From e566733d7bc595f07cd78c0f356f58e419f8aad3 Mon Sep 17 00:00:00 2001 From: nsfisis Date: Mon, 4 Mar 2024 07:43:38 +0900 Subject: feat: add examples/php-on-wasm --- examples/php-on-wasm/php-wasm.mjs | 8308 ++++++++++++++++++++++++++++++++++++ examples/php-on-wasm/php-wasm.php | 956 +++++ examples/php-on-wasm/php-wasm.wasm | Bin 0 -> 4863136 bytes 3 files changed, 9264 insertions(+) create mode 100644 examples/php-on-wasm/php-wasm.mjs create mode 100644 examples/php-on-wasm/php-wasm.php create mode 100755 examples/php-on-wasm/php-wasm.wasm (limited to 'examples') diff --git a/examples/php-on-wasm/php-wasm.mjs b/examples/php-on-wasm/php-wasm.mjs new file mode 100644 index 0000000..8477416 --- /dev/null +++ b/examples/php-on-wasm/php-wasm.mjs @@ -0,0 +1,8308 @@ + +import { createRequire } from 'module'; +const require = createRequire(import.meta.url); + +var Module = (() => { + var _scriptDir = import.meta.url; + + return ( +function(moduleArg = {}) { + +// include: shell.js +// The Module object: Our interface to the outside world. We import +// and export values on it. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to check if Module already exists (e.g. case 3 above). +// Substitution will be replaced with actual code on later stage of the build, +// this way Closure Compiler will not mangle it (e.g. case 4. above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module = moduleArg; + +// Set up the promise that indicates the Module is initialized +var readyPromiseResolve, readyPromiseReject; +Module['ready'] = new Promise((resolve, reject) => { + readyPromiseResolve = resolve; + readyPromiseReject = reject; +}); +["_main","_memory","_php_wasm_run","_fflush","___indirect_function_table","onRuntimeInitialized"].forEach((prop) => { + if (!Object.getOwnPropertyDescriptor(Module['ready'], prop)) { + Object.defineProperty(Module['ready'], prop, { + get: () => abort('You are getting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'), + set: () => abort('You are setting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'), + }); + } +}); + +// --pre-jses are emitted after the Module integration code, so that they can +// refer to Module (if they choose; they can also define Module) + + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = Object.assign({}, Module); + +var arguments_ = []; +var thisProgram = './this.program'; +var quit_ = (status, toThrow) => { + throw toThrow; +}; + +// Determine the runtime environment we are in. You can customize this by +// setting the ENVIRONMENT setting at compile time (see settings.js). + +var ENVIRONMENT_IS_WEB = false; +var ENVIRONMENT_IS_WORKER = false; +var ENVIRONMENT_IS_NODE = true; +var ENVIRONMENT_IS_SHELL = false; + +if (Module['ENVIRONMENT']) { + throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)'); +} + +// `/` should be present at the end if `scriptDirectory` is not empty +var scriptDirectory = ''; +function locateFile(path) { + if (Module['locateFile']) { + return Module['locateFile'](path, scriptDirectory); + } + return scriptDirectory + path; +} + +// Hooks that are implemented differently in different runtime environments. +var read_, + readAsync, + readBinary; + +if (ENVIRONMENT_IS_NODE) { + if (typeof process == 'undefined' || !process.release || process.release.name !== 'node') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + var nodeVersion = process.versions.node; + var numericVersion = nodeVersion.split('.').slice(0, 3); + numericVersion = (numericVersion[0] * 10000) + (numericVersion[1] * 100) + (numericVersion[2].split('-')[0] * 1); + var minVersion = 160000; + if (numericVersion < 160000) { + throw new Error('This emscripten-generated code requires node v16.0.0 (detected v' + nodeVersion + ')'); + } + + // `require()` is no-op in an ESM module, use `createRequire()` to construct + // the require()` function. This is only necessary for multi-environment + // builds, `-sENVIRONMENT=node` emits a static import declaration instead. + // TODO: Swap all `require()`'s with `import()`'s? + // These modules will usually be used on Node.js. Load them eagerly to avoid + // the complexity of lazy-loading. + var fs = require('fs'); + var nodePath = require('path'); + + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = nodePath.dirname(scriptDirectory) + '/'; + } else { + // EXPORT_ES6 + ENVIRONMENT_IS_NODE always requires use of import.meta.url, + // since there's no way getting the current absolute path of the module when + // support for that is not available. + scriptDirectory = require('url').fileURLToPath(new URL('./', import.meta.url)); // includes trailing slash + } + +// include: node_shell_read.js +read_ = (filename, binary) => { + // We need to re-wrap `file://` strings to URLs. Normalizing isn't + // necessary in that case, the path should already be absolute. + filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename); + return fs.readFileSync(filename, binary ? undefined : 'utf8'); +}; + +readBinary = (filename) => { + var ret = read_(filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; +}; + +readAsync = (filename, onload, onerror, binary = true) => { + // See the comment in the `read_` function. + filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename); + fs.readFile(filename, binary ? undefined : 'utf8', (err, data) => { + if (err) onerror(err); + else onload(binary ? data.buffer : data); + }); +}; +// end include: node_shell_read.js + if (!Module['thisProgram'] && process.argv.length > 1) { + thisProgram = process.argv[1].replace(/\\/g, '/'); + } + + arguments_ = process.argv.slice(2); + + // MODULARIZE will export the module in the proper place outside, we don't need to export here + + quit_ = (status, toThrow) => { + process.exitCode = status; + throw toThrow; + }; + + Module['inspect'] = () => '[Emscripten Module object]'; + +} else +if (ENVIRONMENT_IS_SHELL) { + + if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + if (typeof read != 'undefined') { + read_ = read; + } + + readBinary = (f) => { + if (typeof readbuffer == 'function') { + return new Uint8Array(readbuffer(f)); + } + let data = read(f, 'binary'); + assert(typeof data == 'object'); + return data; + }; + + readAsync = (f, onload, onerror) => { + setTimeout(() => onload(readBinary(f))); + }; + + if (typeof clearTimeout == 'undefined') { + globalThis.clearTimeout = (id) => {}; + } + + if (typeof setTimeout == 'undefined') { + // spidermonkey lacks setTimeout but we use it above in readAsync. + globalThis.setTimeout = (f) => (typeof f == 'function') ? f() : abort(); + } + + if (typeof scriptArgs != 'undefined') { + arguments_ = scriptArgs; + } else if (typeof arguments != 'undefined') { + arguments_ = arguments; + } + + if (typeof quit == 'function') { + quit_ = (status, toThrow) => { + // Unlike node which has process.exitCode, d8 has no such mechanism. So we + // have no way to set the exit code and then let the program exit with + // that code when it naturally stops running (say, when all setTimeouts + // have completed). For that reason, we must call `quit` - the only way to + // set the exit code - but quit also halts immediately. To increase + // consistency with node (and the web) we schedule the actual quit call + // using a setTimeout to give the current stack and any exception handlers + // a chance to run. This enables features such as addOnPostRun (which + // expected to be able to run code after main returns). + setTimeout(() => { + if (!(toThrow instanceof ExitStatus)) { + let toLog = toThrow; + if (toThrow && typeof toThrow == 'object' && toThrow.stack) { + toLog = [toThrow, toThrow.stack]; + } + err(`exiting due to exception: ${toLog}`); + } + quit(status); + }); + throw toThrow; + }; + } + + if (typeof print != 'undefined') { + // Prefer to use print/printErr where they exist, as they usually work better. + if (typeof console == 'undefined') console = /** @type{!Console} */({}); + console.log = /** @type{!function(this:Console, ...*): undefined} */ (print); + console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print); + } + +} else + +// Note that this includes Node.js workers when relevant (pthreads is enabled). +// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and +// ENVIRONMENT_IS_NODE. +{ + throw new Error('environment detection error'); +} + +var out = Module['print'] || console.log.bind(console); +var err = Module['printErr'] || console.error.bind(console); + +// Merge back in the overrides +Object.assign(Module, moduleOverrides); +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = null; +checkIncomingModuleAPI(); + +// Emit code to handle expected values on the Module object. This applies Module.x +// to the proper local x. This has two benefits: first, we only emit it if it is +// expected to arrive, and second, by using a local everywhere else that can be +// minified. + +if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_'); + +if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram'); + +if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_'); + +// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message +// Assertions on removed incoming Module JS APIs. +assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)'); +assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)'); +assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)'); +assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify emscripten_set_window_title in JS)'); +assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY'); +legacyModuleProp('asm', 'wasmExports'); +legacyModuleProp('read', 'read_'); +legacyModuleProp('readAsync', 'readAsync'); +legacyModuleProp('readBinary', 'readBinary'); +legacyModuleProp('setWindowTitle', 'setWindowTitle'); +var IDBFS = 'IDBFS is no longer included by default; build with -lidbfs.js'; +var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js'; +var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js'; +var FETCHFS = 'FETCHFS is no longer included by default; build with -lfetchfs.js'; +var ICASEFS = 'ICASEFS is no longer included by default; build with -licasefs.js'; +var JSFILEFS = 'JSFILEFS is no longer included by default; build with -ljsfilefs.js'; +var OPFS = 'OPFS is no longer included by default; build with -lopfs.js'; + +var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js'; + +assert(!ENVIRONMENT_IS_WEB, "web environment detected but not enabled at build time. Add 'web' to `-sENVIRONMENT` to enable."); + +assert(!ENVIRONMENT_IS_WORKER, "worker environment detected but not enabled at build time. Add 'worker' to `-sENVIRONMENT` to enable."); + +assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-sENVIRONMENT` to enable."); + + +// end include: shell.js +// include: preamble.js +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + +var wasmBinary; +if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary'); +var noExitRuntime = Module['noExitRuntime'] || true;legacyModuleProp('noExitRuntime', 'noExitRuntime'); + +if (typeof WebAssembly != 'object') { + abort('no native wasm support detected'); +} + +// Wasm globals + +var wasmMemory; + +//======================================== +// Runtime essentials +//======================================== + +// whether we are quitting the application. no code should run after this. +// set in exit() and abort() +var ABORT = false; + +// set by exit() and abort(). Passed to 'onExit' handler. +// NOTE: This is also used as the process return code code in shell environments +// but only when noExitRuntime is false. +var EXITSTATUS; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed' + (text ? ': ' + text : '')); + } +} + +// We used to include malloc/free by default in the past. Show a helpful error in +// builds with assertions. + +// Memory management + +var HEAP, +/** @type {!Int8Array} */ + HEAP8, +/** @type {!Uint8Array} */ + HEAPU8, +/** @type {!Int16Array} */ + HEAP16, +/** @type {!Uint16Array} */ + HEAPU16, +/** @type {!Int32Array} */ + HEAP32, +/** @type {!Uint32Array} */ + HEAPU32, +/** @type {!Float32Array} */ + HEAPF32, +/** @type {!Float64Array} */ + HEAPF64; + +function updateMemoryViews() { + var b = wasmMemory.buffer; + Module['HEAP8'] = HEAP8 = new Int8Array(b); + Module['HEAP16'] = HEAP16 = new Int16Array(b); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(b); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(b); + Module['HEAP32'] = HEAP32 = new Int32Array(b); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(b); + Module['HEAPF32'] = HEAPF32 = new Float32Array(b); + Module['HEAPF64'] = HEAPF64 = new Float64Array(b); +} + +assert(!Module['STACK_SIZE'], 'STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time') + +assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined, + 'JS engine does not provide full typed array support'); + +// If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY +assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected. Use -sIMPORTED_MEMORY to define wasmMemory externally'); +assert(!Module['INITIAL_MEMORY'], 'Detected runtime INITIAL_MEMORY setting. Use -sIMPORTED_MEMORY to define wasmMemory dynamically'); + +// include: runtime_stack_check.js +// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. +function writeStackCookie() { + var max = _emscripten_stack_get_end(); + assert((max & 3) == 0); + // If the stack ends at address zero we write our cookies 4 bytes into the + // stack. This prevents interference with SAFE_HEAP and ASAN which also + // monitor writes to address zero. + if (max == 0) { + max += 4; + } + // The stack grow downwards towards _emscripten_stack_get_end. + // We write cookies to the final two words in the stack and detect if they are + // ever overwritten. + HEAPU32[((max)>>2)] = 0x02135467; + HEAPU32[(((max)+(4))>>2)] = 0x89BACDFE; + // Also test the global address 0 for integrity. + HEAPU32[((0)>>2)] = 1668509029; +} + +function checkStackCookie() { + if (ABORT) return; + var max = _emscripten_stack_get_end(); + // See writeStackCookie(). + if (max == 0) { + max += 4; + } + var cookie1 = HEAPU32[((max)>>2)]; + var cookie2 = HEAPU32[(((max)+(4))>>2)]; + if (cookie1 != 0x02135467 || cookie2 != 0x89BACDFE) { + abort(`Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`); + } + // Also test the global address 0 for integrity. + if (HEAPU32[((0)>>2)] != 0x63736d65 /* 'emsc' */) { + abort('Runtime error: The application has corrupted its heap memory area (address zero)!'); + } +} +// end include: runtime_stack_check.js +// include: runtime_assertions.js +// Endianness check +(function() { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 0x6373; + if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)'; +})(); + +// end include: runtime_assertions.js +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the main() is called + +var runtimeInitialized = false; + +var runtimeKeepaliveCounter = 0; + +function keepRuntimeAlive() { + return noExitRuntime || runtimeKeepaliveCounter > 0; +} + +function preRun() { + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function initRuntime() { + assert(!runtimeInitialized); + runtimeInitialized = true; + + checkStackCookie(); + + +if (!Module["noFSInit"] && !FS.init.initialized) + FS.init(); +FS.ignorePermissions = false; + +TTY.init(); +SOCKFS.root = FS.mount(SOCKFS, {}, null); +PIPEFS.root = FS.mount(PIPEFS, {}, null); + callRuntimeCallbacks(__ATINIT__); +} + +function postRun() { + checkStackCookie(); + + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnExit(cb) { +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +// include: runtime_math.js +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32 + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc + +assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +// end include: runtime_math.js +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// Module.preRun (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } +} + +function addRunDependency(id) { + runDependencies++; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval != 'undefined') { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(() => { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err('still waiting on run dependencies:'); + } + err(`dependency: ${dep}`); + } + if (shown) { + err('(end of list)'); + } + }, 10000); + } + } else { + err('warning: run dependency added without ID'); + } +} + +function removeRunDependency(id) { + runDependencies--; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err('warning: run dependency removed without ID'); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} + +/** @param {string|number=} what */ +function abort(what) { + if (Module['onAbort']) { + Module['onAbort'](what); + } + + what = 'Aborted(' + what + ')'; + // TODO(sbc): Should we remove printing and leave it up to whoever + // catches the exception? + err(what); + + ABORT = true; + EXITSTATUS = 1; + + // Use a wasm runtime error, because a JS error might be seen as a foreign + // exception, which means we'd run destructors on it. We need the error to + // simply make the program stop. + // FIXME This approach does not work in Wasm EH because it currently does not assume + // all RuntimeErrors are from traps; it decides whether a RuntimeError is from + // a trap or not based on a hidden field within the object. So at the moment + // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that + // allows this in the wasm spec. + + // Suppress closure compiler warning here. Closure compiler's builtin extern + // defintion for WebAssembly.RuntimeError claims it takes no arguments even + // though it can. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed. + /** @suppress {checkTypes} */ + var e = new WebAssembly.RuntimeError(what); + + readyPromiseReject(e); + // Throw the error whether or not MODULARIZE is set because abort is used + // in code paths apart from instantiation where an exception is expected + // to be thrown when abort is called. + throw e; +} + +// include: memoryprofiler.js +// end include: memoryprofiler.js +// include: URIUtils.js +// Prefix of data URIs emitted by SINGLE_FILE and related options. +var dataURIPrefix = 'data:application/octet-stream;base64,'; + +// Indicates whether filename is a base64 data URI. +function isDataURI(filename) { + // Prefix of data URIs emitted by SINGLE_FILE and related options. + return filename.startsWith(dataURIPrefix); +} + +// Indicates whether filename is delivered via file protocol (as opposed to http/https) +function isFileURI(filename) { + return filename.startsWith('file://'); +} +// end include: URIUtils.js +function createExportWrapper(name) { + return function() { + assert(runtimeInitialized, `native function \`${name}\` called before runtime initialization`); + var f = wasmExports[name]; + assert(f, `exported native function \`${name}\` not found`); + return f.apply(null, arguments); + }; +} + +// include: runtime_exceptions.js +// end include: runtime_exceptions.js +var wasmBinaryFile; +if (Module['locateFile']) { + wasmBinaryFile = 'php-wasm.wasm'; + if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); + } +} else { + // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too. + wasmBinaryFile = new URL('php-wasm.wasm', import.meta.url).href; +} + +function getBinarySync(file) { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary); + } + if (readBinary) { + return readBinary(file); + } + throw "both async and sync fetching of the wasm failed"; +} + +function getBinaryPromise(binaryFile) { + // If we don't have the binary yet, try to load it asynchronously. + // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url. + // See https://github.com/github/fetch/pull/92#issuecomment-140665932 + // Cordova or Electron apps are typically loaded from a file:// url. + // So use fetch if it is available and the url is not a file, otherwise fall back to XHR. + if (!wasmBinary + && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) { + if (typeof fetch == 'function' + ) { + return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => { + if (!response['ok']) { + throw "failed to load wasm binary file at '" + binaryFile + "'"; + } + return response['arrayBuffer'](); + }).catch(() => getBinarySync(binaryFile)); + } + } + + // Otherwise, getBinarySync should be able to get it synchronously + return Promise.resolve().then(() => getBinarySync(binaryFile)); +} + +function instantiateArrayBuffer(binaryFile, imports, receiver) { + return getBinaryPromise(binaryFile).then((binary) => { + return WebAssembly.instantiate(binary, imports); + }).then((instance) => { + return instance; + }).then(receiver, (reason) => { + err(`failed to asynchronously prepare wasm: ${reason}`); + + // Warn on some common problems. + if (isFileURI(wasmBinaryFile)) { + err(`warning: Loading from a file URI (${wasmBinaryFile}) is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing`); + } + abort(reason); + }); +} + +function instantiateAsync(binary, binaryFile, imports, callback) { + if (!binary && + typeof WebAssembly.instantiateStreaming == 'function' && + !isDataURI(binaryFile) && + // Avoid instantiateStreaming() on Node.js environment for now, as while + // Node.js v18.1.0 implements it, it does not have a full fetch() + // implementation yet. + // + // Reference: + // https://github.com/emscripten-core/emscripten/pull/16917 + !ENVIRONMENT_IS_NODE && + typeof fetch == 'function') { + return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => { + // Suppress closure warning here since the upstream definition for + // instantiateStreaming only allows Promise rather than + // an actual Response. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed. + /** @suppress {checkTypes} */ + var result = WebAssembly.instantiateStreaming(response, imports); + + return result.then( + callback, + function(reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err(`wasm streaming compile failed: ${reason}`); + err('falling back to ArrayBuffer instantiation'); + return instantiateArrayBuffer(binaryFile, imports, callback); + }); + }); + } + return instantiateArrayBuffer(binaryFile, imports, callback); +} + +// Create the wasm instance. +// Receives the wasm imports, returns the exports. +function createWasm() { + // prepare imports + var info = { + 'env': wasmImports, + 'wasi_snapshot_preview1': wasmImports, + }; + // Load the wasm module and create an instance of using native support in the JS engine. + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + /** @param {WebAssembly.Module=} module*/ + function receiveInstance(instance, module) { + wasmExports = instance.exports; + + + + wasmMemory = wasmExports['memory']; + + assert(wasmMemory, "memory not found in wasm exports"); + // This assertion doesn't hold when emscripten is run in --post-link + // mode. + // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode. + //assert(wasmMemory.buffer.byteLength === 16777216); + updateMemoryViews(); + + wasmTable = wasmExports['__indirect_function_table']; + + assert(wasmTable, "table not found in wasm exports"); + + addOnInit(wasmExports['__wasm_call_ctors']); + + removeRunDependency('wasm-instantiate'); + return wasmExports; + } + // wait for the pthread pool (if any) + addRunDependency('wasm-instantiate'); + + // Prefer streaming instantiation if available. + // Async compilation can be confusing when an error on the page overwrites Module + // (for example, if the order of elements is wrong, and the one defining Module is + // later), so we save Module and check it later. + var trueModule = Module; + function receiveInstantiationResult(result) { + // 'result' is a ResultObject object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?'); + trueModule = null; + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line. + // When the regression is fixed, can restore the above PTHREADS-enabled path. + receiveInstance(result['instance']); + } + + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to + // run the instantiation parallel to any other async startup actions they are + // performing. + // Also pthreads and wasm workers initialize the wasm instance through this + // path. + if (Module['instantiateWasm']) { + + try { + return Module['instantiateWasm'](info, receiveInstance); + } catch(e) { + err(`Module.instantiateWasm callback failed with error: ${e}`); + // If instantiation fails, reject the module ready promise. + readyPromiseReject(e); + } + } + + // If instantiation fails, reject the module ready promise. + instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject); + return {}; // no exports yet; we'll fill them in later +} + +// Globals used by JS i64 conversions (see makeSetValue) +var tempDouble; +var tempI64; + +// include: runtime_debug.js +function legacyModuleProp(prop, newName, incomming=true) { + if (!Object.getOwnPropertyDescriptor(Module, prop)) { + Object.defineProperty(Module, prop, { + configurable: true, + get() { + let extra = incomming ? ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)' : ''; + abort(`\`Module.${prop}\` has been replaced by \`${newName}\`` + extra); + + } + }); + } +} + +function ignoredModuleProp(prop) { + if (Object.getOwnPropertyDescriptor(Module, prop)) { + abort(`\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`); + } +} + +// forcing the filesystem exports a few things by default +function isExportedByForceFilesystem(name) { + return name === 'FS_createPath' || + name === 'FS_createDataFile' || + name === 'FS_createPreloadedFile' || + name === 'FS_unlink' || + name === 'addRunDependency' || + // The old FS has some functionality that WasmFS lacks. + name === 'FS_createLazyFile' || + name === 'FS_createDevice' || + name === 'removeRunDependency'; +} + +function missingGlobal(sym, msg) { + if (typeof globalThis !== 'undefined') { + Object.defineProperty(globalThis, sym, { + configurable: true, + get() { + warnOnce('`' + sym + '` is not longer defined by emscripten. ' + msg); + return undefined; + } + }); + } +} + +missingGlobal('buffer', 'Please use HEAP8.buffer or wasmMemory.buffer'); +missingGlobal('asm', 'Please use wasmExports instead'); + +function missingLibrarySymbol(sym) { + if (typeof globalThis !== 'undefined' && !Object.getOwnPropertyDescriptor(globalThis, sym)) { + Object.defineProperty(globalThis, sym, { + configurable: true, + get() { + // Can't `abort()` here because it would break code that does runtime + // checks. e.g. `if (typeof SDL === 'undefined')`. + var msg = '`' + sym + '` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line'; + // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in + // library.js, which means $name for a JS name with no prefix, or name + // for a JS name like _name. + var librarySymbol = sym; + if (!librarySymbol.startsWith('_')) { + librarySymbol = '$' + sym; + } + msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='" + librarySymbol + "')"; + if (isExportedByForceFilesystem(sym)) { + msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you'; + } + warnOnce(msg); + return undefined; + } + }); + } + // Any symbol that is not included from the JS libary is also (by definition) + // not exported on the Module object. + unexportedRuntimeSymbol(sym); +} + +function unexportedRuntimeSymbol(sym) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Object.defineProperty(Module, sym, { + configurable: true, + get() { + var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)"; + if (isExportedByForceFilesystem(sym)) { + msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you'; + } + abort(msg); + } + }); + } +} + +// Used by XXXXX_DEBUG settings to output debug messages. +function dbg(text) { + // TODO(sbc): Make this configurable somehow. Its not always convenient for + // logging to show up as warnings. + console.warn.apply(console, arguments); +} +// end include: runtime_debug.js +// === Body === + +// end include: preamble.js + + /** @constructor */ + function ExitStatus(status) { + this.name = 'ExitStatus'; + this.message = `Program terminated with exit(${status})`; + this.status = status; + } + + var callRuntimeCallbacks = (callbacks) => { + while (callbacks.length > 0) { + // Pass the module as the first argument. + callbacks.shift()(Module); + } + }; + + + /** + * @param {number} ptr + * @param {string} type + */ + function getValue(ptr, type = 'i8') { + if (type.endsWith('*')) type = '*'; + switch (type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': abort('to do getValue(i64) use WASM_BIGINT'); + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + case '*': return HEAPU32[((ptr)>>2)]; + default: abort(`invalid type for getValue: ${type}`); + } + } + + var ptrToString = (ptr) => { + assert(typeof ptr === 'number'); + // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned. + ptr >>>= 0; + return '0x' + ptr.toString(16).padStart(8, '0'); + }; + + + /** + * @param {number} ptr + * @param {number} value + * @param {string} type + */ + function setValue(ptr, value, type = 'i8') { + if (type.endsWith('*')) type = '*'; + switch (type) { + case 'i1': HEAP8[((ptr)>>0)] = value; break; + case 'i8': HEAP8[((ptr)>>0)] = value; break; + case 'i16': HEAP16[((ptr)>>1)] = value; break; + case 'i32': HEAP32[((ptr)>>2)] = value; break; + case 'i64': abort('to do setValue(i64) use WASM_BIGINT'); + case 'float': HEAPF32[((ptr)>>2)] = value; break; + case 'double': HEAPF64[((ptr)>>3)] = value; break; + case '*': HEAPU32[((ptr)>>2)] = value; break; + default: abort(`invalid type for setValue: ${type}`); + } + } + + var warnOnce = (text) => { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + if (ENVIRONMENT_IS_NODE) text = 'warning: ' + text; + err(text); + } + }; + + var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined; + + /** + * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given + * array that contains uint8 values, returns a copy of that string as a + * Javascript String object. + * heapOrArray is either a regular array, or a JavaScript typed array view. + * @param {number} idx + * @param {number=} maxBytesToRead + * @return {string} + */ + var UTF8ArrayToString = (heapOrArray, idx, maxBytesToRead) => { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on + // null terminator by itself. Also, use the length info to avoid running tiny + // strings through TextDecoder, since .subarray() allocates garbage. + // (As a tiny code save trick, compare endPtr against endIdx using a negation, + // so that undefined means Infinity) + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr)); + } + var str = ''; + // If building with TextDecoder, we have already computed the string length + // above, so test loop end condition against that + while (idx < endPtr) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + var u0 = heapOrArray[idx++]; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte ' + ptrToString(u0) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!'); + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63); + } + + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + return str; + }; + + /** + * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the + * emscripten HEAP, returns a copy of that string as a Javascript String object. + * + * @param {number} ptr + * @param {number=} maxBytesToRead - An optional length that specifies the + * maximum number of bytes to read. You can omit this parameter to scan the + * string until the first 0 byte. If maxBytesToRead is passed, and the string + * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the + * string will cut short at that byte index (i.e. maxBytesToRead will not + * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing + * frequent uses of UTF8ToString() with and without maxBytesToRead may throw + * JS JIT optimizations off, so it is worth to consider consistently using one + * @return {string} + */ + var UTF8ToString = (ptr, maxBytesToRead) => { + assert(typeof ptr == 'number'); + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : ''; + }; + var ___assert_fail = (condition, filename, line, func) => { + abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']); + }; + + var wasmTableMirror = []; + + var wasmTable; + var getWasmTableEntry = (funcPtr) => { + var func = wasmTableMirror[funcPtr]; + if (!func) { + if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1; + wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr); + } + assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!"); + return func; + }; + var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig); + + var PATH = { + isAbs:(path) => path.charAt(0) === '/', + splitPath:(filename) => { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + }, + normalizeArray:(parts, allowAboveRoot) => { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + }, + normalize:(path) => { + var isAbsolute = PATH.isAbs(path), + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + }, + dirname:(path) => { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + }, + basename:(path) => { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + }, + join:function() { + var paths = Array.prototype.slice.call(arguments); + return PATH.normalize(paths.join('/')); + }, + join2:(l, r) => { + return PATH.normalize(l + '/' + r); + }, + }; + + var initRandomFill = () => { + if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') { + // for modern web browsers + return (view) => crypto.getRandomValues(view); + } else + if (ENVIRONMENT_IS_NODE) { + // for nodejs with or without crypto support included + try { + var crypto_module = require('crypto'); + var randomFillSync = crypto_module['randomFillSync']; + if (randomFillSync) { + // nodejs with LTS crypto support + return (view) => crypto_module['randomFillSync'](view); + } + // very old nodejs with the original crypto API + var randomBytes = crypto_module['randomBytes']; + return (view) => ( + view.set(randomBytes(view.byteLength)), + // Return the original view to match modern native implementations. + view + ); + } catch (e) { + // nodejs doesn't have crypto support + } + } + // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096 + abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); + }; + var randomFill = (view) => { + // Lazily init on the first invocation. + return (randomFill = initRandomFill())(view); + }; + + + + var PATH_FS = { + resolve:function() { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path != 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = PATH.isAbs(path); + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + }, + relative:(from, to) => { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }, + }; + + + + var FS_stdin_getChar_buffer = []; + + var lengthBytesUTF8 = (str) => { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var c = str.charCodeAt(i); // possibly a lead surrogate + if (c <= 0x7F) { + len++; + } else if (c <= 0x7FF) { + len += 2; + } else if (c >= 0xD800 && c <= 0xDFFF) { + len += 4; ++i; + } else { + len += 3; + } + } + return len; + }; + + var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => { + assert(typeof str === 'string'); + // Parameter maxBytesToWrite is not optional. Negative values, 0, null, + // undefined and false each don't write out any bytes. + if (!(maxBytesToWrite > 0)) + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description + // and https://www.ietf.org/rfc/rfc2279.txt + // and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) { + var u1 = str.charCodeAt(++i); + u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); + } + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 0xC0 | (u >> 6); + heap[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 0xE0 | (u >> 12); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 3 >= endIdx) break; + if (u > 0x10FFFF) warnOnce('Invalid Unicode code point ' + ptrToString(u) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).'); + heap[outIdx++] = 0xF0 | (u >> 18); + heap[outIdx++] = 0x80 | ((u >> 12) & 63); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + heap[outIdx] = 0; + return outIdx - startIdx; + }; + /** @type {function(string, boolean=, number=)} */ + function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; + } + var FS_stdin_getChar = () => { + if (!FS_stdin_getChar_buffer.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = Buffer.alloc(BUFSIZE); + var bytesRead = 0; + + // For some reason we must suppress a closure warning here, even though + // fd definitely exists on process.stdin, and is even the proper way to + // get the fd of stdin, + // https://github.com/nodejs/help/issues/2136#issuecomment-523649904 + // This started to happen after moving this logic out of library_tty.js, + // so it is related to the surrounding code in some unclear manner. + /** @suppress {missingProperties} */ + var fd = process.stdin.fd; + + try { + bytesRead = fs.readSync(fd, buf); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().includes('EOF')) bytesRead = 0; + else throw e; + } + + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + } else + if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + FS_stdin_getChar_buffer = intArrayFromString(result, true); + } + return FS_stdin_getChar_buffer.shift(); + }; + var TTY = { + ttys:[], + init() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process.stdin.setEncoding('utf8'); + // } + }, + shutdown() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process.stdin.pause(); + // } + }, + register(dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + }, + stream_ops:{ + open(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + }, + close(stream) { + // flush any pending line data + stream.tty.ops.fsync(stream.tty); + }, + fsync(stream) { + stream.tty.ops.fsync(stream.tty); + }, + read(stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }, + }, + default_tty_ops:{ + get_char(tty) { + return FS_stdin_getChar(); + }, + put_char(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + }, + fsync(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }, + ioctl_tcgets(tty) { + // typical setting + return { + c_iflag: 25856, + c_oflag: 5, + c_cflag: 191, + c_lflag: 35387, + c_cc: [ + 0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, 0x00, + 0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + ] + }; + }, + ioctl_tcsets(tty, optional_actions, data) { + // currently just ignore + return 0; + }, + ioctl_tiocgwinsz(tty) { + return [24, 80]; + }, + }, + default_tty1_ops:{ + put_char(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + }, + fsync(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }, + }, + }; + + + var zeroMemory = (address, size) => { + HEAPU8.fill(0, address, address + size); + return address; + }; + + var alignMemory = (size, alignment) => { + assert(alignment, "alignment argument is required"); + return Math.ceil(size / alignment) * alignment; + }; + var mmapAlloc = (size) => { + size = alignMemory(size, 65536); + var ptr = _emscripten_builtin_memalign(65536, size); + if (!ptr) return 0; + return zeroMemory(ptr, size); + }; + var MEMFS = { + ops_table:null, + mount(mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + }, + createNode(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(63); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + parent.timestamp = node.timestamp; + } + return node; + }, + getFileDataAsTypedArray(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + }, + expandFileStorage(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + }, + resizeFileStorage(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + } + }, + node_ops:{ + getattr(node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + }, + setattr(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + }, + lookup(parent, name) { + throw FS.genericErrors[44]; + }, + mknod(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + }, + rename(old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.parent.timestamp = Date.now() + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + new_dir.timestamp = old_node.parent.timestamp; + old_node.parent = new_dir; + }, + unlink(parent, name) { + delete parent.contents[name]; + parent.timestamp = Date.now(); + }, + rmdir(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + parent.timestamp = Date.now(); + }, + readdir(node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + }, + symlink(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + }, + readlink(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + }, + }, + stream_ops:{ + read(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + }, + write(stream, buffer, offset, length, position, canOwn) { + // The data buffer should be a typed array view + assert(!(buffer instanceof ArrayBuffer)); + + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + assert(position === 0, 'canOwn must imply no weird position inside the file'); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) { + // Use typed array write which is available. + node.contents.set(buffer.subarray(offset, offset + length), position); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + }, + llseek(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + }, + allocate(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + }, + mmap(stream, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if (!(flags & 2) && contents.buffer === HEAP8.buffer) { + // We can't emulate MAP_SHARED when the file is not backed by the + // buffer we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + HEAP8.set(contents, ptr); + } + return { ptr, allocated }; + }, + msync(stream, buffer, offset, length, mmapFlags) { + MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }, + }, + }; + + /** @param {boolean=} noRunDep */ + var asyncLoad = (url, onload, onerror, noRunDep) => { + var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : ''; + readAsync(url, (arrayBuffer) => { + assert(arrayBuffer, `Loading data file "${url}" failed (no arrayBuffer).`); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, (event) => { + if (onerror) { + onerror(); + } else { + throw `Loading data file "${url}" failed.`; + } + }); + if (dep) addRunDependency(dep); + }; + + + var FS_createDataFile = (parent, name, fileData, canRead, canWrite, canOwn) => { + return FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn); + }; + + var preloadPlugins = Module['preloadPlugins'] || []; + var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => { + // Ensure plugins are ready. + if (typeof Browser != 'undefined') Browser.init(); + + var handled = false; + preloadPlugins.forEach((plugin) => { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, onerror); + handled = true; + } + }); + return handled; + }; + var FS_createPreloadedFile = (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => { + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS_createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => { + if (onerror) onerror(); + removeRunDependency(dep); + })) { + return; + } + finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + asyncLoad(url, (byteArray) => processData(byteArray), onerror); + } else { + processData(url); + } + }; + + var FS_modeStringToFlags = (str) => { + var flagModes = { + 'r': 0, + 'r+': 2, + 'w': 512 | 64 | 1, + 'w+': 512 | 64 | 2, + 'a': 1024 | 64 | 1, + 'a+': 1024 | 64 | 2, + }; + var flags = flagModes[str]; + if (typeof flags == 'undefined') { + throw new Error(`Unknown file open mode: ${str}`); + } + return flags; + }; + + var FS_getMode = (canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + }; + + + + + var ERRNO_MESSAGES = { + 0:"Success", + 1:"Arg list too long", + 2:"Permission denied", + 3:"Address already in use", + 4:"Address not available", + 5:"Address family not supported by protocol family", + 6:"No more processes", + 7:"Socket already connected", + 8:"Bad file number", + 9:"Trying to read unreadable message", + 10:"Mount device busy", + 11:"Operation canceled", + 12:"No children", + 13:"Connection aborted", + 14:"Connection refused", + 15:"Connection reset by peer", + 16:"File locking deadlock error", + 17:"Destination address required", + 18:"Math arg out of domain of func", + 19:"Quota exceeded", + 20:"File exists", + 21:"Bad address", + 22:"File too large", + 23:"Host is unreachable", + 24:"Identifier removed", + 25:"Illegal byte sequence", + 26:"Connection already in progress", + 27:"Interrupted system call", + 28:"Invalid argument", + 29:"I/O error", + 30:"Socket is already connected", + 31:"Is a directory", + 32:"Too many symbolic links", + 33:"Too many open files", + 34:"Too many links", + 35:"Message too long", + 36:"Multihop attempted", + 37:"File or path name too long", + 38:"Network interface is not configured", + 39:"Connection reset by network", + 40:"Network is unreachable", + 41:"Too many open files in system", + 42:"No buffer space available", + 43:"No such device", + 44:"No such file or directory", + 45:"Exec format error", + 46:"No record locks available", + 47:"The link has been severed", + 48:"Not enough core", + 49:"No message of desired type", + 50:"Protocol not available", + 51:"No space left on device", + 52:"Function not implemented", + 53:"Socket is not connected", + 54:"Not a directory", + 55:"Directory not empty", + 56:"State not recoverable", + 57:"Socket operation on non-socket", + 59:"Not a typewriter", + 60:"No such device or address", + 61:"Value too large for defined data type", + 62:"Previous owner died", + 63:"Not super-user", + 64:"Broken pipe", + 65:"Protocol error", + 66:"Unknown protocol", + 67:"Protocol wrong type for socket", + 68:"Math result not representable", + 69:"Read only file system", + 70:"Illegal seek", + 71:"No such process", + 72:"Stale file handle", + 73:"Connection timed out", + 74:"Text file busy", + 75:"Cross-device link", + 100:"Device not a stream", + 101:"Bad font file fmt", + 102:"Invalid slot", + 103:"Invalid request code", + 104:"No anode", + 105:"Block device required", + 106:"Channel number out of range", + 107:"Level 3 halted", + 108:"Level 3 reset", + 109:"Link number out of range", + 110:"Protocol driver not attached", + 111:"No CSI structure available", + 112:"Level 2 halted", + 113:"Invalid exchange", + 114:"Invalid request descriptor", + 115:"Exchange full", + 116:"No data (for no delay io)", + 117:"Timer expired", + 118:"Out of streams resources", + 119:"Machine is not on the network", + 120:"Package not installed", + 121:"The object is remote", + 122:"Advertise error", + 123:"Srmount error", + 124:"Communication error on send", + 125:"Cross mount point (not really error)", + 126:"Given log. name not unique", + 127:"f.d. invalid for this operation", + 128:"Remote address changed", + 129:"Can access a needed shared lib", + 130:"Accessing a corrupted shared lib", + 131:".lib section in a.out corrupted", + 132:"Attempting to link in too many libs", + 133:"Attempting to exec a shared library", + 135:"Streams pipe error", + 136:"Too many users", + 137:"Socket type not supported", + 138:"Not supported", + 139:"Protocol family not supported", + 140:"Can't send after socket shutdown", + 141:"Too many references", + 142:"Host is down", + 148:"No medium (in tape drive)", + 156:"Level 2 not synchronized", + }; + + var ERRNO_CODES = { + }; + + var demangle = (func) => { + warnOnce('warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling'); + return func; + }; + var demangleAll = (text) => { + var regex = + /\b_Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (y + ' [' + x + ']'); + }); + }; + var FS = { + root:null, + mounts:[], + devices:{ + }, + streams:[], + nextInode:1, + nameTable:null, + currentPath:"/", + initialized:false, + ignorePermissions:true, + ErrnoError:null, + genericErrors:{ + }, + filesystems:null, + syncFSRequests:0, + lookupPath(path, opts = {}) { + path = PATH_FS.resolve(path); + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + opts = Object.assign(defaults, opts) + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(32); + } + + // split the absolute path + var parts = path.split('/').filter((p) => !!p); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(32); + } + } + } + } + + return { path: current_path, node: current }; + }, + getPath(node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? `${mount}/${path}` : mount + path; + } + path = path ? `${node.name}/${path}` : node.name; + node = node.parent; + } + }, + hashName(parentid, name) { + var hash = 0; + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + }, + hashAddNode(node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + }, + hashRemoveNode(node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + }, + lookupNode(parent, name) { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + }, + createNode(parent, name, mode, rdev) { + assert(typeof parent == 'object') + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + }, + destroyNode(node) { + FS.hashRemoveNode(node); + }, + isRoot(node) { + return node === node.parent; + }, + isMountpoint(node) { + return !!node.mounted; + }, + isFile(mode) { + return (mode & 61440) === 32768; + }, + isDir(mode) { + return (mode & 61440) === 16384; + }, + isLink(mode) { + return (mode & 61440) === 40960; + }, + isChrdev(mode) { + return (mode & 61440) === 8192; + }, + isBlkdev(mode) { + return (mode & 61440) === 24576; + }, + isFIFO(mode) { + return (mode & 61440) === 4096; + }, + isSocket(mode) { + return (mode & 49152) === 49152; + }, + flagsToPermissionString(flag) { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + }, + nodePermissions(node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.includes('r') && !(node.mode & 292)) { + return 2; + } else if (perms.includes('w') && !(node.mode & 146)) { + return 2; + } else if (perms.includes('x') && !(node.mode & 73)) { + return 2; + } + return 0; + }, + mayLookup(dir) { + var errCode = FS.nodePermissions(dir, 'x'); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + }, + mayCreate(dir, name) { + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + }, + mayDelete(dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, 'wx'); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + }, + mayOpen(node, flags) { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + }, + MAX_OPEN_FDS:4096, + nextfd() { + for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + }, + getStreamChecked(fd) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + return stream; + }, + getStream:(fd) => FS.streams[fd], + createStream(stream, fd = -1) { + if (!FS.FSStream) { + FS.FSStream = /** @constructor */ function() { + this.shared = { }; + }; + FS.FSStream.prototype = {}; + Object.defineProperties(FS.FSStream.prototype, { + object: { + /** @this {FS.FSStream} */ + get() { return this.node; }, + /** @this {FS.FSStream} */ + set(val) { this.node = val; } + }, + isRead: { + /** @this {FS.FSStream} */ + get() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + /** @this {FS.FSStream} */ + get() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + /** @this {FS.FSStream} */ + get() { return (this.flags & 1024); } + }, + flags: { + /** @this {FS.FSStream} */ + get() { return this.shared.flags; }, + /** @this {FS.FSStream} */ + set(val) { this.shared.flags = val; }, + }, + position : { + /** @this {FS.FSStream} */ + get() { return this.shared.position; }, + /** @this {FS.FSStream} */ + set(val) { this.shared.position = val; }, + }, + }); + } + // clone it, so we can return an instance of FSStream + stream = Object.assign(new FS.FSStream(), stream); + if (fd == -1) { + fd = FS.nextfd(); + } + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + }, + closeStream(fd) { + FS.streams[fd] = null; + }, + chrdev_stream_ops:{ + open(stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + }, + llseek() { + throw new FS.ErrnoError(70); + }, + }, + major:(dev) => ((dev) >> 8), + minor:(dev) => ((dev) & 0xff), + makedev:(ma, mi) => ((ma) << 8 | (mi)), + registerDevice(dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + }, + getDevice:(dev) => FS.devices[dev], + getMounts(mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + }, + syncfs(populate, callback) { + if (typeof populate == 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach((mount) => { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + }, + mount(type, opts, mountpoint) { + if (typeof type == 'string') { + // The filesystem was not included, and instead we have an error + // message stored in the variable. + throw type; + } + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + + var mount = { + type, + opts, + mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + }, + unmount(mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach((hash) => { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.includes(current.mount)) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + }, + lookup(parent, name) { + return parent.node_ops.lookup(parent, name); + }, + mknod(path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + }, + create(path, mode) { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + }, + mkdir(path, mode) { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + }, + mkdirTree(path, mode) { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != 20) throw e; + } + } + }, + mkdev(path, mode, dev) { + if (typeof dev == 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + }, + symlink(oldpath, newpath) { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + }, + rename(old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + + // let the errors from non existant directories percolate up + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(28); + } + // new path should not be an ancestor of the old path + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(55); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + errCode = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(10); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + }, + rmdir(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + }, + readdir(path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + }, + unlink(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + }, + readlink(path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + }, + stat(path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + }, + lstat(path) { + return FS.stat(path, true); + }, + chmod(path, mode, dontFollow) { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + }, + lchmod(path, mode) { + FS.chmod(path, mode, true); + }, + fchmod(fd, mode) { + var stream = FS.getStreamChecked(fd); + FS.chmod(stream.node, mode); + }, + chown(path, uid, gid, dontFollow) { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + }, + lchown(path, uid, gid) { + FS.chown(path, uid, gid, true); + }, + fchown(fd, uid, gid) { + var stream = FS.getStreamChecked(fd); + FS.chown(stream.node, uid, gid); + }, + truncate(path, len) { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + }, + ftruncate(fd, len) { + var stream = FS.getStreamChecked(fd); + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + }, + utime(path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + }, + open(path, flags, mode) { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags == 'string' ? FS_modeStringToFlags(flags) : flags; + mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path == 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(20); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // do truncation if necessary + if ((flags & 512) && !created) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512 | 131072); + + // register the stream with the filesystem + var stream = FS.createStream({ + node, + path: FS.getPath(node), // we want the absolute path to the node + flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + } + } + return stream; + }, + close(stream) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + }, + isClosed(stream) { + return stream.fd === null; + }, + llseek(stream, offset, whence) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + }, + read(stream, buffer, offset, length, position) { + assert(offset >= 0); + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + }, + write(stream, buffer, offset, length, position, canOwn) { + assert(offset >= 0); + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + return bytesWritten; + }, + allocate(stream, offset, length) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + }, + mmap(stream, length, position, prot, flags) { + // User requests writing to file (prot & PROT_WRITE != 0). + // Checking if we have permissions to write to the file unless + // MAP_PRIVATE flag is set. According to POSIX spec it is possible + // to write to file opened in read-only mode with MAP_PRIVATE flag, + // as all modifications will be visible only in the memory of + // the current process. + if ((prot & 2) !== 0 + && (flags & 2) === 0 + && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + return stream.stream_ops.mmap(stream, length, position, prot, flags); + }, + msync(stream, buffer, offset, length, mmapFlags) { + assert(offset >= 0); + if (!stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + }, + munmap:(stream) => 0, + ioctl(stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + }, + readFile(path, opts = {}) { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error(`Invalid encoding type "${opts.encoding}"`); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + }, + writeFile(path, data, opts = {}) { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == 'string') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error('Unsupported data type'); + } + FS.close(stream); + }, + cwd:() => FS.currentPath, + chdir(path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, 'x'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + }, + createDefaultDirectories() { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + }, + createDefaultDevices() { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length, + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using err() rather than out() + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + // use a buffer to avoid overhead of individual crypto calls per byte + var randomBuffer = new Uint8Array(1024), randomLeft = 0; + var randomByte = () => { + if (randomLeft === 0) { + randomLeft = randomFill(randomBuffer).byteLength; + } + return randomBuffer[--randomLeft]; + }; + FS.createDevice('/dev', 'random', randomByte); + FS.createDevice('/dev', 'urandom', randomByte); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + }, + createSpecialDirectories() { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the + // name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + var proc_self = FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount() { + var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup(parent, name) { + var fd = +name; + var stream = FS.getStreamChecked(fd); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: () => stream.path }, + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + }, + createStandardStreams() { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 0); + var stdout = FS.open('/dev/stdout', 1); + var stderr = FS.open('/dev/stderr', 1); + assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`); + assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`); + assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`); + }, + ensureErrnoError() { + if (FS.ErrnoError) return; + FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) { + // We set the `name` property to be able to identify `FS.ErrnoError` + // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway. + // - when using PROXYFS, an error can come from an underlying FS + // as different FS objects have their own FS.ErrnoError each, + // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs. + // we'll use the reliable test `err.name == "ErrnoError"` instead + this.name = 'ErrnoError'; + this.node = node; + this.setErrno = /** @this{Object} */ function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + + // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack + // now ensures it shows what we want. + if (this.stack) { + // Define the stack property for Node.js 4, which otherwise errors on the next line. + Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); + this.stack = demangleAll(this.stack); + } + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [44].forEach((code) => { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = ''; + }); + }, + staticInit() { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + }; + }, + init(input, output, error) { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + }, + quit() { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + _fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + }, + findObject(path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (!ret.exists) { + return null; + } + return ret.object; + }, + analyzePath(path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + }, + createPath(parent, path, canRead, canWrite) { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + }, + createFile(parent, name, properties, canRead, canWrite) { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS_getMode(canRead, canWrite); + return FS.create(path, mode); + }, + createDataFile(parent, name, data, canRead, canWrite, canOwn) { + var path = name; + if (parent) { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent; + } + var mode = FS_getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + }, + createDevice(parent, name, input, output) { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS_getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open(stream) { + stream.seekable = false; + }, + close(stream) { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + }, + forceLoadFile(obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + if (typeof XMLHttpRequest != 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (read_) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + throw new FS.ErrnoError(29); + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + }, + createLazyFile(parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + /** @constructor */ + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (from, to) => { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(/** @type{Array} */(xhr.response || [])); + } + return intArrayFromString(xhr.responseText || '', true); + }; + var lazyArray = this; + lazyArray.setDataGetter((chunkNum) => { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof lazyArray.chunks[chunkNum] == 'undefined') { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!'); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + }; + if (typeof XMLHttpRequest != 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: /** @this {FSNode} */ function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach((key) => { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + FS.forceLoadFile(node); + return fn.apply(null, arguments); + }; + }); + function writeChunks(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + } + // use a custom read function + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + return writeChunks(stream, buffer, offset, length, position) + }; + // use a custom mmap function + stream_ops.mmap = (stream, length, position, prot, flags) => { + FS.forceLoadFile(node); + var ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + writeChunks(stream, HEAP8, ptr, length, position); + return { ptr, allocated: true }; + }; + node.stream_ops = stream_ops; + return node; + }, + absolutePath() { + abort('FS.absolutePath has been removed; use PATH_FS.resolve instead'); + }, + createFolder() { + abort('FS.createFolder has been removed; use FS.mkdir instead'); + }, + createLink() { + abort('FS.createLink has been removed; use FS.symlink instead'); + }, + joinPath() { + abort('FS.joinPath has been removed; use PATH.join instead'); + }, + mmapAlloc() { + abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc'); + }, + standardizePath() { + abort('FS.standardizePath has been removed; use PATH.normalize instead'); + }, + }; + + var SYSCALLS = { + DEFAULT_POLLMASK:5, + calculateAt(dirfd, path, allowEmpty) { + if (PATH.isAbs(path)) { + return path; + } + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = SYSCALLS.getStreamFromFD(dirfd); + dir = dirstream.path; + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44);; + } + return dir; + } + return PATH.join2(dir, path); + }, + doStat(func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -54; + } + throw e; + } + HEAP32[((buf)>>2)] = stat.dev; + HEAP32[(((buf)+(4))>>2)] = stat.mode; + HEAPU32[(((buf)+(8))>>2)] = stat.nlink; + HEAP32[(((buf)+(12))>>2)] = stat.uid; + HEAP32[(((buf)+(16))>>2)] = stat.gid; + HEAP32[(((buf)+(20))>>2)] = stat.rdev; + (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(24))>>2)] = tempI64[0],HEAP32[(((buf)+(28))>>2)] = tempI64[1]); + HEAP32[(((buf)+(32))>>2)] = 4096; + HEAP32[(((buf)+(36))>>2)] = stat.blocks; + var atime = stat.atime.getTime(); + var mtime = stat.mtime.getTime(); + var ctime = stat.ctime.getTime(); + (tempI64 = [Math.floor(atime / 1000)>>>0,(tempDouble=Math.floor(atime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(48))>>2)] = (atime % 1000) * 1000; + (tempI64 = [Math.floor(mtime / 1000)>>>0,(tempDouble=Math.floor(mtime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(56))>>2)] = tempI64[0],HEAP32[(((buf)+(60))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(64))>>2)] = (mtime % 1000) * 1000; + (tempI64 = [Math.floor(ctime / 1000)>>>0,(tempDouble=Math.floor(ctime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(72))>>2)] = tempI64[0],HEAP32[(((buf)+(76))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(80))>>2)] = (ctime % 1000) * 1000; + (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(88))>>2)] = tempI64[0],HEAP32[(((buf)+(92))>>2)] = tempI64[1]); + return 0; + }, + doMsync(addr, stream, len, flags, offset) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (flags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + }, + varargs:undefined, + get() { + assert(SYSCALLS.varargs != undefined); + // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number. + var ret = HEAP32[((+SYSCALLS.varargs)>>2)]; + SYSCALLS.varargs += 4; + return ret; + }, + getp() { return SYSCALLS.get() }, + getStr(ptr) { + var ret = UTF8ToString(ptr); + return ret; + }, + getStreamFromFD(fd) { + var stream = FS.getStreamChecked(fd); + return stream; + }, + }; + function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) { + try { + + // readfds are supported, + // writefds checks socket open status + // exceptfds are supported, although on web, such exceptional conditions never arise in web sockets + // and so the exceptfds list will always return empty. + // timeout is supported, although on SOCKFS and PIPEFS these are ignored and always treated as 0 - fully async + assert(nfds <= 64, 'nfds must be less than or equal to 64'); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers + + var total = 0; + + var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0), + srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0); + var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0), + srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0); + var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0), + srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var dstReadLow = 0, + dstReadHigh = 0; + var dstWriteLow = 0, + dstWriteHigh = 0; + var dstExceptLow = 0, + dstExceptHigh = 0; + + var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) | + (writefds ? HEAP32[((writefds)>>2)] : 0) | + (exceptfds ? HEAP32[((exceptfds)>>2)] : 0); + var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) | + (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) | + (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var check = function(fd, low, high, val) { + return (fd < 32 ? (low & val) : (high & val)); + }; + + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << (fd % 32); + if (!(check(fd, allLow, allHigh, mask))) { + continue; // index isn't in the set + } + + var stream = SYSCALLS.getStreamFromFD(fd); + + var flags = SYSCALLS.DEFAULT_POLLMASK; + + if (stream.stream_ops.poll) { + var timeoutInMillis = -1; + if (timeout) { + var tv_sec = (readfds ? HEAP32[((timeout)>>2)] : 0), + tv_usec = (readfds ? HEAP32[(((timeout)+(8))>>2)] : 0); + timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000; + } + flags = stream.stream_ops.poll(stream, timeoutInMillis); + } + + if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask); + total++; + } + if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask); + total++; + } + if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask); + total++; + } + } + + if (readfds) { + HEAP32[((readfds)>>2)] = dstReadLow; + HEAP32[(((readfds)+(4))>>2)] = dstReadHigh; + } + if (writefds) { + HEAP32[((writefds)>>2)] = dstWriteLow; + HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh; + } + if (exceptfds) { + HEAP32[((exceptfds)>>2)] = dstExceptLow; + HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh; + } + + return total; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + var SOCKFS = { + mount(mount) { + // If Module['websocket'] has already been defined (e.g. for configuring + // the subprotocol/url) use that, if not initialise it to a new object. + Module['websocket'] = (Module['websocket'] && + ('object' === typeof Module['websocket'])) ? Module['websocket'] : {}; + + // Add the Event registration mechanism to the exported websocket configuration + // object so we can register network callbacks from native JavaScript too. + // For more documentation see system/include/emscripten/emscripten.h + Module['websocket']._callbacks = {}; + Module['websocket']['on'] = /** @this{Object} */ function(event, callback) { + if ('function' === typeof callback) { + this._callbacks[event] = callback; + } + return this; + }; + + Module['websocket'].emit = /** @this{Object} */ function(event, param) { + if ('function' === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param); + } + }; + + // If debug is enabled register simple default logging callbacks for each Event. + + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + }, + createSocket(family, type, protocol) { + type &= ~526336; // Some applications may pass it; it makes no sense for a single process. + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0. + } + + // create our internal socket structure + var sock = { + family, + type, + protocol, + server: null, + error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + + // create the filesystem node to store the socket structure + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + + // and the wrapping stream that enables library functions such + // as read and write to indirectly interact with the socket + var stream = FS.createStream({ + path: name, + node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + + // map the new stream to the socket structure (sockets have a 1:1 + // relationship with a stream) + sock.stream = stream; + + return sock; + }, + getSocket(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + }, + stream_ops:{ + poll(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + }, + ioctl(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + }, + read(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + // socket is closed + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + }, + write(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + }, + close(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + }, + }, + nextname() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return 'socket[' + (SOCKFS.nextname.current++) + ']'; + }, + websocket_sock_ops:{ + createPeer(sock, addr, port) { + var ws; + + if (typeof addr == 'object') { + ws = addr; + addr = null; + port = null; + } + + if (ws) { + // for sockets that've already connected (e.g. we're the server) + // we can inspect the _socket property for the address + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } + // if we're just now initializing a connection to the remote, + // inspect the url property + else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error('WebSocket URL must be in the format ws(s)://address:port'); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + // create the actual websocket object and connect + try { + // runtimeConfig gets set to true if WebSocket runtime configuration is available. + var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket'])); + + // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#' + // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again. + var url = 'ws:#'.replace('#', '//'); + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['url']) { + url = Module['websocket']['url']; // Fetch runtime WebSocket URL config. + } + } + + if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it. + var parts = addr.split('/'); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/'); + } + + // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set. + var subProtocols = 'binary'; // The default value is 'binary' + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['subprotocol']) { + subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config. + } + } + + // The default WebSocket options + var opts = undefined; + + if (subProtocols !== 'null') { + // The regex trims the string (removes spaces at the beginning and end, then splits the string by + // , into an Array. Whitespace removal is important for Websockify and ws. + subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */); + + opts = subProtocols; + } + + // some webservers (azure) does not support subprotocol header + if (runtimeConfig && null === Module['websocket']['subprotocol']) { + subProtocols = 'null'; + opts = undefined; + } + + // If node we use the ws library. + var WebSocketConstructor; + if (ENVIRONMENT_IS_NODE) { + WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws')); + } else + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = 'arraybuffer'; + } catch (e) { + throw new FS.ErrnoError(23); + } + } + + var peer = { + addr, + port, + socket: ws, + dgram_send_queue: [] + }; + + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + + // if this is a bound dgram socket, send the port number first to allow + // us to override the ephemeral port reported to us by remotePort on the + // remote end. + if (sock.type === 2 && typeof sock.sport != 'undefined') { + peer.dgram_send_queue.push(new Uint8Array([ + 255, 255, 255, 255, + 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0), + ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff) + ])); + } + + return peer; + }, + getPeer(sock, addr, port) { + return sock.peers[addr + ':' + port]; + }, + addPeer(sock, peer) { + sock.peers[peer.addr + ':' + peer.port] = peer; + }, + removePeer(sock, peer) { + delete sock.peers[peer.addr + ':' + peer.port]; + }, + handlePeerEvents(sock, peer) { + var first = true; + + var handleOpen = function () { + + Module['websocket'].emit('open', sock.stream.fd); + + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift(); + } + } catch (e) { + // not much we can do here in the way of proper error handling as we've already + // lied and said this data was sent. shut it down. + peer.socket.close(); + } + }; + + function handleMessage(data) { + if (typeof data == 'string') { + var encoder = new TextEncoder(); // should be utf-8 + data = encoder.encode(data); // make a typed array from the string + } else { + assert(data.byteLength !== undefined); // must receive an ArrayBuffer + if (data.byteLength == 0) { + // An empty ArrayBuffer will emit a pseudo disconnect event + // as recv/recvmsg will return zero which indicates that a socket + // has performed a shutdown although the connection has not been disconnected yet. + return; + } + data = new Uint8Array(data); // make a typed array view on the array buffer + } + + // if this is the port message, override the peer's port with it + var wasfirst = first; + first = false; + if (wasfirst && + data.length === 10 && + data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && + data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) { + // update the peer's port and it's key in the peer map + var newport = ((data[8] << 8) | data[9]); + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + + sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data }); + Module['websocket'].emit('message', sock.stream.fd); + }; + + if (ENVIRONMENT_IS_NODE) { + peer.socket.on('open', handleOpen); + peer.socket.on('message', function(data, isBinary) { + if (!isBinary) { + return; + } + handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer + }); + peer.socket.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + }); + peer.socket.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED + // is still probably the most useful thing to do. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + // don't throw + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module['websocket'].emit('close', sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function(error) { + // The WebSocket spec only allows a 'simple event' to be thrown on error, + // so we only really know as much as ECONNREFUSED. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + }; + } + }, + poll(sock) { + if (sock.type === 1 && sock.server) { + // listen sockets should only say they're available for reading + // if there are pending clients. + return sock.pending.length ? (64 | 1) : 0; + } + + var mask = 0; + var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets + SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : + null; + + if (sock.recv_queue.length || + !dest || // connection-less sockets are always ready to read + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed + mask |= (64 | 1); + } + + if (!dest || // connection-less sockets are always ready to write + (dest && dest.socket.readyState === dest.socket.OPEN)) { + mask |= 4; + } + + if ((dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { + mask |= 16; + } + + return mask; + }, + ioctl(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + HEAP32[((arg)>>2)] = bytes; + return 0; + default: + return 28; + } + }, + close(sock) { + // if we've spawned a listen server, close it + if (sock.server) { + try { + sock.server.close(); + } catch (e) { + } + sock.server = null; + } + // close any peer connections + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) { + } + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + }, + bind(sock, addr, port) { + if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') { + throw new FS.ErrnoError(28); // already bound + } + sock.saddr = addr; + sock.sport = port; + // in order to emulate dgram sockets, we need to launch a listen server when + // binding on a connection-less socket + // note: this is only required on the server side + if (sock.type === 2) { + // close the existing server if it exists + if (sock.server) { + sock.server.close(); + sock.server = null; + } + // swallow error operation not supported error that occurs when binding in the + // browser where this isn't supported + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e.name === 'ErrnoError')) throw e; + if (e.errno !== 138) throw e; + } + } + }, + connect(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138); + } + + // TODO autobind + // if (!sock.addr && sock.type == 2) { + // } + + // early out if we're already connected / in the middle of connecting + if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7); + } else { + throw new FS.ErrnoError(30); + } + } + } + + // add the socket to our peer list and set our + // destination address / port to match + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + + // always "fail" in non-blocking mode + throw new FS.ErrnoError(26); + }, + listen(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138); + } + if (sock.server) { + throw new FS.ErrnoError(28); // already listening + } + var WebSocketServer = require('ws').Server; + var host = sock.saddr; + sock.server = new WebSocketServer({ + host, + port: sock.sport + // TODO support backlog + }); + Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd. + + sock.server.on('connection', function(ws) { + if (sock.type === 1) { + var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol); + + // create a peer on the new socket + var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws); + newsock.daddr = peer.addr; + newsock.dport = peer.port; + + // push to queue for accept to pick up + sock.pending.push(newsock); + Module['websocket'].emit('connection', newsock.stream.fd); + } else { + // create a peer on the listen socket so calling sendto + // with the listen socket and an address will resolve + // to the correct client + SOCKFS.websocket_sock_ops.createPeer(sock, ws); + Module['websocket'].emit('connection', sock.stream.fd); + } + }); + sock.server.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + sock.server = null; + }); + sock.server.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH + // is still probably the most useful thing to do. This error shouldn't + // occur in a well written app as errors should get trapped in the compiled + // app's own getaddrinfo call. + sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']); + // don't throw + }); + }, + accept(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + }, + getname(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53); + } + addr = sock.daddr; + port = sock.dport; + } else { + // TODO saddr and sport will be set for bind()'d UDP sockets, but what + // should we be returning for TCP sockets that've been connect()'d? + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { addr, port }; + }, + sendmsg(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + // connection-less sockets will honor the message address, + // and otherwise fall back to the bound destination address + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + // if there was no address to fall back to, error out + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17); + } + } else { + // connection-based sockets will only use the bound + addr = sock.daddr; + port = sock.dport; + } + + // find the peer for the destination address + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + + // early out if not connected with a connection-based socket + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(53); + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(6); + } + } + + // create a copy of the incoming data to send, as the WebSocket API + // doesn't work entirely with an ArrayBufferView, it'll just send + // the entire underlying buffer + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + + var data; + data = buffer.slice(offset, offset + length); + + // if we're emulating a connection-less dgram socket and don't have + // a cached connection, queue the buffer to send upon connect and + // lie, saying the data was sent now. + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + // if we're not connected, open a new connection + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + dest.dgram_send_queue.push(data); + return length; + } + } + + try { + // send the actual data + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(28); + } + }, + recvmsg(sock, length) { + // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html + if (sock.type === 1 && sock.server) { + // tcp servers should not be recv()'ing on the listen socket + throw new FS.ErrnoError(53); + } + + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + + if (!dest) { + // if we have a destination address but are not connected, error out + throw new FS.ErrnoError(53); + } + if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + // return null if the socket has closed + return null; + } + // else, our socket is in a valid state but truly has nothing available + throw new FS.ErrnoError(6); + } + throw new FS.ErrnoError(6); + } + + // queued.data will be an ArrayBuffer if it's unadulterated, but if it's + // requeued TCP data it'll be an ArrayBufferView + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + + // push back any unread data for TCP connections + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued); + } + + return res; + }, + }, + }; + + var getSocketFromFD = (fd) => { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket; + }; + + var setErrNo = (value) => { + HEAP32[((___errno_location())>>2)] = value; + return value; + }; + var Sockets = { + BUFFER_SIZE:10240, + MAX_BUFFER_SIZE:10485760, + nextFd:1, + fds:{ + }, + nextport:1, + maxport:65535, + peer:null, + connections:{ + }, + portmap:{ + }, + localAddr:4261412874, + addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034], + }; + + var inetPton4 = (str) => { + var b = str.split('.'); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0; + }; + + + /** @suppress {checkTypes} */ + var jstoi_q = (str) => parseInt(str); + var inetPton6 = (str) => { + var words; + var w, offset, z, i; + /* http://home.deds.nl/~aeron/regex/ */ + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0]; + } + // Z placeholder to keep track of zeros when splitting the string on ":" + if (str.startsWith("::")) { + str = str.replace("::", "Z:"); // leading zeros case + } else { + str = str.replace("::", ":Z:"); + } + + if (str.indexOf(".") > 0) { + // parse IPv4 embedded stress + str = str.replace(new RegExp('[.]', 'g'), ":"); + words = str.split(":"); + words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256; + words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256; + words = words.slice(0, words.length-2); + } else { + words = str.split(":"); + } + + offset = 0; z = 0; + for (w=0; w < words.length; w++) { + if (typeof words[w] == 'string') { + if (words[w] === 'Z') { + // compressed zeros - write appropriate number of zero words + for (z = 0; z < (8 - words.length+1); z++) { + parts[w+z] = 0; + } + offset = z-1; + } else { + // parse hex to field to 16-bit value and write it in network byte-order + parts[w+offset] = _htons(parseInt(words[w],16)); + } + } else { + // parsed IPv4 words + parts[w+offset] = words[w]; + } + } + return [ + (parts[1] << 16) | parts[0], + (parts[3] << 16) | parts[2], + (parts[5] << 16) | parts[4], + (parts[7] << 16) | parts[6] + ]; + }; + + + /** @param {number=} addrlen */ + var writeSockaddr = (sa, family, addr, port, addrlen) => { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 16; + } + HEAP16[((sa)>>1)] = family; + HEAP32[(((sa)+(4))>>2)] = addr; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 28; + } + HEAP32[((sa)>>2)] = family; + HEAP32[(((sa)+(8))>>2)] = addr[0]; + HEAP32[(((sa)+(12))>>2)] = addr[1]; + HEAP32[(((sa)+(16))>>2)] = addr[2]; + HEAP32[(((sa)+(20))>>2)] = addr[3]; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + default: + return 5; + } + return 0; + }; + + + var DNS = { + address_map:{ + id:1, + addrs:{ + }, + names:{ + }, + }, + lookup_name(name) { + // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one. + var res = inetPton4(name); + if (res !== null) { + return name; + } + res = inetPton6(name); + if (res !== null) { + return name; + } + + // See if this name is already mapped. + var addr; + + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, 'exceeded max address mappings of 65535'); + + addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00); + + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + + return addr; + }, + lookup_addr(addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + + return null; + }, + }; + + function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) { + try { + + var sock = getSocketFromFD(fd); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen); + assert(!errno); + } + return newsock.stream.fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + var inetNtop4 = (addr) => { + return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff) + }; + + + var inetNtop6 = (ints) => { + // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4 + // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses + // 128-bits are split into eight 16-bit words + // stored in network byte order (big-endian) + // | 80 bits | 16 | 32 bits | + // +-----------------------------------------------------------------+ + // | 10 bytes | 2 | 4 bytes | + // +--------------------------------------+--------------------------+ + // + 5 words | 1 | 2 words | + // +--------------------------------------+--------------------------+ + // |0000..............................0000|0000| IPv4 ADDRESS | (compatible) + // +--------------------------------------+----+---------------------+ + // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped) + // +--------------------------------------+----+---------------------+ + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ + ints[0] & 0xffff, + (ints[0] >> 16), + ints[1] & 0xffff, + (ints[1] >> 16), + ints[2] & 0xffff, + (ints[2] >> 16), + ints[3] & 0xffff, + (ints[3] >> 16) + ]; + + // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses + + var hasipv4 = true; + var v4part = ""; + // check if the 10 high-order bytes are all zeros (first 5 words) + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { hasipv4 = false; break; } + } + + if (hasipv4) { + // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words) + v4part = inetNtop4(parts[6] | (parts[7] << 16)); + // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word) + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word) + if (parts[5] === 0) { + str = "::"; + //special case IPv6 addresses + if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address + if (v4part === "0.0.0.1") v4part = "1";// loopback address + str += v4part; + return str; + } + } + + // Handle all other IPv6 addresses + + // first run to find the longest contiguous zero words + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + + for (word = 0; word < 8; word++) { + if (longest > 1) { + // compress contiguous zeros - to produce "::" + if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; //leading zeros case + } + continue; + } + } + // converts 16-bit words from big-endian to little-endian before converting to hex string + str += Number(_ntohs(parts[word] & 0xffff)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; + }; + + var readSockaddr = (sa, salen) => { + // family / port offsets are common to both sockaddr_in and sockaddr_in6 + var family = HEAP16[((sa)>>1)]; + var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]); + var addr; + + switch (family) { + case 2: + if (salen !== 16) { + return { errno: 28 }; + } + addr = HEAP32[(((sa)+(4))>>2)]; + addr = inetNtop4(addr); + break; + case 10: + if (salen !== 28) { + return { errno: 28 }; + } + addr = [ + HEAP32[(((sa)+(8))>>2)], + HEAP32[(((sa)+(12))>>2)], + HEAP32[(((sa)+(16))>>2)], + HEAP32[(((sa)+(20))>>2)] + ]; + addr = inetNtop6(addr); + break; + default: + return { errno: 5 }; + } + + return { family: family, addr: addr, port: port }; + }; + + + /** @param {boolean=} allowNull */ + var getSocketAddress = (addrp, addrlen, allowNull) => { + if (allowNull && addrp === 0) return null; + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + }; + + function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_chdir(path) { + try { + + path = SYSCALLS.getStr(path); + FS.chdir(path); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_chmod(path, mode) { + try { + + path = SYSCALLS.getStr(path); + FS.chmod(path, mode); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_dup(fd) { + try { + + var old = SYSCALLS.getStreamFromFD(fd); + return FS.createStream(old).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_dup3(fd, newfd, flags) { + try { + + var old = SYSCALLS.getStreamFromFD(fd); + assert(!flags); + if (old.fd === newfd) return -28; + var existing = FS.getStream(newfd); + if (existing) FS.close(existing); + return FS.createStream(old, newfd).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_faccessat(dirfd, path, amode, flags) { + try { + + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + if (amode & ~7) { + // need a valid mode + return -28; + } + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node) { + return -44; + } + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -2; + } + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_fchownat(dirfd, path, owner, group, flags) { + try { + + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + flags = flags & (~256); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + (nofollow ? FS.lchown : FS.chown)(path, owner, group); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + function ___syscall_fcntl64(fd, cmd, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28; + } + while (FS.streams[arg]) { + arg++; + } + var newStream; + newStream = FS.createStream(stream, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 5: { + var arg = SYSCALLS.getp(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)] = 2; + return 0; + } + case 6: + case 7: + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -28; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves. + setErrNo(28); + return -1; + default: { + return -28; + } + } + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_fdatasync(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + return 0; // we can't do anything synchronously; the in-memory FS is already synced to + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_fstat64(fd, buf) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + return SYSCALLS.doStat(FS.stat, stream.path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + var convertI32PairToI53Checked = (lo, hi) => { + assert(lo == (lo >>> 0) || lo == (lo|0)); // lo should either be a i32 or a u32 + assert(hi === (hi|0)); // hi should be a i32 + return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN; + }; + function ___syscall_ftruncate64(fd,length_low, length_high) { + var length = convertI32PairToI53Checked(length_low, length_high);; + + + try { + + if (isNaN(length)) return 61; + FS.ftruncate(fd, length); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + ; + } + + + var stringToUTF8 = (str, outPtr, maxBytesToWrite) => { + assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite); + }; + + function ___syscall_getcwd(buf, size) { + try { + + if (size === 0) return -28; + var cwd = FS.cwd(); + var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1; + if (size < cwdLengthInBytes) return -68; + stringToUTF8(cwd, buf, size); + return cwdLengthInBytes; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + function ___syscall_getdents64(fd, dirp, count) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd) + if (!stream.getdents) { + stream.getdents = FS.readdir(stream.path); + } + + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + + var idx = Math.floor(off / struct_size); + + while (idx < stream.getdents.length && pos + struct_size <= count) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === '.') { + id = stream.node.id; + type = 4; // DT_DIR + } + else if (name === '..') { + var lookup = FS.lookupPath(stream.path, { parent: true }); + id = lookup.node.id; + type = 4; // DT_DIR + } + else { + var child = FS.lookupNode(stream.node, name); + id = child.id; + type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device. + FS.isDir(child.mode) ? 4 : // DT_DIR, directory. + FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link. + 8; // DT_REG, regular file. + } + assert(id); + (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]); + (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]); + HEAP16[(((dirp + pos)+(16))>>1)] = 280; + HEAP8[(((dirp + pos)+(18))>>0)] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + idx += 1; + } + FS.llseek(stream, idx * struct_size, 0); + return pos; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + + function ___syscall_getpeername(fd, addr, addrlen, d1, d2, d3) { + try { + + var sock = getSocketFromFD(fd); + if (!sock.daddr) { + return -53; // The socket is not connected. + } + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport, addrlen); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + + function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) { + try { + + var sock = getSocketFromFD(fd); + // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport, addrlen); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) { + try { + + var sock = getSocketFromFD(fd); + // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211 + // so only supports SOL_SOCKET with SO_ERROR. + if (level === 1) { + if (optname === 4) { + HEAP32[((optval)>>2)] = sock.error; + HEAP32[((optlen)>>2)] = 4; + sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field). + return 0; + } + } + return -50; // The option is unknown at the level indicated. + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_ioctl(fd, op, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: { + if (!stream.tty) return -59; + return 0; + } + case 21505: { + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tcgets) { + var termios = stream.tty.ops.ioctl_tcgets(stream); + var argp = SYSCALLS.getp(); + HEAP32[((argp)>>2)] = termios.c_iflag || 0; + HEAP32[(((argp)+(4))>>2)] = termios.c_oflag || 0; + HEAP32[(((argp)+(8))>>2)] = termios.c_cflag || 0; + HEAP32[(((argp)+(12))>>2)] = termios.c_lflag || 0; + for (var i = 0; i < 32; i++) { + HEAP8[(((argp + i)+(17))>>0)] = termios.c_cc[i] || 0; + } + return 0; + } + return 0; + } + case 21510: + case 21511: + case 21512: { + if (!stream.tty) return -59; + return 0; // no-op, not actually adjusting terminal settings + } + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tcsets) { + var argp = SYSCALLS.getp(); + var c_iflag = HEAP32[((argp)>>2)]; + var c_oflag = HEAP32[(((argp)+(4))>>2)]; + var c_cflag = HEAP32[(((argp)+(8))>>2)]; + var c_lflag = HEAP32[(((argp)+(12))>>2)]; + var c_cc = [] + for (var i = 0; i < 32; i++) { + c_cc.push(HEAP8[(((argp + i)+(17))>>0)]); + } + return stream.tty.ops.ioctl_tcsets(stream.tty, op, { c_iflag, c_oflag, c_cflag, c_lflag, c_cc }); + } + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -59; + var argp = SYSCALLS.getp(); + HEAP32[((argp)>>2)] = 0; + return 0; + } + case 21520: { + if (!stream.tty) return -59; + return -28; // not supported + } + case 21531: { + var argp = SYSCALLS.getp(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tiocgwinsz) { + var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty); + var argp = SYSCALLS.getp(); + HEAP16[((argp)>>1)] = winsize[0]; + HEAP16[(((argp)+(2))>>1)] = winsize[1]; + } + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -59; + return 0; + } + case 21515: { + if (!stream.tty) return -59; + return 0; + } + default: return -28; // not supported + } + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + function ___syscall_listen(fd, backlog) { + try { + + var sock = getSocketFromFD(fd); + sock.sock_ops.listen(sock, backlog); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_lstat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_mkdirat(dirfd, path, mode) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_newfstatat(dirfd, path, buf, flags) { + try { + + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & (~6400); + assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`); + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_openat(dirfd, path, flags, varargs) { + SYSCALLS.varargs = varargs; + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? SYSCALLS.get() : 0; + return FS.open(path, flags, mode).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + var PIPEFS = { + BUCKET_BUFFER_SIZE:8192, + mount(mount) { + // Do not pollute the real root directory or its child nodes with pipes + // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + }, + createPipe() { + var pipe = { + buckets: [], + // refcnt 2 because pipe has a read end and a write end. We need to be + // able to read from the read end after write end is closed. + refcnt : 2, + }; + + pipe.buckets.push({ + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0 + }); + + var rName = PIPEFS.nextname(); + var wName = PIPEFS.nextname(); + var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0); + var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0); + + rNode.pipe = pipe; + wNode.pipe = pipe; + + var readableStream = FS.createStream({ + path: rName, + node: rNode, + flags: 0, + seekable: false, + stream_ops: PIPEFS.stream_ops + }); + rNode.stream = readableStream; + + var writableStream = FS.createStream({ + path: wName, + node: wNode, + flags: 1, + seekable: false, + stream_ops: PIPEFS.stream_ops + }); + wNode.stream = writableStream; + + return { + readable_fd: readableStream.fd, + writable_fd: writableStream.fd + }; + }, + stream_ops:{ + poll(stream) { + var pipe = stream.node.pipe; + + if ((stream.flags & 2097155) === 1) { + return (256 | 4); + } + if (pipe.buckets.length > 0) { + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + if (bucket.offset - bucket.roffset > 0) { + return (64 | 1); + } + } + } + + return 0; + }, + ioctl(stream, request, varargs) { + return 28; + }, + fsync(stream) { + return 28; + }, + read(stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + var currentLength = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + currentLength += bucket.offset - bucket.roffset; + } + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + if (length <= 0) { + return 0; + } + if (currentLength == 0) { + // Behave as if the read end is always non-blocking + throw new FS.ErrnoError(6); + } + var toRead = Math.min(currentLength, length); + + var totalRead = toRead; + var toRemove = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var currBucket = pipe.buckets[i]; + var bucketSize = currBucket.offset - currBucket.roffset; + + if (toRead <= bucketSize) { + var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset); + if (toRead < bucketSize) { + tmpSlice = tmpSlice.subarray(0, toRead); + currBucket.roffset += toRead; + } else { + toRemove++; + } + data.set(tmpSlice); + break; + } else { + var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset); + data.set(tmpSlice); + data = data.subarray(tmpSlice.byteLength); + toRead -= tmpSlice.byteLength; + toRemove++; + } + } + + if (toRemove && toRemove == pipe.buckets.length) { + // Do not generate excessive garbage in use cases such as + // write several bytes, read everything, write several bytes, read everything... + toRemove--; + pipe.buckets[toRemove].offset = 0; + pipe.buckets[toRemove].roffset = 0; + } + + pipe.buckets.splice(0, toRemove); + + return totalRead; + }, + write(stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + var dataLen = data.byteLength; + if (dataLen <= 0) { + return 0; + } + + var currBucket = null; + + if (pipe.buckets.length == 0) { + currBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0 + }; + pipe.buckets.push(currBucket); + } else { + currBucket = pipe.buckets[pipe.buckets.length - 1]; + } + + assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE); + + var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset; + if (freeBytesInCurrBuffer >= dataLen) { + currBucket.buffer.set(data, currBucket.offset); + currBucket.offset += dataLen; + return dataLen; + } else if (freeBytesInCurrBuffer > 0) { + currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset); + currBucket.offset += freeBytesInCurrBuffer; + data = data.subarray(freeBytesInCurrBuffer, data.byteLength); + } + + var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0; + var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE; + + for (var i = 0; i < numBuckets; i++) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: PIPEFS.BUCKET_BUFFER_SIZE, + roffset: 0 + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE)); + data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength); + } + + if (remElements > 0) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: data.byteLength, + roffset: 0 + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data); + } + + return dataLen; + }, + close(stream) { + var pipe = stream.node.pipe; + pipe.refcnt--; + if (pipe.refcnt === 0) { + pipe.buckets = null; + } + }, + }, + nextname() { + if (!PIPEFS.nextname.current) { + PIPEFS.nextname.current = 0; + } + return 'pipe[' + (PIPEFS.nextname.current++) + ']'; + }, + }; + + function ___syscall_pipe(fdPtr) { + try { + + if (fdPtr == 0) { + throw new FS.ErrnoError(21); + } + + var res = PIPEFS.createPipe(); + + HEAP32[((fdPtr)>>2)] = res.readable_fd; + HEAP32[(((fdPtr)+(4))>>2)] = res.writable_fd; + + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_poll(fds, nfds, timeout) { + try { + + var nonzero = 0; + for (var i = 0; i < nfds; i++) { + var pollfd = fds + 8 * i; + var fd = HEAP32[((pollfd)>>2)]; + var events = HEAP16[(((pollfd)+(4))>>1)]; + var mask = 32; + var stream = FS.getStream(fd); + if (stream) { + mask = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + mask = stream.stream_ops.poll(stream, -1); + } + } + mask &= events | 8 | 16; + if (mask) nonzero++; + HEAP16[(((pollfd)+(6))>>1)] = mask; + } + return nonzero; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + function ___syscall_readlinkat(dirfd, path, buf, bufsize) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf+len]; + stringToUTF8(ret, buf, bufsize+1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf+len] = endChar; + return len; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + + function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; // socket is closed + if (addr) { + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen); + assert(!errno); + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + try { + + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_rmdir(path) { + try { + + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + + function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + try { + + var sock = getSocketFromFD(fd); + var dest = getSocketAddress(addr, addr_len, true); + if (!dest) { + // send, no address provided + return FS.write(sock.stream, HEAP8, message, length); + } + // sendto an address + return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port); + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + + function ___syscall_socket(domain, type, protocol) { + try { + + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63 + return sock.stream.fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_stat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_statfs64(path, size, buf) { + try { + + path = SYSCALLS.getStr(path); + assert(size === 64); + // NOTE: None of the constants here are true. We're just returning safe and + // sane values. + HEAP32[(((buf)+(4))>>2)] = 4096; + HEAP32[(((buf)+(40))>>2)] = 4096; + HEAP32[(((buf)+(8))>>2)] = 1000000; + HEAP32[(((buf)+(12))>>2)] = 500000; + HEAP32[(((buf)+(16))>>2)] = 500000; + HEAP32[(((buf)+(20))>>2)] = FS.nextInode; + HEAP32[(((buf)+(24))>>2)] = 1000000; + HEAP32[(((buf)+(28))>>2)] = 42; + HEAP32[(((buf)+(44))>>2)] = 2; // ST_NOSUID + HEAP32[(((buf)+(36))>>2)] = 255; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_symlink(target, linkpath) { + try { + + target = SYSCALLS.getStr(target); + linkpath = SYSCALLS.getStr(linkpath); + FS.symlink(target, linkpath); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + function ___syscall_unlinkat(dirfd, path, flags) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path); + } else if (flags === 512) { + FS.rmdir(path); + } else { + abort('Invalid flags passed to unlinkat'); + } + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + var readI53FromI64 = (ptr) => { + return HEAPU32[((ptr)>>2)] + HEAP32[(((ptr)+(4))>>2)] * 4294967296; + }; + + function ___syscall_utimensat(dirfd, path, times, flags) { + try { + + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path, true); + if (!times) { + var atime = Date.now(); + var mtime = atime; + } else { + var seconds = readI53FromI64(times); + var nanoseconds = HEAP32[(((times)+(8))>>2)]; + atime = (seconds*1000) + (nanoseconds/(1000*1000)); + times += 16; + seconds = readI53FromI64(times); + nanoseconds = HEAP32[(((times)+(8))>>2)]; + mtime = (seconds*1000) + (nanoseconds/(1000*1000)); + } + FS.utime(path, atime, mtime); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + } + + var nowIsMonotonic = true;; + var __emscripten_get_now_is_monotonic = () => nowIsMonotonic; + + var __emscripten_throw_longjmp = () => { + throw Infinity; + }; + + function __gmtime_js(time_low, time_high,tmPtr) { + var time = convertI32PairToI53Checked(time_low, time_high);; + + + var date = new Date(time * 1000); + HEAP32[((tmPtr)>>2)] = date.getUTCSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + ; + } + + var isLeapYear = (year) => { + return year%4 === 0 && (year%100 !== 0 || year%400 === 0); + }; + + var MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335]; + + var MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334]; + var ydayFromDate = (date) => { + var leap = isLeapYear(date.getFullYear()); + var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE); + var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1 + + return yday; + }; + + function __localtime_js(time_low, time_high,tmPtr) { + var time = convertI32PairToI53Checked(time_low, time_high);; + + + var date = new Date(time*1000); + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + + var yday = ydayFromDate(date)|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60); + + // Attention: DST is in December in South, and some regions don't have DST at all. + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0; + HEAP32[(((tmPtr)+(32))>>2)] = dst; + ; + } + + + + var __mktime_js = function(tmPtr) { + + var ret = (() => { + var date = new Date(HEAP32[(((tmPtr)+(20))>>2)] + 1900, + HEAP32[(((tmPtr)+(16))>>2)], + HEAP32[(((tmPtr)+(12))>>2)], + HEAP32[(((tmPtr)+(8))>>2)], + HEAP32[(((tmPtr)+(4))>>2)], + HEAP32[((tmPtr)>>2)], + 0); + + // There's an ambiguous hour when the time goes back; the tm_isdst field is + // used to disambiguate it. Date() basically guesses, so we fix it up if it + // guessed wrong, or fill in tm_isdst with the guess if it's -1. + var dst = HEAP32[(((tmPtr)+(32))>>2)]; + var guessedOffset = date.getTimezoneOffset(); + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South + if (dst < 0) { + // Attention: some regions don't have DST at all. + HEAP32[(((tmPtr)+(32))>>2)] = Number(summerOffset != winterOffset && dstOffset == guessedOffset); + } else if ((dst > 0) != (dstOffset == guessedOffset)) { + var nonDstOffset = Math.max(winterOffset, summerOffset); + var trueOffset = dst > 0 ? dstOffset : nonDstOffset; + // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up. + date.setTime(date.getTime() + (trueOffset - guessedOffset)*60000); + } + + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + var yday = ydayFromDate(date)|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + // To match expected behavior, update fields from date + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getYear(); + + return date.getTime() / 1000; + })(); + return (setTempRet0((tempDouble=ret,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)), ret>>>0); + }; + + + + + + + function __mmap_js(len,prot,flags,fd,offset_low, offset_high,allocated,addr) { + var offset = convertI32PairToI53Checked(offset_low, offset_high);; + + + try { + + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + var res = FS.mmap(stream, len, offset, prot, flags); + var ptr = res.ptr; + HEAP32[((allocated)>>2)] = res.allocated; + HEAPU32[((addr)>>2)] = ptr; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + ; + } + + + + + function __munmap_js(addr,len,prot,flags,fd,offset_low, offset_high) { + var offset = convertI32PairToI53Checked(offset_low, offset_high);; + + + try { + + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + if (prot & 2) { + SYSCALLS.doMsync(addr, stream, len, flags, offset); + } + FS.munmap(stream); + // implicitly return 0 + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return -e.errno; + } + ; + } + + var timers = { + }; + + var handleException = (e) => { + // Certain exception types we do not treat as errors since they are used for + // internal control flow. + // 1. ExitStatus, which is thrown by exit() + // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others + // that wish to return to JS event loop. + if (e instanceof ExitStatus || e == 'unwind') { + return EXITSTATUS; + } + checkStackCookie(); + if (e instanceof WebAssembly.RuntimeError) { + if (_emscripten_stack_get_current() <= 0) { + err('Stack overflow detected. You can try increasing -sSTACK_SIZE (currently set to 65536)'); + } + } + quit_(1, e); + }; + + + var _proc_exit = (code) => { + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + if (Module['onExit']) Module['onExit'](code); + ABORT = true; + } + quit_(code, new ExitStatus(code)); + }; + /** @suppress {duplicate } */ + /** @param {boolean|number=} implicit */ + var exitJS = (status, implicit) => { + EXITSTATUS = status; + + checkUnflushedContent(); + + // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down + if (keepRuntimeAlive() && !implicit) { + var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`; + readyPromiseReject(msg); + err(msg); + } + + _proc_exit(status); + }; + var _exit = exitJS; + + var maybeExit = () => { + if (!keepRuntimeAlive()) { + try { + _exit(EXITSTATUS); + } catch (e) { + handleException(e); + } + } + }; + var callUserCallback = (func) => { + if (ABORT) { + err('user callback triggered after runtime exited or application aborted. Ignoring.'); + return; + } + try { + func(); + maybeExit(); + } catch (e) { + handleException(e); + } + }; + + + var _emscripten_get_now; + // Modern environment where performance.now() is supported: + // N.B. a shorter form "_emscripten_get_now = performance.now;" is + // unfortunately not allowed even in current browsers (e.g. FF Nightly 75). + _emscripten_get_now = () => performance.now(); + ; + var __setitimer_js = (which, timeout_ms) => { + // First, clear any existing timer. + if (timers[which]) { + clearTimeout(timers[which].id); + delete timers[which]; + } + + // A timeout of zero simply cancels the current timeout so we have nothing + // more to do. + if (!timeout_ms) return 0; + + var id = setTimeout(() => { + assert(which in timers); + delete timers[which]; + callUserCallback(() => __emscripten_timeout(which, _emscripten_get_now())); + }, timeout_ms); + timers[which] = { id, timeout_ms }; + return 0; + }; + + + + var stringToNewUTF8 = (str) => { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8(str, ret, size); + return ret; + }; + var __tzset_js = (timezone, daylight, tzname) => { + // TODO: Use (malleable) environment variables instead of system settings. + var currentYear = new Date().getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + + // Local standard timezone offset. Local standard time is not adjusted for daylight savings. + // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST). + // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST). + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + + // timezone is specified as seconds west of UTC ("The external variable + // `timezone` shall be set to the difference, in seconds, between + // Coordinated Universal Time (UTC) and local standard time."), the same + // as returned by stdTimezoneOffset. + // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html + HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60; + + HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset); + + function extractZone(date) { + var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); + return match ? match[1] : "GMT"; + }; + var winterName = extractZone(winter); + var summerName = extractZone(summer); + var winterNamePtr = stringToNewUTF8(winterName); + var summerNamePtr = stringToNewUTF8(summerName); + if (summerOffset < winterOffset) { + // Northern hemisphere + HEAPU32[((tzname)>>2)] = winterNamePtr; + HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr; + } else { + HEAPU32[((tzname)>>2)] = summerNamePtr; + HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr; + } + }; + + var _abort = () => { + abort('native code called abort()'); + }; + + var _emscripten_date_now = () => Date.now(); + + var _emscripten_err = (str) => err(UTF8ToString(str)); + + var getHeapMax = () => + HEAPU8.length; + var _emscripten_get_heap_max = () => getHeapMax(); + + + var _emscripten_memcpy_js = (dest, src, num) => HEAPU8.copyWithin(dest, src, src + num); + + + var abortOnCannotGrowMemory = (requestedSize) => { + abort(`Cannot enlarge memory arrays to size ${requestedSize} bytes (OOM). Either (1) compile with -sINITIAL_MEMORY=X with X higher than the current value ${HEAP8.length}, (2) compile with -sALLOW_MEMORY_GROWTH which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -sABORTING_MALLOC=0`); + }; + var _emscripten_resize_heap = (requestedSize) => { + var oldSize = HEAPU8.length; + // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned. + requestedSize >>>= 0; + abortOnCannotGrowMemory(requestedSize); + }; + + var ENV = { + }; + + var getExecutableName = () => { + return thisProgram || './this.program'; + }; + var getEnvStrings = () => { + if (!getEnvStrings.strings) { + // Default values. + // Browser language detection #8751 + var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8'; + var env = { + 'USER': 'web_user', + 'LOGNAME': 'web_user', + 'PATH': '/', + 'PWD': '/', + 'HOME': '/home/web_user', + 'LANG': lang, + '_': getExecutableName() + }; + // Apply the user-provided values, if any. + for (var x in ENV) { + // x is a key in ENV; if ENV[x] is undefined, that means it was + // explicitly set to be so. We allow user code to do that to + // force variables with default values to remain unset. + if (ENV[x] === undefined) delete env[x]; + else env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(`${x}=${env[x]}`); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; + }; + + var stringToAscii = (str, buffer) => { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff)); + HEAP8[((buffer++)>>0)] = str.charCodeAt(i); + } + // Null-terminate the string + HEAP8[((buffer)>>0)] = 0; + }; + + var _environ_get = (__environ, environ_buf) => { + var bufSize = 0; + getEnvStrings().forEach((string, i) => { + var ptr = environ_buf + bufSize; + HEAPU32[(((__environ)+(i*4))>>2)] = ptr; + stringToAscii(string, ptr); + bufSize += string.length + 1; + }); + return 0; + }; + + + var _environ_sizes_get = (penviron_count, penviron_buf_size) => { + var strings = getEnvStrings(); + HEAPU32[((penviron_count)>>2)] = strings.length; + var bufSize = 0; + strings.forEach((string) => bufSize += string.length + 1); + HEAPU32[((penviron_buf_size)>>2)] = bufSize; + return 0; + }; + + + function _fd_close(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + } + + function _fd_fdstat_get(fd, pbuf) { + try { + + var rightsBase = 0; + var rightsInheriting = 0; + var flags = 0; + { + var stream = SYSCALLS.getStreamFromFD(fd); + // All character devices are terminals (other things a Linux system would + // assume is a character device, like the mouse, we have special APIs for). + var type = stream.tty ? 2 : + FS.isDir(stream.mode) ? 3 : + FS.isLink(stream.mode) ? 7 : + 4; + } + HEAP8[((pbuf)>>0)] = type; + HEAP16[(((pbuf)+(2))>>1)] = flags; + (tempI64 = [rightsBase>>>0,(tempDouble=rightsBase,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]); + (tempI64 = [rightsInheriting>>>0,(tempDouble=rightsInheriting,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + var doReadv = (stream, iov, iovcnt, offset) => { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[((iov)>>2)]; + var len = HEAPU32[(((iov)+(4))>>2)]; + iov += 8; + var curr = FS.read(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + if (typeof offset !== 'undefined') { + offset += curr; + } + } + return ret; + }; + + function _fd_read(fd, iov, iovcnt, pnum) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doReadv(stream, iov, iovcnt); + HEAPU32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + } + + + function _fd_seek(fd,offset_low, offset_high,whence,newOffset) { + var offset = convertI32PairToI53Checked(offset_low, offset_high);; + + + try { + + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + FS.llseek(stream, offset, whence); + (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]); + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + ; + } + + function _fd_sync(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + if (stream.stream_ops && stream.stream_ops.fsync) { + return stream.stream_ops.fsync(stream); + } + return 0; // we can't do anything synchronously; the in-memory FS is already synced to + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + var doWritev = (stream, iov, iovcnt, offset) => { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[((iov)>>2)]; + var len = HEAPU32[(((iov)+(4))>>2)]; + iov += 8; + var curr = FS.write(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (typeof offset !== 'undefined') { + offset += curr; + } + } + return ret; + }; + + function _fd_write(fd, iov, iovcnt, pnum) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doWritev(stream, iov, iovcnt); + HEAPU32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e; + return e.errno; + } + } + + + + + + + + + + + var _getaddrinfo = (node, service, hint, out) => { + // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL + // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we + // really should provide a linked list of suitable addrinfo values. + var addrs = []; + var canon = null; + var addr = 0; + var port = 0; + var flags = 0; + var family = 0; + var type = 0; + var proto = 0; + var ai, last; + + function allocaddrinfo(family, type, proto, canon, addr, port) { + var sa, salen, ai; + var errno; + + salen = family === 10 ? + 28 : + 16; + addr = family === 10 ? + inetNtop6(addr) : + inetNtop4(addr); + sa = _malloc(salen); + errno = writeSockaddr(sa, family, addr, port); + assert(!errno); + + ai = _malloc(32); + HEAP32[(((ai)+(4))>>2)] = family; + HEAP32[(((ai)+(8))>>2)] = type; + HEAP32[(((ai)+(12))>>2)] = proto; + HEAPU32[(((ai)+(24))>>2)] = canon; + HEAPU32[(((ai)+(20))>>2)] = sa; + if (family === 10) { + HEAP32[(((ai)+(16))>>2)] = 28; + } else { + HEAP32[(((ai)+(16))>>2)] = 16; + } + HEAP32[(((ai)+(28))>>2)] = 0; + + return ai; + } + + if (hint) { + flags = HEAP32[((hint)>>2)]; + family = HEAP32[(((hint)+(4))>>2)]; + type = HEAP32[(((hint)+(8))>>2)]; + proto = HEAP32[(((hint)+(12))>>2)]; + } + if (type && !proto) { + proto = type === 2 ? 17 : 6; + } + if (!type && proto) { + type = proto === 17 ? 2 : 1; + } + + // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for + // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints. + if (proto === 0) { + proto = 6; + } + if (type === 0) { + type = 1; + } + + if (!node && !service) { + return -2; + } + if (flags & ~(1|2|4| + 1024|8|16|32)) { + return -1; + } + if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) { + return -1; + } + if (flags & 32) { + // TODO + return -2; + } + if (type !== 0 && type !== 1 && type !== 2) { + return -7; + } + if (family !== 0 && family !== 2 && family !== 10) { + return -6; + } + + if (service) { + service = UTF8ToString(service); + port = parseInt(service, 10); + + if (isNaN(port)) { + if (flags & 1024) { + return -2; + } + // TODO support resolving well-known service names from: + // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt + return -8; + } + } + + if (!node) { + if (family === 0) { + family = 2; + } + if ((flags & 1) === 0) { + if (family === 2) { + addr = _htonl(2130706433); + } else { + addr = [0, 0, 0, 1]; + } + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[((out)>>2)] = ai; + return 0; + } + + // + // try as a numeric address + // + node = UTF8ToString(node); + addr = inetPton4(node); + if (addr !== null) { + // incoming node is a valid ipv4 address + if (family === 0 || family === 2) { + family = 2; + } + else if (family === 10 && (flags & 8)) { + addr = [0, 0, _htonl(0xffff), addr]; + family = 10; + } else { + return -2; + } + } else { + addr = inetPton6(node); + if (addr !== null) { + // incoming node is a valid ipv6 address + if (family === 0 || family === 10) { + family = 10; + } else { + return -2; + } + } + } + if (addr != null) { + ai = allocaddrinfo(family, type, proto, node, addr, port); + HEAPU32[((out)>>2)] = ai; + return 0; + } + if (flags & 4) { + return -2; + } + + // + // try as a hostname + // + // resolve the hostname to a temporary fake address + node = DNS.lookup_name(node); + addr = inetPton4(node); + if (family === 0) { + family = 2; + } else if (family === 10) { + addr = [0, 0, _htonl(0xffff), addr]; + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[((out)>>2)] = ai; + return 0; + }; + + /** @type {function(...*):?} */ + function _getcontext( + ) { + abort('missing function: getcontext'); + } + _getcontext.stub = true; + + /** @type {function(...*):?} */ + function _getdtablesize( + ) { + abort('missing function: getdtablesize'); + } + _getdtablesize.stub = true; + + + + + var getHostByName = (name) => { + // generate hostent + var ret = _malloc(20); // XXX possibly leaked, as are others here + var nameBuf = stringToNewUTF8(name); + HEAPU32[((ret)>>2)] = nameBuf; + var aliasesBuf = _malloc(4); + HEAPU32[((aliasesBuf)>>2)] = 0; + HEAPU32[(((ret)+(4))>>2)] = aliasesBuf; + var afinet = 2; + HEAP32[(((ret)+(8))>>2)] = afinet; + HEAP32[(((ret)+(12))>>2)] = 4; + var addrListBuf = _malloc(12); + HEAPU32[((addrListBuf)>>2)] = addrListBuf+8; + HEAPU32[(((addrListBuf)+(4))>>2)] = 0; + HEAP32[(((addrListBuf)+(8))>>2)] = inetPton4(DNS.lookup_name(name)); + HEAPU32[(((ret)+(16))>>2)] = addrListBuf; + return ret; + }; + + var _gethostbyname = (name) => { + return getHostByName(UTF8ToString(name)); + }; + + + var _gethostbyname_r = (name, ret, buf, buflen, out, err) => { + var data = _gethostbyname(name); + _memcpy(ret, data, 20); + _free(data); + HEAP32[((err)>>2)] = 0; + HEAPU32[((out)>>2)] = ret; + return 0; + }; + + + + + var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => { + var info = readSockaddr(sa, salen); + if (info.errno) { + return -6; + } + var port = info.port; + var addr = info.addr; + + var overflowed = false; + + if (node && nodelen) { + var lookup; + if ((flags & 1) || !(lookup = DNS.lookup_addr(addr))) { + if (flags & 8) { + return -2; + } + } else { + addr = lookup; + } + var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen); + + if (numBytesWrittenExclNull+1 >= nodelen) { + overflowed = true; + } + } + + if (serv && servlen) { + port = '' + port; + var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen); + + if (numBytesWrittenExclNull+1 >= servlen) { + overflowed = true; + } + } + + if (overflowed) { + // Note: even when we overflow, getnameinfo() is specced to write out the truncated results. + return -12; + } + + return 0; + }; + + var Protocols = { + list:[], + map:{ + }, + }; + + + var _setprotoent = (stayopen) => { + // void setprotoent(int stayopen); + + // Allocate and populate a protoent structure given a name, protocol number and array of aliases + function allocprotoent(name, proto, aliases) { + // write name into buffer + var nameBuf = _malloc(name.length + 1); + stringToAscii(name, nameBuf); + + // write aliases into buffer + var j = 0; + var length = aliases.length; + var aliasListBuf = _malloc((length + 1) * 4); // Use length + 1 so we have space for the terminating NULL ptr. + + for (var i = 0; i < length; i++, j += 4) { + var alias = aliases[i]; + var aliasBuf = _malloc(alias.length + 1); + stringToAscii(alias, aliasBuf); + HEAPU32[(((aliasListBuf)+(j))>>2)] = aliasBuf; + } + HEAPU32[(((aliasListBuf)+(j))>>2)] = 0; // Terminating NULL pointer. + + // generate protoent + var pe = _malloc(12); + HEAPU32[((pe)>>2)] = nameBuf; + HEAPU32[(((pe)+(4))>>2)] = aliasListBuf; + HEAP32[(((pe)+(8))>>2)] = proto; + return pe; + }; + + // Populate the protocol 'database'. The entries are limited to tcp and udp, though it is fairly trivial + // to add extra entries from /etc/protocols if desired - though not sure if that'd actually be useful. + var list = Protocols.list; + var map = Protocols.map; + if (list.length === 0) { + var entry = allocprotoent('tcp', 6, ['TCP']); + list.push(entry); + map['tcp'] = map['6'] = entry; + entry = allocprotoent('udp', 17, ['UDP']); + list.push(entry); + map['udp'] = map['17'] = entry; + } + + _setprotoent.index = 0; + }; + + + var _getprotobyname = (name) => { + // struct protoent *getprotobyname(const char *); + name = UTF8ToString(name); + _setprotoent(true); + var result = Protocols.map[name]; + return result; + }; + + + var _getprotobynumber = (number) => { + // struct protoent *getprotobynumber(int proto); + _setprotoent(true); + var result = Protocols.map[number]; + return result; + }; + + /** @type {function(...*):?} */ + function _makecontext( + ) { + abort('missing function: makecontext'); + } + _makecontext.stub = true; + + + + var arraySum = (array, index) => { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) { + // no-op + } + return sum; + }; + + + var MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31]; + + var MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31]; + var addDays = (date, days) => { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth]; + + if (days > daysInCurrentMonth-newDate.getDate()) { + // we spill over to next month + days -= (daysInCurrentMonth-newDate.getDate()+1); + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth+1) + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear()+1); + } + } else { + // we stay in current month + newDate.setDate(newDate.getDate()+days); + return newDate; + } + } + + return newDate; + }; + + + + + var writeArrayToMemory = (array, buffer) => { + assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') + HEAP8.set(array, buffer); + }; + + var _strftime = (s, maxsize, format, tm) => { + // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html + + var tm_zone = HEAPU32[(((tm)+(40))>>2)]; + + var date = { + tm_sec: HEAP32[((tm)>>2)], + tm_min: HEAP32[(((tm)+(4))>>2)], + tm_hour: HEAP32[(((tm)+(8))>>2)], + tm_mday: HEAP32[(((tm)+(12))>>2)], + tm_mon: HEAP32[(((tm)+(16))>>2)], + tm_year: HEAP32[(((tm)+(20))>>2)], + tm_wday: HEAP32[(((tm)+(24))>>2)], + tm_yday: HEAP32[(((tm)+(28))>>2)], + tm_isdst: HEAP32[(((tm)+(32))>>2)], + tm_gmtoff: HEAP32[(((tm)+(36))>>2)], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : '' + }; + + var pattern = UTF8ToString(format); + + // expand format + var EXPANSION_RULES_1 = { + '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013 + '%D': '%m/%d/%y', // Equivalent to %m / %d / %y + '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d + '%h': '%b', // Equivalent to %b + '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation + '%R': '%H:%M', // Replaced by the time in 24-hour notation + '%T': '%H:%M:%S', // Replaced by the time + '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation + '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation + // Modified Conversion Specifiers + '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation. + '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation. + '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation. + '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation. + '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation. + '%EY': '%Y', // Replaced by the full alternative year representation. + '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading characters. + '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading characters. + '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols. + '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols. + '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols. + '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols. + '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols. + '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1). + '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols. + '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols. + '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols. + '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols. + '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols. + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]); + } + + var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']; + var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']; + + function leadingSomething(value, digits, character) { + var str = typeof value == 'number' ? value.toString() : (value || ''); + while (str.length < digits) { + str = character[0]+str; + } + return str; + } + + function leadingNulls(value, digits) { + return leadingSomething(value, digits, '0'); + } + + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : (value > 0 ? 1 : 0); + } + + var compare; + if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) { + compare = sgn(date1.getDate()-date2.getDate()); + } + } + return compare; + } + + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: // Sunday + return new Date(janFourth.getFullYear()-1, 11, 29); + case 1: // Monday + return janFourth; + case 2: // Tuesday + return new Date(janFourth.getFullYear(), 0, 3); + case 3: // Wednesday + return new Date(janFourth.getFullYear(), 0, 2); + case 4: // Thursday + return new Date(janFourth.getFullYear(), 0, 1); + case 5: // Friday + return new Date(janFourth.getFullYear()-1, 11, 31); + case 6: // Saturday + return new Date(janFourth.getFullYear()-1, 11, 30); + } + } + + function getWeekBasedYear(date) { + var thisDate = addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); + + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4); + + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + // this date is after the start of the first week of this year + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear()+1; + } + return thisDate.getFullYear(); + } + return thisDate.getFullYear()-1; + } + + var EXPANSION_RULES_2 = { + '%a': (date) => WEEKDAYS[date.tm_wday].substring(0,3) , + '%A': (date) => WEEKDAYS[date.tm_wday], + '%b': (date) => MONTHS[date.tm_mon].substring(0,3), + '%B': (date) => MONTHS[date.tm_mon], + '%C': (date) => { + var year = date.tm_year+1900; + return leadingNulls((year/100)|0,2); + }, + '%d': (date) => leadingNulls(date.tm_mday, 2), + '%e': (date) => leadingSomething(date.tm_mday, 2, ' '), + '%g': (date) => { + // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year. + // In this system, weeks begin on a Monday and week 1 of the year is the week that includes + // January 4th, which is also the week that includes the first Thursday of the year, and + // is also the first week that contains at least four days in the year. + // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of + // the last week of the preceding year; thus, for Saturday 2nd January 1999, + // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th, + // or 31st is a Monday, it and any following days are part of week 1 of the following year. + // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01. + + return getWeekBasedYear(date).toString().substring(2); + }, + '%G': (date) => getWeekBasedYear(date), + '%H': (date) => leadingNulls(date.tm_hour, 2), + '%I': (date) => { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; + else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2); + }, + '%j': (date) => { + // Day of the year (001-366) + return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year+1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon-1), 3); + }, + '%m': (date) => leadingNulls(date.tm_mon+1, 2), + '%M': (date) => leadingNulls(date.tm_min, 2), + '%n': () => '\n', + '%p': (date) => { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return 'AM'; + } + return 'PM'; + }, + '%S': (date) => leadingNulls(date.tm_sec, 2), + '%t': () => '\t', + '%u': (date) => date.tm_wday || 7, + '%U': (date) => { + var days = date.tm_yday + 7 - date.tm_wday; + return leadingNulls(Math.floor(days / 7), 2); + }, + '%V': (date) => { + // Replaced by the week number of the year (Monday as the first day of the week) + // as a decimal number [01,53]. If the week containing 1 January has four + // or more days in the new year, then it is considered week 1. + // Otherwise, it is the last week of the previous year, and the next week is week 1. + // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday] + var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7); + // If 1 Jan is just 1-3 days past Monday, the previous week + // is also in this year. + if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) { + val++; + } + if (!val) { + val = 52; + // If 31 December of prev year a Thursday, or Friday of a + // leap year, then the prev year has 53 weeks. + var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7; + if (dec31 == 4 || (dec31 == 5 && isLeapYear(date.tm_year%400-1))) { + val++; + } + } else if (val == 53) { + // If 1 January is not a Thursday, and not a Wednesday of a + // leap year, then this year has only 52 weeks. + var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7; + if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year))) + val = 1; + } + return leadingNulls(val, 2); + }, + '%w': (date) => date.tm_wday, + '%W': (date) => { + var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7); + return leadingNulls(Math.floor(days / 7), 2); + }, + '%y': (date) => { + // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year] + return (date.tm_year+1900).toString().substring(2); + }, + // Replaced by the year as a decimal number (for example, 1997). [ tm_year] + '%Y': (date) => date.tm_year+1900, + '%z': (date) => { + // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ). + // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich). + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + // convert from minutes into hhmm format (which means 60 minutes = 100 units) + off = (off / 60)*100 + (off % 60); + return (ahead ? '+' : '-') + String("0000" + off).slice(-4); + }, + '%Z': (date) => date.tm_zone, + '%%': () => '%' + }; + + // Replace %% with a pair of NULLs (which cannot occur in a C string), then + // re-inject them after processing. + pattern = pattern.replace(/%%/g, '\0\0') + for (var rule in EXPANSION_RULES_2) { + if (pattern.includes(rule)) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date)); + } + } + pattern = pattern.replace(/\0\0/g, '%') + + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0; + } + + writeArrayToMemory(bytes, s); + return bytes.length-1; + }; + + + + + + + + + var _strptime = (buf, format, tm) => { + // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html + var pattern = UTF8ToString(format); + + // escape special characters + // TODO: not sure we really need to escape all of these in JS regexps + var SPECIAL_CHARS = '\\!@#$^&*()+=-[]/{}|:<>?,.'; + for (var i=0, ii=SPECIAL_CHARS.length; i=0; i=pattern.indexOf('%')) { + capture.push(pattern[i+1]); + pattern = pattern.replace(new RegExp('\\%'+pattern[i+1], 'g'), ''); + } + + var matches = new RegExp('^'+pattern, "i").exec(UTF8ToString(buf)) + // out(UTF8ToString(buf)+ ' is matched by '+((new RegExp('^'+pattern)).source)+' into: '+JSON.stringify(matches)); + + function initDate() { + function fixup(value, min, max) { + return (typeof value != 'number' || isNaN(value)) ? min : (value>=min ? (value<=max ? value: max): min); + }; + return { + year: fixup(HEAP32[(((tm)+(20))>>2)] + 1900 , 1970, 9999), + month: fixup(HEAP32[(((tm)+(16))>>2)], 0, 11), + day: fixup(HEAP32[(((tm)+(12))>>2)], 1, 31), + hour: fixup(HEAP32[(((tm)+(8))>>2)], 0, 23), + min: fixup(HEAP32[(((tm)+(4))>>2)], 0, 59), + sec: fixup(HEAP32[((tm)>>2)], 0, 59) + }; + }; + + if (matches) { + var date = initDate(); + var value; + + var getMatch = (symbol) => { + var pos = capture.indexOf(symbol); + // check if symbol appears in regexp + if (pos >= 0) { + // return matched value or null (falsy!) for non-matches + return matches[pos+1]; + } + return; + }; + + // seconds + if ((value=getMatch('S'))) { + date.sec = jstoi_q(value); + } + + // minutes + if ((value=getMatch('M'))) { + date.min = jstoi_q(value); + } + + // hours + if ((value=getMatch('H'))) { + // 24h clock + date.hour = jstoi_q(value); + } else if ((value = getMatch('I'))) { + // AM/PM clock + var hour = jstoi_q(value); + if ((value=getMatch('p'))) { + hour += value.toUpperCase()[0] === 'P' ? 12 : 0; + } + date.hour = hour; + } + + // year + if ((value=getMatch('Y'))) { + // parse from four-digit year + date.year = jstoi_q(value); + } else if ((value=getMatch('y'))) { + // parse from two-digit year... + var year = jstoi_q(value); + if ((value=getMatch('C'))) { + // ...and century + year += jstoi_q(value)*100; + } else { + // ...and rule-of-thumb + year += year<69 ? 2000 : 1900; + } + date.year = year; + } + + // month + if ((value=getMatch('m'))) { + // parse from month number + date.month = jstoi_q(value)-1; + } else if ((value=getMatch('b'))) { + // parse from month name + date.month = MONTH_NUMBERS[value.substring(0,3).toUpperCase()] || 0; + // TODO: derive month from day in year+year, week number+day of week+year + } + + // day + if ((value=getMatch('d'))) { + // get day of month directly + date.day = jstoi_q(value); + } else if ((value=getMatch('j'))) { + // get day of month from day of year ... + var day = jstoi_q(value); + var leapYear = isLeapYear(date.year); + for (var month=0; month<12; ++month) { + var daysUntilMonth = arraySum(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, month-1); + if (day<=daysUntilMonth+(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[month]) { + date.day = day-daysUntilMonth; + } + } + } else if ((value=getMatch('a'))) { + // get day of month from weekday ... + var weekDay = value.substring(0,3).toUpperCase(); + if ((value=getMatch('U'))) { + // ... and week number (Sunday being first day of week) + // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Sunday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay() === 0) { + // Jan 1st is a Sunday, and, hence in the 1st CW + endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1)); + } else { + // Jan 1st is not a Sunday, and, hence still in the 0th CW + endDate = addDays(janFirst, 7-janFirst.getDay()+weekDayNumber+7*(weekNumber-1)); + } + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } else if ((value=getMatch('W'))) { + // ... and week number (Monday being first day of week) + // Week number of the year (Monday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Monday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay()===1) { + // Jan 1st is a Monday, and, hence in the 1st CW + endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1)); + } else { + // Jan 1st is not a Monday, and, hence still in the 0th CW + endDate = addDays(janFirst, 7-janFirst.getDay()+1+weekDayNumber+7*(weekNumber-1)); + } + + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } + } + + /* + tm_sec int seconds after the minute 0-61* + tm_min int minutes after the hour 0-59 + tm_hour int hours since midnight 0-23 + tm_mday int day of the month 1-31 + tm_mon int months since January 0-11 + tm_year int years since 1900 + tm_wday int days since Sunday 0-6 + tm_yday int days since January 1 0-365 + tm_isdst int Daylight Saving Time flag + */ + + var fullDate = new Date(date.year, date.month, date.day, date.hour, date.min, date.sec, 0); + HEAP32[((tm)>>2)] = fullDate.getSeconds(); + HEAP32[(((tm)+(4))>>2)] = fullDate.getMinutes(); + HEAP32[(((tm)+(8))>>2)] = fullDate.getHours(); + HEAP32[(((tm)+(12))>>2)] = fullDate.getDate(); + HEAP32[(((tm)+(16))>>2)] = fullDate.getMonth(); + HEAP32[(((tm)+(20))>>2)] = fullDate.getFullYear()-1900; + HEAP32[(((tm)+(24))>>2)] = fullDate.getDay(); + HEAP32[(((tm)+(28))>>2)] = arraySum(isLeapYear(fullDate.getFullYear()) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, fullDate.getMonth()-1)+fullDate.getDate()-1; + HEAP32[(((tm)+(32))>>2)] = 0; + + // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F + // TODO: not sure that intArrayFromString handles all unicode characters correctly + return buf+intArrayFromString(matches[0]).length-1; + } + + return 0; + }; + + /** @type {function(...*):?} */ + function _swapcontext( + ) { + abort('missing function: swapcontext'); + } + _swapcontext.stub = true; + + + var getCFunc = (ident) => { + var func = Module['_' + ident]; // closure exported function + assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported'); + return func; + }; + + + + var stringToUTF8OnStack = (str) => { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8(str, ret, size); + return ret; + }; + + + /** + * @param {string|null=} returnType + * @param {Array=} argTypes + * @param {Arguments|Array=} args + * @param {Object=} opts + */ + var ccall = (ident, returnType, argTypes, args, opts) => { + // For fast lookup of conversion functions + var toC = { + 'string': (str) => { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + ret = stringToUTF8OnStack(str); + } + return ret; + }, + 'array': (arr) => { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + } + }; + + function convertReturnValue(ret) { + if (returnType === 'string') { + + return UTF8ToString(ret); + } + if (returnType === 'boolean') return Boolean(ret); + return ret; + } + + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== 'array', 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + function onDone(ret) { + if (stack !== 0) stackRestore(stack); + return convertReturnValue(ret); + } + + ret = onDone(ret); + return ret; + }; + + var FSNode = /** @constructor */ function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + var readMode = 292/*292*/ | 73/*73*/; + var writeMode = 146/*146*/; + Object.defineProperties(FSNode.prototype, { + read: { + get: /** @this{FSNode} */function() { + return (this.mode & readMode) === readMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode; + } + }, + write: { + get: /** @this{FSNode} */function() { + return (this.mode & writeMode) === writeMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode; + } + }, + isFolder: { + get: /** @this{FSNode} */function() { + return FS.isDir(this.mode); + } + }, + isDevice: { + get: /** @this{FSNode} */function() { + return FS.isChrdev(this.mode); + } + } + }); + FS.FSNode = FSNode; + FS.createPreloadedFile = FS_createPreloadedFile; + FS.staticInit();; +ERRNO_CODES = { + 'EPERM': 63, + 'ENOENT': 44, + 'ESRCH': 71, + 'EINTR': 27, + 'EIO': 29, + 'ENXIO': 60, + 'E2BIG': 1, + 'ENOEXEC': 45, + 'EBADF': 8, + 'ECHILD': 12, + 'EAGAIN': 6, + 'EWOULDBLOCK': 6, + 'ENOMEM': 48, + 'EACCES': 2, + 'EFAULT': 21, + 'ENOTBLK': 105, + 'EBUSY': 10, + 'EEXIST': 20, + 'EXDEV': 75, + 'ENODEV': 43, + 'ENOTDIR': 54, + 'EISDIR': 31, + 'EINVAL': 28, + 'ENFILE': 41, + 'EMFILE': 33, + 'ENOTTY': 59, + 'ETXTBSY': 74, + 'EFBIG': 22, + 'ENOSPC': 51, + 'ESPIPE': 70, + 'EROFS': 69, + 'EMLINK': 34, + 'EPIPE': 64, + 'EDOM': 18, + 'ERANGE': 68, + 'ENOMSG': 49, + 'EIDRM': 24, + 'ECHRNG': 106, + 'EL2NSYNC': 156, + 'EL3HLT': 107, + 'EL3RST': 108, + 'ELNRNG': 109, + 'EUNATCH': 110, + 'ENOCSI': 111, + 'EL2HLT': 112, + 'EDEADLK': 16, + 'ENOLCK': 46, + 'EBADE': 113, + 'EBADR': 114, + 'EXFULL': 115, + 'ENOANO': 104, + 'EBADRQC': 103, + 'EBADSLT': 102, + 'EDEADLOCK': 16, + 'EBFONT': 101, + 'ENOSTR': 100, + 'ENODATA': 116, + 'ETIME': 117, + 'ENOSR': 118, + 'ENONET': 119, + 'ENOPKG': 120, + 'EREMOTE': 121, + 'ENOLINK': 47, + 'EADV': 122, + 'ESRMNT': 123, + 'ECOMM': 124, + 'EPROTO': 65, + 'EMULTIHOP': 36, + 'EDOTDOT': 125, + 'EBADMSG': 9, + 'ENOTUNIQ': 126, + 'EBADFD': 127, + 'EREMCHG': 128, + 'ELIBACC': 129, + 'ELIBBAD': 130, + 'ELIBSCN': 131, + 'ELIBMAX': 132, + 'ELIBEXEC': 133, + 'ENOSYS': 52, + 'ENOTEMPTY': 55, + 'ENAMETOOLONG': 37, + 'ELOOP': 32, + 'EOPNOTSUPP': 138, + 'EPFNOSUPPORT': 139, + 'ECONNRESET': 15, + 'ENOBUFS': 42, + 'EAFNOSUPPORT': 5, + 'EPROTOTYPE': 67, + 'ENOTSOCK': 57, + 'ENOPROTOOPT': 50, + 'ESHUTDOWN': 140, + 'ECONNREFUSED': 14, + 'EADDRINUSE': 3, + 'ECONNABORTED': 13, + 'ENETUNREACH': 40, + 'ENETDOWN': 38, + 'ETIMEDOUT': 73, + 'EHOSTDOWN': 142, + 'EHOSTUNREACH': 23, + 'EINPROGRESS': 26, + 'EALREADY': 7, + 'EDESTADDRREQ': 17, + 'EMSGSIZE': 35, + 'EPROTONOSUPPORT': 66, + 'ESOCKTNOSUPPORT': 137, + 'EADDRNOTAVAIL': 4, + 'ENETRESET': 39, + 'EISCONN': 30, + 'ENOTCONN': 53, + 'ETOOMANYREFS': 141, + 'EUSERS': 136, + 'EDQUOT': 19, + 'ESTALE': 72, + 'ENOTSUP': 138, + 'ENOMEDIUM': 148, + 'EILSEQ': 25, + 'EOVERFLOW': 61, + 'ECANCELED': 11, + 'ENOTRECOVERABLE': 56, + 'EOWNERDEAD': 62, + 'ESTRPIPE': 135, + };; +function checkIncomingModuleAPI() { + ignoredModuleProp('fetchSettings'); +} +var wasmImports = { + /** @export */ + __assert_fail: ___assert_fail, + /** @export */ + __call_sighandler: ___call_sighandler, + /** @export */ + __syscall__newselect: ___syscall__newselect, + /** @export */ + __syscall_accept4: ___syscall_accept4, + /** @export */ + __syscall_bind: ___syscall_bind, + /** @export */ + __syscall_chdir: ___syscall_chdir, + /** @export */ + __syscall_chmod: ___syscall_chmod, + /** @export */ + __syscall_connect: ___syscall_connect, + /** @export */ + __syscall_dup: ___syscall_dup, + /** @export */ + __syscall_dup3: ___syscall_dup3, + /** @export */ + __syscall_faccessat: ___syscall_faccessat, + /** @export */ + __syscall_fchownat: ___syscall_fchownat, + /** @export */ + __syscall_fcntl64: ___syscall_fcntl64, + /** @export */ + __syscall_fdatasync: ___syscall_fdatasync, + /** @export */ + __syscall_fstat64: ___syscall_fstat64, + /** @export */ + __syscall_ftruncate64: ___syscall_ftruncate64, + /** @export */ + __syscall_getcwd: ___syscall_getcwd, + /** @export */ + __syscall_getdents64: ___syscall_getdents64, + /** @export */ + __syscall_getpeername: ___syscall_getpeername, + /** @export */ + __syscall_getsockname: ___syscall_getsockname, + /** @export */ + __syscall_getsockopt: ___syscall_getsockopt, + /** @export */ + __syscall_ioctl: ___syscall_ioctl, + /** @export */ + __syscall_listen: ___syscall_listen, + /** @export */ + __syscall_lstat64: ___syscall_lstat64, + /** @export */ + __syscall_mkdirat: ___syscall_mkdirat, + /** @export */ + __syscall_newfstatat: ___syscall_newfstatat, + /** @export */ + __syscall_openat: ___syscall_openat, + /** @export */ + __syscall_pipe: ___syscall_pipe, + /** @export */ + __syscall_poll: ___syscall_poll, + /** @export */ + __syscall_readlinkat: ___syscall_readlinkat, + /** @export */ + __syscall_recvfrom: ___syscall_recvfrom, + /** @export */ + __syscall_renameat: ___syscall_renameat, + /** @export */ + __syscall_rmdir: ___syscall_rmdir, + /** @export */ + __syscall_sendto: ___syscall_sendto, + /** @export */ + __syscall_socket: ___syscall_socket, + /** @export */ + __syscall_stat64: ___syscall_stat64, + /** @export */ + __syscall_statfs64: ___syscall_statfs64, + /** @export */ + __syscall_symlink: ___syscall_symlink, + /** @export */ + __syscall_unlinkat: ___syscall_unlinkat, + /** @export */ + __syscall_utimensat: ___syscall_utimensat, + /** @export */ + _emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic, + /** @export */ + _emscripten_throw_longjmp: __emscripten_throw_longjmp, + /** @export */ + _gmtime_js: __gmtime_js, + /** @export */ + _localtime_js: __localtime_js, + /** @export */ + _mktime_js: __mktime_js, + /** @export */ + _mmap_js: __mmap_js, + /** @export */ + _munmap_js: __munmap_js, + /** @export */ + _setitimer_js: __setitimer_js, + /** @export */ + _tzset_js: __tzset_js, + /** @export */ + abort: _abort, + /** @export */ + emscripten_date_now: _emscripten_date_now, + /** @export */ + emscripten_err: _emscripten_err, + /** @export */ + emscripten_get_heap_max: _emscripten_get_heap_max, + /** @export */ + emscripten_get_now: _emscripten_get_now, + /** @export */ + emscripten_memcpy_js: _emscripten_memcpy_js, + /** @export */ + emscripten_resize_heap: _emscripten_resize_heap, + /** @export */ + environ_get: _environ_get, + /** @export */ + environ_sizes_get: _environ_sizes_get, + /** @export */ + exit: _exit, + /** @export */ + fd_close: _fd_close, + /** @export */ + fd_fdstat_get: _fd_fdstat_get, + /** @export */ + fd_read: _fd_read, + /** @export */ + fd_seek: _fd_seek, + /** @export */ + fd_sync: _fd_sync, + /** @export */ + fd_write: _fd_write, + /** @export */ + getaddrinfo: _getaddrinfo, + /** @export */ + getcontext: _getcontext, + /** @export */ + getdtablesize: _getdtablesize, + /** @export */ + gethostbyname_r: _gethostbyname_r, + /** @export */ + getnameinfo: _getnameinfo, + /** @export */ + getprotobyname: _getprotobyname, + /** @export */ + getprotobynumber: _getprotobynumber, + /** @export */ + invoke_i: invoke_i, + /** @export */ + invoke_ii: invoke_ii, + /** @export */ + invoke_iii: invoke_iii, + /** @export */ + invoke_iiii: invoke_iiii, + /** @export */ + invoke_iiiii: invoke_iiiii, + /** @export */ + invoke_iiiiii: invoke_iiiiii, + /** @export */ + invoke_iiiiiii: invoke_iiiiiii, + /** @export */ + invoke_iiiiiiiiii: invoke_iiiiiiiiii, + /** @export */ + invoke_v: invoke_v, + /** @export */ + invoke_vi: invoke_vi, + /** @export */ + invoke_vii: invoke_vii, + /** @export */ + invoke_viidii: invoke_viidii, + /** @export */ + invoke_viii: invoke_viii, + /** @export */ + invoke_viiii: invoke_viiii, + /** @export */ + invoke_viiiii: invoke_viiiii, + /** @export */ + invoke_viiiiii: invoke_viiiiii, + /** @export */ + makecontext: _makecontext, + /** @export */ + proc_exit: _proc_exit, + /** @export */ + strftime: _strftime, + /** @export */ + strptime: _strptime, + /** @export */ + swapcontext: _swapcontext +}; +var wasmExports = createWasm(); +var ___wasm_call_ctors = createExportWrapper('__wasm_call_ctors'); +var _php_wasm_run = Module['_php_wasm_run'] = createExportWrapper('php_wasm_run'); +var _malloc = createExportWrapper('malloc'); +var setTempRet0 = createExportWrapper('setTempRet0'); +var _fflush = Module['_fflush'] = createExportWrapper('fflush'); +var _free = createExportWrapper('free'); +var ___errno_location = createExportWrapper('__errno_location'); +var _memcpy = createExportWrapper('memcpy'); +var _htons = createExportWrapper('htons'); +var _ntohs = createExportWrapper('ntohs'); +var _htonl = createExportWrapper('htonl'); +var _emscripten_builtin_memalign = createExportWrapper('emscripten_builtin_memalign'); +var __emscripten_timeout = createExportWrapper('_emscripten_timeout'); +var _setThrew = createExportWrapper('setThrew'); +var _emscripten_stack_init = () => (_emscripten_stack_init = wasmExports['emscripten_stack_init'])(); +var _emscripten_stack_get_free = () => (_emscripten_stack_get_free = wasmExports['emscripten_stack_get_free'])(); +var _emscripten_stack_get_base = () => (_emscripten_stack_get_base = wasmExports['emscripten_stack_get_base'])(); +var _emscripten_stack_get_end = () => (_emscripten_stack_get_end = wasmExports['emscripten_stack_get_end'])(); +var stackSave = createExportWrapper('stackSave'); +var stackRestore = createExportWrapper('stackRestore'); +var stackAlloc = createExportWrapper('stackAlloc'); +var _emscripten_stack_get_current = () => (_emscripten_stack_get_current = wasmExports['emscripten_stack_get_current'])(); +var dynCall_vij = Module['dynCall_vij'] = createExportWrapper('dynCall_vij'); +var dynCall_ji = Module['dynCall_ji'] = createExportWrapper('dynCall_ji'); +var dynCall_jiji = Module['dynCall_jiji'] = createExportWrapper('dynCall_jiji'); + +function invoke_iii(index,a1,a2) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_v(index) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ii(index,a1) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viii(index,a1,a2,a3) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vii(index,a1,a2) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vi(index,a1) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_i(index) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viidii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + + +// include: postamble.js +// === Auto-generated postamble setup entry stuff === + +Module['ccall'] = ccall; +var missingLibrarySymbols = [ + 'writeI53ToI64', + 'writeI53ToI64Clamped', + 'writeI53ToI64Signaling', + 'writeI53ToU64Clamped', + 'writeI53ToU64Signaling', + 'readI53FromU64', + 'convertI32PairToI53', + 'convertU32PairToI53', + 'growMemory', + 'getCallstack', + 'emscriptenLog', + 'convertPCtoSourceLocation', + 'readEmAsmArgs', + 'jstoi_s', + 'listenOnce', + 'autoResumeAudioContext', + 'dynCallLegacy', + 'getDynCaller', + 'dynCall', + 'runtimeKeepalivePush', + 'runtimeKeepalivePop', + 'safeSetTimeout', + 'asmjsMangle', + 'handleAllocatorInit', + 'HandleAllocator', + 'getNativeTypeSize', + 'STACK_SIZE', + 'STACK_ALIGN', + 'POINTER_SIZE', + 'ASSERTIONS', + 'cwrap', + 'uleb128Encode', + 'sigToWasmTypes', + 'generateFuncType', + 'convertJsFunctionToWasm', + 'getEmptyTableSlot', + 'updateTableMap', + 'getFunctionAddress', + 'addFunction', + 'removeFunction', + 'reallyNegative', + 'unSign', + 'strLen', + 'reSign', + 'formatString', + 'intArrayToString', + 'AsciiToString', + 'UTF16ToString', + 'stringToUTF16', + 'lengthBytesUTF16', + 'UTF32ToString', + 'stringToUTF32', + 'lengthBytesUTF32', + 'registerKeyEventCallback', + 'maybeCStringToJsString', + 'findEventTarget', + 'findCanvasEventTarget', + 'getBoundingClientRect', + 'fillMouseEventData', + 'registerMouseEventCallback', + 'registerWheelEventCallback', + 'registerUiEventCallback', + 'registerFocusEventCallback', + 'fillDeviceOrientationEventData', + 'registerDeviceOrientationEventCallback', + 'fillDeviceMotionEventData', + 'registerDeviceMotionEventCallback', + 'screenOrientation', + 'fillOrientationChangeEventData', + 'registerOrientationChangeEventCallback', + 'fillFullscreenChangeEventData', + 'registerFullscreenChangeEventCallback', + 'JSEvents_requestFullscreen', + 'JSEvents_resizeCanvasForFullscreen', + 'registerRestoreOldStyle', + 'hideEverythingExceptGivenElement', + 'restoreHiddenElements', + 'setLetterbox', + 'softFullscreenResizeWebGLRenderTarget', + 'doRequestFullscreen', + 'fillPointerlockChangeEventData', + 'registerPointerlockChangeEventCallback', + 'registerPointerlockErrorEventCallback', + 'requestPointerLock', + 'fillVisibilityChangeEventData', + 'registerVisibilityChangeEventCallback', + 'registerTouchEventCallback', + 'fillGamepadEventData', + 'registerGamepadEventCallback', + 'registerBeforeUnloadEventCallback', + 'fillBatteryEventData', + 'battery', + 'registerBatteryEventCallback', + 'setCanvasElementSize', + 'getCanvasElementSize', + 'jsStackTrace', + 'stackTrace', + 'checkWasiClock', + 'wasiRightsToMuslOFlags', + 'wasiOFlagsToMuslOFlags', + 'createDyncallWrapper', + 'setImmediateWrapped', + 'clearImmediateWrapped', + 'polyfillSetImmediate', + 'getPromise', + 'makePromise', + 'idsToPromises', + 'makePromiseCallback', + 'ExceptionInfo', + 'findMatchingCatch', + 'setMainLoop', + 'FS_unlink', + 'FS_mkdirTree', + '_setNetworkCallback', + 'heapObjectForWebGLType', + 'heapAccessShiftForWebGLHeap', + 'webgl_enable_ANGLE_instanced_arrays', + 'webgl_enable_OES_vertex_array_object', + 'webgl_enable_WEBGL_draw_buffers', + 'webgl_enable_WEBGL_multi_draw', + 'emscriptenWebGLGet', + 'computeUnpackAlignedImageSize', + 'colorChannelsInGlTextureFormat', + 'emscriptenWebGLGetTexPixelData', + '__glGenObject', + 'emscriptenWebGLGetUniform', + 'webglGetUniformLocation', + 'webglPrepareUniformLocationsBeforeFirstUse', + 'webglGetLeftBracePos', + 'emscriptenWebGLGetVertexAttrib', + '__glGetActiveAttribOrUniform', + 'writeGLArray', + 'registerWebGlEventCallback', + 'runAndAbortIfError', + 'SDL_unicode', + 'SDL_ttfContext', + 'SDL_audio', + 'ALLOC_NORMAL', + 'ALLOC_STACK', + 'allocate', + 'writeStringToMemory', + 'writeAsciiToMemory', +]; +missingLibrarySymbols.forEach(missingLibrarySymbol) + +var unexportedSymbols = [ + 'run', + 'addOnPreRun', + 'addOnInit', + 'addOnPreMain', + 'addOnExit', + 'addOnPostRun', + 'addRunDependency', + 'removeRunDependency', + 'FS_createFolder', + 'FS_createPath', + 'FS_createLazyFile', + 'FS_createLink', + 'FS_createDevice', + 'FS_readFile', + 'out', + 'err', + 'callMain', + 'abort', + 'keepRuntimeAlive', + 'wasmMemory', + 'wasmExports', + 'stackAlloc', + 'stackSave', + 'stackRestore', + 'getTempRet0', + 'setTempRet0', + 'writeStackCookie', + 'checkStackCookie', + 'readI53FromI64', + 'convertI32PairToI53Checked', + 'ptrToString', + 'zeroMemory', + 'exitJS', + 'getHeapMax', + 'abortOnCannotGrowMemory', + 'ENV', + 'MONTH_DAYS_REGULAR', + 'MONTH_DAYS_LEAP', + 'MONTH_DAYS_REGULAR_CUMULATIVE', + 'MONTH_DAYS_LEAP_CUMULATIVE', + 'isLeapYear', + 'ydayFromDate', + 'arraySum', + 'addDays', + 'ERRNO_CODES', + 'ERRNO_MESSAGES', + 'setErrNo', + 'inetPton4', + 'inetNtop4', + 'inetPton6', + 'inetNtop6', + 'readSockaddr', + 'writeSockaddr', + 'DNS', + 'getHostByName', + 'Protocols', + 'Sockets', + 'initRandomFill', + 'randomFill', + 'timers', + 'warnOnce', + 'UNWIND_CACHE', + 'readEmAsmArgsArray', + 'jstoi_q', + 'getExecutableName', + 'handleException', + 'callUserCallback', + 'maybeExit', + 'asyncLoad', + 'alignMemory', + 'mmapAlloc', + 'wasmTable', + 'getCFunc', + 'freeTableIndexes', + 'functionsInTableMap', + 'setValue', + 'getValue', + 'PATH', + 'PATH_FS', + 'UTF8Decoder', + 'UTF8ArrayToString', + 'UTF8ToString', + 'stringToUTF8Array', + 'stringToUTF8', + 'lengthBytesUTF8', + 'intArrayFromString', + 'stringToAscii', + 'UTF16Decoder', + 'stringToNewUTF8', + 'stringToUTF8OnStack', + 'writeArrayToMemory', + 'JSEvents', + 'specialHTMLTargets', + 'currentFullscreenStrategy', + 'restoreOldWindowedStyle', + 'demangle', + 'demangleAll', + 'ExitStatus', + 'getEnvStrings', + 'doReadv', + 'doWritev', + 'promiseMap', + 'uncaughtExceptionCount', + 'exceptionLast', + 'exceptionCaught', + 'Browser', + 'wget', + 'SYSCALLS', + 'getSocketFromFD', + 'getSocketAddress', + 'preloadPlugins', + 'FS_createPreloadedFile', + 'FS_modeStringToFlags', + 'FS_getMode', + 'FS_stdin_getChar_buffer', + 'FS_stdin_getChar', + 'FS', + 'FS_createDataFile', + 'MEMFS', + 'TTY', + 'PIPEFS', + 'SOCKFS', + 'tempFixedLengthArray', + 'miniTempWebGLFloatBuffers', + 'miniTempWebGLIntBuffers', + 'GL', + 'emscripten_webgl_power_preferences', + 'AL', + 'GLUT', + 'EGL', + 'GLEW', + 'IDBStore', + 'SDL', + 'SDL_gfx', + 'allocateUTF8', + 'allocateUTF8OnStack', +]; +unexportedSymbols.forEach(unexportedRuntimeSymbol); + + + +var calledRun; + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +}; + +function stackCheckInit() { + // This is normally called automatically during __wasm_call_ctors but need to + // get these values before even running any of the ctors so we call it redundantly + // here. + _emscripten_stack_init(); + // TODO(sbc): Move writeStackCookie to native to to avoid this. + writeStackCookie(); +} + +function run() { + + if (runDependencies > 0) { + return; + } + + stackCheckInit(); + + preRun(); + + // a preRun added a dependency, run will be called later + if (runDependencies > 0) { + return; + } + + function doRun() { + // run may have just been called through dependencies being fulfilled just in this very frame, + // or while the async setStatus time below was happening + if (calledRun) return; + calledRun = true; + Module['calledRun'] = true; + + if (ABORT) return; + + initRuntime(); + + readyPromiseResolve(Module); + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + assert(!Module['_main'], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]'); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else + { + doRun(); + } + checkStackCookie(); +} + +function checkUnflushedContent() { + // Compiler settings do not allow exiting the runtime, so flushing + // the streams is not possible. but in ASSERTIONS mode we check + // if there was something to flush, and if so tell the user they + // should request that the runtime be exitable. + // Normally we would not even include flush() at all, but in ASSERTIONS + // builds we do so just for this check, and here we see if there is any + // content to flush, that is, we check if there would have been + // something a non-ASSERTIONS build would have not seen. + // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0 + // mode (which has its own special function for this; otherwise, all + // the code is inside libc) + var oldOut = out; + var oldErr = err; + var has = false; + out = err = (x) => { + has = true; + } + try { // it doesn't matter if it fails + _fflush(0); + // also flush in the JS FS layer + ['stdout', 'stderr'].forEach(function(name) { + var info = FS.analyzePath('/dev/' + name); + if (!info) return; + var stream = info.object; + var rdev = stream.rdev; + var tty = TTY.ttys[rdev]; + if (tty && tty.output && tty.output.length) { + has = true; + } + }); + } catch(e) {} + out = oldOut; + err = oldErr; + if (has) { + warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the Emscripten FAQ), or make sure to emit a newline when you printf etc.'); + } +} + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +run(); + + +// end include: postamble.js + + + return moduleArg.ready +} + +); +})(); +export default Module; \ No newline at end of file diff --git a/examples/php-on-wasm/php-wasm.php b/examples/php-on-wasm/php-wasm.php new file mode 100644 index 0000000..32c375e --- /dev/null +++ b/examples/php-on-wasm/php-wasm.php @@ -0,0 +1,956 @@ +decode(); + // Debug::printImports($module); +} catch (InvalidBinaryFormatException $e) { + echo $e->getMessage() . PHP_EOL; +} + +echo "Instantiating...\n"; +$hostFuncs = [ + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env__invoke_iii(...)), + makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiii(...)), + makeHostFunc('(i32) -> ()', hostFunc__env__invoke_v(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiii(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env__invoke_ii(...)), + makeHostFunc('() -> ()', hostFunc__env__abort(...)), + makeHostFunc('(i32) -> ()', hostFunc__env__exit(...)), + makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viii(...)), + makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env__invoke_vii(...)), + makeHostFunc('(i32, i32) -> ()', hostFunc__env__invoke_vi(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env__invoke_i(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiiii(...)), + makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env____assert_fail(...)), + makeHostFunc('(i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiii(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiiii(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiii(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiiiiiii(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__strftime(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__getaddrinfo(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__gethostbyname_r(...)), + makeHostFunc('() -> (i32)', hostFunc__env__getdtablesize(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env__getprotobyname(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env__getprotobynumber(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env__strptime(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__getnameinfo(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiiiii(...)), + makeHostFunc('(i32, i32, i32, f64, i32, i32) -> ()', hostFunc__env__invoke_viidii(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env__getcontext(...)), + makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env__makecontext(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env__swapcontext(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__environ_sizes_get(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__environ_get(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_fcntl64(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_ioctl(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_close(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_read(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_write(...)), + makeHostFunc('(i32) -> ()', hostFunc__wasi_snapshot_preview1__proc_exit(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_faccessat(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_chdir(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_chmod(...)), + makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_fchownat(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_dup(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_dup3(...)), + makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env__emscripten_memcpy_js(...)), + makeHostFunc('() -> (f64)', hostFunc__env__emscripten_date_now(...)), + makeHostFunc('() -> (i32)', hostFunc__env___emscripten_get_now_is_monotonic(...)), + makeHostFunc('() -> (f64)', hostFunc__env__emscripten_get_now(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_fdatasync(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_openat(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_fstat64(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_stat64(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_newfstatat(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_lstat64(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_sync(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_getcwd(...)), + makeHostFunc('(i32) -> ()', hostFunc__env__emscripten_err(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_fdstat_get(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_mkdirat(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_pipe(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_poll(...)), + makeHostFunc('(i32, i32) -> ()', hostFunc__env____call_sighandler(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_getdents64(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_readlinkat(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_renameat(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_rmdir(...)), + makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall__newselect(...)), + makeHostFunc('(i32, f64) -> (i32)', hostFunc__env___setitimer_js(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_statfs64(...)), + makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_symlink(...)), + makeHostFunc('() -> (i32)', hostFunc__env__emscripten_get_heap_max(...)), + makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___tzset_js(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_unlinkat(...)), + makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_utimensat(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env__emscripten_resize_heap(...)), + makeHostFunc('() -> ()', hostFunc__env___emscripten_throw_longjmp(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_accept4(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_bind(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_connect(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getpeername(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getsockname(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getsockopt(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_listen(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_recvfrom(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_sendto(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_socket(...)), + makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_ftruncate64(...)), + makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_seek(...)), + makeHostFunc('(i32) -> (i32)', hostFunc__env___mktime_js(...)), + makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___localtime_js(...)), + makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___gmtime_js(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env___munmap_js(...)), + makeHostFunc('(i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env___mmap_js(...)), +]; +$store = Store::empty(); +$externVals = []; +foreach ($hostFuncs as $hostFunc) { + $store->funcs[] = $hostFunc; + $externVals[] = ExternVal::Func(new FuncAddr(count($store->funcs) - 1)); +} +$runtime = Runtime::instantiate($store, $module, $externVals); +$codePtr = allocateStringOnWasmMemory($runtime, PHP_HELLO_WORLD); + +echo "Executing...\n"; +$results = $runtime->invoke("php_wasm_run", [Val::NumI32($codePtr)]); +assert(count($results) === 1); +$result = $results[0]; +assert($result instanceof Vals\Num); +assert($result->inner instanceof Nums\I32); +$exitCode = $result->inner->value; + +echo "Exit code: $exitCode\n"; + +function allocateStringOnWasmMemory(Runtime $runtime, string $str): int { + // Plus 1 for the null terminator in C. + $size = strlen($str) + 1; + $outPtr = wasm_stackAlloc($runtime, $size); + copyStringToWasmMemory($runtime, $outPtr, $str); + return $outPtr; +} + +function wasm_stackAlloc(Runtime $runtime, int $size): int { + $results = $runtime->invoke("stackAlloc", [Val::NumI32($size)]); + assert(count($results) === 1); + $result = $results[0]; + assert($result instanceof Vals\Num); + assert($result->inner instanceof Nums\I32); + return $result->inner->value; +} + +function wasm_stackSave(Runtime $runtime): int { + $results = $runtime->invoke("stackSave", []); + assert(count($results) === 1); + $result = $results[0]; + assert($result instanceof Vals\Num); + assert($result->inner instanceof Nums\I32); + return $result->inner->value; +} + +function copyStringToWasmMemory(Runtime $runtime, int $dst, string $src): void { + $mem = $runtime->getExportedMemory('memory'); + for ($i = 0; $i < strlen($src); $i++) { + $ok = $mem->storeByte($dst + $i, ord($src[$i])); + assert($ok); + } + // Terminate the string with a null byte for interoperation with C. + $ok = $mem->storeByte($dst + strlen($src), 0); + assert($ok); +} + +function makeHostFunc(string $typeDef, callable $fn): FuncInst { + $stringToType = fn (string $s) => match ($s) { + 'i32' => ValType::NumType(NumType::I32), + 'i64' => ValType::NumType(NumType::I64), + 'f32' => ValType::NumType(NumType::F32), + 'f64' => ValType::NumType(NumType::F64), + default => throw new \RuntimeException('Invalid type: ' . $s), + }; + preg_match('/^\(([^)]*)\) -> \(([^)]*)\)$/', $typeDef, $matches); + $paramsDef = $matches[1]; + $resultsDef = $matches[2]; + $params = array_map($stringToType, $paramsDef === '' ? [] : explode(', ', $paramsDef)); + $results = array_map($stringToType, $resultsDef === '' ? [] : explode(', ', $resultsDef)); + $type = new FuncType(new ResultType($params), new ResultType($results)); + return FuncInst::Host($type, $fn); +} + +function getWasmTableEntry(Runtime $runtime, int $funcPtr): FuncAddr { + static $wasmTable = null; + + if ($wasmTable === null) { + $wasmTable = $runtime->getExportedTable('__indirect_function_table'); + assert($wasmTable !== null); + } + + $func = $wasmTable->elem[$funcPtr] ?? null; + assert($func instanceof Refs\RefFunc, "Expected RefFunc, but got " . get_class($func)); + return $func->addr; +} + +function syscallGetStr(Runtime $runtime, int $ptr): string { + $mem = $runtime->getExportedMemory('memory'); + $str = ''; + for ($i = $ptr; $mem->loadByte($i) !== 0; $i++) { + $str .= chr($mem->loadByte($i)); + } + return $str; +} + +function syscallCalculateAt(Runtime $runtime, int $dirfd, string $path): string { + if ($path[0] === '/') { + return $path; + } + if ($dirfd === -100) { + $dir = getcwd(); + } else { + throw new \RuntimeException("syscallCalculateAt: not implemented ($dirfd)"); + } + if ($path === '.') { + return $dir; + } else { + return $dir . '/' . $path; + } +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iii(Runtime $runtime): void { + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iiiii(Runtime $runtime): void { + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32) -> () +function hostFunc__env__invoke_v(Runtime $runtime): void { + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iiii(Runtime $runtime): void { + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env__invoke_ii(Runtime $runtime): void { + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->invokeByFuncAddr($func); +} + +// Type: () -> () +function hostFunc__env__abort(Runtime $runtime): void { + throw new \RuntimeException('env::abort: not implemented'); +} + +// Type: (i32) -> () +function hostFunc__env__exit(Runtime $runtime): void { + throw new \RuntimeException('env::exit: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> () +function hostFunc__env__invoke_viii(Runtime $runtime): void { + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32) -> () +function hostFunc__env__invoke_vii(Runtime $runtime): void { + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32) -> () +function hostFunc__env__invoke_vi(Runtime $runtime): void { + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32) -> (i32) +function hostFunc__env__invoke_i(Runtime $runtime): void { + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iiiiiii(Runtime $runtime): void { + $a6 = $runtime->stack->popI32(); + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->stack->pushI32($a6); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32) -> () +function hostFunc__env____assert_fail(Runtime $runtime): void { + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32) -> () +function hostFunc__env__invoke_viiii(Runtime $runtime): void { + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> () +function hostFunc__env__invoke_viiiii(Runtime $runtime): void { + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iiiiii(Runtime $runtime): void { + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__invoke_iiiiiiiiii(Runtime $runtime): void { + $a9 = $runtime->stack->popI32(); + $a8 = $runtime->stack->popI32(); + $a7 = $runtime->stack->popI32(); + $a6 = $runtime->stack->popI32(); + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->stack->pushI32($a6); + $runtime->stack->pushI32($a7); + $runtime->stack->pushI32($a8); + $runtime->stack->pushI32($a9); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env__strftime(Runtime $runtime): void { + throw new \RuntimeException('env::strftime: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env__getaddrinfo(Runtime $runtime): void { + throw new \RuntimeException('env::getaddrinfo: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__gethostbyname_r(Runtime $runtime): void { + throw new \RuntimeException('env::gethostbyname_r: not implemented'); +} + +// Type: () -> (i32) +function hostFunc__env__getdtablesize(Runtime $runtime): void { + throw new \RuntimeException('env::getdtablesize: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env__getprotobyname(Runtime $runtime): void { + throw new \RuntimeException('env::getprotobyname: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env__getprotobynumber(Runtime $runtime): void { + throw new \RuntimeException('env::getprotobynumber: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env__strptime(Runtime $runtime): void { + throw new \RuntimeException('env::strptime: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env__getnameinfo(Runtime $runtime): void { + throw new \RuntimeException('env::getnameinfo: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32) -> () +function hostFunc__env__invoke_viiiiii(Runtime $runtime): void { + $a6 = $runtime->stack->popI32(); + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popI32(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushI32($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->stack->pushI32($a6); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32, i32, i32, f64, i32, i32) -> () +function hostFunc__env__invoke_viidii(Runtime $runtime): void { + $a5 = $runtime->stack->popI32(); + $a4 = $runtime->stack->popI32(); + $a3 = $runtime->stack->popF64(); + $a2 = $runtime->stack->popI32(); + $a1 = $runtime->stack->popI32(); + $index = $runtime->stack->popI32(); + $sp = wasm_stackSave($runtime); + $func = getWasmTableEntry($runtime, $index); + $runtime->stack->pushI32($a1); + $runtime->stack->pushI32($a2); + $runtime->stack->pushF64($a3); + $runtime->stack->pushI32($a4); + $runtime->stack->pushI32($a5); + $runtime->invokeByFuncAddr($func); +} + +// Type: (i32) -> (i32) +function hostFunc__env__getcontext(Runtime $runtime): void { + throw new \RuntimeException('env::getcontext: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> () +function hostFunc__env__makecontext(Runtime $runtime): void { + throw new \RuntimeException('env::makecontext: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env__swapcontext(Runtime $runtime): void { + throw new \RuntimeException('env::swapcontext: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__environ_sizes_get(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::environ_sizes_get: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__environ_get(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::environ_get: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_fcntl64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_fcntl64: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_ioctl(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_ioctl: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_close(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::fd_close: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_read(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::fd_read: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_write(Runtime $runtime): void { + // Output pointer to the number of bytes written. + $pnum = $runtime->stack->popI32(); + // Length of the array of iov structs. + $iovcnt = $runtime->stack->popI32(); + // Pointer to the array of iov structs. + $iov = $runtime->stack->popI32(); + // File descripter. + $fd = $runtime->stack->popI32(); + + // struct iov { + // ptr: u32, pointer to the data + // len: u32 + // } + assert($fd === 1 || $fd === 2, "fd: $fd"); + + $mem = $runtime->getExportedMemory('memory'); + + $nWritten = 0; + for ($i = 0; $i < $iovcnt; $i++) { + $ptr = $mem->loadI32($iov + $i * 8, 4, true); + $len = $mem->loadI32($iov + $i * 8 + 4, 4, true); + $buf = ''; + for ($j = 0; $j < $len; $j++) { + $buf .= chr($mem->loadByte($ptr + $j)); + } + if ($fd === 1) { + fputs(STDOUT, $buf); + } else { + fputs(STDERR, $buf); + } + $nWritten += $len; + } + $mem->storeI32($pnum, $nWritten, 4); + + $runtime->stack->pushI32(0); +} + +// Type: (i32) -> () +function hostFunc__wasi_snapshot_preview1__proc_exit(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::proc_exit: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_faccessat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_faccessat: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env____syscall_chdir(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_chdir: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_chmod(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_chmod: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_fchownat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_fchownat: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env____syscall_dup(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_dup: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_dup3(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_dup3: not implemented'); +} + +// Type: (i32, i32, i32) -> () +function hostFunc__env__emscripten_memcpy_js(Runtime $runtime): void { + $num = $runtime->stack->popI32(); + $src = $runtime->stack->popI32(); + $dest = $runtime->stack->popI32(); + $mem = $runtime->getExportedMemory('memory'); + for ($i = 0; $i < $num; $i++) { + $byte = $mem->loadByte($src + $i); + $mem->storeByte($dest + $i, $byte); + } +} + +// Type: () -> (f64) +function hostFunc__env__emscripten_date_now(Runtime $runtime): void { + throw new \RuntimeException('env::emscripten_date_now: not implemented'); +} + +// Type: () -> (i32) +function hostFunc__env___emscripten_get_now_is_monotonic(Runtime $runtime): void { + throw new \RuntimeException('env::_emscripten_get_now_is_monotonic: not implemented'); +} + +// Type: () -> (f64) +function hostFunc__env__emscripten_get_now(Runtime $runtime): void { + throw new \RuntimeException('env::emscripten_get_now: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env____syscall_fdatasync(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_fdatasync: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_openat(Runtime $runtime): void { + $varargs = $runtime->stack->popI32(); + $flags = $runtime->stack->popI32(); + $path = $runtime->stack->popI32(); + $dirfd = $runtime->stack->popI32(); + + $path = syscallGetStr($runtime, $path); + $path = syscallCalculateAt($runtime, $dirfd, $path); + + $mem = $runtime->getExportedMemory('memory'); + + if ($varargs !== 0) { + $mode = $mem->loadI32($varargs, 4, true); + $varargs += 4; + } else { + $mode = 0; + } + + // echo "syscall_openat: $path, $flags, $mode\n"; + + // no such file + $runtime->stack->pushI32(-44); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_fstat64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_fstat64: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_stat64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_stat64: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_newfstatat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_newfstatat: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_lstat64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_lstat64: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_sync(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::fd_sync: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_getcwd(Runtime $runtime): void { + $size = $runtime->stack->popI32(); + $bufPtr = $runtime->stack->popI32(); + if ($size === 0) { + $runtime->stack->pushI32(-28); + return; + } + $cwd = getcwd(); + $cwdLen = strlen($cwd) + 1; + if ($size < $cwdLen) { + $runtime->stack->pushI32(-68); + return; + } + copyStringToWasmMemory($runtime, $bufPtr, $cwd); + $runtime->stack->pushI32($cwdLen); +} + +// Type: (i32) -> () +function hostFunc__env__emscripten_err(Runtime $runtime): void { + throw new \RuntimeException('env::emscripten_err: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_fdstat_get(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::fd_fdstat_get: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_mkdirat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_mkdirat: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env____syscall_pipe(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_pipe: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_poll(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_poll: not implemented'); +} + +// Type: (i32, i32) -> () +function hostFunc__env____call_sighandler(Runtime $runtime): void { + throw new \RuntimeException('env::__call_sighandler: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_getdents64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_getdents64: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_readlinkat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_readlinkat: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_renameat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_renameat: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env____syscall_rmdir(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_rmdir: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall__newselect(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall__newselect: not implemented'); +} + +// Type: (i32, f64) -> (i32) +function hostFunc__env___setitimer_js(Runtime $runtime): void { + throw new \RuntimeException('env::_setitimer_js: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_statfs64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_statfs64: not implemented'); +} + +// Type: (i32, i32) -> (i32) +function hostFunc__env____syscall_symlink(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_symlink: not implemented'); +} + +// Type: () -> (i32) +function hostFunc__env__emscripten_get_heap_max(Runtime $runtime): void { + throw new \RuntimeException('env::emscripten_get_heap_max: not implemented'); +} + +// Type: (i32, i32, i32) -> () +function hostFunc__env___tzset_js(Runtime $runtime): void { + $tzname = $runtime->stack->popI32(); + $daylight = $runtime->stack->popI32(); + $timezone = $runtime->stack->popI32(); + // Do nothing ;) +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_unlinkat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_unlinkat: not implemented'); +} + +// Type: (i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_utimensat(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_utimensat: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env__emscripten_resize_heap(Runtime $runtime): void { + throw new \RuntimeException('env::emscripten_resize_heap: not implemented'); +} + +// Type: () -> () +function hostFunc__env___emscripten_throw_longjmp(Runtime $runtime): void { + throw new \RuntimeException('env::_emscripten_throw_longjmp: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_accept4(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_accept4: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_bind(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_bind: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_connect(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_connect: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_getpeername(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_getpeername: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_getsockname(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_getsockname: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_getsockopt(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_getsockopt: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_listen(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_listen: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_recvfrom(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_recvfrom: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_sendto(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_sendto: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env____syscall_socket(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_socket: not implemented'); +} + +// Type: (i32, i32, i32) -> (i32) +function hostFunc__env____syscall_ftruncate64(Runtime $runtime): void { + throw new \RuntimeException('env::__syscall_ftruncate64: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32) -> (i32) +function hostFunc__wasi_snapshot_preview1__fd_seek(Runtime $runtime): void { + throw new \RuntimeException('wasi_snapshot_preview1::fd_seek: not implemented'); +} + +// Type: (i32) -> (i32) +function hostFunc__env___mktime_js(Runtime $runtime): void { + throw new \RuntimeException('env::_mktime_js: not implemented'); +} + +// Type: (i32, i32, i32) -> () +function hostFunc__env___localtime_js(Runtime $runtime): void { + throw new \RuntimeException('env::_localtime_js: not implemented'); +} + +// Type: (i32, i32, i32) -> () +function hostFunc__env___gmtime_js(Runtime $runtime): void { + throw new \RuntimeException('env::_gmtime_js: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env___munmap_js(Runtime $runtime): void { + throw new \RuntimeException('env::_munmap_js: not implemented'); +} + +// Type: (i32, i32, i32, i32, i32, i32, i32, i32) -> (i32) +function hostFunc__env___mmap_js(Runtime $runtime): void { + throw new \RuntimeException('env::_mmap_js: not implemented'); +} diff --git a/examples/php-on-wasm/php-wasm.wasm b/examples/php-on-wasm/php-wasm.wasm new file mode 100755 index 0000000..8e91021 Binary files /dev/null and b/examples/php-on-wasm/php-wasm.wasm differ -- cgit v1.3-1-g0d28