDate = addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday);
+  
+          var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
+          var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4);
+  
+          var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
+          var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
+  
+          if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
+            // this date is after the start of the first week of this year
+            if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
+              return thisDate.getFullYear()+1;
+            }
+            return thisDate.getFullYear();
+          }
+          return thisDate.getFullYear()-1;
+      }
+  
+      var EXPANSION_RULES_2 = {
+        '%a': (date) => WEEKDAYS[date.tm_wday].substring(0,3) ,
+        '%A': (date) => WEEKDAYS[date.tm_wday],
+        '%b': (date) => MONTHS[date.tm_mon].substring(0,3),
+        '%B': (date) => MONTHS[date.tm_mon],
+        '%C': (date) => {
+          var year = date.tm_year+1900;
+          return leadingNulls((year/100)|0,2);
+        },
+        '%d': (date) => leadingNulls(date.tm_mday, 2),
+        '%e': (date) => leadingSomething(date.tm_mday, 2, ' '),
+        '%g': (date) => {
+          // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year.
+          // In this system, weeks begin on a Monday and week 1 of the year is the week that includes
+          // January 4th, which is also the week that includes the first Thursday of the year, and
+          // is also the first week that contains at least four days in the year.
+          // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of
+          // the last week of the preceding year; thus, for Saturday 2nd January 1999,
+          // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th,
+          // or 31st is a Monday, it and any following days are part of week 1 of the following year.
+          // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01.
+  
+          return getWeekBasedYear(date).toString().substring(2);
+        },
+        '%G': (date) => getWeekBasedYear(date),
+        '%H': (date) => leadingNulls(date.tm_hour, 2),
+        '%I': (date) => {
+          var twelveHour = date.tm_hour;
+          if (twelveHour == 0) twelveHour = 12;
+          else if (twelveHour > 12) twelveHour -= 12;
+          return leadingNulls(twelveHour, 2);
+        },
+        '%j': (date) => {
+          // Day of the year (001-366)
+          return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year+1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon-1), 3);
+        },
+        '%m': (date) => leadingNulls(date.tm_mon+1, 2),
+        '%M': (date) => leadingNulls(date.tm_min, 2),
+        '%n': () => '\n',
+        '%p': (date) => {
+          if (date.tm_hour >= 0 && date.tm_hour < 12) {
+            return 'AM';
+          }
+          return 'PM';
+        },
+        '%S': (date) => leadingNulls(date.tm_sec, 2),
+        '%t': () => '\t',
+        '%u': (date) => date.tm_wday || 7,
+        '%U': (date) => {
+          var days = date.tm_yday + 7 - date.tm_wday;
+          return leadingNulls(Math.floor(days / 7), 2);
+        },
+        '%V': (date) => {
+          // Replaced by the week number of the year (Monday as the first day of the week)
+          // as a decimal number [01,53]. If the week containing 1 January has four
+          // or more days in the new year, then it is considered week 1.
+          // Otherwise, it is the last week of the previous year, and the next week is week 1.
+          // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday]
+          var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7);
+          // If 1 Jan is just 1-3 days past Monday, the previous week
+          // is also in this year.
+          if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
+            val++;
+          }
+          if (!val) {
+            val = 52;
+            // If 31 December of prev year a Thursday, or Friday of a
+            // leap year, then the prev year has 53 weeks.
+            var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
+            if (dec31 == 4 || (dec31 == 5 && isLeapYear(date.tm_year%400-1))) {
+              val++;
+            }
+          } else if (val == 53) {
+            // If 1 January is not a Thursday, and not a Wednesday of a
+            // leap year, then this year has only 52 weeks.
+            var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
+            if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year)))
+              val = 1;
+          }
+          return leadingNulls(val, 2);
+        },
+        '%w': (date) => date.tm_wday,
+        '%W': (date) => {
+          var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7);
+          return leadingNulls(Math.floor(days / 7), 2);
+        },
+        '%y': (date) => {
+          // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year]
+          return (date.tm_year+1900).toString().substring(2);
+        },
+        // Replaced by the year as a decimal number (for example, 1997). [ tm_year]
+        '%Y': (date) => date.tm_year+1900,
+        '%z': (date) => {
+          // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ).
+          // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich).
+          var off = date.tm_gmtoff;
+          var ahead = off >= 0;
+          off = Math.abs(off) / 60;
+          // convert from minutes into hhmm format (which means 60 minutes = 100 units)
+          off = (off / 60)*100 + (off % 60);
+          return (ahead ? '+' : '-') + String("0000" + off).slice(-4);
+        },
+        '%Z': (date) => date.tm_zone,
+        '%%': () => '%'
+      };
+  
+      // Replace %% with a pair of NULLs (which cannot occur in a C string), then
+      // re-inject them after processing.
+      pattern = pattern.replace(/%%/g, '\0\0')
+      for (var rule in EXPANSION_RULES_2) {
+        if (pattern.includes(rule)) {
+          pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date));
+        }
+      }
+      pattern = pattern.replace(/\0\0/g, '%')
+  
+      var bytes = intArrayFromString(pattern, false);
+      if (bytes.length > maxsize) {
+        return 0;
+      }
+  
+      writeArrayToMemory(bytes, s);
+      return bytes.length-1;
+    };
+
+  
+  
+  
+  
+  
+  
+  
+  var _strptime = (buf, format, tm) => {
+      // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm);
+      // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html
+      var pattern = UTF8ToString(format);
+  
+      // escape special characters
+      // TODO: not sure we really need to escape all of these in JS regexps
+      var SPECIAL_CHARS = '\\!@#$^&*()+=-[]/{}|:<>?,.';
+      for (var i=0, ii=SPECIAL_CHARS.length; i<ii; ++i) {
+        pattern = pattern.replace(new RegExp('\\'+SPECIAL_CHARS[i], 'g'), '\\'+SPECIAL_CHARS[i]);
+      }
+  
+      // reduce number of matchers
+      var EQUIVALENT_MATCHERS = {
+        '%A':  '%a',
+        '%B':  '%b',
+        '%c':  '%a %b %d %H:%M:%S %Y',
+        '%D':  '%m\\/%d\\/%y',
+        '%e':  '%d',
+        '%F':  '%Y-%m-%d',
+        '%h':  '%b',
+        '%R':  '%H\\:%M',
+        '%r':  '%I\\:%M\\:%S\\s%p',
+        '%T':  '%H\\:%M\\:%S',
+        '%x':  '%m\\/%d\\/(?:%y|%Y)',
+        '%X':  '%H\\:%M\\:%S'
+      };
+      for (var matcher in EQUIVALENT_MATCHERS) {
+        pattern = pattern.replace(matcher, EQUIVALENT_MATCHERS[matcher]);
+      }
+  
+      // TODO: take care of locale
+  
+      var DATE_PATTERNS = {
+        /* weeday name */     '%a': '(?:Sun(?:day)?)|(?:Mon(?:day)?)|(?:Tue(?:sday)?)|(?:Wed(?:nesday)?)|(?:Thu(?:rsday)?)|(?:Fri(?:day)?)|(?:Sat(?:urday)?)',
+        /* month name */      '%b': '(?:Jan(?:uary)?)|(?:Feb(?:ruary)?)|(?:Mar(?:ch)?)|(?:Apr(?:il)?)|May|(?:Jun(?:e)?)|(?:Jul(?:y)?)|(?:Aug(?:ust)?)|(?:Sep(?:tember)?)|(?:Oct(?:ober)?)|(?:Nov(?:ember)?)|(?:Dec(?:ember)?)',
+        /* century */         '%C': '\\d\\d',
+        /* day of month */    '%d': '0[1-9]|[1-9](?!\\d)|1\\d|2\\d|30|31',
+        /* hour (24hr) */     '%H': '\\d(?!\\d)|[0,1]\\d|20|21|22|23',
+        /* hour (12hr) */     '%I': '\\d(?!\\d)|0\\d|10|11|12',
+        /* day of year */     '%j': '00[1-9]|0?[1-9](?!\\d)|0?[1-9]\\d(?!\\d)|[1,2]\\d\\d|3[0-6]\\d',
+        /* month */           '%m': '0[1-9]|[1-9](?!\\d)|10|11|12',
+        /* minutes */         '%M': '0\\d|\\d(?!\\d)|[1-5]\\d',
+        /* whitespace */      '%n': '\\s',
+        /* AM/PM */           '%p': 'AM|am|PM|pm|A\\.M\\.|a\\.m\\.|P\\.M\\.|p\\.m\\.',
+        /* seconds */         '%S': '0\\d|\\d(?!\\d)|[1-5]\\d|60',
+        /* week number */     '%U': '0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53',
+        /* week number */     '%W': '0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53',
+        /* weekday number */  '%w': '[0-6]',
+        /* 2-digit year */    '%y': '\\d\\d',
+        /* 4-digit year */    '%Y': '\\d\\d\\d\\d',
+        /* % */               '%%': '%',
+        /* whitespace */      '%t': '\\s',
+      };
+  
+      var MONTH_NUMBERS = {JAN: 0, FEB: 1, MAR: 2, APR: 3, MAY: 4, JUN: 5, JUL: 6, AUG: 7, SEP: 8, OCT: 9, NOV: 10, DEC: 11};
+      var DAY_NUMBERS_SUN_FIRST = {SUN: 0, MON: 1, TUE: 2, WED: 3, THU: 4, FRI: 5, SAT: 6};
+      var DAY_NUMBERS_MON_FIRST = {MON: 0, TUE: 1, WED: 2, THU: 3, FRI: 4, SAT: 5, SUN: 6};
+  
+      for (var datePattern in DATE_PATTERNS) {
+        pattern = pattern.replace(datePattern, '('+datePattern+DATE_PATTERNS[datePattern]+')');
+      }
+  
+      // take care of capturing groups
+      var capture = [];
+      for (var i=pattern.indexOf('%'); i>=0; i=pattern.indexOf('%')) {
+        capture.push(pattern[i+1]);
+        pattern = pattern.replace(new RegExp('\\%'+pattern[i+1], 'g'), '');
+      }
+  
+      var matches = new RegExp('^'+pattern, "i").exec(UTF8ToString(buf))
+      // out(UTF8ToString(buf)+ ' is matched by '+((new RegExp('^'+pattern)).source)+' into: '+JSON.stringify(matches));
+  
+      function initDate() {
+        function fixup(value, min, max) {
+          return (typeof value != 'number' || isNaN(value)) ? min : (value>=min ? (value<=max ? value: max): min);
+        };
+        return {
+          year: fixup(HEAP32[(((tm)+(20))>>2)] + 1900 , 1970, 9999),
+          month: fixup(HEAP32[(((tm)+(16))>>2)], 0, 11),
+          day: fixup(HEAP32[(((tm)+(12))>>2)], 1, 31),
+          hour: fixup(HEAP32[(((tm)+(8))>>2)], 0, 23),
+          min: fixup(HEAP32[(((tm)+(4))>>2)], 0, 59),
+          sec: fixup(HEAP32[((tm)>>2)], 0, 59)
+        };
+      };
+  
+      if (matches) {
+        var date = initDate();
+        var value;
+  
+        var getMatch = (symbol) => {
+          var pos = capture.indexOf(symbol);
+          // check if symbol appears in regexp
+          if (pos >= 0) {
+            // return matched value or null (falsy!) for non-matches
+            return matches[pos+1];
+          }
+          return;
+        };
+  
+        // seconds
+        if ((value=getMatch('S'))) {
+          date.sec = jstoi_q(value);
+        }
+  
+        // minutes
+        if ((value=getMatch('M'))) {
+          date.min = jstoi_q(value);
+        }
+  
+        // hours
+        if ((value=getMatch('H'))) {
+          // 24h clock
+          date.hour = jstoi_q(value);
+        } else if ((value = getMatch('I'))) {
+          // AM/PM clock
+          var hour = jstoi_q(value);
+          if ((value=getMatch('p'))) {
+            hour += value.toUpperCase()[0] === 'P' ? 12 : 0;
+          }
+          date.hour = hour;
+        }
+  
+        // year
+        if ((value=getMatch('Y'))) {
+          // parse from four-digit year
+          date.year = jstoi_q(value);
+        } else if ((value=getMatch('y'))) {
+          // parse from two-digit year...
+          var year = jstoi_q(value);
+          if ((value=getMatch('C'))) {
+            // ...and century
+            year += jstoi_q(value)*100;
+          } else {
+            // ...and rule-of-thumb
+            year += year<69 ? 2000 : 1900;
+          }
+          date.year = year;
+        }
+  
+        // month
+        if ((value=getMatch('m'))) {
+          // parse from month number
+          date.month = jstoi_q(value)-1;
+        } else if ((value=getMatch('b'))) {
+          // parse from month name
+          date.month = MONTH_NUMBERS[value.substring(0,3).toUpperCase()] || 0;
+          // TODO: derive month from day in year+year, week number+day of week+year
+        }
+  
+        // day
+        if ((value=getMatch('d'))) {
+          // get day of month directly
+          date.day = jstoi_q(value);
+        } else if ((value=getMatch('j'))) {
+          // get day of month from day of year ...
+          var day = jstoi_q(value);
+          var leapYear = isLeapYear(date.year);
+          for (var month=0; month<12; ++month) {
+            var daysUntilMonth = arraySum(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, month-1);
+            if (day<=daysUntilMonth+(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[month]) {
+              date.day = day-daysUntilMonth;
+            }
+          }
+        } else if ((value=getMatch('a'))) {
+          // get day of month from weekday ...
+          var weekDay = value.substring(0,3).toUpperCase();
+          if ((value=getMatch('U'))) {
+            // ... and week number (Sunday being first day of week)
+            // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53].
+            // All days in a new year preceding the first Sunday are considered to be in week 0.
+            var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay];
+            var weekNumber = jstoi_q(value);
+  
+            // January 1st
+            var janFirst = new Date(date.year, 0, 1);
+            var endDate;
+            if (janFirst.getDay() === 0) {
+              // Jan 1st is a Sunday, and, hence in the 1st CW
+              endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1));
+            } else {
+              // Jan 1st is not a Sunday, and, hence still in the 0th CW
+              endDate = addDays(janFirst, 7-janFirst.getDay()+weekDayNumber+7*(weekNumber-1));
+            }
+            date.day = endDate.getDate();
+            date.month = endDate.getMonth();
+          } else if ((value=getMatch('W'))) {
+            // ... and week number (Monday being first day of week)
+            // Week number of the year (Monday as the first day of the week) as a decimal number [00,53].
+            // All days in a new year preceding the first Monday are considered to be in week 0.
+            var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay];
+            var weekNumber = jstoi_q(value);
+  
+            // January 1st
+            var janFirst = new Date(date.year, 0, 1);
+            var endDate;
+            if (janFirst.getDay()===1) {
+              // Jan 1st is a Monday, and, hence in the 1st CW
+               endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1));
+            } else {
+              // Jan 1st is not a Monday, and, hence still in the 0th CW
+              endDate = addDays(janFirst, 7-janFirst.getDay()+1+weekDayNumber+7*(weekNumber-1));
+            }
+  
+            date.day = endDate.getDate();
+            date.month = endDate.getMonth();
+          }
+        }
+  
+        /*
+        tm_sec  int seconds after the minute  0-61*
+        tm_min  int minutes after the hour  0-59
+        tm_hour int hours since midnight  0-23
+        tm_mday int day of the month  1-31
+        tm_mon  int months since January  0-11
+        tm_year int years since 1900
+        tm_wday int days since Sunday 0-6
+        tm_yday int days since January 1  0-365
+        tm_isdst  int Daylight Saving Time flag
+        */
+  
+        var fullDate = new Date(date.year, date.month, date.day, date.hour, date.min, date.sec, 0);
+        HEAP32[((tm)>>2)] = fullDate.getSeconds();
+        HEAP32[(((tm)+(4))>>2)] = fullDate.getMinutes();
+        HEAP32[(((tm)+(8))>>2)] = fullDate.getHours();
+        HEAP32[(((tm)+(12))>>2)] = fullDate.getDate();
+        HEAP32[(((tm)+(16))>>2)] = fullDate.getMonth();
+        HEAP32[(((tm)+(20))>>2)] = fullDate.getFullYear()-1900;
+        HEAP32[(((tm)+(24))>>2)] = fullDate.getDay();
+        HEAP32[(((tm)+(28))>>2)] = arraySum(isLeapYear(fullDate.getFullYear()) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, fullDate.getMonth()-1)+fullDate.getDate()-1;
+        HEAP32[(((tm)+(32))>>2)] = 0;
+  
+        // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F
+        // TODO: not sure that intArrayFromString handles all unicode characters correctly
+        return buf+intArrayFromString(matches[0]).length-1;
+      }
+  
+      return 0;
+    };
+
+  /** @type {function(...*):?} */
+  function _swapcontext(
+  ) {
+  abort('missing function: swapcontext');
+  }
+  _swapcontext.stub = true;
+
+
+  var getCFunc = (ident) => {
+      var func = Module['_' + ident]; // closure exported function
+      assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+      return func;
+    };
+  
+  
+  
+  var stringToUTF8OnStack = (str) => {
+      var size = lengthBytesUTF8(str) + 1;
+      var ret = stackAlloc(size);
+      stringToUTF8(str, ret, size);
+      return ret;
+    };
+  
+  
+    /**
+     * @param {string|null=} returnType
+     * @param {Array=} argTypes
+     * @param {Arguments|Array=} args
+     * @param {Object=} opts
+     */
+  var ccall = (ident, returnType, argTypes, args, opts) => {
+      // For fast lookup of conversion functions
+      var toC = {
+        'string': (str) => {
+          var ret = 0;
+          if (str !== null && str !== undefined && str !== 0) { // null string
+            // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+            ret = stringToUTF8OnStack(str);
+          }
+          return ret;
+        },
+        'array': (arr) => {
+          var ret = stackAlloc(arr.length);
+          writeArrayToMemory(arr, ret);
+          return ret;
+        }
+      };
+  
+      function convertReturnValue(ret) {
+        if (returnType === 'string') {
+          
+          return UTF8ToString(ret);
+        }
+        if (returnType === 'boolean') return Boolean(ret);
+        return ret;
+      }
+  
+      var func = getCFunc(ident);
+      var cArgs = [];
+      var stack = 0;
+      assert(returnType !== 'array', 'Return type should not be "array".');
+      if (args) {
+        for (var i = 0; i < args.length; i++) {
+          var converter = toC[argTypes[i]];
+          if (converter) {
+            if (stack === 0) stack = stackSave();
+            cArgs[i] = converter(args[i]);
+          } else {
+            cArgs[i] = args[i];
+          }
+        }
+      }
+      var ret = func.apply(null, cArgs);
+      function onDone(ret) {
+        if (stack !== 0) stackRestore(stack);
+        return convertReturnValue(ret);
+      }
+  
+      ret = onDone(ret);
+      return ret;
+    };
+
+  var FSNode = /** @constructor */ function(parent, name, mode, rdev) {
+    if (!parent) {
+      parent = this;  // root node sets parent to itself
+    }
+    this.parent = parent;
+    this.mount = parent.mount;
+    this.mounted = null;
+    this.id = FS.nextInode++;
+    this.name = name;
+    this.mode = mode;
+    this.node_ops = {};
+    this.stream_ops = {};
+    this.rdev = rdev;
+  };
+  var readMode = 292/*292*/ | 73/*73*/;
+  var writeMode = 146/*146*/;
+  Object.defineProperties(FSNode.prototype, {
+   read: {
+    get: /** @this{FSNode} */function() {
+     return (this.mode & readMode) === readMode;
+    },
+    set: /** @this{FSNode} */function(val) {
+     val ? this.mode |= readMode : this.mode &= ~readMode;
+    }
+   },
+   write: {
+    get: /** @this{FSNode} */function() {
+     return (this.mode & writeMode) === writeMode;
+    },
+    set: /** @this{FSNode} */function(val) {
+     val ? this.mode |= writeMode : this.mode &= ~writeMode;
+    }
+   },
+   isFolder: {
+    get: /** @this{FSNode} */function() {
+     return FS.isDir(this.mode);
+    }
+   },
+   isDevice: {
+    get: /** @this{FSNode} */function() {
+     return FS.isChrdev(this.mode);
+    }
+   }
+  });
+  FS.FSNode = FSNode;
+  FS.createPreloadedFile = FS_createPreloadedFile;
+  FS.staticInit();;
+ERRNO_CODES = {
+      'EPERM': 63,
+      'ENOENT': 44,
+      'ESRCH': 71,
+      'EINTR': 27,
+      'EIO': 29,
+      'ENXIO': 60,
+      'E2BIG': 1,
+      'ENOEXEC': 45,
+      'EBADF': 8,
+      'ECHILD': 12,
+      'EAGAIN': 6,
+      'EWOULDBLOCK': 6,
+      'ENOMEM': 48,
+      'EACCES': 2,
+      'EFAULT': 21,
+      'ENOTBLK': 105,
+      'EBUSY': 10,
+      'EEXIST': 20,
+      'EXDEV': 75,
+      'ENODEV': 43,
+      'ENOTDIR': 54,
+      'EISDIR': 31,
+      'EINVAL': 28,
+      'ENFILE': 41,
+      'EMFILE': 33,
+      'ENOTTY': 59,
+      'ETXTBSY': 74,
+      'EFBIG': 22,
+      'ENOSPC': 51,
+      'ESPIPE': 70,
+      'EROFS': 69,
+      'EMLINK': 34,
+      'EPIPE': 64,
+      'EDOM': 18,
+      'ERANGE': 68,
+      'ENOMSG': 49,
+      'EIDRM': 24,
+      'ECHRNG': 106,
+      'EL2NSYNC': 156,
+      'EL3HLT': 107,
+      'EL3RST': 108,
+      'ELNRNG': 109,
+      'EUNATCH': 110,
+      'ENOCSI': 111,
+      'EL2HLT': 112,
+      'EDEADLK': 16,
+      'ENOLCK': 46,
+      'EBADE': 113,
+      'EBADR': 114,
+      'EXFULL': 115,
+      'ENOANO': 104,
+      'EBADRQC': 103,
+      'EBADSLT': 102,
+      'EDEADLOCK': 16,
+      'EBFONT': 101,
+      'ENOSTR': 100,
+      'ENODATA': 116,
+      'ETIME': 117,
+      'ENOSR': 118,
+      'ENONET': 119,
+      'ENOPKG': 120,
+      'EREMOTE': 121,
+      'ENOLINK': 47,
+      'EADV': 122,
+      'ESRMNT': 123,
+      'ECOMM': 124,
+      'EPROTO': 65,
+      'EMULTIHOP': 36,
+      'EDOTDOT': 125,
+      'EBADMSG': 9,
+      'ENOTUNIQ': 126,
+      'EBADFD': 127,
+      'EREMCHG': 128,
+      'ELIBACC': 129,
+      'ELIBBAD': 130,
+      'ELIBSCN': 131,
+      'ELIBMAX': 132,
+      'ELIBEXEC': 133,
+      'ENOSYS': 52,
+      'ENOTEMPTY': 55,
+      'ENAMETOOLONG': 37,
+      'ELOOP': 32,
+      'EOPNOTSUPP': 138,
+      'EPFNOSUPPORT': 139,
+      'ECONNRESET': 15,
+      'ENOBUFS': 42,
+      'EAFNOSUPPORT': 5,
+      'EPROTOTYPE': 67,
+      'ENOTSOCK': 57,
+      'ENOPROTOOPT': 50,
+      'ESHUTDOWN': 140,
+      'ECONNREFUSED': 14,
+      'EADDRINUSE': 3,
+      'ECONNABORTED': 13,
+      'ENETUNREACH': 40,
+      'ENETDOWN': 38,
+      'ETIMEDOUT': 73,
+      'EHOSTDOWN': 142,
+      'EHOSTUNREACH': 23,
+      'EINPROGRESS': 26,
+      'EALREADY': 7,
+      'EDESTADDRREQ': 17,
+      'EMSGSIZE': 35,
+      'EPROTONOSUPPORT': 66,
+      'ESOCKTNOSUPPORT': 137,
+      'EADDRNOTAVAIL': 4,
+      'ENETRESET': 39,
+      'EISCONN': 30,
+      'ENOTCONN': 53,
+      'ETOOMANYREFS': 141,
+      'EUSERS': 136,
+      'EDQUOT': 19,
+      'ESTALE': 72,
+      'ENOTSUP': 138,
+      'ENOMEDIUM': 148,
+      'EILSEQ': 25,
+      'EOVERFLOW': 61,
+      'ECANCELED': 11,
+      'ENOTRECOVERABLE': 56,
+      'EOWNERDEAD': 62,
+      'ESTRPIPE': 135,
+    };;
+function checkIncomingModuleAPI() {
+  ignoredModuleProp('fetchSettings');
+}
+var wasmImports = {
+  /** @export */
+  __assert_fail: ___assert_fail,
+  /** @export */
+  __call_sighandler: ___call_sighandler,
+  /** @export */
+  __syscall__newselect: ___syscall__newselect,
+  /** @export */
+  __syscall_accept4: ___syscall_accept4,
+  /** @export */
+  __syscall_bind: ___syscall_bind,
+  /** @export */
+  __syscall_chdir: ___syscall_chdir,
+  /** @export */
+  __syscall_chmod: ___syscall_chmod,
+  /** @export */
+  __syscall_connect: ___syscall_connect,
+  /** @export */
+  __syscall_dup: ___syscall_dup,
+  /** @export */
+  __syscall_dup3: ___syscall_dup3,
+  /** @export */
+  __syscall_faccessat: ___syscall_faccessat,
+  /** @export */
+  __syscall_fchownat: ___syscall_fchownat,
+  /** @export */
+  __syscall_fcntl64: ___syscall_fcntl64,
+  /** @export */
+  __syscall_fdatasync: ___syscall_fdatasync,
+  /** @export */
+  __syscall_fstat64: ___syscall_fstat64,
+  /** @export */
+  __syscall_ftruncate64: ___syscall_ftruncate64,
+  /** @export */
+  __syscall_getcwd: ___syscall_getcwd,
+  /** @export */
+  __syscall_getdents64: ___syscall_getdents64,
+  /** @export */
+  __syscall_getpeername: ___syscall_getpeername,
+  /** @export */
+  __syscall_getsockname: ___syscall_getsockname,
+  /** @export */
+  __syscall_getsockopt: ___syscall_getsockopt,
+  /** @export */
+  __syscall_ioctl: ___syscall_ioctl,
+  /** @export */
+  __syscall_listen: ___syscall_listen,
+  /** @export */
+  __syscall_lstat64: ___syscall_lstat64,
+  /** @export */
+  __syscall_mkdirat: ___syscall_mkdirat,
+  /** @export */
+  __syscall_newfstatat: ___syscall_newfstatat,
+  /** @export */
+  __syscall_openat: ___syscall_openat,
+  /** @export */
+  __syscall_pipe: ___syscall_pipe,
+  /** @export */
+  __syscall_poll: ___syscall_poll,
+  /** @export */
+  __syscall_readlinkat: ___syscall_readlinkat,
+  /** @export */
+  __syscall_recvfrom: ___syscall_recvfrom,
+  /** @export */
+  __syscall_renameat: ___syscall_renameat,
+  /** @export */
+  __syscall_rmdir: ___syscall_rmdir,
+  /** @export */
+  __syscall_sendto: ___syscall_sendto,
+  /** @export */
+  __syscall_socket: ___syscall_socket,
+  /** @export */
+  __syscall_stat64: ___syscall_stat64,
+  /** @export */
+  __syscall_statfs64: ___syscall_statfs64,
+  /** @export */
+  __syscall_symlink: ___syscall_symlink,
+  /** @export */
+  __syscall_unlinkat: ___syscall_unlinkat,
+  /** @export */
+  __syscall_utimensat: ___syscall_utimensat,
+  /** @export */
+  _emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic,
+  /** @export */
+  _emscripten_throw_longjmp: __emscripten_throw_longjmp,
+  /** @export */
+  _gmtime_js: __gmtime_js,
+  /** @export */
+  _localtime_js: __localtime_js,
+  /** @export */
+  _mktime_js: __mktime_js,
+  /** @export */
+  _mmap_js: __mmap_js,
+  /** @export */
+  _munmap_js: __munmap_js,
+  /** @export */
+  _setitimer_js: __setitimer_js,
+  /** @export */
+  _tzset_js: __tzset_js,
+  /** @export */
+  abort: _abort,
+  /** @export */
+  emscripten_date_now: _emscripten_date_now,
+  /** @export */
+  emscripten_err: _emscripten_err,
+  /** @export */
+  emscripten_get_heap_max: _emscripten_get_heap_max,
+  /** @export */
+  emscripten_get_now: _emscripten_get_now,
+  /** @export */
+  emscripten_memcpy_js: _emscripten_memcpy_js,
+  /** @export */
+  emscripten_resize_heap: _emscripten_resize_heap,
+  /** @export */
+  environ_get: _environ_get,
+  /** @export */
+  environ_sizes_get: _environ_sizes_get,
+  /** @export */
+  exit: _exit,
+  /** @export */
+  fd_close: _fd_close,
+  /** @export */
+  fd_fdstat_get: _fd_fdstat_get,
+  /** @export */
+  fd_read: _fd_read,
+  /** @export */
+  fd_seek: _fd_seek,
+  /** @export */
+  fd_sync: _fd_sync,
+  /** @export */
+  fd_write: _fd_write,
+  /** @export */
+  getaddrinfo: _getaddrinfo,
+  /** @export */
+  getcontext: _getcontext,
+  /** @export */
+  getdtablesize: _getdtablesize,
+  /** @export */
+  gethostbyname_r: _gethostbyname_r,
+  /** @export */
+  getnameinfo: _getnameinfo,
+  /** @export */
+  getprotobyname: _getprotobyname,
+  /** @export */
+  getprotobynumber: _getprotobynumber,
+  /** @export */
+  invoke_i: invoke_i,
+  /** @export */
+  invoke_ii: invoke_ii,
+  /** @export */
+  invoke_iii: invoke_iii,
+  /** @export */
+  invoke_iiii: invoke_iiii,
+  /** @export */
+  invoke_iiiii: invoke_iiiii,
+  /** @export */
+  invoke_iiiiii: invoke_iiiiii,
+  /** @export */
+  invoke_iiiiiii: invoke_iiiiiii,
+  /** @export */
+  invoke_iiiiiiiiii: invoke_iiiiiiiiii,
+  /** @export */
+  invoke_v: invoke_v,
+  /** @export */
+  invoke_vi: invoke_vi,
+  /** @export */
+  invoke_vii: invoke_vii,
+  /** @export */
+  invoke_viidii: invoke_viidii,
+  /** @export */
+  invoke_viii: invoke_viii,
+  /** @export */
+  invoke_viiii: invoke_viiii,
+  /** @export */
+  invoke_viiiii: invoke_viiiii,
+  /** @export */
+  invoke_viiiiii: invoke_viiiiii,
+  /** @export */
+  makecontext: _makecontext,
+  /** @export */
+  proc_exit: _proc_exit,
+  /** @export */
+  strftime: _strftime,
+  /** @export */
+  strptime: _strptime,
+  /** @export */
+  swapcontext: _swapcontext
+};
+var wasmExports = createWasm();
+var ___wasm_call_ctors = createExportWrapper('__wasm_call_ctors');
+var _php_wasm_run = Module['_php_wasm_run'] = createExportWrapper('php_wasm_run');
+var _malloc = createExportWrapper('malloc');
+var setTempRet0 = createExportWrapper('setTempRet0');
+var _fflush = Module['_fflush'] = createExportWrapper('fflush');
+var _free = createExportWrapper('free');
+var ___errno_location = createExportWrapper('__errno_location');
+var _memcpy = createExportWrapper('memcpy');
+var _htons = createExportWrapper('htons');
+var _ntohs = createExportWrapper('ntohs');
+var _htonl = createExportWrapper('htonl');
+var _emscripten_builtin_memalign = createExportWrapper('emscripten_builtin_memalign');
+var __emscripten_timeout = createExportWrapper('_emscripten_timeout');
+var _setThrew = createExportWrapper('setThrew');
+var _emscripten_stack_init = () => (_emscripten_stack_init = wasmExports['emscripten_stack_init'])();
+var _emscripten_stack_get_free = () => (_emscripten_stack_get_free = wasmExports['emscripten_stack_get_free'])();
+var _emscripten_stack_get_base = () => (_emscripten_stack_get_base = wasmExports['emscripten_stack_get_base'])();
+var _emscripten_stack_get_end = () => (_emscripten_stack_get_end = wasmExports['emscripten_stack_get_end'])();
+var stackSave = createExportWrapper('stackSave');
+var stackRestore = createExportWrapper('stackRestore');
+var stackAlloc = createExportWrapper('stackAlloc');
+var _emscripten_stack_get_current = () => (_emscripten_stack_get_current = wasmExports['emscripten_stack_get_current'])();
+var dynCall_vij = Module['dynCall_vij'] = createExportWrapper('dynCall_vij');
+var dynCall_ji = Module['dynCall_ji'] = createExportWrapper('dynCall_ji');
+var dynCall_jiji = Module['dynCall_jiji'] = createExportWrapper('dynCall_jiji');
+
+function invoke_iii(index,a1,a2) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_iiiii(index,a1,a2,a3,a4) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2,a3,a4);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_v(index) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)();
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_ii(index,a1) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2,a3);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_vii(index,a1,a2) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_vi(index,a1) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_i(index) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)();
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2,a3);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2,a3,a4);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+  var sp = stackSave();
+  try {
+    return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+function invoke_viidii(index,a1,a2,a3,a4,a5) {
+  var sp = stackSave();
+  try {
+    getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+  } catch(e) {
+    stackRestore(sp);
+    if (e !== e+0) throw e;
+    _setThrew(1, 0);
+  }
+}
+
+
+// include: postamble.js
+// === Auto-generated postamble setup entry stuff ===
+
+Module['ccall'] = ccall;
+var missingLibrarySymbols = [
+  'writeI53ToI64',
+  'writeI53ToI64Clamped',
+  'writeI53ToI64Signaling',
+  'writeI53ToU64Clamped',
+  'writeI53ToU64Signaling',
+  'readI53FromU64',
+  'convertI32PairToI53',
+  'convertU32PairToI53',
+  'growMemory',
+  'getCallstack',
+  'emscriptenLog',
+  'convertPCtoSourceLocation',
+  'readEmAsmArgs',
+  'jstoi_s',
+  'listenOnce',
+  'autoResumeAudioContext',
+  'dynCallLegacy',
+  'getDynCaller',
+  'dynCall',
+  'runtimeKeepalivePush',
+  'runtimeKeepalivePop',
+  'safeSetTimeout',
+  'asmjsMangle',
+  'handleAllocatorInit',
+  'HandleAllocator',
+  'getNativeTypeSize',
+  'STACK_SIZE',
+  'STACK_ALIGN',
+  'POINTER_SIZE',
+  'ASSERTIONS',
+  'cwrap',
+  'uleb128Encode',
+  'sigToWasmTypes',
+  'generateFuncType',
+  'convertJsFunctionToWasm',
+  'getEmptyTableSlot',
+  'updateTableMap',
+  'getFunctionAddress',
+  'addFunction',
+  'removeFunction',
+  'reallyNegative',
+  'unSign',
+  'strLen',
+  'reSign',
+  'formatString',
+  'intArrayToString',
+  'AsciiToString',
+  'UTF16ToString',
+  'stringToUTF16',
+  'lengthBytesUTF16',
+  'UTF32ToString',
+  'stringToUTF32',
+  'lengthBytesUTF32',
+  'registerKeyEventCallback',
+  'maybeCStringToJsString',
+  'findEventTarget',
+  'findCanvasEventTarget',
+  'getBoundingClientRect',
+  'fillMouseEventData',
+  'registerMouseEventCallback',
+  'registerWheelEventCallback',
+  'registerUiEventCallback',
+  'registerFocusEventCallback',
+  'fillDeviceOrientationEventData',
+  'registerDeviceOrientationEventCallback',
+  'fillDeviceMotionEventData',
+  'registerDeviceMotionEventCallback',
+  'screenOrientation',
+  'fillOrientationChangeEventData',
+  'registerOrientationChangeEventCallback',
+  'fillFullscreenChangeEventData',
+  'registerFullscreenChangeEventCallback',
+  'JSEvents_requestFullscreen',
+  'JSEvents_resizeCanvasForFullscreen',
+  'registerRestoreOldStyle',
+  'hideEverythingExceptGivenElement',
+  'restoreHiddenElements',
+  'setLetterbox',
+  'softFullscreenResizeWebGLRenderTarget',
+  'doRequestFullscreen',
+  'fillPointerlockChangeEventData',
+  'registerPointerlockChangeEventCallback',
+  'registerPointerlockErrorEventCallback',
+  'requestPointerLock',
+  'fillVisibilityChangeEventData',
+  'registerVisibilityChangeEventCallback',
+  'registerTouchEventCallback',
+  'fillGamepadEventData',
+  'registerGamepadEventCallback',
+  'registerBeforeUnloadEventCallback',
+  'fillBatteryEventData',
+  'battery',
+  'registerBatteryEventCallback',
+  'setCanvasElementSize',
+  'getCanvasElementSize',
+  'jsStackTrace',
+  'stackTrace',
+  'checkWasiClock',
+  'wasiRightsToMuslOFlags',
+  'wasiOFlagsToMuslOFlags',
+  'createDyncallWrapper',
+  'setImmediateWrapped',
+  'clearImmediateWrapped',
+  'polyfillSetImmediate',
+  'getPromise',
+  'makePromise',
+  'idsToPromises',
+  'makePromiseCallback',
+  'ExceptionInfo',
+  'findMatchingCatch',
+  'setMainLoop',
+  'FS_unlink',
+  'FS_mkdirTree',
+  '_setNetworkCallback',
+  'heapObjectForWebGLType',
+  'heapAccessShiftForWebGLHeap',
+  'webgl_enable_ANGLE_instanced_arrays',
+  'webgl_enable_OES_vertex_array_object',
+  'webgl_enable_WEBGL_draw_buffers',
+  'webgl_enable_WEBGL_multi_draw',
+  'emscriptenWebGLGet',
+  'computeUnpackAlignedImageSize',
+  'colorChannelsInGlTextureFormat',
+  'emscriptenWebGLGetTexPixelData',
+  '__glGenObject',
+  'emscriptenWebGLGetUniform',
+  'webglGetUniformLocation',
+  'webglPrepareUniformLocationsBeforeFirstUse',
+  'webglGetLeftBracePos',
+  'emscriptenWebGLGetVertexAttrib',
+  '__glGetActiveAttribOrUniform',
+  'writeGLArray',
+  'registerWebGlEventCallback',
+  'runAndAbortIfError',
+  'SDL_unicode',
+  'SDL_ttfContext',
+  'SDL_audio',
+  'ALLOC_NORMAL',
+  'ALLOC_STACK',
+  'allocate',
+  'writeStringToMemory',
+  'writeAsciiToMemory',
+];
+missingLibrarySymbols.forEach(missingLibrarySymbol)
+
+var unexportedSymbols = [
+  'run',
+  'addOnPreRun',
+  'addOnInit',
+  'addOnPreMain',
+  'addOnExit',
+  'addOnPostRun',
+  'addRunDependency',
+  'removeRunDependency',
+  'FS_createFolder',
+  'FS_createPath',
+  'FS_createLazyFile',
+  'FS_createLink',
+  'FS_createDevice',
+  'FS_readFile',
+  'out',
+  'err',
+  'callMain',
+  'abort',
+  'keepRuntimeAlive',
+  'wasmMemory',
+  'wasmExports',
+  'stackAlloc',
+  'stackSave',
+  'stackRestore',
+  'getTempRet0',
+  'setTempRet0',
+  'writeStackCookie',
+  'checkStackCookie',
+  'readI53FromI64',
+  'convertI32PairToI53Checked',
+  'ptrToString',
+  'zeroMemory',
+  'exitJS',
+  'getHeapMax',
+  'abortOnCannotGrowMemory',
+  'ENV',
+  'MONTH_DAYS_REGULAR',
+  'MONTH_DAYS_LEAP',
+  'MONTH_DAYS_REGULAR_CUMULATIVE',
+  'MONTH_DAYS_LEAP_CUMULATIVE',
+  'isLeapYear',
+  'ydayFromDate',
+  'arraySum',
+  'addDays',
+  'ERRNO_CODES',
+  'ERRNO_MESSAGES',
+  'setErrNo',
+  'inetPton4',
+  'inetNtop4',
+  'inetPton6',
+  'inetNtop6',
+  'readSockaddr',
+  'writeSockaddr',
+  'DNS',
+  'getHostByName',
+  'Protocols',
+  'Sockets',
+  'initRandomFill',
+  'randomFill',
+  'timers',
+  'warnOnce',
+  'UNWIND_CACHE',
+  'readEmAsmArgsArray',
+  'jstoi_q',
+  'getExecutableName',
+  'handleException',
+  'callUserCallback',
+  'maybeExit',
+  'asyncLoad',
+  'alignMemory',
+  'mmapAlloc',
+  'wasmTable',
+  'getCFunc',
+  'freeTableIndexes',
+  'functionsInTableMap',
+  'setValue',
+  'getValue',
+  'PATH',
+  'PATH_FS',
+  'UTF8Decoder',
+  'UTF8ArrayToString',
+  'UTF8ToString',
+  'stringToUTF8Array',
+  'stringToUTF8',
+  'lengthBytesUTF8',
+  'intArrayFromString',
+  'stringToAscii',
+  'UTF16Decoder',
+  'stringToNewUTF8',
+  'stringToUTF8OnStack',
+  'writeArrayToMemory',
+  'JSEvents',
+  'specialHTMLTargets',
+  'currentFullscreenStrategy',
+  'restoreOldWindowedStyle',
+  'demangle',
+  'demangleAll',
+  'ExitStatus',
+  'getEnvStrings',
+  'doReadv',
+  'doWritev',
+  'promiseMap',
+  'uncaughtExceptionCount',
+  'exceptionLast',
+  'exceptionCaught',
+  'Browser',
+  'wget',
+  'SYSCALLS',
+  'getSocketFromFD',
+  'getSocketAddress',
+  'preloadPlugins',
+  'FS_createPreloadedFile',
+  'FS_modeStringToFlags',
+  'FS_getMode',
+  'FS_stdin_getChar_buffer',
+  'FS_stdin_getChar',
+  'FS',
+  'FS_createDataFile',
+  'MEMFS',
+  'TTY',
+  'PIPEFS',
+  'SOCKFS',
+  'tempFixedLengthArray',
+  'miniTempWebGLFloatBuffers',
+  'miniTempWebGLIntBuffers',
+  'GL',
+  'emscripten_webgl_power_preferences',
+  'AL',
+  'GLUT',
+  'EGL',
+  'GLEW',
+  'IDBStore',
+  'SDL',
+  'SDL_gfx',
+  'allocateUTF8',
+  'allocateUTF8OnStack',
+];
+unexportedSymbols.forEach(unexportedRuntimeSymbol);
+
+
+
+var calledRun;
+
+dependenciesFulfilled = function runCaller() {
+  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+  if (!calledRun) run();
+  if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+};
+
+function stackCheckInit() {
+  // This is normally called automatically during __wasm_call_ctors but need to
+  // get these values before even running any of the ctors so we call it redundantly
+  // here.
+  _emscripten_stack_init();
+  // TODO(sbc): Move writeStackCookie to native to to avoid this.
+  writeStackCookie();
+}
+
+function run() {
+
+  if (runDependencies > 0) {
+    return;
+  }
+
+    stackCheckInit();
+
+  preRun();
+
+  // a preRun added a dependency, run will be called later
+  if (runDependencies > 0) {
+    return;
+  }
+
+  function doRun() {
+    // run may have just been called through dependencies being fulfilled just in this very frame,
+    // or while the async setStatus time below was happening
+    if (calledRun) return;
+    calledRun = true;
+    Module['calledRun'] = true;
+
+    if (ABORT) return;
+
+    initRuntime();
+
+    readyPromiseResolve(Module);
+    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+    assert(!Module['_main'], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');
+
+    postRun();
+  }
+
+  if (Module['setStatus']) {
+    Module['setStatus']('Running...');
+    setTimeout(function() {
+      setTimeout(function() {
+        Module['setStatus']('');
+      }, 1);
+      doRun();
+    }, 1);
+  } else
+  {
+    doRun();
+  }
+  checkStackCookie();
+}
+
+function checkUnflushedContent() {
+  // Compiler settings do not allow exiting the runtime, so flushing
+  // the streams is not possible. but in ASSERTIONS mode we check
+  // if there was something to flush, and if so tell the user they
+  // should request that the runtime be exitable.
+  // Normally we would not even include flush() at all, but in ASSERTIONS
+  // builds we do so just for this check, and here we see if there is any
+  // content to flush, that is, we check if there would have been
+  // something a non-ASSERTIONS build would have not seen.
+  // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0
+  // mode (which has its own special function for this; otherwise, all
+  // the code is inside libc)
+  var oldOut = out;
+  var oldErr = err;
+  var has = false;
+  out = err = (x) => {
+    has = true;
+  }
+  try { // it doesn't matter if it fails
+    _fflush(0);
+    // also flush in the JS FS layer
+    ['stdout', 'stderr'].forEach(function(name) {
+      var info = FS.analyzePath('/dev/' + name);
+      if (!info) return;
+      var stream = info.object;
+      var rdev = stream.rdev;
+      var tty = TTY.ttys[rdev];
+      if (tty && tty.output && tty.output.length) {
+        has = true;
+      }
+    });
+  } catch(e) {}
+  out = oldOut;
+  err = oldErr;
+  if (has) {
+    warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the Emscripten FAQ), or make sure to emit a newline when you printf etc.');
+  }
+}
+
+if (Module['preInit']) {
+  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+  while (Module['preInit'].length > 0) {
+    Module['preInit'].pop()();
+  }
+}
+
+run();
+
+
+// end include: postamble.js
+
+
+  return moduleArg.ready
+}
+
+);
+})();
+export default Module;
\ No newline at end of file
diff --git a/examples/compile-php-to-wasm/php-wasm.wasm b/examples/compile-php-to-wasm/php-wasm.wasm
new file mode 100755
index 0000000..cf5ca85
--- /dev/null
+++ b/examples/compile-php-to-wasm/php-wasm.wasm