diff options
| author | nsfisis <nsfisis@gmail.com> | 2025-03-17 22:19:18 +0900 |
|---|---|---|
| committer | nsfisis <nsfisis@gmail.com> | 2025-03-17 22:19:18 +0900 |
| commit | facdf9357e576f6d47e7dd23f4f7b2b34f6a8d30 (patch) | |
| tree | 21c6aee60b3ddc26ff88ee3273c887125bb5828f /docs/assets/php-wasm-bridge-BCntMcWX.js | |
| parent | c739bbfa7cbb68a51755254d59abf15e514795ca (diff) | |
| download | PHPerKaigi2025-tokens-facdf9357e576f6d47e7dd23f4f7b2b34f6a8d30.tar.gz PHPerKaigi2025-tokens-facdf9357e576f6d47e7dd23f4f7b2b34f6a8d30.tar.zst PHPerKaigi2025-tokens-facdf9357e576f6d47e7dd23f4f7b2b34f6a8d30.zip | |
commit files
Diffstat (limited to 'docs/assets/php-wasm-bridge-BCntMcWX.js')
| -rw-r--r-- | docs/assets/php-wasm-bridge-BCntMcWX.js | 8366 |
1 files changed, 8366 insertions, 0 deletions
diff --git a/docs/assets/php-wasm-bridge-BCntMcWX.js b/docs/assets/php-wasm-bridge-BCntMcWX.js new file mode 100644 index 0000000..fbf574b --- /dev/null +++ b/docs/assets/php-wasm-bridge-BCntMcWX.js @@ -0,0 +1,8366 @@ +var Module = (() => { + var _scriptName = import.meta.url; + + return function (moduleArg = {}) { + var moduleRtn; + + // include: shell.js + // The Module object: Our interface to the outside world. We import + // and export values on it. There are various ways Module can be used: + // 1. Not defined. We create it here + // 2. A function parameter, function(moduleArg) => Promise<Module> + // 3. pre-run appended it, var Module = {}; ..generated code.. + // 4. External script tag defines var Module. + // We need to check if Module already exists (e.g. case 3 above). + // Substitution will be replaced with actual code on later stage of the build, + // this way Closure Compiler will not mangle it (e.g. case 4. above). + // Note that if you want to run closure, and also to use Module + // after the generated code, you will need to define var Module = {}; + // before the code. Then that object will be used in the code, and you + // can continue to use Module afterwards as well. + var Module = moduleArg; + + // Set up the promise that indicates the Module is initialized + var readyPromiseResolve, readyPromiseReject; + var readyPromise = new Promise((resolve, reject) => { + readyPromiseResolve = resolve; + readyPromiseReject = reject; + }); + [ + "_memory", + "_php_wasm_run", + "___indirect_function_table", + "onRuntimeInitialized", + ].forEach((prop) => { + if (!Object.getOwnPropertyDescriptor(readyPromise, prop)) { + Object.defineProperty(readyPromise, prop, { + get: () => + abort( + "You are getting " + + prop + + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js", + ), + set: () => + abort( + "You are setting " + + prop + + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js", + ), + }); + } + }); + + // Determine the runtime environment we are in. You can customize this by + // setting the ENVIRONMENT setting at compile time (see settings.js). + + var ENVIRONMENT_IS_WEB = true; + var ENVIRONMENT_IS_WORKER = false; + var ENVIRONMENT_IS_NODE = false; + var ENVIRONMENT_IS_SHELL = false; + + // --pre-jses are emitted after the Module integration code, so that they can + // refer to Module (if they choose; they can also define Module) + + // Sometimes an existing Module object exists with properties + // meant to overwrite the default module functionality. Here + // we collect those properties and reapply _after_ we configure + // the current environment's defaults to avoid having to be so + // defensive during initialization. + var moduleOverrides = Object.assign({}, Module); + + var arguments_ = []; + var thisProgram = "./this.program"; + var quit_ = (status, toThrow) => { + throw toThrow; + }; + + // `/` should be present at the end if `scriptDirectory` is not empty + var scriptDirectory = ""; + function locateFile(path) { + if (Module["locateFile"]) { + return Module["locateFile"](path, scriptDirectory); + } + return scriptDirectory + path; + } + + // Hooks that are implemented differently in different runtime environments. + var readAsync, readBinary; + + if (ENVIRONMENT_IS_SHELL) { + if ( + (typeof process == "object" && typeof require === "function") || + typeof window == "object" || + typeof WorkerGlobalScope != "undefined" + ) + throw new Error( + "not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)", + ); + } + + // Note that this includes Node.js workers when relevant (pthreads is enabled). + // Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and + // ENVIRONMENT_IS_NODE. + else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { + // Check worker, not web, since window could be polyfilled + scriptDirectory = self.location.href; + } else if (typeof document != "undefined" && document.currentScript) { + // web + scriptDirectory = document.currentScript.src; + } + // When MODULARIZE, this JS may be executed later, after document.currentScript + // is gone, so we saved it, and we use it here instead of any other info. + if (_scriptName) { + scriptDirectory = _scriptName; + } + // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. + // otherwise, slice off the final part of the url to find the script directory. + // if scriptDirectory does not contain a slash, lastIndexOf will return -1, + // and scriptDirectory will correctly be replaced with an empty string. + // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #), + // they are removed because they could contain a slash. + if (scriptDirectory.startsWith("blob:")) { + scriptDirectory = ""; + } else { + scriptDirectory = scriptDirectory.substr( + 0, + scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1, + ); + } + + if ( + !(typeof window == "object" || typeof WorkerGlobalScope != "undefined") + ) + throw new Error( + "not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)", + ); + + { + // include: web_or_worker_shell_read.js + readAsync = async (url) => { + assert(!isFileURI(url), "readAsync does not work with file:// URLs"); + var response = await fetch(url, { credentials: "same-origin" }); + if (response.ok) { + return response.arrayBuffer(); + } + throw new Error(response.status + " : " + response.url); + }; + // end include: web_or_worker_shell_read.js + } + } else { + throw new Error("environment detection error"); + } + + var out = Module["print"] || console.log.bind(console); + var err = Module["printErr"] || console.error.bind(console); + + // Merge back in the overrides + Object.assign(Module, moduleOverrides); + // Free the object hierarchy contained in the overrides, this lets the GC + // reclaim data used. + moduleOverrides = null; + checkIncomingModuleAPI(); + + // Emit code to handle expected values on the Module object. This applies Module.x + // to the proper local x. This has two benefits: first, we only emit it if it is + // expected to arrive, and second, by using a local everywhere else that can be + // minified. + + if (Module["arguments"]) arguments_ = Module["arguments"]; + legacyModuleProp("arguments", "arguments_"); + + if (Module["thisProgram"]) thisProgram = Module["thisProgram"]; + legacyModuleProp("thisProgram", "thisProgram"); + + // perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message + // Assertions on removed incoming Module JS APIs. + assert( + typeof Module["memoryInitializerPrefixURL"] == "undefined", + "Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead", + ); + assert( + typeof Module["pthreadMainPrefixURL"] == "undefined", + "Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead", + ); + assert( + typeof Module["cdInitializerPrefixURL"] == "undefined", + "Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead", + ); + assert( + typeof Module["filePackagePrefixURL"] == "undefined", + "Module.filePackagePrefixURL option was removed, use Module.locateFile instead", + ); + assert( + typeof Module["read"] == "undefined", + "Module.read option was removed", + ); + assert( + typeof Module["readAsync"] == "undefined", + "Module.readAsync option was removed (modify readAsync in JS)", + ); + assert( + typeof Module["readBinary"] == "undefined", + "Module.readBinary option was removed (modify readBinary in JS)", + ); + assert( + typeof Module["setWindowTitle"] == "undefined", + "Module.setWindowTitle option was removed (modify emscripten_set_window_title in JS)", + ); + assert( + typeof Module["TOTAL_MEMORY"] == "undefined", + "Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY", + ); + legacyModuleProp("asm", "wasmExports"); + legacyModuleProp("readAsync", "readAsync"); + legacyModuleProp("readBinary", "readBinary"); + legacyModuleProp("setWindowTitle", "setWindowTitle"); + var IDBFS = "IDBFS is no longer included by default; build with -lidbfs.js"; + var PROXYFS = + "PROXYFS is no longer included by default; build with -lproxyfs.js"; + var WORKERFS = + "WORKERFS is no longer included by default; build with -lworkerfs.js"; + var FETCHFS = + "FETCHFS is no longer included by default; build with -lfetchfs.js"; + var ICASEFS = + "ICASEFS is no longer included by default; build with -licasefs.js"; + var JSFILEFS = + "JSFILEFS is no longer included by default; build with -ljsfilefs.js"; + var OPFS = "OPFS is no longer included by default; build with -lopfs.js"; + + var NODEFS = + "NODEFS is no longer included by default; build with -lnodefs.js"; + + assert( + !ENVIRONMENT_IS_WORKER, + "worker environment detected but not enabled at build time. Add `worker` to `-sENVIRONMENT` to enable.", + ); + + assert( + !ENVIRONMENT_IS_NODE, + "node environment detected but not enabled at build time. Add `node` to `-sENVIRONMENT` to enable.", + ); + + assert( + !ENVIRONMENT_IS_SHELL, + "shell environment detected but not enabled at build time. Add `shell` to `-sENVIRONMENT` to enable.", + ); + + // end include: shell.js + + // include: preamble.js + // === Preamble library stuff === + + // Documentation for the public APIs defined in this file must be updated in: + // site/source/docs/api_reference/preamble.js.rst + // A prebuilt local version of the documentation is available at: + // site/build/text/docs/api_reference/preamble.js.txt + // You can also build docs locally as HTML or other formats in site/ + // An online HTML version (which may be of a different version of Emscripten) + // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + + var wasmBinary = Module["wasmBinary"]; + legacyModuleProp("wasmBinary", "wasmBinary"); + + if (typeof WebAssembly != "object") { + err("no native wasm support detected"); + } + + // Wasm globals + + var wasmMemory; + + //======================================== + // Runtime essentials + //======================================== + + // whether we are quitting the application. no code should run after this. + // set in exit() and abort() + var ABORT = false; + + // set by exit() and abort(). Passed to 'onExit' handler. + // NOTE: This is also used as the process return code code in shell environments + // but only when noExitRuntime is false. + var EXITSTATUS; + + // In STRICT mode, we only define assert() when ASSERTIONS is set. i.e. we + // don't define it at all in release modes. This matches the behaviour of + // MINIMAL_RUNTIME. + // TODO(sbc): Make this the default even without STRICT enabled. + /** @type {function(*, string=)} */ + function assert(condition, text) { + if (!condition) { + abort("Assertion failed" + (text ? ": " + text : "")); + } + } + + // We used to include malloc/free by default in the past. Show a helpful error in + // builds with assertions. + function _free() { + // Show a helpful error since we used to include free by default in the past. + abort( + "free() called but not included in the build - add `_free` to EXPORTED_FUNCTIONS", + ); + } + + // Memory management + + var HEAP, + /** @type {!Int8Array} */ + HEAP8, + /** @type {!Uint8Array} */ + HEAPU8, + /** @type {!Int16Array} */ + HEAP16, + /** @type {!Uint16Array} */ + HEAPU16, + /** @type {!Int32Array} */ + HEAP32, + /** @type {!Uint32Array} */ + HEAPU32, + /** @type {!Float32Array} */ + HEAPF32, + /** @type {!Float64Array} */ + HEAPF64; + + // include: runtime_shared.js + function updateMemoryViews() { + var b = wasmMemory.buffer; + Module["HEAP8"] = HEAP8 = new Int8Array(b); + Module["HEAP16"] = HEAP16 = new Int16Array(b); + Module["HEAPU8"] = HEAPU8 = new Uint8Array(b); + Module["HEAPU16"] = HEAPU16 = new Uint16Array(b); + Module["HEAP32"] = HEAP32 = new Int32Array(b); + Module["HEAPU32"] = HEAPU32 = new Uint32Array(b); + Module["HEAPF32"] = HEAPF32 = new Float32Array(b); + Module["HEAPF64"] = HEAPF64 = new Float64Array(b); + } + + // end include: runtime_shared.js + assert( + !Module["STACK_SIZE"], + "STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time", + ); + + assert( + typeof Int32Array != "undefined" && + typeof Float64Array !== "undefined" && + Int32Array.prototype.subarray != undefined && + Int32Array.prototype.set != undefined, + "JS engine does not provide full typed array support", + ); + + // If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY + assert( + !Module["wasmMemory"], + "Use of `wasmMemory` detected. Use -sIMPORTED_MEMORY to define wasmMemory externally", + ); + assert( + !Module["INITIAL_MEMORY"], + "Detected runtime INITIAL_MEMORY setting. Use -sIMPORTED_MEMORY to define wasmMemory dynamically", + ); + + // include: runtime_stack_check.js + // Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. + function writeStackCookie() { + var max = _emscripten_stack_get_end(); + assert((max & 3) == 0); + // If the stack ends at address zero we write our cookies 4 bytes into the + // stack. This prevents interference with SAFE_HEAP and ASAN which also + // monitor writes to address zero. + if (max == 0) { + max += 4; + } + // The stack grow downwards towards _emscripten_stack_get_end. + // We write cookies to the final two words in the stack and detect if they are + // ever overwritten. + HEAPU32[max >> 2] = 0x02135467; + HEAPU32[(max + 4) >> 2] = 0x89bacdfe; + // Also test the global address 0 for integrity. + HEAPU32[0 >> 2] = 1668509029; + } + + function checkStackCookie() { + if (ABORT) return; + var max = _emscripten_stack_get_end(); + // See writeStackCookie(). + if (max == 0) { + max += 4; + } + var cookie1 = HEAPU32[max >> 2]; + var cookie2 = HEAPU32[(max + 4) >> 2]; + if (cookie1 != 0x02135467 || cookie2 != 0x89bacdfe) { + abort( + `Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`, + ); + } + // Also test the global address 0 for integrity. + if (HEAPU32[0 >> 2] != 0x63736d65 /* 'emsc' */) { + abort( + "Runtime error: The application has corrupted its heap memory area (address zero)!", + ); + } + } + // end include: runtime_stack_check.js + var __ATPRERUN__ = []; // functions called before the runtime is initialized + var __ATINIT__ = []; // functions called during startup + var __ATEXIT__ = []; // functions called during shutdown + var __ATPOSTRUN__ = []; // functions called after the main() is called + + var runtimeInitialized = false; + + function preRun() { + if (Module["preRun"]) { + if (typeof Module["preRun"] == "function") + Module["preRun"] = [Module["preRun"]]; + while (Module["preRun"].length) { + addOnPreRun(Module["preRun"].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); + } + + function initRuntime() { + assert(!runtimeInitialized); + runtimeInitialized = true; + + checkStackCookie(); + + if (!Module["noFSInit"] && !FS.initialized) FS.init(); + FS.ignorePermissions = false; + + TTY.init(); + SOCKFS.root = FS.mount(SOCKFS, {}, null); + PIPEFS.root = FS.mount(PIPEFS, {}, null); + callRuntimeCallbacks(__ATINIT__); + } + + function postRun() { + checkStackCookie(); + + if (Module["postRun"]) { + if (typeof Module["postRun"] == "function") + Module["postRun"] = [Module["postRun"]]; + while (Module["postRun"].length) { + addOnPostRun(Module["postRun"].shift()); + } + } + + callRuntimeCallbacks(__ATPOSTRUN__); + } + + function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); + } + + function addOnInit(cb) { + __ATINIT__.unshift(cb); + } + + function addOnExit(cb) {} + + function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); + } + + // include: runtime_math.js + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul + + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround + + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32 + + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc + + assert( + Math.imul, + "This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill", + ); + assert( + Math.fround, + "This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill", + ); + assert( + Math.clz32, + "This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill", + ); + assert( + Math.trunc, + "This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill", + ); + // end include: runtime_math.js + // A counter of dependencies for calling run(). If we need to + // do asynchronous work before running, increment this and + // decrement it. Incrementing must happen in a place like + // Module.preRun (used by emcc to add file preloading). + // Note that you can add dependencies in preRun, even though + // it happens right before run - run will be postponed until + // the dependencies are met. + var runDependencies = 0; + var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled + var runDependencyTracking = {}; + var runDependencyWatcher = null; + + function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } + } + + function addRunDependency(id) { + runDependencies++; + + Module["monitorRunDependencies"]?.(runDependencies); + + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if ( + runDependencyWatcher === null && + typeof setInterval != "undefined" + ) { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(() => { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err("still waiting on run dependencies:"); + } + err(`dependency: ${dep}`); + } + if (shown) { + err("(end of list)"); + } + }, 10000); + } + } else { + err("warning: run dependency added without ID"); + } + } + + function removeRunDependency(id) { + runDependencies--; + + Module["monitorRunDependencies"]?.(runDependencies); + + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err("warning: run dependency removed without ID"); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } + } + + /** @param {string|number=} what */ + function abort(what) { + Module["onAbort"]?.(what); + + what = "Aborted(" + what + ")"; + // TODO(sbc): Should we remove printing and leave it up to whoever + // catches the exception? + err(what); + + ABORT = true; + + // Use a wasm runtime error, because a JS error might be seen as a foreign + // exception, which means we'd run destructors on it. We need the error to + // simply make the program stop. + // FIXME This approach does not work in Wasm EH because it currently does not assume + // all RuntimeErrors are from traps; it decides whether a RuntimeError is from + // a trap or not based on a hidden field within the object. So at the moment + // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that + // allows this in the wasm spec. + + // Suppress closure compiler warning here. Closure compiler's builtin extern + // definition for WebAssembly.RuntimeError claims it takes no arguments even + // though it can. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed. + /** @suppress {checkTypes} */ + var e = new WebAssembly.RuntimeError(what); + + readyPromiseReject(e); + // Throw the error whether or not MODULARIZE is set because abort is used + // in code paths apart from instantiation where an exception is expected + // to be thrown when abort is called. + throw e; + } + + // include: memoryprofiler.js + // end include: memoryprofiler.js + // include: URIUtils.js + // Prefix of data URIs emitted by SINGLE_FILE and related options. + var dataURIPrefix = "data:application/octet-stream;base64,"; + + /** + * Indicates whether filename is a base64 data URI. + * @noinline + */ + var isDataURI = (filename) => filename.startsWith(dataURIPrefix); + + /** + * Indicates whether filename is delivered via file protocol (as opposed to http/https) + * @noinline + */ + var isFileURI = (filename) => filename.startsWith("file://"); + // end include: URIUtils.js + function createExportWrapper(name, nargs) { + return (...args) => { + assert( + runtimeInitialized, + `native function \`${name}\` called before runtime initialization`, + ); + var f = wasmExports[name]; + assert(f, `exported native function \`${name}\` not found`); + // Only assert for too many arguments. Too few can be valid since the missing arguments will be zero filled. + assert( + args.length <= nargs, + `native function \`${name}\` called with ${args.length} args but expects ${nargs}`, + ); + return f(...args); + }; + } + + // include: runtime_exceptions.js + // end include: runtime_exceptions.js + function findWasmBinary() { + if (Module["locateFile"]) { + var f = "php-wasm.wasm"; + if (!isDataURI(f)) { + return locateFile(f); + } + return f; + } + // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too. + return new URL("php-wasm.wasm", import.meta.url).href; + } + + var wasmBinaryFile; + + function getBinarySync(file) { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary); + } + if (readBinary) { + return readBinary(file); + } + throw "both async and sync fetching of the wasm failed"; + } + + async function getWasmBinary(binaryFile) { + // If we don't have the binary yet, load it asynchronously using readAsync. + if (!wasmBinary) { + // Fetch the binary using readAsync + try { + var response = await readAsync(binaryFile); + return new Uint8Array(response); + } catch { + // Fall back to getBinarySync below; + } + } + + // Otherwise, getBinarySync should be able to get it synchronously + return getBinarySync(binaryFile); + } + + async function instantiateArrayBuffer(binaryFile, imports) { + try { + var binary = await getWasmBinary(binaryFile); + var instance = await WebAssembly.instantiate(binary, imports); + return instance; + } catch (reason) { + err(`failed to asynchronously prepare wasm: ${reason}`); + + // Warn on some common problems. + if (isFileURI(wasmBinaryFile)) { + err( + `warning: Loading from a file URI (${wasmBinaryFile}) is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing`, + ); + } + abort(reason); + } + } + + async function instantiateAsync(binary, binaryFile, imports) { + if ( + !binary && + typeof WebAssembly.instantiateStreaming == "function" && + !isDataURI(binaryFile) && + typeof fetch == "function" + ) { + try { + var response = fetch(binaryFile, { credentials: "same-origin" }); + var instantiationResult = await WebAssembly.instantiateStreaming( + response, + imports, + ); + return instantiationResult; + } catch (reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err(`wasm streaming compile failed: ${reason}`); + err("falling back to ArrayBuffer instantiation"); + // fall back of instantiateArrayBuffer below + } + } + return instantiateArrayBuffer(binaryFile, imports); + } + + function getWasmImports() { + // prepare imports + return { + env: wasmImports, + wasi_snapshot_preview1: wasmImports, + }; + } + + // Create the wasm instance. + // Receives the wasm imports, returns the exports. + async function createWasm() { + // Load the wasm module and create an instance of using native support in the JS engine. + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + /** @param {WebAssembly.Module=} module*/ + function receiveInstance(instance, module) { + wasmExports = instance.exports; + + wasmMemory = wasmExports["memory"]; + + assert(wasmMemory, "memory not found in wasm exports"); + updateMemoryViews(); + + wasmTable = wasmExports["__indirect_function_table"]; + + assert(wasmTable, "table not found in wasm exports"); + + addOnInit(wasmExports["__wasm_call_ctors"]); + + removeRunDependency("wasm-instantiate"); + return wasmExports; + } + // wait for the pthread pool (if any) + addRunDependency("wasm-instantiate"); + + // Prefer streaming instantiation if available. + // Async compilation can be confusing when an error on the page overwrites Module + // (for example, if the order of elements is wrong, and the one defining Module is + // later), so we save Module and check it later. + var trueModule = Module; + function receiveInstantiationResult(result) { + // 'result' is a ResultObject object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + assert( + Module === trueModule, + "the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?", + ); + trueModule = null; + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line. + // When the regression is fixed, can restore the above PTHREADS-enabled path. + receiveInstance(result["instance"]); + } + + var info = getWasmImports(); + + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to + // run the instantiation parallel to any other async startup actions they are + // performing. + // Also pthreads and wasm workers initialize the wasm instance through this + // path. + if (Module["instantiateWasm"]) { + try { + return Module["instantiateWasm"](info, receiveInstance); + } catch (e) { + err(`Module.instantiateWasm callback failed with error: ${e}`); + // If instantiation fails, reject the module ready promise. + readyPromiseReject(e); + } + } + + wasmBinaryFile ??= findWasmBinary(); + + try { + var result = await instantiateAsync(wasmBinary, wasmBinaryFile, info); + receiveInstantiationResult(result); + return result; + } catch (e) { + // If instantiation fails, reject the module ready promise. + readyPromiseReject(e); + return; + } + } + + // Globals used by JS i64 conversions (see makeSetValue) + var tempDouble; + var tempI64; + + // include: runtime_debug.js + // Endianness check + (() => { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 0x6373; + if (h8[0] !== 0x73 || h8[1] !== 0x63) + throw "Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)"; + })(); + + if (Module["ENVIRONMENT"]) { + throw new Error( + "Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)", + ); + } + + function legacyModuleProp(prop, newName, incoming = true) { + if (!Object.getOwnPropertyDescriptor(Module, prop)) { + Object.defineProperty(Module, prop, { + configurable: true, + get() { + let extra = incoming + ? " (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)" + : ""; + abort( + `\`Module.${prop}\` has been replaced by \`${newName}\`` + extra, + ); + }, + }); + } + } + + function ignoredModuleProp(prop) { + if (Object.getOwnPropertyDescriptor(Module, prop)) { + abort( + `\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`, + ); + } + } + + // forcing the filesystem exports a few things by default + function isExportedByForceFilesystem(name) { + return ( + name === "FS_createPath" || + name === "FS_createDataFile" || + name === "FS_createPreloadedFile" || + name === "FS_unlink" || + name === "addRunDependency" || + // The old FS has some functionality that WasmFS lacks. + name === "FS_createLazyFile" || + name === "FS_createDevice" || + name === "removeRunDependency" + ); + } + + /** + * Intercept access to a global symbol. This enables us to give informative + * warnings/errors when folks attempt to use symbols they did not include in + * their build, or no symbols that no longer exist. + */ + function hookGlobalSymbolAccess(sym, func) { + if ( + typeof globalThis != "undefined" && + !Object.getOwnPropertyDescriptor(globalThis, sym) + ) { + Object.defineProperty(globalThis, sym, { + configurable: true, + get() { + func(); + return undefined; + }, + }); + } + } + + function missingGlobal(sym, msg) { + hookGlobalSymbolAccess(sym, () => { + warnOnce(`\`${sym}\` is not longer defined by emscripten. ${msg}`); + }); + } + + missingGlobal("buffer", "Please use HEAP8.buffer or wasmMemory.buffer"); + missingGlobal("asm", "Please use wasmExports instead"); + + function missingLibrarySymbol(sym) { + hookGlobalSymbolAccess(sym, () => { + // Can't `abort()` here because it would break code that does runtime + // checks. e.g. `if (typeof SDL === 'undefined')`. + var msg = `\`${sym}\` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line`; + // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in + // library.js, which means $name for a JS name with no prefix, or name + // for a JS name like _name. + var librarySymbol = sym; + if (!librarySymbol.startsWith("_")) { + librarySymbol = "$" + sym; + } + msg += ` (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='${librarySymbol}')`; + if (isExportedByForceFilesystem(sym)) { + msg += + ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you"; + } + warnOnce(msg); + }); + + // Any symbol that is not included from the JS library is also (by definition) + // not exported on the Module object. + unexportedRuntimeSymbol(sym); + } + + function unexportedRuntimeSymbol(sym) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Object.defineProperty(Module, sym, { + configurable: true, + get() { + var msg = `'${sym}' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)`; + if (isExportedByForceFilesystem(sym)) { + msg += + ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you"; + } + abort(msg); + }, + }); + } + } + + // Used by XXXXX_DEBUG settings to output debug messages. + function dbg(...args) { + // TODO(sbc): Make this configurable somehow. Its not always convenient for + // logging to show up as warnings. + console.warn(...args); + } + // end include: runtime_debug.js + // === Body === + // end include: preamble.js + + class ExitStatus { + name = "ExitStatus"; + constructor(status) { + this.message = `Program terminated with exit(${status})`; + this.status = status; + } + } + + var callRuntimeCallbacks = (callbacks) => { + while (callbacks.length > 0) { + // Pass the module as the first argument. + callbacks.shift()(Module); + } + }; + + /** + * @param {number} ptr + * @param {string} type + */ + function getValue(ptr, type = "i8") { + if (type.endsWith("*")) type = "*"; + switch (type) { + case "i1": + return HEAP8[ptr]; + case "i8": + return HEAP8[ptr]; + case "i16": + return HEAP16[ptr >> 1]; + case "i32": + return HEAP32[ptr >> 2]; + case "i64": + abort("to do getValue(i64) use WASM_BIGINT"); + case "float": + return HEAPF32[ptr >> 2]; + case "double": + return HEAPF64[ptr >> 3]; + case "*": + return HEAPU32[ptr >> 2]; + default: + abort(`invalid type for getValue: ${type}`); + } + } + + var noExitRuntime = Module["noExitRuntime"] || true; + + var ptrToString = (ptr) => { + assert(typeof ptr === "number"); + // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned. + ptr >>>= 0; + return "0x" + ptr.toString(16).padStart(8, "0"); + }; + + /** + * @param {number} ptr + * @param {number} value + * @param {string} type + */ + function setValue(ptr, value, type = "i8") { + if (type.endsWith("*")) type = "*"; + switch (type) { + case "i1": + HEAP8[ptr] = value; + break; + case "i8": + HEAP8[ptr] = value; + break; + case "i16": + HEAP16[ptr >> 1] = value; + break; + case "i32": + HEAP32[ptr >> 2] = value; + break; + case "i64": + abort("to do setValue(i64) use WASM_BIGINT"); + case "float": + HEAPF32[ptr >> 2] = value; + break; + case "double": + HEAPF64[ptr >> 3] = value; + break; + case "*": + HEAPU32[ptr >> 2] = value; + break; + default: + abort(`invalid type for setValue: ${type}`); + } + } + + var stackRestore = (val) => __emscripten_stack_restore(val); + + var stackSave = () => _emscripten_stack_get_current(); + + var warnOnce = (text) => { + warnOnce.shown ||= {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text); + } + }; + + var UTF8Decoder = + typeof TextDecoder != "undefined" ? new TextDecoder() : undefined; + + /** + * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given + * array that contains uint8 values, returns a copy of that string as a + * Javascript String object. + * heapOrArray is either a regular array, or a JavaScript typed array view. + * @param {number=} idx + * @param {number=} maxBytesToRead + * @return {string} + */ + var UTF8ArrayToString = (heapOrArray, idx = 0, maxBytesToRead = NaN) => { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on + // null terminator by itself. Also, use the length info to avoid running tiny + // strings through TextDecoder, since .subarray() allocates garbage. + // (As a tiny code save trick, compare endPtr against endIdx using a negation, + // so that undefined/NaN means Infinity) + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr)); + } + var str = ""; + // If building with TextDecoder, we have already computed the string length + // above, so test loop end condition against that + while (idx < endPtr) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + var u0 = heapOrArray[idx++]; + if (!(u0 & 0x80)) { + str += String.fromCharCode(u0); + continue; + } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 0xe0) == 0xc0) { + str += String.fromCharCode(((u0 & 31) << 6) | u1); + continue; + } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 0xf0) == 0xe0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + if ((u0 & 0xf8) != 0xf0) + warnOnce( + "Invalid UTF-8 leading byte " + + ptrToString(u0) + + " encountered when deserializing a UTF-8 string in wasm memory to a JS string!", + ); + u0 = + ((u0 & 7) << 18) | + (u1 << 12) | + (u2 << 6) | + (heapOrArray[idx++] & 63); + } + + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode( + 0xd800 | (ch >> 10), + 0xdc00 | (ch & 0x3ff), + ); + } + } + return str; + }; + + /** + * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the + * emscripten HEAP, returns a copy of that string as a Javascript String object. + * + * @param {number} ptr + * @param {number=} maxBytesToRead - An optional length that specifies the + * maximum number of bytes to read. You can omit this parameter to scan the + * string until the first 0 byte. If maxBytesToRead is passed, and the string + * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the + * string will cut short at that byte index (i.e. maxBytesToRead will not + * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing + * frequent uses of UTF8ToString() with and without maxBytesToRead may throw + * JS JIT optimizations off, so it is worth to consider consistently using one + * @return {string} + */ + var UTF8ToString = (ptr, maxBytesToRead) => { + assert( + typeof ptr == "number", + `UTF8ToString expects a number (got ${typeof ptr})`, + ); + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : ""; + }; + var ___assert_fail = (condition, filename, line, func) => + abort( + `Assertion failed: ${UTF8ToString(condition)}, at: ` + + [ + filename ? UTF8ToString(filename) : "unknown filename", + line, + func ? UTF8ToString(func) : "unknown function", + ], + ); + + var wasmTableMirror = []; + + /** @type {WebAssembly.Table} */ + var wasmTable; + var getWasmTableEntry = (funcPtr) => { + var func = wasmTableMirror[funcPtr]; + if (!func) { + if (funcPtr >= wasmTableMirror.length) + wasmTableMirror.length = funcPtr + 1; + /** @suppress {checkTypes} */ + wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr); + } + /** @suppress {checkTypes} */ + assert( + wasmTable.get(funcPtr) == func, + "JavaScript-side Wasm function table mirror is out of date!", + ); + return func; + }; + var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig); + + var PATH = { + isAbs: (path) => path.charAt(0) === "/", + splitPath: (filename) => { + var splitPathRe = + /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + }, + normalizeArray: (parts, allowAboveRoot) => { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === ".") { + parts.splice(i, 1); + } else if (last === "..") { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift(".."); + } + } + return parts; + }, + normalize: (path) => { + var isAbsolute = PATH.isAbs(path), + trailingSlash = path.substr(-1) === "/"; + // Normalize the path + path = PATH.normalizeArray( + path.split("/").filter((p) => !!p), + !isAbsolute, + ).join("/"); + if (!path && !isAbsolute) { + path = "."; + } + if (path && trailingSlash) { + path += "/"; + } + return (isAbsolute ? "/" : "") + path; + }, + dirname: (path) => { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return "."; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + }, + basename: (path) => { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === "/") return "/"; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf("/"); + if (lastSlash === -1) return path; + return path.substr(lastSlash + 1); + }, + join: (...paths) => PATH.normalize(paths.join("/")), + join2: (l, r) => PATH.normalize(l + "/" + r), + }; + + var initRandomFill = () => { + if ( + typeof crypto == "object" && + typeof crypto["getRandomValues"] == "function" + ) { + // for modern web browsers + return (view) => crypto.getRandomValues(view); + } + // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096 + else + abort( + "no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };", + ); + }; + var randomFill = (view) => { + // Lazily init on the first invocation. + return (randomFill = initRandomFill())(view); + }; + + var PATH_FS = { + resolve: (...args) => { + var resolvedPath = "", + resolvedAbsolute = false; + for (var i = args.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = i >= 0 ? args[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path != "string") { + throw new TypeError("Arguments to path.resolve must be strings"); + } else if (!path) { + return ""; // an invalid portion invalidates the whole thing + } + resolvedPath = path + "/" + resolvedPath; + resolvedAbsolute = PATH.isAbs(path); + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray( + resolvedPath.split("/").filter((p) => !!p), + !resolvedAbsolute, + ).join("/"); + return (resolvedAbsolute ? "/" : "") + resolvedPath || "."; + }, + relative: (from, to) => { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== "") break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== "") break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split("/")); + var toParts = trim(to.split("/")); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push(".."); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join("/"); + }, + }; + + var FS_stdin_getChar_buffer = []; + + var lengthBytesUTF8 = (str) => { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var c = str.charCodeAt(i); // possibly a lead surrogate + if (c <= 0x7f) { + len++; + } else if (c <= 0x7ff) { + len += 2; + } else if (c >= 0xd800 && c <= 0xdfff) { + len += 4; + ++i; + } else { + len += 3; + } + } + return len; + }; + + var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => { + assert( + typeof str === "string", + `stringToUTF8Array expects a string (got ${typeof str})`, + ); + // Parameter maxBytesToWrite is not optional. Negative values, 0, null, + // undefined and false each don't write out any bytes. + if (!(maxBytesToWrite > 0)) return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description + // and https://www.ietf.org/rfc/rfc2279.txt + // and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xd800 && u <= 0xdfff) { + var u1 = str.charCodeAt(++i); + u = (0x10000 + ((u & 0x3ff) << 10)) | (u1 & 0x3ff); + } + if (u <= 0x7f) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 0x7ff) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 0xc0 | (u >> 6); + heap[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xffff) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 0xe0 | (u >> 12); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 3 >= endIdx) break; + if (u > 0x10ffff) + warnOnce( + "Invalid Unicode code point " + + ptrToString(u) + + " encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).", + ); + heap[outIdx++] = 0xf0 | (u >> 18); + heap[outIdx++] = 0x80 | ((u >> 12) & 63); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + heap[outIdx] = 0; + return outIdx - startIdx; + }; + /** @type {function(string, boolean=, number=)} */ + function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array( + stringy, + u8array, + 0, + u8array.length, + ); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; + } + var FS_stdin_getChar = () => { + if (!FS_stdin_getChar_buffer.length) { + var result = null; + if ( + typeof window != "undefined" && + typeof window.prompt == "function" + ) { + // Browser. + result = window.prompt("Input: "); // returns null on cancel + if (result !== null) { + result += "\n"; + } + } else { + } + if (!result) { + return null; + } + FS_stdin_getChar_buffer = intArrayFromString(result, true); + } + return FS_stdin_getChar_buffer.shift(); + }; + var TTY = { + ttys: [], + init() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process.stdin.setEncoding('utf8'); + // } + }, + shutdown() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process.stdin.pause(); + // } + }, + register(dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + }, + stream_ops: { + open(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + }, + close(stream) { + // flush any pending line data + stream.tty.ops.fsync(stream.tty); + }, + fsync(stream) { + stream.tty.ops.fsync(stream.tty); + }, + read(stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result; + } + if (bytesRead) { + stream.node.atime = Date.now(); + } + return bytesRead; + }, + write(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset + i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.mtime = stream.node.ctime = Date.now(); + } + return i; + }, + }, + default_tty_ops: { + get_char(tty) { + return FS_stdin_getChar(); + }, + put_char(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + }, + fsync(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output)); + tty.output = []; + } + }, + ioctl_tcgets(tty) { + // typical setting + return { + c_iflag: 25856, + c_oflag: 5, + c_cflag: 191, + c_lflag: 35387, + c_cc: [ + 0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, + 0x00, 0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + ], + }; + }, + ioctl_tcsets(tty, optional_actions, data) { + // currently just ignore + return 0; + }, + ioctl_tiocgwinsz(tty) { + return [24, 80]; + }, + }, + default_tty1_ops: { + put_char(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + }, + fsync(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output)); + tty.output = []; + } + }, + }, + }; + + var zeroMemory = (address, size) => { + HEAPU8.fill(0, address, address + size); + }; + + var alignMemory = (size, alignment) => { + assert(alignment, "alignment argument is required"); + return Math.ceil(size / alignment) * alignment; + }; + var mmapAlloc = (size) => { + size = alignMemory(size, 65536); + var ptr = _emscripten_builtin_memalign(65536, size); + if (ptr) zeroMemory(ptr, size); + return ptr; + }; + var MEMFS = { + ops_table: null, + mount(mount) { + return MEMFS.createNode(null, "/", 16895, 0); + }, + createNode(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(63); + } + MEMFS.ops_table ||= { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink, + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + }, + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync, + }, + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink, + }, + stream: {}, + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + }, + stream: FS.chrdev_stream_ops, + }, + }; + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.atime = node.mtime = node.ctime = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + parent.atime = parent.mtime = parent.ctime = node.atime; + } + return node; + }, + getFileDataAsTypedArray(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) + return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + }, + expandFileStorage(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max( + newCapacity, + (prevCapacity * + (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> + 0, + ); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) + node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + }, + resizeFileStorage(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); // Allocate new storage. + if (oldContents) { + node.contents.set( + oldContents.subarray(0, Math.min(newSize, node.usedBytes)), + ); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + } + }, + node_ops: { + getattr(node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.atime); + attr.mtime = new Date(node.mtime); + attr.ctime = new Date(node.ctime); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + }, + setattr(node, attr) { + for (const key of ["mode", "atime", "mtime", "ctime"]) { + if (attr[key]) { + node[key] = attr[key]; + } + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + }, + lookup(parent, name) { + throw new FS.ErrnoError(44); + }, + mknod(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + }, + rename(old_node, new_dir, new_name) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) {} + if (new_node) { + if (FS.isDir(old_node.mode)) { + // if we're overwriting a directory at new_name, make sure it's empty. + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + FS.hashRemoveNode(new_node); + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + new_dir.contents[new_name] = old_node; + old_node.name = new_name; + new_dir.ctime = + new_dir.mtime = + old_node.parent.ctime = + old_node.parent.mtime = + Date.now(); + }, + unlink(parent, name) { + delete parent.contents[name]; + parent.ctime = parent.mtime = Date.now(); + }, + rmdir(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + parent.ctime = parent.mtime = Date.now(); + }, + readdir(node) { + return [".", "..", ...Object.keys(node.contents)]; + }, + symlink(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 0o777 | 40960, 0); + node.link = oldpath; + return node; + }, + readlink(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + }, + }, + stream_ops: { + read(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { + // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) + buffer[offset + i] = contents[position + i]; + } + return size; + }, + write(stream, buffer, offset, length, position, canOwn) { + // The data buffer should be a typed array view + assert(!(buffer instanceof ArrayBuffer)); + + if (!length) return 0; + var node = stream.node; + node.mtime = node.ctime = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { + // This write is from a typed array to a typed array? + if (canOwn) { + assert( + position === 0, + "canOwn must imply no weird position inside the file", + ); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { + // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { + // Writing to an already allocated and used subrange of the file? + node.contents.set( + buffer.subarray(offset, offset + length), + position, + ); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position + length); + if (node.contents.subarray && buffer.subarray) { + // Use typed array write which is available. + node.contents.set( + buffer.subarray(offset, offset + length), + position, + ); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + }, + llseek(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + }, + allocate(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max( + stream.node.usedBytes, + offset + length, + ); + }, + mmap(stream, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if (!(flags & 2) && contents && contents.buffer === HEAP8.buffer) { + // We can't emulate MAP_SHARED when the file is not backed by the + // buffer we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + if (contents) { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call( + contents, + position, + position + length, + ); + } + } + HEAP8.set(contents, ptr); + } + } + return { ptr, allocated }; + }, + msync(stream, buffer, offset, length, mmapFlags) { + MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }, + }, + }; + + var asyncLoad = async (url) => { + var arrayBuffer = await readAsync(url); + assert( + arrayBuffer, + `Loading data file "${url}" failed (no arrayBuffer).`, + ); + return new Uint8Array(arrayBuffer); + }; + + var FS_createDataFile = ( + parent, + name, + fileData, + canRead, + canWrite, + canOwn, + ) => { + FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn); + }; + + var preloadPlugins = Module["preloadPlugins"] || []; + var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => { + // Ensure plugins are ready. + if (typeof Browser != "undefined") Browser.init(); + + var handled = false; + preloadPlugins.forEach((plugin) => { + if (handled) return; + if (plugin["canHandle"](fullname)) { + plugin["handle"](byteArray, fullname, finish, onerror); + handled = true; + } + }); + return handled; + }; + var FS_createPreloadedFile = ( + parent, + name, + url, + canRead, + canWrite, + onload, + onerror, + dontCreateFile, + canOwn, + preFinish, + ) => { + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + preFinish?.(); + if (!dontCreateFile) { + FS_createDataFile( + parent, + name, + byteArray, + canRead, + canWrite, + canOwn, + ); + } + onload?.(); + removeRunDependency(dep); + } + if ( + FS_handledByPreloadPlugin(byteArray, fullname, finish, () => { + onerror?.(); + removeRunDependency(dep); + }) + ) { + return; + } + finish(byteArray); + } + addRunDependency(dep); + if (typeof url == "string") { + asyncLoad(url).then(processData, onerror); + } else { + processData(url); + } + }; + + var FS_modeStringToFlags = (str) => { + var flagModes = { + r: 0, + "r+": 2, + w: 512 | 64 | 1, + "w+": 512 | 64 | 2, + a: 1024 | 64 | 1, + "a+": 1024 | 64 | 2, + }; + var flags = flagModes[str]; + if (typeof flags == "undefined") { + throw new Error(`Unknown file open mode: ${str}`); + } + return flags; + }; + + var FS_getMode = (canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + }; + + var strError = (errno) => UTF8ToString(_strerror(errno)); + + var ERRNO_CODES = { + EPERM: 63, + ENOENT: 44, + ESRCH: 71, + EINTR: 27, + EIO: 29, + ENXIO: 60, + E2BIG: 1, + ENOEXEC: 45, + EBADF: 8, + ECHILD: 12, + EAGAIN: 6, + EWOULDBLOCK: 6, + ENOMEM: 48, + EACCES: 2, + EFAULT: 21, + ENOTBLK: 105, + EBUSY: 10, + EEXIST: 20, + EXDEV: 75, + ENODEV: 43, + ENOTDIR: 54, + EISDIR: 31, + EINVAL: 28, + ENFILE: 41, + EMFILE: 33, + ENOTTY: 59, + ETXTBSY: 74, + EFBIG: 22, + ENOSPC: 51, + ESPIPE: 70, + EROFS: 69, + EMLINK: 34, + EPIPE: 64, + EDOM: 18, + ERANGE: 68, + ENOMSG: 49, + EIDRM: 24, + ECHRNG: 106, + EL2NSYNC: 156, + EL3HLT: 107, + EL3RST: 108, + ELNRNG: 109, + EUNATCH: 110, + ENOCSI: 111, + EL2HLT: 112, + EDEADLK: 16, + ENOLCK: 46, + EBADE: 113, + EBADR: 114, + EXFULL: 115, + ENOANO: 104, + EBADRQC: 103, + EBADSLT: 102, + EDEADLOCK: 16, + EBFONT: 101, + ENOSTR: 100, + ENODATA: 116, + ETIME: 117, + ENOSR: 118, + ENONET: 119, + ENOPKG: 120, + EREMOTE: 121, + ENOLINK: 47, + EADV: 122, + ESRMNT: 123, + ECOMM: 124, + EPROTO: 65, + EMULTIHOP: 36, + EDOTDOT: 125, + EBADMSG: 9, + ENOTUNIQ: 126, + EBADFD: 127, + EREMCHG: 128, + ELIBACC: 129, + ELIBBAD: 130, + ELIBSCN: 131, + ELIBMAX: 132, + ELIBEXEC: 133, + ENOSYS: 52, + ENOTEMPTY: 55, + ENAMETOOLONG: 37, + ELOOP: 32, + EOPNOTSUPP: 138, + EPFNOSUPPORT: 139, + ECONNRESET: 15, + ENOBUFS: 42, + EAFNOSUPPORT: 5, + EPROTOTYPE: 67, + ENOTSOCK: 57, + ENOPROTOOPT: 50, + ESHUTDOWN: 140, + ECONNREFUSED: 14, + EADDRINUSE: 3, + ECONNABORTED: 13, + ENETUNREACH: 40, + ENETDOWN: 38, + ETIMEDOUT: 73, + EHOSTDOWN: 142, + EHOSTUNREACH: 23, + EINPROGRESS: 26, + EALREADY: 7, + EDESTADDRREQ: 17, + EMSGSIZE: 35, + EPROTONOSUPPORT: 66, + ESOCKTNOSUPPORT: 137, + EADDRNOTAVAIL: 4, + ENETRESET: 39, + EISCONN: 30, + ENOTCONN: 53, + ETOOMANYREFS: 141, + EUSERS: 136, + EDQUOT: 19, + ESTALE: 72, + ENOTSUP: 138, + ENOMEDIUM: 148, + EILSEQ: 25, + EOVERFLOW: 61, + ECANCELED: 11, + ENOTRECOVERABLE: 56, + EOWNERDEAD: 62, + ESTRPIPE: 135, + }; + var FS = { + root: null, + mounts: [], + devices: {}, + streams: [], + nextInode: 1, + nameTable: null, + currentPath: "/", + initialized: false, + ignorePermissions: true, + ErrnoError: class extends Error { + name = "ErrnoError"; + // We set the `name` property to be able to identify `FS.ErrnoError` + // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway. + // - when using PROXYFS, an error can come from an underlying FS + // as different FS objects have their own FS.ErrnoError each, + // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs. + // we'll use the reliable test `err.name == "ErrnoError"` instead + constructor(errno) { + super(runtimeInitialized ? strError(errno) : ""); + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + } + }, + filesystems: null, + syncFSRequests: 0, + readFiles: {}, + FSStream: class { + shared = {}; + get object() { + return this.node; + } + set object(val) { + this.node = val; + } + get isRead() { + return (this.flags & 2097155) !== 1; + } + get isWrite() { + return (this.flags & 2097155) !== 0; + } + get isAppend() { + return this.flags & 1024; + } + get flags() { + return this.shared.flags; + } + set flags(val) { + this.shared.flags = val; + } + get position() { + return this.shared.position; + } + set position(val) { + this.shared.position = val; + } + }, + FSNode: class { + node_ops = {}; + stream_ops = {}; + readMode = 292 | 73; + writeMode = 146; + mounted = null; + constructor(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.rdev = rdev; + this.atime = this.mtime = this.ctime = Date.now(); + } + get read() { + return (this.mode & this.readMode) === this.readMode; + } + set read(val) { + val ? (this.mode |= this.readMode) : (this.mode &= ~this.readMode); + } + get write() { + return (this.mode & this.writeMode) === this.writeMode; + } + set write(val) { + val ? (this.mode |= this.writeMode) : (this.mode &= ~this.writeMode); + } + get isFolder() { + return FS.isDir(this.mode); + } + get isDevice() { + return FS.isChrdev(this.mode); + } + }, + lookupPath(path, opts = {}) { + if (!path) return { path: "", node: null }; + opts.follow_mount ??= true; + + if (!PATH.isAbs(path)) { + path = FS.cwd() + "/" + path; + } + + // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + linkloop: for (var nlinks = 0; nlinks < 40; nlinks++) { + // split the absolute path + var parts = path.split("/").filter((p) => !!p && p !== "."); + + // start at the root + var current = FS.root; + var current_path = "/"; + + for (var i = 0; i < parts.length; i++) { + var islast = i === parts.length - 1; + if (islast && opts.parent) { + // stop resolving + break; + } + + if (parts[i] === "..") { + current_path = PATH.dirname(current_path); + current = current.parent; + continue; + } + + current_path = PATH.join2(current_path, parts[i]); + try { + current = FS.lookupNode(current, parts[i]); + } catch (e) { + // if noent_okay is true, suppress a ENOENT in the last component + // and return an object with an undefined node. This is needed for + // resolving symlinks in the path when creating a file. + if (e?.errno === 44 && islast && opts.noent_okay) { + return { path: current_path }; + } + throw e; + } + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current) && (!islast || opts.follow_mount)) { + current = current.mounted.root; + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (FS.isLink(current.mode) && (!islast || opts.follow)) { + if (!current.node_ops.readlink) { + throw new FS.ErrnoError(52); + } + var link = current.node_ops.readlink(current); + if (!PATH.isAbs(link)) { + link = PATH.dirname(current_path) + "/" + link; + } + path = link + "/" + parts.slice(i + 1).join("/"); + continue linkloop; + } + } + return { path: current_path, node: current }; + } + throw new FS.ErrnoError(32); + }, + getPath(node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length - 1] !== "/" + ? `${mount}/${path}` + : mount + path; + } + path = path ? `${node.name}/${path}` : node.name; + node = node.parent; + } + }, + hashName(parentid, name) { + var hash = 0; + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + }, + hashAddNode(node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + }, + hashRemoveNode(node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + }, + lookupNode(parent, name) { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + }, + createNode(parent, name, mode, rdev) { + assert(typeof parent == "object"); + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + }, + destroyNode(node) { + FS.hashRemoveNode(node); + }, + isRoot(node) { + return node === node.parent; + }, + isMountpoint(node) { + return !!node.mounted; + }, + isFile(mode) { + return (mode & 61440) === 32768; + }, + isDir(mode) { + return (mode & 61440) === 16384; + }, + isLink(mode) { + return (mode & 61440) === 40960; + }, + isChrdev(mode) { + return (mode & 61440) === 8192; + }, + isBlkdev(mode) { + return (mode & 61440) === 24576; + }, + isFIFO(mode) { + return (mode & 61440) === 4096; + }, + isSocket(mode) { + return (mode & 49152) === 49152; + }, + flagsToPermissionString(flag) { + var perms = ["r", "w", "rw"][flag & 3]; + if (flag & 512) { + perms += "w"; + } + return perms; + }, + nodePermissions(node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.includes("r") && !(node.mode & 292)) { + return 2; + } else if (perms.includes("w") && !(node.mode & 146)) { + return 2; + } else if (perms.includes("x") && !(node.mode & 73)) { + return 2; + } + return 0; + }, + mayLookup(dir) { + if (!FS.isDir(dir.mode)) return 54; + var errCode = FS.nodePermissions(dir, "x"); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + }, + mayCreate(dir, name) { + if (!FS.isDir(dir.mode)) { + return 54; + } + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) {} + return FS.nodePermissions(dir, "wx"); + }, + mayDelete(dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, "wx"); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + }, + mayOpen(node, flags) { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if ( + FS.flagsToPermissionString(flags) !== "r" || // opening for write + flags & 512 + ) { + // TODO: check for O_SEARCH? (== search for dir only) + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + }, + MAX_OPEN_FDS: 4096, + nextfd() { + for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + }, + getStreamChecked(fd) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + return stream; + }, + getStream: (fd) => FS.streams[fd], + createStream(stream, fd = -1) { + assert(fd >= -1); + + // clone it, so we can return an instance of FSStream + stream = Object.assign(new FS.FSStream(), stream); + if (fd == -1) { + fd = FS.nextfd(); + } + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + }, + closeStream(fd) { + FS.streams[fd] = null; + }, + dupStream(origStream, fd = -1) { + var stream = FS.createStream(origStream, fd); + stream.stream_ops?.dup?.(stream); + return stream; + }, + chrdev_stream_ops: { + open(stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + stream.stream_ops.open?.(stream); + }, + llseek() { + throw new FS.ErrnoError(70); + }, + }, + major: (dev) => dev >> 8, + minor: (dev) => dev & 0xff, + makedev: (ma, mi) => (ma << 8) | mi, + registerDevice(dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + }, + getDevice: (dev) => FS.devices[dev], + getMounts(mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push(...m.mounts); + } + + return mounts; + }, + syncfs(populate, callback) { + if (typeof populate == "function") { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + err( + `warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`, + ); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + } + + // sync all mounts + mounts.forEach((mount) => { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + }, + mount(type, opts, mountpoint) { + if (typeof type == "string") { + // The filesystem was not included, and instead we have an error + // message stored in the variable. + throw type; + } + var root = mountpoint === "/"; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + + var mount = { + type, + opts, + mountpoint, + mounts: [], + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + }, + unmount(mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach((hash) => { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.includes(current.mount)) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + }, + lookup(parent, name) { + return parent.node_ops.lookup(parent, name); + }, + mknod(path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === "." || name === "..") { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + }, + statfs(path) { + // NOTE: None of the defaults here are true. We're just returning safe and + // sane values. + var rtn = { + bsize: 4096, + frsize: 4096, + blocks: 1e6, + bfree: 5e5, + bavail: 5e5, + files: FS.nextInode, + ffree: FS.nextInode - 1, + fsid: 42, + flags: 2, + namelen: 255, + }; + + var parent = FS.lookupPath(path, { follow: true }).node; + if (parent?.node_ops.statfs) { + Object.assign(rtn, parent.node_ops.statfs(parent.mount.opts.root)); + } + return rtn; + }, + create(path, mode = 0o666) { + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + }, + mkdir(path, mode = 0o777) { + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + }, + mkdirTree(path, mode) { + var dirs = path.split("/"); + var d = ""; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += "/" + dirs[i]; + try { + FS.mkdir(d, mode); + } catch (e) { + if (e.errno != 20) throw e; + } + } + }, + mkdev(path, mode, dev) { + if (typeof dev == "undefined") { + dev = mode; + mode = 0o666; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + }, + symlink(oldpath, newpath) { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + }, + rename(old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + + // let the errors from non existent directories percolate up + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(28); + } + // new path should not be an ancestor of the old path + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(55); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + errCode = new_node + ? FS.mayDelete(new_dir, new_name, isdir) + : FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if ( + FS.isMountpoint(old_node) || + (new_node && FS.isMountpoint(new_node)) + ) { + throw new FS.ErrnoError(10); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + // update old node (we do this here to avoid each backend + // needing to) + old_node.parent = new_dir; + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + }, + rmdir(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + }, + readdir(path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + }, + unlink(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + }, + readlink(path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return link.node_ops.readlink(link); + }, + stat(path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + }, + lstat(path) { + return FS.stat(path, true); + }, + chmod(path, mode, dontFollow) { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + ctime: Date.now(), + }); + }, + lchmod(path, mode) { + FS.chmod(path, mode, true); + }, + fchmod(fd, mode) { + var stream = FS.getStreamChecked(fd); + FS.chmod(stream.node, mode); + }, + chown(path, uid, gid, dontFollow) { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now(), + // we ignore the uid / gid for now + }); + }, + lchown(path, uid, gid) { + FS.chown(path, uid, gid, true); + }, + fchown(fd, uid, gid) { + var stream = FS.getStreamChecked(fd); + FS.chown(stream.node, uid, gid); + }, + truncate(path, len) { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now(), + }); + }, + ftruncate(fd, len) { + var stream = FS.getStreamChecked(fd); + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + }, + utime(path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + atime: atime, + mtime: mtime, + }); + }, + open(path, flags, mode = 0o666) { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags == "string" ? FS_modeStringToFlags(flags) : flags; + if (flags & 64) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path == "object") { + node = path; + } else { + // noent_okay makes it so that if the final component of the path + // doesn't exist, lookupPath returns `node: undefined`. `path` will be + // updated to point to the target of all symlinks. + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072), + noent_okay: true, + }); + node = lookup.node; + path = lookup.path; + } + // perhaps we need to create the node + var created = false; + if (flags & 64) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if (flags & 128) { + throw new FS.ErrnoError(20); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if (flags & 65536 && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // do truncation if necessary + if (flags & 512 && !created) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512 | 131072); + + // register the stream with the filesystem + var stream = FS.createStream({ + node, + path: FS.getPath(node), // we want the absolute path to the node + flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false, + }); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module["logReadFiles"] && !(flags & 1)) { + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + } + } + return stream; + }, + close(stream) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + }, + isClosed(stream) { + return stream.fd === null; + }, + llseek(stream, offset, whence) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + }, + read(stream, buffer, offset, length, position) { + assert(offset >= 0); + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read( + stream, + buffer, + offset, + length, + position, + ); + if (!seeking) stream.position += bytesRead; + return bytesRead; + }, + write(stream, buffer, offset, length, position, canOwn) { + assert(offset >= 0); + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write( + stream, + buffer, + offset, + length, + position, + canOwn, + ); + if (!seeking) stream.position += bytesWritten; + return bytesWritten; + }, + allocate(stream, offset, length) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + }, + mmap(stream, length, position, prot, flags) { + // User requests writing to file (prot & PROT_WRITE != 0). + // Checking if we have permissions to write to the file unless + // MAP_PRIVATE flag is set. According to POSIX spec it is possible + // to write to file opened in read-only mode with MAP_PRIVATE flag, + // as all modifications will be visible only in the memory of + // the current process. + if ( + (prot & 2) !== 0 && + (flags & 2) === 0 && + (stream.flags & 2097155) !== 2 + ) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + if (!length) { + throw new FS.ErrnoError(28); + } + return stream.stream_ops.mmap(stream, length, position, prot, flags); + }, + msync(stream, buffer, offset, length, mmapFlags) { + assert(offset >= 0); + if (!stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync( + stream, + buffer, + offset, + length, + mmapFlags, + ); + }, + ioctl(stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + }, + readFile(path, opts = {}) { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || "binary"; + if (opts.encoding !== "utf8" && opts.encoding !== "binary") { + throw new Error(`Invalid encoding type "${opts.encoding}"`); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === "utf8") { + ret = UTF8ArrayToString(buf); + } else if (opts.encoding === "binary") { + ret = buf; + } + FS.close(stream); + return ret; + }, + writeFile(path, data, opts = {}) { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == "string") { + var buf = new Uint8Array(lengthBytesUTF8(data) + 1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error("Unsupported data type"); + } + FS.close(stream); + }, + cwd: () => FS.currentPath, + chdir(path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, "x"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + }, + createDefaultDirectories() { + FS.mkdir("/tmp"); + FS.mkdir("/home"); + FS.mkdir("/home/web_user"); + }, + createDefaultDevices() { + // create /dev + FS.mkdir("/dev"); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length, + llseek: () => 0, + }); + FS.mkdev("/dev/null", FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using err() rather than out() + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev("/dev/tty", FS.makedev(5, 0)); + FS.mkdev("/dev/tty1", FS.makedev(6, 0)); + // setup /dev/[u]random + // use a buffer to avoid overhead of individual crypto calls per byte + var randomBuffer = new Uint8Array(1024), + randomLeft = 0; + var randomByte = () => { + if (randomLeft === 0) { + randomLeft = randomFill(randomBuffer).byteLength; + } + return randomBuffer[--randomLeft]; + }; + FS.createDevice("/dev", "random", randomByte); + FS.createDevice("/dev", "urandom", randomByte); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir("/dev/shm"); + FS.mkdir("/dev/shm/tmp"); + }, + createSpecialDirectories() { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the + // name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir("/proc"); + var proc_self = FS.mkdir("/proc/self"); + FS.mkdir("/proc/self/fd"); + FS.mount( + { + mount() { + var node = FS.createNode(proc_self, "fd", 16895, 73); + node.stream_ops = { + llseek: MEMFS.stream_ops.llseek, + }; + node.node_ops = { + lookup(parent, name) { + var fd = +name; + var stream = FS.getStreamChecked(fd); + var ret = { + parent: null, + mount: { mountpoint: "fake" }, + node_ops: { readlink: () => stream.path }, + id: fd + 1, + }; + ret.parent = ret; // make it look like a simple root node + return ret; + }, + readdir() { + return Array.from(FS.streams.entries()) + .filter(([k, v]) => v) + .map(([k, v]) => k.toString()); + }, + }; + return node; + }, + }, + {}, + "/proc/self/fd", + ); + }, + createStandardStreams(input, output, error) { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (input) { + FS.createDevice("/dev", "stdin", input); + } else { + FS.symlink("/dev/tty", "/dev/stdin"); + } + if (output) { + FS.createDevice("/dev", "stdout", null, output); + } else { + FS.symlink("/dev/tty", "/dev/stdout"); + } + if (error) { + FS.createDevice("/dev", "stderr", null, error); + } else { + FS.symlink("/dev/tty1", "/dev/stderr"); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open("/dev/stdin", 0); + var stdout = FS.open("/dev/stdout", 1); + var stderr = FS.open("/dev/stderr", 1); + assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`); + assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`); + assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`); + }, + staticInit() { + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, "/"); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + MEMFS: MEMFS, + }; + }, + init(input, output, error) { + assert( + !FS.initialized, + "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)", + ); + FS.initialized = true; + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + input ??= Module["stdin"]; + output ??= Module["stdout"]; + error ??= Module["stderr"]; + + FS.createStandardStreams(input, output, error); + }, + quit() { + FS.initialized = false; + // force-flush all streams, so we get musl std streams printed out + _fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + }, + findObject(path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (!ret.exists) { + return null; + } + return ret.object; + }, + analyzePath(path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) {} + var ret = { + isRoot: false, + exists: false, + error: 0, + name: null, + path: null, + object: null, + parentExists: false, + parentPath: null, + parentObject: null, + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === "/"; + } catch (e) { + ret.error = e.errno; + } + return ret; + }, + createPath(parent, path, canRead, canWrite) { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + var parts = path.split("/").reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + }, + createFile(parent, name, properties, canRead, canWrite) { + var path = PATH.join2( + typeof parent == "string" ? parent : FS.getPath(parent), + name, + ); + var mode = FS_getMode(canRead, canWrite); + return FS.create(path, mode); + }, + createDataFile(parent, name, data, canRead, canWrite, canOwn) { + var path = name; + if (parent) { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent; + } + var mode = FS_getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == "string") { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) + arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + }, + createDevice(parent, name, input, output) { + var path = PATH.join2( + typeof parent == "string" ? parent : FS.getPath(parent), + name, + ); + var mode = FS_getMode(!!input, !!output); + FS.createDevice.major ??= 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open(stream) { + stream.seekable = false; + }, + close(stream) { + // flush any pending line data + if (output?.buffer?.length) { + output(10); + } + }, + read(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result; + } + if (bytesRead) { + stream.node.atime = Date.now(); + } + return bytesRead; + }, + write(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset + i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.mtime = stream.node.ctime = Date.now(); + } + return i; + }, + }); + return FS.mkdev(path, mode, dev); + }, + forceLoadFile(obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) + return true; + if (typeof XMLHttpRequest != "undefined") { + throw new Error( + "Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.", + ); + } else { + // Command-line. + try { + obj.contents = readBinary(obj.url); + obj.usedBytes = obj.contents.length; + } catch (e) { + throw new FS.ErrnoError(29); + } + } + }, + createLazyFile(parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). + // Actual getting is abstracted away for eventual reuse. + class LazyUint8Array { + lengthKnown = false; + chunks = []; // Loaded chunks. Index is the chunk number + get(idx) { + if (idx > this.length - 1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize) | 0; + return this.getter(chunkNum)[chunkOffset]; + } + setDataGetter(getter) { + this.getter = getter; + } + cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open("HEAD", url, false); + xhr.send(null); + if ( + !((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304) + ) + throw new Error( + "Couldn't load " + url + ". Status: " + xhr.status, + ); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = + (header = xhr.getResponseHeader("Accept-Ranges")) && + header === "bytes"; + var usesGzip = + (header = xhr.getResponseHeader("Content-Encoding")) && + header === "gzip"; + + var chunkSize = 1024 * 1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (from, to) => { + if (from > to) + throw new Error( + "invalid range (" + + from + + ", " + + to + + ") or no bytes requested!", + ); + if (to > datalength - 1) + throw new Error( + "only " + datalength + " bytes available! programmer error!", + ); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open("GET", url, false); + if (datalength !== chunkSize) + xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + xhr.responseType = "arraybuffer"; + if (xhr.overrideMimeType) { + xhr.overrideMimeType("text/plain; charset=x-user-defined"); + } + + xhr.send(null); + if ( + !((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304) + ) + throw new Error( + "Couldn't load " + url + ". Status: " + xhr.status, + ); + if (xhr.response !== undefined) { + return new Uint8Array( + /** @type{Array<number>} */ (xhr.response || []), + ); + } + return intArrayFromString(xhr.responseText || "", true); + }; + var lazyArray = this; + lazyArray.setDataGetter((chunkNum) => { + var start = chunkNum * chunkSize; + var end = (chunkNum + 1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength - 1); // if datalength-1 is selected, this is the last block + if (typeof lazyArray.chunks[chunkNum] == "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof lazyArray.chunks[chunkNum] == "undefined") + throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + out( + "LazyFiles on gzip forces download of the whole file when length is accessed", + ); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + } + get length() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + get chunkSize() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + + if (typeof XMLHttpRequest != "undefined") { + if (!ENVIRONMENT_IS_WORKER) + throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc"; + var lazyArray = new LazyUint8Array(); + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: function () { + return this.contents.length; + }, + }, + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach((key) => { + var fn = node.stream_ops[key]; + stream_ops[key] = (...args) => { + FS.forceLoadFile(node); + return fn(...args); + }; + }); + function writeChunks(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= contents.length) return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { + // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { + // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + } + // use a custom read function + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + return writeChunks(stream, buffer, offset, length, position); + }; + // use a custom mmap function + stream_ops.mmap = (stream, length, position, prot, flags) => { + FS.forceLoadFile(node); + var ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + writeChunks(stream, HEAP8, ptr, length, position); + return { ptr, allocated: true }; + }; + node.stream_ops = stream_ops; + return node; + }, + absolutePath() { + abort("FS.absolutePath has been removed; use PATH_FS.resolve instead"); + }, + createFolder() { + abort("FS.createFolder has been removed; use FS.mkdir instead"); + }, + createLink() { + abort("FS.createLink has been removed; use FS.symlink instead"); + }, + joinPath() { + abort("FS.joinPath has been removed; use PATH.join instead"); + }, + mmapAlloc() { + abort( + "FS.mmapAlloc has been replaced by the top level function mmapAlloc", + ); + }, + standardizePath() { + abort( + "FS.standardizePath has been removed; use PATH.normalize instead", + ); + }, + }; + + var SYSCALLS = { + DEFAULT_POLLMASK: 5, + calculateAt(dirfd, path, allowEmpty) { + if (PATH.isAbs(path)) { + return path; + } + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = SYSCALLS.getStreamFromFD(dirfd); + dir = dirstream.path; + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44); + } + return dir; + } + return dir + "/" + path; + }, + doStat(func, path, buf) { + var stat = func(path); + HEAP32[buf >> 2] = stat.dev; + HEAP32[(buf + 4) >> 2] = stat.mode; + HEAPU32[(buf + 8) >> 2] = stat.nlink; + HEAP32[(buf + 12) >> 2] = stat.uid; + HEAP32[(buf + 16) >> 2] = stat.gid; + HEAP32[(buf + 20) >> 2] = stat.rdev; + (tempI64 = [ + stat.size >>> 0, + ((tempDouble = stat.size), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(buf + 24) >> 2] = tempI64[0]), + (HEAP32[(buf + 28) >> 2] = tempI64[1]); + HEAP32[(buf + 32) >> 2] = 4096; + HEAP32[(buf + 36) >> 2] = stat.blocks; + var atime = stat.atime.getTime(); + var mtime = stat.mtime.getTime(); + var ctime = stat.ctime.getTime(); + (tempI64 = [ + Math.floor(atime / 1000) >>> 0, + ((tempDouble = Math.floor(atime / 1000)), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(buf + 40) >> 2] = tempI64[0]), + (HEAP32[(buf + 44) >> 2] = tempI64[1]); + HEAPU32[(buf + 48) >> 2] = (atime % 1000) * 1000 * 1000; + (tempI64 = [ + Math.floor(mtime / 1000) >>> 0, + ((tempDouble = Math.floor(mtime / 1000)), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(buf + 56) >> 2] = tempI64[0]), + (HEAP32[(buf + 60) >> 2] = tempI64[1]); + HEAPU32[(buf + 64) >> 2] = (mtime % 1000) * 1000 * 1000; + (tempI64 = [ + Math.floor(ctime / 1000) >>> 0, + ((tempDouble = Math.floor(ctime / 1000)), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(buf + 72) >> 2] = tempI64[0]), + (HEAP32[(buf + 76) >> 2] = tempI64[1]); + HEAPU32[(buf + 80) >> 2] = (ctime % 1000) * 1000 * 1000; + (tempI64 = [ + stat.ino >>> 0, + ((tempDouble = stat.ino), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(buf + 88) >> 2] = tempI64[0]), + (HEAP32[(buf + 92) >> 2] = tempI64[1]); + return 0; + }, + doMsync(addr, stream, len, flags, offset) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (flags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + }, + getStreamFromFD(fd) { + var stream = FS.getStreamChecked(fd); + return stream; + }, + varargs: undefined, + getStr(ptr) { + var ret = UTF8ToString(ptr); + return ret; + }, + }; + var ___syscall__newselect = function ( + nfds, + readfds, + writefds, + exceptfds, + timeout, + ) { + try { + // readfds are supported, + // writefds checks socket open status + // exceptfds are supported, although on web, such exceptional conditions never arise in web sockets + // and so the exceptfds list will always return empty. + // timeout is supported, although on SOCKFS and PIPEFS these are ignored and always treated as 0 - fully async + assert(nfds <= 64, "nfds must be less than or equal to 64"); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers + + var total = 0; + + var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0, + srcReadHigh = readfds ? HEAP32[(readfds + 4) >> 2] : 0; + var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0, + srcWriteHigh = writefds ? HEAP32[(writefds + 4) >> 2] : 0; + var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0, + srcExceptHigh = exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0; + + var dstReadLow = 0, + dstReadHigh = 0; + var dstWriteLow = 0, + dstWriteHigh = 0; + var dstExceptLow = 0, + dstExceptHigh = 0; + + var allLow = + (readfds ? HEAP32[readfds >> 2] : 0) | + (writefds ? HEAP32[writefds >> 2] : 0) | + (exceptfds ? HEAP32[exceptfds >> 2] : 0); + var allHigh = + (readfds ? HEAP32[(readfds + 4) >> 2] : 0) | + (writefds ? HEAP32[(writefds + 4) >> 2] : 0) | + (exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0); + + var check = (fd, low, high, val) => (fd < 32 ? low & val : high & val); + + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << (fd % 32); + if (!check(fd, allLow, allHigh, mask)) { + continue; // index isn't in the set + } + + var stream = SYSCALLS.getStreamFromFD(fd); + + var flags = SYSCALLS.DEFAULT_POLLMASK; + + if (stream.stream_ops.poll) { + var timeoutInMillis = -1; + if (timeout) { + // select(2) is declared to accept "struct timeval { time_t tv_sec; suseconds_t tv_usec; }". + // However, musl passes the two values to the syscall as an array of long values. + // Note that sizeof(time_t) != sizeof(long) in wasm32. The former is 8, while the latter is 4. + // This means using "C_STRUCTS.timeval.tv_usec" leads to a wrong offset. + // So, instead, we use POINTER_SIZE. + var tv_sec = readfds ? HEAP32[timeout >> 2] : 0, + tv_usec = readfds ? HEAP32[(timeout + 4) >> 2] : 0; + timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000; + } + flags = stream.stream_ops.poll(stream, timeoutInMillis); + } + + if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 + ? (dstReadLow = dstReadLow | mask) + : (dstReadHigh = dstReadHigh | mask); + total++; + } + if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 + ? (dstWriteLow = dstWriteLow | mask) + : (dstWriteHigh = dstWriteHigh | mask); + total++; + } + if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 + ? (dstExceptLow = dstExceptLow | mask) + : (dstExceptHigh = dstExceptHigh | mask); + total++; + } + } + + if (readfds) { + HEAP32[readfds >> 2] = dstReadLow; + HEAP32[(readfds + 4) >> 2] = dstReadHigh; + } + if (writefds) { + HEAP32[writefds >> 2] = dstWriteLow; + HEAP32[(writefds + 4) >> 2] = dstWriteHigh; + } + if (exceptfds) { + HEAP32[exceptfds >> 2] = dstExceptLow; + HEAP32[(exceptfds + 4) >> 2] = dstExceptHigh; + } + + return total; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + }; + + var SOCKFS = { + websocketArgs: {}, + callbacks: {}, + on(event, callback) { + SOCKFS.callbacks[event] = callback; + }, + emit(event, param) { + SOCKFS.callbacks[event]?.(param); + }, + mount(mount) { + // The incomming Module['websocket'] can be used for configuring + // configuring subprotocol/url, etc + SOCKFS.websocketArgs = Module["websocket"] || {}; + // Add the Event registration mechanism to the exported websocket configuration + // object so we can register network callbacks from native JavaScript too. + // For more documentation see system/include/emscripten/emscripten.h + (Module["websocket"] ??= {})["on"] = SOCKFS.on; + + return FS.createNode(null, "/", 16895, 0); + }, + createSocket(family, type, protocol) { + type &= ~526336; // Some applications may pass it; it makes no sense for a single process. + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0. + } + + // create our internal socket structure + var sock = { + family, + type, + protocol, + server: null, + error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops, + }; + + // create the filesystem node to store the socket structure + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + + // and the wrapping stream that enables library functions such + // as read and write to indirectly interact with the socket + var stream = FS.createStream({ + path: name, + node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops, + }); + + // map the new stream to the socket structure (sockets have a 1:1 + // relationship with a stream) + sock.stream = stream; + + return sock; + }, + getSocket(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + }, + stream_ops: { + poll(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + }, + ioctl(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + }, + read(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + // socket is closed + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + }, + write(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + }, + close(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + }, + }, + nextname() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return `socket[${SOCKFS.nextname.current++}]`; + }, + websocket_sock_ops: { + createPeer(sock, addr, port) { + var ws; + + if (typeof addr == "object") { + ws = addr; + addr = null; + port = null; + } + + if (ws) { + // for sockets that've already connected (e.g. we're the server) + // we can inspect the _socket property for the address + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } + // if we're just now initializing a connection to the remote, + // inspect the url property + else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error( + "WebSocket URL must be in the format ws(s)://address:port", + ); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + // create the actual websocket object and connect + try { + // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#' + // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again. + var url = "ws:#".replace("#", "//"); + // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set. + var subProtocols = "binary"; // The default value is 'binary' + // The default WebSocket options + var opts = undefined; + + // Fetch runtime WebSocket URL config. + if (SOCKFS.websocketArgs["url"]) { + url = SOCKFS.websocketArgs["url"]; + } + // Fetch runtime WebSocket subprotocol config. + if (SOCKFS.websocketArgs["subprotocol"]) { + subProtocols = SOCKFS.websocketArgs["subprotocol"]; + } else if (SOCKFS.websocketArgs["subprotocol"] === null) { + subProtocols = "null"; + } + + if (url === "ws://" || url === "wss://") { + // Is the supplied URL config just a prefix, if so complete it. + var parts = addr.split("/"); + url = + url + parts[0] + ":" + port + "/" + parts.slice(1).join("/"); + } + + if (subProtocols !== "null") { + // The regex trims the string (removes spaces at the beginning and end, then splits the string by + // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws. + subProtocols = subProtocols + .replace(/^ +| +$/g, "") + .split(/ *, */); + + opts = subProtocols; + } + + // If node we use the ws library. + var WebSocketConstructor; + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = "arraybuffer"; + } catch (e) { + throw new FS.ErrnoError(23); + } + } + + var peer = { + addr, + port, + socket: ws, + msg_send_queue: [], + }; + + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + + // if this is a bound dgram socket, send the port number first to allow + // us to override the ephemeral port reported to us by remotePort on the + // remote end. + if (sock.type === 2 && typeof sock.sport != "undefined") { + peer.msg_send_queue.push( + new Uint8Array([ + 255, + 255, + 255, + 255, + "p".charCodeAt(0), + "o".charCodeAt(0), + "r".charCodeAt(0), + "t".charCodeAt(0), + (sock.sport & 0xff00) >> 8, + sock.sport & 0xff, + ]), + ); + } + + return peer; + }, + getPeer(sock, addr, port) { + return sock.peers[addr + ":" + port]; + }, + addPeer(sock, peer) { + sock.peers[peer.addr + ":" + peer.port] = peer; + }, + removePeer(sock, peer) { + delete sock.peers[peer.addr + ":" + peer.port]; + }, + handlePeerEvents(sock, peer) { + var first = true; + + var handleOpen = function () { + sock.connecting = false; + SOCKFS.emit("open", sock.stream.fd); + + try { + var queued = peer.msg_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.msg_send_queue.shift(); + } + } catch (e) { + // not much we can do here in the way of proper error handling as we've already + // lied and said this data was sent. shut it down. + peer.socket.close(); + } + }; + + function handleMessage(data) { + if (typeof data == "string") { + var encoder = new TextEncoder(); // should be utf-8 + data = encoder.encode(data); // make a typed array from the string + } else { + assert(data.byteLength !== undefined); // must receive an ArrayBuffer + if (data.byteLength == 0) { + // An empty ArrayBuffer will emit a pseudo disconnect event + // as recv/recvmsg will return zero which indicates that a socket + // has performed a shutdown although the connection has not been disconnected yet. + return; + } + data = new Uint8Array(data); // make a typed array view on the array buffer + } + + // if this is the port message, override the peer's port with it + var wasfirst = first; + first = false; + if ( + wasfirst && + data.length === 10 && + data[0] === 255 && + data[1] === 255 && + data[2] === 255 && + data[3] === 255 && + data[4] === "p".charCodeAt(0) && + data[5] === "o".charCodeAt(0) && + data[6] === "r".charCodeAt(0) && + data[7] === "t".charCodeAt(0) + ) { + // update the peer's port and it's key in the peer map + var newport = (data[8] << 8) | data[9]; + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + + sock.recv_queue.push({ + addr: peer.addr, + port: peer.port, + data: data, + }); + SOCKFS.emit("message", sock.stream.fd); + } + + if (ENVIRONMENT_IS_NODE) { + peer.socket.on("open", handleOpen); + peer.socket.on("message", function (data, isBinary) { + if (!isBinary) { + return; + } + handleMessage(new Uint8Array(data).buffer); // copy from node Buffer -> ArrayBuffer + }); + peer.socket.on("close", function () { + SOCKFS.emit("close", sock.stream.fd); + }); + peer.socket.on("error", function (error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED + // is still probably the most useful thing to do. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + SOCKFS.emit("error", [ + sock.stream.fd, + sock.error, + "ECONNREFUSED: Connection refused", + ]); + // don't throw + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function () { + SOCKFS.emit("close", sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function (error) { + // The WebSocket spec only allows a 'simple event' to be thrown on error, + // so we only really know as much as ECONNREFUSED. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + SOCKFS.emit("error", [ + sock.stream.fd, + sock.error, + "ECONNREFUSED: Connection refused", + ]); + }; + } + }, + poll(sock) { + if (sock.type === 1 && sock.server) { + // listen sockets should only say they're available for reading + // if there are pending clients. + return sock.pending.length ? 64 | 1 : 0; + } + + var mask = 0; + var dest = + sock.type === 1 + ? // we only care about the socket state for connection-based sockets + SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) + : null; + + if ( + sock.recv_queue.length || + !dest || // connection-less sockets are always ready to read + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED) + ) { + // let recv return 0 once closed + mask |= 64 | 1; + } + + if ( + !dest || // connection-less sockets are always ready to write + (dest && dest.socket.readyState === dest.socket.OPEN) + ) { + mask |= 4; + } + + if ( + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED) + ) { + // When an non-blocking connect fails mark the socket as writable. + // Its up to the calling code to then use getsockopt with SO_ERROR to + // retrieve the error. + // See https://man7.org/linux/man-pages/man2/connect.2.html + if (sock.connecting) { + mask |= 4; + } else { + mask |= 16; + } + } + + return mask; + }, + ioctl(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + HEAP32[arg >> 2] = bytes; + return 0; + default: + return 28; + } + }, + close(sock) { + // if we've spawned a listen server, close it + if (sock.server) { + try { + sock.server.close(); + } catch (e) {} + sock.server = null; + } + // close any peer connections + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) {} + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + }, + bind(sock, addr, port) { + if ( + typeof sock.saddr != "undefined" || + typeof sock.sport != "undefined" + ) { + throw new FS.ErrnoError(28); // already bound + } + sock.saddr = addr; + sock.sport = port; + // in order to emulate dgram sockets, we need to launch a listen server when + // binding on a connection-less socket + // note: this is only required on the server side + if (sock.type === 2) { + // close the existing server if it exists + if (sock.server) { + sock.server.close(); + sock.server = null; + } + // swallow error operation not supported error that occurs when binding in the + // browser where this isn't supported + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e.name === "ErrnoError")) throw e; + if (e.errno !== 138) throw e; + } + } + }, + connect(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138); + } + + // TODO autobind + // if (!sock.addr && sock.type == 2) { + // } + + // early out if we're already connected / in the middle of connecting + if ( + typeof sock.daddr != "undefined" && + typeof sock.dport != "undefined" + ) { + var dest = SOCKFS.websocket_sock_ops.getPeer( + sock, + sock.daddr, + sock.dport, + ); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7); + } else { + throw new FS.ErrnoError(30); + } + } + } + + // add the socket to our peer list and set our + // destination address / port to match + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + + // because we cannot synchronously block to wait for the WebSocket + // connection to complete, we return here pretending that the connection + // was a success. + sock.connecting = true; + }, + listen(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138); + } + }, + accept(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + }, + getname(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53); + } + addr = sock.daddr; + port = sock.dport; + } else { + // TODO saddr and sport will be set for bind()'d UDP sockets, but what + // should we be returning for TCP sockets that've been connect()'d? + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { addr, port }; + }, + sendmsg(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + // connection-less sockets will honor the message address, + // and otherwise fall back to the bound destination address + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + // if there was no address to fall back to, error out + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17); + } + } else { + // connection-based sockets will only use the bound + addr = sock.daddr; + port = sock.dport; + } + + // find the peer for the destination address + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + + // early out if not connected with a connection-based socket + if (sock.type === 1) { + if ( + !dest || + dest.socket.readyState === dest.socket.CLOSING || + dest.socket.readyState === dest.socket.CLOSED + ) { + throw new FS.ErrnoError(53); + } + } + + // create a copy of the incoming data to send, as the WebSocket API + // doesn't work entirely with an ArrayBufferView, it'll just send + // the entire underlying buffer + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + + var data = buffer.slice(offset, offset + length); + + // if we don't have a cached connectionless UDP datagram connection, or + // the TCP socket is still connecting, queue the message to be sent upon + // connect, and lie, saying the data was sent now. + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + // if we're not connected, open a new connection + if (sock.type === 2) { + if ( + !dest || + dest.socket.readyState === dest.socket.CLOSING || + dest.socket.readyState === dest.socket.CLOSED + ) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + } + dest.msg_send_queue.push(data); + return length; + } + + try { + // send the actual data + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(28); + } + }, + recvmsg(sock, length) { + // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html + if (sock.type === 1 && sock.server) { + // tcp servers should not be recv()'ing on the listen socket + throw new FS.ErrnoError(53); + } + + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer( + sock, + sock.daddr, + sock.dport, + ); + + if (!dest) { + // if we have a destination address but are not connected, error out + throw new FS.ErrnoError(53); + } + if ( + dest.socket.readyState === dest.socket.CLOSING || + dest.socket.readyState === dest.socket.CLOSED + ) { + // return null if the socket has closed + return null; + } + // else, our socket is in a valid state but truly has nothing available + throw new FS.ErrnoError(6); + } + throw new FS.ErrnoError(6); + } + + // queued.data will be an ArrayBuffer if it's unadulterated, but if it's + // requeued TCP data it'll be an ArrayBufferView + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port, + }; + + // push back any unread data for TCP connections + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array( + queuedBuffer, + queuedOffset + bytesRead, + bytesRemaining, + ); + sock.recv_queue.unshift(queued); + } + + return res; + }, + }, + }; + + var getSocketFromFD = (fd) => { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket; + }; + + var Sockets = { + BUFFER_SIZE: 10240, + MAX_BUFFER_SIZE: 10485760, + nextFd: 1, + fds: {}, + nextport: 1, + maxport: 65535, + peer: null, + connections: {}, + portmap: {}, + localAddr: 4261412874, + addrPool: [ + 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738, + 150994954, 167772170, 184549386, 201326602, 218103818, 234881034, + ], + }; + + var inetPton4 = (str) => { + var b = str.split("."); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0; + }; + + /** @suppress {checkTypes} */ + var jstoi_q = (str) => parseInt(str); + var inetPton6 = (str) => { + var words; + var w, offset, z, i; + /* http://home.deds.nl/~aeron/regex/ */ + var valid6regx = + /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i; + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0]; + } + // Z placeholder to keep track of zeros when splitting the string on ":" + if (str.startsWith("::")) { + str = str.replace("::", "Z:"); // leading zeros case + } else { + str = str.replace("::", ":Z:"); + } + + if (str.indexOf(".") > 0) { + // parse IPv4 embedded stress + str = str.replace(new RegExp("[.]", "g"), ":"); + words = str.split(":"); + words[words.length - 4] = + jstoi_q(words[words.length - 4]) + + jstoi_q(words[words.length - 3]) * 256; + words[words.length - 3] = + jstoi_q(words[words.length - 2]) + + jstoi_q(words[words.length - 1]) * 256; + words = words.slice(0, words.length - 2); + } else { + words = str.split(":"); + } + + offset = 0; + z = 0; + for (w = 0; w < words.length; w++) { + if (typeof words[w] == "string") { + if (words[w] === "Z") { + // compressed zeros - write appropriate number of zero words + for (z = 0; z < 8 - words.length + 1; z++) { + parts[w + z] = 0; + } + offset = z - 1; + } else { + // parse hex to field to 16-bit value and write it in network byte-order + parts[w + offset] = _htons(parseInt(words[w], 16)); + } + } else { + // parsed IPv4 words + parts[w + offset] = words[w]; + } + } + return [ + (parts[1] << 16) | parts[0], + (parts[3] << 16) | parts[2], + (parts[5] << 16) | parts[4], + (parts[7] << 16) | parts[6], + ]; + }; + + /** @param {number=} addrlen */ + var writeSockaddr = (sa, family, addr, port, addrlen) => { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + HEAP32[addrlen >> 2] = 16; + } + HEAP16[sa >> 1] = family; + HEAP32[(sa + 4) >> 2] = addr; + HEAP16[(sa + 2) >> 1] = _htons(port); + break; + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + HEAP32[addrlen >> 2] = 28; + } + HEAP32[sa >> 2] = family; + HEAP32[(sa + 8) >> 2] = addr[0]; + HEAP32[(sa + 12) >> 2] = addr[1]; + HEAP32[(sa + 16) >> 2] = addr[2]; + HEAP32[(sa + 20) >> 2] = addr[3]; + HEAP16[(sa + 2) >> 1] = _htons(port); + break; + default: + return 5; + } + return 0; + }; + + var DNS = { + address_map: { + id: 1, + addrs: {}, + names: {}, + }, + lookup_name(name) { + // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one. + var res = inetPton4(name); + if (res !== null) { + return name; + } + res = inetPton6(name); + if (res !== null) { + return name; + } + + // See if this name is already mapped. + var addr; + + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, "exceeded max address mappings of 65535"); + + addr = "172.29." + (id & 0xff) + "." + (id & 0xff00); + + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + + return addr; + }, + lookup_addr(addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + + return null; + }, + }; + function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) { + try { + var sock = getSocketFromFD(fd); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var errno = writeSockaddr( + addr, + newsock.family, + DNS.lookup_name(newsock.daddr), + newsock.dport, + addrlen, + ); + assert(!errno); + } + return newsock.stream.fd; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var inetNtop4 = (addr) => + (addr & 0xff) + + "." + + ((addr >> 8) & 0xff) + + "." + + ((addr >> 16) & 0xff) + + "." + + ((addr >> 24) & 0xff); + + var inetNtop6 = (ints) => { + // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4 + // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses + // 128-bits are split into eight 16-bit words + // stored in network byte order (big-endian) + // | 80 bits | 16 | 32 bits | + // +-----------------------------------------------------------------+ + // | 10 bytes | 2 | 4 bytes | + // +--------------------------------------+--------------------------+ + // + 5 words | 1 | 2 words | + // +--------------------------------------+--------------------------+ + // |0000..............................0000|0000| IPv4 ADDRESS | (compatible) + // +--------------------------------------+----+---------------------+ + // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped) + // +--------------------------------------+----+---------------------+ + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ + ints[0] & 0xffff, + ints[0] >> 16, + ints[1] & 0xffff, + ints[1] >> 16, + ints[2] & 0xffff, + ints[2] >> 16, + ints[3] & 0xffff, + ints[3] >> 16, + ]; + + // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses + + var hasipv4 = true; + var v4part = ""; + // check if the 10 high-order bytes are all zeros (first 5 words) + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { + hasipv4 = false; + break; + } + } + + if (hasipv4) { + // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words) + v4part = inetNtop4(parts[6] | (parts[7] << 16)); + // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word) + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word) + if (parts[5] === 0) { + str = "::"; + //special case IPv6 addresses + if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address + if (v4part === "0.0.0.1") v4part = "1"; // loopback address + str += v4part; + return str; + } + } + + // Handle all other IPv6 addresses + + // first run to find the longest contiguous zero words + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + + for (word = 0; word < 8; word++) { + if (longest > 1) { + // compress contiguous zeros - to produce "::" + if (parts[word] === 0 && word >= zstart && word < zstart + longest) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; //leading zeros case + } + continue; + } + } + // converts 16-bit words from big-endian to little-endian before converting to hex string + str += Number(_ntohs(parts[word] & 0xffff)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; + }; + + var readSockaddr = (sa, salen) => { + // family / port offsets are common to both sockaddr_in and sockaddr_in6 + var family = HEAP16[sa >> 1]; + var port = _ntohs(HEAPU16[(sa + 2) >> 1]); + var addr; + + switch (family) { + case 2: + if (salen !== 16) { + return { errno: 28 }; + } + addr = HEAP32[(sa + 4) >> 2]; + addr = inetNtop4(addr); + break; + case 10: + if (salen !== 28) { + return { errno: 28 }; + } + addr = [ + HEAP32[(sa + 8) >> 2], + HEAP32[(sa + 12) >> 2], + HEAP32[(sa + 16) >> 2], + HEAP32[(sa + 20) >> 2], + ]; + addr = inetNtop6(addr); + break; + default: + return { errno: 5 }; + } + + return { family: family, addr: addr, port: port }; + }; + + var getSocketAddress = (addrp, addrlen) => { + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + }; + function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) { + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_chdir(path) { + try { + path = SYSCALLS.getStr(path); + FS.chdir(path); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_chmod(path, mode) { + try { + path = SYSCALLS.getStr(path); + FS.chmod(path, mode); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) { + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_dup(fd) { + try { + var old = SYSCALLS.getStreamFromFD(fd); + return FS.dupStream(old).fd; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_faccessat(dirfd, path, amode, flags) { + try { + path = SYSCALLS.getStr(path); + assert(flags === 0 || flags == 512); + path = SYSCALLS.calculateAt(dirfd, path); + if (amode & ~7) { + // need a valid mode + return -28; + } + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node) { + return -44; + } + var perms = ""; + if (amode & 4) perms += "r"; + if (amode & 2) perms += "w"; + if (amode & 1) perms += "x"; + if ( + perms /* otherwise, they've just passed F_OK */ && + FS.nodePermissions(node, perms) + ) { + return -2; + } + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_fchownat(dirfd, path, owner, group, flags) { + try { + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + flags = flags & ~256; + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + (nofollow ? FS.lchown : FS.chown)(path, owner, group); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + /** @suppress {duplicate } */ + var syscallGetVarargI = () => { + assert(SYSCALLS.varargs != undefined); + // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number. + var ret = HEAP32[+SYSCALLS.varargs >> 2]; + SYSCALLS.varargs += 4; + return ret; + }; + var syscallGetVarargP = syscallGetVarargI; + + function ___syscall_fcntl64(fd, cmd, varargs) { + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: { + var arg = syscallGetVarargI(); + if (arg < 0) { + return -28; + } + while (FS.streams[arg]) { + arg++; + } + var newStream; + newStream = FS.dupStream(stream, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = syscallGetVarargI(); + stream.flags |= arg; + return 0; + } + case 12: { + var arg = syscallGetVarargP(); + var offset = 0; + // We're always unlocked. + HEAP16[(arg + offset) >> 1] = 2; + return 0; + } + case 13: + case 14: + return 0; // Pretend that the locking is successful. + } + return -28; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_fdatasync(fd) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + return 0; // we can't do anything synchronously; the in-memory FS is already synced to + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_fstat64(fd, buf) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + return SYSCALLS.doStat(FS.stat, stream.path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var convertI32PairToI53Checked = (lo, hi) => { + assert(lo == lo >>> 0 || lo == (lo | 0)); // lo should either be a i32 or a u32 + assert(hi === (hi | 0)); // hi should be a i32 + return (hi + 0x200000) >>> 0 < 0x400001 - !!lo + ? (lo >>> 0) + hi * 4294967296 + : NaN; + }; + function ___syscall_ftruncate64(fd, length_low, length_high) { + var length = convertI32PairToI53Checked(length_low, length_high); + + try { + if (isNaN(length)) return 61; + FS.ftruncate(fd, length); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var stringToUTF8 = (str, outPtr, maxBytesToWrite) => { + assert( + typeof maxBytesToWrite == "number", + "stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!", + ); + return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite); + }; + function ___syscall_getcwd(buf, size) { + try { + if (size === 0) return -28; + var cwd = FS.cwd(); + var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1; + if (size < cwdLengthInBytes) return -68; + stringToUTF8(cwd, buf, size); + return cwdLengthInBytes; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_getdents64(fd, dirp, count) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + stream.getdents ||= FS.readdir(stream.path); + + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + + var startIdx = Math.floor(off / struct_size); + var endIdx = Math.min( + stream.getdents.length, + startIdx + Math.floor(count / struct_size), + ); + for (var idx = startIdx; idx < endIdx; idx++) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === ".") { + id = stream.node.id; + type = 4; // DT_DIR + } else if (name === "..") { + var lookup = FS.lookupPath(stream.path, { parent: true }); + id = lookup.node.id; + type = 4; // DT_DIR + } else { + var child; + try { + child = FS.lookupNode(stream.node, name); + } catch (e) { + // If the entry is not a directory, file, or symlink, nodefs + // lookupNode will raise EINVAL. Skip these and continue. + if (e?.errno === 28) { + continue; + } + throw e; + } + id = child.id; + type = FS.isChrdev(child.mode) + ? 2 + : // DT_CHR, character device. + FS.isDir(child.mode) + ? 4 + : // DT_DIR, directory. + FS.isLink(child.mode) + ? 10 + : // DT_LNK, symbolic link. + 8; // DT_REG, regular file. + } + assert(id); + (tempI64 = [ + id >>> 0, + ((tempDouble = id), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(dirp + pos) >> 2] = tempI64[0]), + (HEAP32[(dirp + pos + 4) >> 2] = tempI64[1]); + (tempI64 = [ + ((idx + 1) * struct_size) >>> 0, + ((tempDouble = (idx + 1) * struct_size), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(dirp + pos + 8) >> 2] = tempI64[0]), + (HEAP32[(dirp + pos + 12) >> 2] = tempI64[1]); + HEAP16[(dirp + pos + 16) >> 1] = 280; + HEAP8[dirp + pos + 18] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + } + FS.llseek(stream, idx * struct_size, 0); + return pos; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_getpeername(fd, addr, addrlen, d1, d2, d3) { + try { + var sock = getSocketFromFD(fd); + if (!sock.daddr) { + return -53; // The socket is not connected. + } + var errno = writeSockaddr( + addr, + sock.family, + DNS.lookup_name(sock.daddr), + sock.dport, + addrlen, + ); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) { + try { + var sock = getSocketFromFD(fd); + // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname + var errno = writeSockaddr( + addr, + sock.family, + DNS.lookup_name(sock.saddr || "0.0.0.0"), + sock.sport, + addrlen, + ); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) { + try { + var sock = getSocketFromFD(fd); + // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211 + // so only supports SOL_SOCKET with SO_ERROR. + if (level === 1) { + if (optname === 4) { + HEAP32[optval >> 2] = sock.error; + HEAP32[optlen >> 2] = 4; + sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field). + return 0; + } + } + return -50; // The option is unknown at the level indicated. + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_ioctl(fd, op, varargs) { + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: { + if (!stream.tty) return -59; + return 0; + } + case 21505: { + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tcgets) { + var termios = stream.tty.ops.ioctl_tcgets(stream); + var argp = syscallGetVarargP(); + HEAP32[argp >> 2] = termios.c_iflag || 0; + HEAP32[(argp + 4) >> 2] = termios.c_oflag || 0; + HEAP32[(argp + 8) >> 2] = termios.c_cflag || 0; + HEAP32[(argp + 12) >> 2] = termios.c_lflag || 0; + for (var i = 0; i < 32; i++) { + HEAP8[argp + i + 17] = termios.c_cc[i] || 0; + } + return 0; + } + return 0; + } + case 21510: + case 21511: + case 21512: { + if (!stream.tty) return -59; + return 0; // no-op, not actually adjusting terminal settings + } + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tcsets) { + var argp = syscallGetVarargP(); + var c_iflag = HEAP32[argp >> 2]; + var c_oflag = HEAP32[(argp + 4) >> 2]; + var c_cflag = HEAP32[(argp + 8) >> 2]; + var c_lflag = HEAP32[(argp + 12) >> 2]; + var c_cc = []; + for (var i = 0; i < 32; i++) { + c_cc.push(HEAP8[argp + i + 17]); + } + return stream.tty.ops.ioctl_tcsets(stream.tty, op, { + c_iflag, + c_oflag, + c_cflag, + c_lflag, + c_cc, + }); + } + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -59; + var argp = syscallGetVarargP(); + HEAP32[argp >> 2] = 0; + return 0; + } + case 21520: { + if (!stream.tty) return -59; + return -28; // not supported + } + case 21531: { + var argp = syscallGetVarargP(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -59; + if (stream.tty.ops.ioctl_tiocgwinsz) { + var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty); + var argp = syscallGetVarargP(); + HEAP16[argp >> 1] = winsize[0]; + HEAP16[(argp + 2) >> 1] = winsize[1]; + } + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -59; + return 0; + } + case 21515: { + if (!stream.tty) return -59; + return 0; + } + default: + return -28; // not supported + } + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_listen(fd, backlog) { + try { + var sock = getSocketFromFD(fd); + sock.sock_ops.listen(sock, backlog); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_lstat64(path, buf) { + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_mkdirat(dirfd, path, mode) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + FS.mkdir(path, mode, 0); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_newfstatat(dirfd, path, buf, flags) { + try { + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & ~6400; + assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`); + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_openat(dirfd, path, flags, varargs) { + SYSCALLS.varargs = varargs; + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? syscallGetVarargI() : 0; + return FS.open(path, flags, mode).fd; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var PIPEFS = { + BUCKET_BUFFER_SIZE: 8192, + mount(mount) { + // Do not pollute the real root directory or its child nodes with pipes + // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way + return FS.createNode(null, "/", 16384 | 0o777, 0); + }, + createPipe() { + var pipe = { + buckets: [], + // refcnt 2 because pipe has a read end and a write end. We need to be + // able to read from the read end after write end is closed. + refcnt: 2, + }; + + pipe.buckets.push({ + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0, + }); + + var rName = PIPEFS.nextname(); + var wName = PIPEFS.nextname(); + var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0); + var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0); + + rNode.pipe = pipe; + wNode.pipe = pipe; + + var readableStream = FS.createStream({ + path: rName, + node: rNode, + flags: 0, + seekable: false, + stream_ops: PIPEFS.stream_ops, + }); + rNode.stream = readableStream; + + var writableStream = FS.createStream({ + path: wName, + node: wNode, + flags: 1, + seekable: false, + stream_ops: PIPEFS.stream_ops, + }); + wNode.stream = writableStream; + + return { + readable_fd: readableStream.fd, + writable_fd: writableStream.fd, + }; + }, + stream_ops: { + poll(stream) { + var pipe = stream.node.pipe; + + if ((stream.flags & 2097155) === 1) { + return 256 | 4; + } + if (pipe.buckets.length > 0) { + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + if (bucket.offset - bucket.roffset > 0) { + return 64 | 1; + } + } + } + + return 0; + }, + ioctl(stream, request, varargs) { + return 28; + }, + fsync(stream) { + return 28; + }, + read(stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + var currentLength = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + currentLength += bucket.offset - bucket.roffset; + } + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + if (length <= 0) { + return 0; + } + if (currentLength == 0) { + // Behave as if the read end is always non-blocking + throw new FS.ErrnoError(6); + } + var toRead = Math.min(currentLength, length); + + var totalRead = toRead; + var toRemove = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var currBucket = pipe.buckets[i]; + var bucketSize = currBucket.offset - currBucket.roffset; + + if (toRead <= bucketSize) { + var tmpSlice = currBucket.buffer.subarray( + currBucket.roffset, + currBucket.offset, + ); + if (toRead < bucketSize) { + tmpSlice = tmpSlice.subarray(0, toRead); + currBucket.roffset += toRead; + } else { + toRemove++; + } + data.set(tmpSlice); + break; + } else { + var tmpSlice = currBucket.buffer.subarray( + currBucket.roffset, + currBucket.offset, + ); + data.set(tmpSlice); + data = data.subarray(tmpSlice.byteLength); + toRead -= tmpSlice.byteLength; + toRemove++; + } + } + + if (toRemove && toRemove == pipe.buckets.length) { + // Do not generate excessive garbage in use cases such as + // write several bytes, read everything, write several bytes, read everything... + toRemove--; + pipe.buckets[toRemove].offset = 0; + pipe.buckets[toRemove].roffset = 0; + } + + pipe.buckets.splice(0, toRemove); + + return totalRead; + }, + write(stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + var dataLen = data.byteLength; + if (dataLen <= 0) { + return 0; + } + + var currBucket = null; + + if (pipe.buckets.length == 0) { + currBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0, + }; + pipe.buckets.push(currBucket); + } else { + currBucket = pipe.buckets[pipe.buckets.length - 1]; + } + + assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE); + + var freeBytesInCurrBuffer = + PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset; + if (freeBytesInCurrBuffer >= dataLen) { + currBucket.buffer.set(data, currBucket.offset); + currBucket.offset += dataLen; + return dataLen; + } else if (freeBytesInCurrBuffer > 0) { + currBucket.buffer.set( + data.subarray(0, freeBytesInCurrBuffer), + currBucket.offset, + ); + currBucket.offset += freeBytesInCurrBuffer; + data = data.subarray(freeBytesInCurrBuffer, data.byteLength); + } + + var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0; + var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE; + + for (var i = 0; i < numBuckets; i++) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: PIPEFS.BUCKET_BUFFER_SIZE, + roffset: 0, + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE)); + data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength); + } + + if (remElements > 0) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: data.byteLength, + roffset: 0, + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data); + } + + return dataLen; + }, + close(stream) { + var pipe = stream.node.pipe; + pipe.refcnt--; + if (pipe.refcnt === 0) { + pipe.buckets = null; + } + }, + }, + nextname() { + if (!PIPEFS.nextname.current) { + PIPEFS.nextname.current = 0; + } + return "pipe[" + PIPEFS.nextname.current++ + "]"; + }, + }; + function ___syscall_pipe(fdPtr) { + try { + if (fdPtr == 0) { + throw new FS.ErrnoError(21); + } + + var res = PIPEFS.createPipe(); + + HEAP32[fdPtr >> 2] = res.readable_fd; + HEAP32[(fdPtr + 4) >> 2] = res.writable_fd; + + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_poll(fds, nfds, timeout) { + try { + var nonzero = 0; + for (var i = 0; i < nfds; i++) { + var pollfd = fds + 8 * i; + var fd = HEAP32[pollfd >> 2]; + var events = HEAP16[(pollfd + 4) >> 1]; + var mask = 32; + var stream = FS.getStream(fd); + if (stream) { + mask = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + mask = stream.stream_ops.poll(stream, -1); + } + } + mask &= events | 8 | 16; + if (mask) nonzero++; + HEAP16[(pollfd + 6) >> 1] = mask; + } + return nonzero; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_readlinkat(dirfd, path, buf, bufsize) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf + len]; + stringToUTF8(ret, buf, bufsize + 1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf + len] = endChar; + return len; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + try { + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; // socket is closed + if (addr) { + var errno = writeSockaddr( + addr, + sock.family, + DNS.lookup_name(msg.addr), + msg.port, + addrlen, + ); + assert(!errno); + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + try { + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_rmdir(path) { + try { + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + try { + var sock = getSocketFromFD(fd); + if (!addr) { + // send, no address provided + return FS.write(sock.stream, HEAP8, message, length); + } + var dest = getSocketAddress(addr, addr_len); + // sendto an address + return sock.sock_ops.sendmsg( + sock, + HEAP8, + message, + length, + dest.addr, + dest.port, + ); + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_socket(domain, type, protocol) { + try { + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63 + return sock.stream.fd; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_stat64(path, buf) { + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_statfs64(path, size, buf) { + try { + assert(size === 64); + var stats = FS.statfs(SYSCALLS.getStr(path)); + HEAP32[(buf + 4) >> 2] = stats.bsize; + HEAP32[(buf + 40) >> 2] = stats.bsize; + HEAP32[(buf + 8) >> 2] = stats.blocks; + HEAP32[(buf + 12) >> 2] = stats.bfree; + HEAP32[(buf + 16) >> 2] = stats.bavail; + HEAP32[(buf + 20) >> 2] = stats.files; + HEAP32[(buf + 24) >> 2] = stats.ffree; + HEAP32[(buf + 28) >> 2] = stats.fsid; + HEAP32[(buf + 44) >> 2] = stats.flags; // ST_NOSUID + HEAP32[(buf + 36) >> 2] = stats.namelen; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_symlinkat(target, dirfd, linkpath) { + try { + target = SYSCALLS.getStr(target); + linkpath = SYSCALLS.getStr(linkpath); + linkpath = SYSCALLS.calculateAt(dirfd, linkpath); + FS.symlink(target, linkpath); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function ___syscall_unlinkat(dirfd, path, flags) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path); + } else if (flags === 512) { + FS.rmdir(path); + } else { + abort("Invalid flags passed to unlinkat"); + } + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var readI53FromI64 = (ptr) => { + return HEAPU32[ptr >> 2] + HEAP32[(ptr + 4) >> 2] * 4294967296; + }; + + function ___syscall_utimensat(dirfd, path, times, flags) { + try { + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path, true); + var now = Date.now(), + atime, + mtime; + if (!times) { + atime = now; + mtime = now; + } else { + var seconds = readI53FromI64(times); + var nanoseconds = HEAP32[(times + 8) >> 2]; + if (nanoseconds == 1073741823) { + atime = now; + } else if (nanoseconds == 1073741822) { + atime = null; + } else { + atime = seconds * 1000 + nanoseconds / (1000 * 1000); + } + times += 16; + seconds = readI53FromI64(times); + nanoseconds = HEAP32[(times + 8) >> 2]; + if (nanoseconds == 1073741823) { + mtime = now; + } else if (nanoseconds == 1073741822) { + mtime = null; + } else { + mtime = seconds * 1000 + nanoseconds / (1000 * 1000); + } + } + // null here means UTIME_OMIT was passed. If both were set to UTIME_OMIT then + // we can skip the call completely. + if ((mtime ?? atime) !== null) { + FS.utime(path, atime, mtime); + } + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var __abort_js = () => abort("native code called abort()"); + + var __emscripten_lookup_name = (name) => { + // uint32_t _emscripten_lookup_name(const char *name); + var nameString = UTF8ToString(name); + return inetPton4(DNS.lookup_name(nameString)); + }; + + var __emscripten_memcpy_js = (dest, src, num) => + HEAPU8.copyWithin(dest, src, src + num); + + var runtimeKeepaliveCounter = 0; + var __emscripten_runtime_keepalive_clear = () => { + noExitRuntime = false; + runtimeKeepaliveCounter = 0; + }; + + var __emscripten_throw_longjmp = () => { + throw Infinity; + }; + + function __gmtime_js(time_low, time_high, tmPtr) { + var time = convertI32PairToI53Checked(time_low, time_high); + + var date = new Date(time * 1000); + HEAP32[tmPtr >> 2] = date.getUTCSeconds(); + HEAP32[(tmPtr + 4) >> 2] = date.getUTCMinutes(); + HEAP32[(tmPtr + 8) >> 2] = date.getUTCHours(); + HEAP32[(tmPtr + 12) >> 2] = date.getUTCDate(); + HEAP32[(tmPtr + 16) >> 2] = date.getUTCMonth(); + HEAP32[(tmPtr + 20) >> 2] = date.getUTCFullYear() - 1900; + HEAP32[(tmPtr + 24) >> 2] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24)) | 0; + HEAP32[(tmPtr + 28) >> 2] = yday; + } + + var isLeapYear = (year) => + year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); + + var MONTH_DAYS_LEAP_CUMULATIVE = [ + 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335, + ]; + + var MONTH_DAYS_REGULAR_CUMULATIVE = [ + 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334, + ]; + var ydayFromDate = (date) => { + var leap = isLeapYear(date.getFullYear()); + var monthDaysCumulative = leap + ? MONTH_DAYS_LEAP_CUMULATIVE + : MONTH_DAYS_REGULAR_CUMULATIVE; + var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1 + + return yday; + }; + + function __localtime_js(time_low, time_high, tmPtr) { + var time = convertI32PairToI53Checked(time_low, time_high); + + var date = new Date(time * 1000); + HEAP32[tmPtr >> 2] = date.getSeconds(); + HEAP32[(tmPtr + 4) >> 2] = date.getMinutes(); + HEAP32[(tmPtr + 8) >> 2] = date.getHours(); + HEAP32[(tmPtr + 12) >> 2] = date.getDate(); + HEAP32[(tmPtr + 16) >> 2] = date.getMonth(); + HEAP32[(tmPtr + 20) >> 2] = date.getFullYear() - 1900; + HEAP32[(tmPtr + 24) >> 2] = date.getDay(); + + var yday = ydayFromDate(date) | 0; + HEAP32[(tmPtr + 28) >> 2] = yday; + HEAP32[(tmPtr + 36) >> 2] = -(date.getTimezoneOffset() * 60); + + // Attention: DST is in December in South, and some regions don't have DST at all. + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = + (summerOffset != winterOffset && + date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0; + HEAP32[(tmPtr + 32) >> 2] = dst; + } + + /** @suppress {duplicate } */ + var setTempRet0 = (val) => __emscripten_tempret_set(val); + var _setTempRet0 = setTempRet0; + + var __mktime_js = function (tmPtr) { + var ret = (() => { + var date = new Date( + HEAP32[(tmPtr + 20) >> 2] + 1900, + HEAP32[(tmPtr + 16) >> 2], + HEAP32[(tmPtr + 12) >> 2], + HEAP32[(tmPtr + 8) >> 2], + HEAP32[(tmPtr + 4) >> 2], + HEAP32[tmPtr >> 2], + 0, + ); + + // There's an ambiguous hour when the time goes back; the tm_isdst field is + // used to disambiguate it. Date() basically guesses, so we fix it up if it + // guessed wrong, or fill in tm_isdst with the guess if it's -1. + var dst = HEAP32[(tmPtr + 32) >> 2]; + var guessedOffset = date.getTimezoneOffset(); + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date( + date.getFullYear(), + 6, + 1, + ).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South + if (dst < 0) { + // Attention: some regions don't have DST at all. + HEAP32[(tmPtr + 32) >> 2] = Number( + summerOffset != winterOffset && dstOffset == guessedOffset, + ); + } else if (dst > 0 != (dstOffset == guessedOffset)) { + var nonDstOffset = Math.max(winterOffset, summerOffset); + var trueOffset = dst > 0 ? dstOffset : nonDstOffset; + // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up. + date.setTime(date.getTime() + (trueOffset - guessedOffset) * 60000); + } + + HEAP32[(tmPtr + 24) >> 2] = date.getDay(); + var yday = ydayFromDate(date) | 0; + HEAP32[(tmPtr + 28) >> 2] = yday; + // To match expected behavior, update fields from date + HEAP32[tmPtr >> 2] = date.getSeconds(); + HEAP32[(tmPtr + 4) >> 2] = date.getMinutes(); + HEAP32[(tmPtr + 8) >> 2] = date.getHours(); + HEAP32[(tmPtr + 12) >> 2] = date.getDate(); + HEAP32[(tmPtr + 16) >> 2] = date.getMonth(); + HEAP32[(tmPtr + 20) >> 2] = date.getYear(); + + var timeMs = date.getTime(); + if (isNaN(timeMs)) { + return -1; + } + // Return time in microseconds + return timeMs / 1000; + })(); + return ( + setTempRet0( + ((tempDouble = ret), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ), + ret >>> 0 + ); + }; + + function __mmap_js( + len, + prot, + flags, + fd, + offset_low, + offset_high, + allocated, + addr, + ) { + var offset = convertI32PairToI53Checked(offset_low, offset_high); + + try { + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + var res = FS.mmap(stream, len, offset, prot, flags); + var ptr = res.ptr; + HEAP32[allocated >> 2] = res.allocated; + HEAPU32[addr >> 2] = ptr; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + function __munmap_js(addr, len, prot, flags, fd, offset_low, offset_high) { + var offset = convertI32PairToI53Checked(offset_low, offset_high); + + try { + var stream = SYSCALLS.getStreamFromFD(fd); + if (prot & 2) { + SYSCALLS.doMsync(addr, stream, len, flags, offset); + } + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return -e.errno; + } + } + + var timers = {}; + + var handleException = (e) => { + // Certain exception types we do not treat as errors since they are used for + // internal control flow. + // 1. ExitStatus, which is thrown by exit() + // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others + // that wish to return to JS event loop. + if (e instanceof ExitStatus || e == "unwind") { + return EXITSTATUS; + } + checkStackCookie(); + if (e instanceof WebAssembly.RuntimeError) { + if (_emscripten_stack_get_current() <= 0) { + err( + "Stack overflow detected. You can try increasing -sSTACK_SIZE (currently set to 65536)", + ); + } + } + quit_(1, e); + }; + + var keepRuntimeAlive = () => noExitRuntime || runtimeKeepaliveCounter > 0; + var _proc_exit = (code) => { + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + Module["onExit"]?.(code); + ABORT = true; + } + quit_(code, new ExitStatus(code)); + }; + + /** @suppress {duplicate } */ + /** @param {boolean|number=} implicit */ + var exitJS = (status, implicit) => { + EXITSTATUS = status; + + checkUnflushedContent(); + + // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down + if (keepRuntimeAlive() && !implicit) { + var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`; + readyPromiseReject(msg); + err(msg); + } + + _proc_exit(status); + }; + var _exit = exitJS; + + var maybeExit = () => { + if (!keepRuntimeAlive()) { + try { + _exit(EXITSTATUS); + } catch (e) { + handleException(e); + } + } + }; + var callUserCallback = (func) => { + if (ABORT) { + err( + "user callback triggered after runtime exited or application aborted. Ignoring.", + ); + return; + } + try { + func(); + maybeExit(); + } catch (e) { + handleException(e); + } + }; + + var _emscripten_get_now = () => performance.now(); + var __setitimer_js = (which, timeout_ms) => { + // First, clear any existing timer. + if (timers[which]) { + clearTimeout(timers[which].id); + delete timers[which]; + } + + // A timeout of zero simply cancels the current timeout so we have nothing + // more to do. + if (!timeout_ms) return 0; + + var id = setTimeout(() => { + assert(which in timers); + delete timers[which]; + callUserCallback(() => + __emscripten_timeout(which, _emscripten_get_now()), + ); + }, timeout_ms); + timers[which] = { id, timeout_ms }; + return 0; + }; + + var __tzset_js = (timezone, daylight, std_name, dst_name) => { + // TODO: Use (malleable) environment variables instead of system settings. + var currentYear = new Date().getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + + // Local standard timezone offset. Local standard time is not adjusted for + // daylight savings. This code uses the fact that getTimezoneOffset returns + // a greater value during Standard Time versus Daylight Saving Time (DST). + // Thus it determines the expected output during Standard Time, and it + // compares whether the output of the given date the same (Standard) or less + // (DST). + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + + // timezone is specified as seconds west of UTC ("The external variable + // `timezone` shall be set to the difference, in seconds, between + // Coordinated Universal Time (UTC) and local standard time."), the same + // as returned by stdTimezoneOffset. + // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html + HEAPU32[timezone >> 2] = stdTimezoneOffset * 60; + + HEAP32[daylight >> 2] = Number(winterOffset != summerOffset); + + var extractZone = (timezoneOffset) => { + // Why inverse sign? + // Read here https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/getTimezoneOffset + var sign = timezoneOffset >= 0 ? "-" : "+"; + + var absOffset = Math.abs(timezoneOffset); + var hours = String(Math.floor(absOffset / 60)).padStart(2, "0"); + var minutes = String(absOffset % 60).padStart(2, "0"); + + return `UTC${sign}${hours}${minutes}`; + }; + + var winterName = extractZone(winterOffset); + var summerName = extractZone(summerOffset); + assert(winterName); + assert(summerName); + assert( + lengthBytesUTF8(winterName) <= 16, + `timezone name truncated to fit in TZNAME_MAX (${winterName})`, + ); + assert( + lengthBytesUTF8(summerName) <= 16, + `timezone name truncated to fit in TZNAME_MAX (${summerName})`, + ); + if (summerOffset < winterOffset) { + // Northern hemisphere + stringToUTF8(winterName, std_name, 17); + stringToUTF8(summerName, dst_name, 17); + } else { + stringToUTF8(winterName, dst_name, 17); + stringToUTF8(summerName, std_name, 17); + } + }; + + var _emscripten_date_now = () => Date.now(); + + var nowIsMonotonic = 1; + + var checkWasiClock = (clock_id) => clock_id >= 0 && clock_id <= 3; + + function _clock_time_get( + clk_id, + ignored_precision_low, + ignored_precision_high, + ptime, + ) { + var ignored_precision = convertI32PairToI53Checked( + ignored_precision_low, + ignored_precision_high, + ); + + if (!checkWasiClock(clk_id)) { + return 28; + } + var now; + // all wasi clocks but realtime are monotonic + if (clk_id === 0) { + now = _emscripten_date_now(); + } else if (nowIsMonotonic) { + now = _emscripten_get_now(); + } else { + return 52; + } + // "now" is in ms, and wasi times are in ns. + var nsec = Math.round(now * 1000 * 1000); + (tempI64 = [ + nsec >>> 0, + ((tempDouble = nsec), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[ptime >> 2] = tempI64[0]), + (HEAP32[(ptime + 4) >> 2] = tempI64[1]); + return 0; + } + + var _emscripten_err = (str) => err(UTF8ToString(str)); + + var getHeapMax = () => HEAPU8.length; + var _emscripten_get_heap_max = () => getHeapMax(); + + var abortOnCannotGrowMemory = (requestedSize) => { + abort( + `Cannot enlarge memory arrays to size ${requestedSize} bytes (OOM). Either (1) compile with -sINITIAL_MEMORY=X with X higher than the current value ${HEAP8.length}, (2) compile with -sALLOW_MEMORY_GROWTH which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -sABORTING_MALLOC=0`, + ); + }; + var _emscripten_resize_heap = (requestedSize) => { + var oldSize = HEAPU8.length; + // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned. + requestedSize >>>= 0; + abortOnCannotGrowMemory(requestedSize); + }; + + var ENV = {}; + + var getExecutableName = () => thisProgram || "./this.program"; + var getEnvStrings = () => { + if (!getEnvStrings.strings) { + // Default values. + // Browser language detection #8751 + var lang = + ( + (typeof navigator == "object" && + navigator.languages && + navigator.languages[0]) || + "C" + ).replace("-", "_") + ".UTF-8"; + var env = { + USER: "web_user", + LOGNAME: "web_user", + PATH: "/", + PWD: "/", + HOME: "/home/web_user", + LANG: lang, + _: getExecutableName(), + }; + // Apply the user-provided values, if any. + for (var x in ENV) { + // x is a key in ENV; if ENV[x] is undefined, that means it was + // explicitly set to be so. We allow user code to do that to + // force variables with default values to remain unset. + if (ENV[x] === undefined) delete env[x]; + else env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(`${x}=${env[x]}`); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; + }; + + var stringToAscii = (str, buffer) => { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff)); + HEAP8[buffer++] = str.charCodeAt(i); + } + // Null-terminate the string + HEAP8[buffer] = 0; + }; + var _environ_get = (__environ, environ_buf) => { + var bufSize = 0; + getEnvStrings().forEach((string, i) => { + var ptr = environ_buf + bufSize; + HEAPU32[(__environ + i * 4) >> 2] = ptr; + stringToAscii(string, ptr); + bufSize += string.length + 1; + }); + return 0; + }; + + var _environ_sizes_get = (penviron_count, penviron_buf_size) => { + var strings = getEnvStrings(); + HEAPU32[penviron_count >> 2] = strings.length; + var bufSize = 0; + strings.forEach((string) => (bufSize += string.length + 1)); + HEAPU32[penviron_buf_size >> 2] = bufSize; + return 0; + }; + + function _fd_close(fd) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + function _fd_fdstat_get(fd, pbuf) { + try { + var rightsBase = 0; + var rightsInheriting = 0; + var flags = 0; + { + var stream = SYSCALLS.getStreamFromFD(fd); + // All character devices are terminals (other things a Linux system would + // assume is a character device, like the mouse, we have special APIs for). + var type = stream.tty + ? 2 + : FS.isDir(stream.mode) + ? 3 + : FS.isLink(stream.mode) + ? 7 + : 4; + } + HEAP8[pbuf] = type; + HEAP16[(pbuf + 2) >> 1] = flags; + (tempI64 = [ + rightsBase >>> 0, + ((tempDouble = rightsBase), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(pbuf + 8) >> 2] = tempI64[0]), + (HEAP32[(pbuf + 12) >> 2] = tempI64[1]); + (tempI64 = [ + rightsInheriting >>> 0, + ((tempDouble = rightsInheriting), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[(pbuf + 16) >> 2] = tempI64[0]), + (HEAP32[(pbuf + 20) >> 2] = tempI64[1]); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + var doReadv = (stream, iov, iovcnt, offset) => { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[iov >> 2]; + var len = HEAPU32[(iov + 4) >> 2]; + iov += 8; + var curr = FS.read(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + if (typeof offset != "undefined") { + offset += curr; + } + } + return ret; + }; + + function _fd_read(fd, iov, iovcnt, pnum) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doReadv(stream, iov, iovcnt); + HEAPU32[pnum >> 2] = num; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + function _fd_seek(fd, offset_low, offset_high, whence, newOffset) { + var offset = convertI32PairToI53Checked(offset_low, offset_high); + + try { + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + FS.llseek(stream, offset, whence); + (tempI64 = [ + stream.position >>> 0, + ((tempDouble = stream.position), + +Math.abs(tempDouble) >= 1.0 + ? tempDouble > 0.0 + ? +Math.floor(tempDouble / 4294967296.0) >>> 0 + : ~~+Math.ceil( + (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0, + ) >>> 0 + : 0), + ]), + (HEAP32[newOffset >> 2] = tempI64[0]), + (HEAP32[(newOffset + 4) >> 2] = tempI64[1]); + if (stream.getdents && offset === 0 && whence === 0) + stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + function _fd_sync(fd) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + if (stream.stream_ops?.fsync) { + return stream.stream_ops.fsync(stream); + } + return 0; // we can't do anything synchronously; the in-memory FS is already synced to + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + var doWritev = (stream, iov, iovcnt, offset) => { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[iov >> 2]; + var len = HEAPU32[(iov + 4) >> 2]; + iov += 8; + var curr = FS.write(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) { + // No more space to write. + break; + } + if (typeof offset != "undefined") { + offset += curr; + } + } + return ret; + }; + + function _fd_write(fd, iov, iovcnt, pnum) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doWritev(stream, iov, iovcnt); + HEAPU32[pnum >> 2] = num; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e; + return e.errno; + } + } + + var _getaddrinfo = (node, service, hint, out) => { + // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL + // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we + // really should provide a linked list of suitable addrinfo values. + var addrs = []; + var canon = null; + var addr = 0; + var port = 0; + var flags = 0; + var family = 0; + var type = 0; + var proto = 0; + var ai, last; + + function allocaddrinfo(family, type, proto, canon, addr, port) { + var sa, salen, ai; + var errno; + + salen = family === 10 ? 28 : 16; + addr = family === 10 ? inetNtop6(addr) : inetNtop4(addr); + sa = _malloc(salen); + errno = writeSockaddr(sa, family, addr, port); + assert(!errno); + + ai = _malloc(32); + HEAP32[(ai + 4) >> 2] = family; + HEAP32[(ai + 8) >> 2] = type; + HEAP32[(ai + 12) >> 2] = proto; + HEAPU32[(ai + 24) >> 2] = canon; + HEAPU32[(ai + 20) >> 2] = sa; + if (family === 10) { + HEAP32[(ai + 16) >> 2] = 28; + } else { + HEAP32[(ai + 16) >> 2] = 16; + } + HEAP32[(ai + 28) >> 2] = 0; + + return ai; + } + + if (hint) { + flags = HEAP32[hint >> 2]; + family = HEAP32[(hint + 4) >> 2]; + type = HEAP32[(hint + 8) >> 2]; + proto = HEAP32[(hint + 12) >> 2]; + } + if (type && !proto) { + proto = type === 2 ? 17 : 6; + } + if (!type && proto) { + type = proto === 17 ? 2 : 1; + } + + // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for + // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints. + if (proto === 0) { + proto = 6; + } + if (type === 0) { + type = 1; + } + + if (!node && !service) { + return -2; + } + if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) { + return -1; + } + if (hint !== 0 && HEAP32[hint >> 2] & 2 && !node) { + return -1; + } + if (flags & 32) { + // TODO + return -2; + } + if (type !== 0 && type !== 1 && type !== 2) { + return -7; + } + if (family !== 0 && family !== 2 && family !== 10) { + return -6; + } + + if (service) { + service = UTF8ToString(service); + port = parseInt(service, 10); + + if (isNaN(port)) { + if (flags & 1024) { + return -2; + } + // TODO support resolving well-known service names from: + // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt + return -8; + } + } + + if (!node) { + if (family === 0) { + family = 2; + } + if ((flags & 1) === 0) { + if (family === 2) { + addr = _htonl(2130706433); + } else { + addr = [0, 0, 0, _htonl(1)]; + } + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[out >> 2] = ai; + return 0; + } + + // + // try as a numeric address + // + node = UTF8ToString(node); + addr = inetPton4(node); + if (addr !== null) { + // incoming node is a valid ipv4 address + if (family === 0 || family === 2) { + family = 2; + } else if (family === 10 && flags & 8) { + addr = [0, 0, _htonl(0xffff), addr]; + family = 10; + } else { + return -2; + } + } else { + addr = inetPton6(node); + if (addr !== null) { + // incoming node is a valid ipv6 address + if (family === 0 || family === 10) { + family = 10; + } else { + return -2; + } + } + } + if (addr != null) { + ai = allocaddrinfo(family, type, proto, node, addr, port); + HEAPU32[out >> 2] = ai; + return 0; + } + if (flags & 4) { + return -2; + } + + // + // try as a hostname + // + // resolve the hostname to a temporary fake address + node = DNS.lookup_name(node); + addr = inetPton4(node); + if (family === 0) { + family = 2; + } else if (family === 10) { + addr = [0, 0, _htonl(0xffff), addr]; + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[out >> 2] = ai; + return 0; + }; + + /** @type {function(...*):?} */ + function _getcontext() { + abort("missing function: getcontext"); + } + _getcontext.stub = true; + + /** @type {function(...*):?} */ + function _getdtablesize() { + abort("missing function: getdtablesize"); + } + _getdtablesize.stub = true; + + var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => { + var info = readSockaddr(sa, salen); + if (info.errno) { + return -6; + } + var port = info.port; + var addr = info.addr; + + var overflowed = false; + + if (node && nodelen) { + var lookup; + if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) { + if (flags & 8) { + return -2; + } + } else { + addr = lookup; + } + var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen); + + if (numBytesWrittenExclNull + 1 >= nodelen) { + overflowed = true; + } + } + + if (serv && servlen) { + port = "" + port; + var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen); + + if (numBytesWrittenExclNull + 1 >= servlen) { + overflowed = true; + } + } + + if (overflowed) { + // Note: even when we overflow, getnameinfo() is specced to write out the truncated results. + return -12; + } + + return 0; + }; + + var Protocols = { + list: [], + map: {}, + }; + + var _setprotoent = (stayopen) => { + // void setprotoent(int stayopen); + + // Allocate and populate a protoent structure given a name, protocol number and array of aliases + function allocprotoent(name, proto, aliases) { + // write name into buffer + var nameBuf = _malloc(name.length + 1); + stringToAscii(name, nameBuf); + + // write aliases into buffer + var j = 0; + var length = aliases.length; + var aliasListBuf = _malloc((length + 1) * 4); // Use length + 1 so we have space for the terminating NULL ptr. + + for (var i = 0; i < length; i++, j += 4) { + var alias = aliases[i]; + var aliasBuf = _malloc(alias.length + 1); + stringToAscii(alias, aliasBuf); + HEAPU32[(aliasListBuf + j) >> 2] = aliasBuf; + } + HEAPU32[(aliasListBuf + j) >> 2] = 0; // Terminating NULL pointer. + + // generate protoent + var pe = _malloc(12); + HEAPU32[pe >> 2] = nameBuf; + HEAPU32[(pe + 4) >> 2] = aliasListBuf; + HEAP32[(pe + 8) >> 2] = proto; + return pe; + } + + // Populate the protocol 'database'. The entries are limited to tcp and udp, though it is fairly trivial + // to add extra entries from /etc/protocols if desired - though not sure if that'd actually be useful. + var list = Protocols.list; + var map = Protocols.map; + if (list.length === 0) { + var entry = allocprotoent("tcp", 6, ["TCP"]); + list.push(entry); + map["tcp"] = map["6"] = entry; + entry = allocprotoent("udp", 17, ["UDP"]); + list.push(entry); + map["udp"] = map["17"] = entry; + } + + _setprotoent.index = 0; + }; + + var _getprotobyname = (name) => { + // struct protoent *getprotobyname(const char *); + name = UTF8ToString(name); + _setprotoent(true); + var result = Protocols.map[name]; + return result; + }; + + var _getprotobynumber = (number) => { + // struct protoent *getprotobynumber(int proto); + _setprotoent(true); + var result = Protocols.map[number]; + return result; + }; + + /** @type {function(...*):?} */ + function _makecontext() { + abort("missing function: makecontext"); + } + _makecontext.stub = true; + + /** @type {function(...*):?} */ + function _posix_spawnp() { + abort("missing function: posix_spawnp"); + } + _posix_spawnp.stub = true; + + var arraySum = (array, index) => { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) { + // no-op + } + return sum; + }; + + var MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + + var MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + var addDays = (date, days) => { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[ + currentMonth + ]; + + if (days > daysInCurrentMonth - newDate.getDate()) { + // we spill over to next month + days -= daysInCurrentMonth - newDate.getDate() + 1; + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth + 1); + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear() + 1); + } + } else { + // we stay in current month + newDate.setDate(newDate.getDate() + days); + return newDate; + } + } + + return newDate; + }; + + var _strptime = (buf, format, tm) => { + // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html + var pattern = UTF8ToString(format); + + // escape special characters + // TODO: not sure we really need to escape all of these in JS regexps + var SPECIAL_CHARS = "\\!@#$^&*()+=-[]/{}|:<>?,."; + for (var i = 0, ii = SPECIAL_CHARS.length; i < ii; ++i) { + pattern = pattern.replace( + new RegExp("\\" + SPECIAL_CHARS[i], "g"), + "\\" + SPECIAL_CHARS[i], + ); + } + + // reduce number of matchers + var EQUIVALENT_MATCHERS = { + A: "%a", + B: "%b", + c: "%a %b %d %H:%M:%S %Y", + D: "%m\\/%d\\/%y", + e: "%d", + F: "%Y-%m-%d", + h: "%b", + R: "%H\\:%M", + r: "%I\\:%M\\:%S\\s%p", + T: "%H\\:%M\\:%S", + x: "%m\\/%d\\/(?:%y|%Y)", + X: "%H\\:%M\\:%S", + }; + // TODO: take care of locale + + var DATE_PATTERNS = { + /* weekday name */ a: "(?:Sun(?:day)?)|(?:Mon(?:day)?)|(?:Tue(?:sday)?)|(?:Wed(?:nesday)?)|(?:Thu(?:rsday)?)|(?:Fri(?:day)?)|(?:Sat(?:urday)?)", + /* month name */ b: "(?:Jan(?:uary)?)|(?:Feb(?:ruary)?)|(?:Mar(?:ch)?)|(?:Apr(?:il)?)|May|(?:Jun(?:e)?)|(?:Jul(?:y)?)|(?:Aug(?:ust)?)|(?:Sep(?:tember)?)|(?:Oct(?:ober)?)|(?:Nov(?:ember)?)|(?:Dec(?:ember)?)", + /* century */ C: "\\d\\d", + /* day of month */ d: "0[1-9]|[1-9](?!\\d)|1\\d|2\\d|30|31", + /* hour (24hr) */ H: "\\d(?!\\d)|[0,1]\\d|20|21|22|23", + /* hour (12hr) */ I: "\\d(?!\\d)|0\\d|10|11|12", + /* day of year */ j: "00[1-9]|0?[1-9](?!\\d)|0?[1-9]\\d(?!\\d)|[1,2]\\d\\d|3[0-6]\\d", + /* month */ m: "0[1-9]|[1-9](?!\\d)|10|11|12", + /* minutes */ M: "0\\d|\\d(?!\\d)|[1-5]\\d", + /* whitespace */ n: " ", + /* AM/PM */ p: "AM|am|PM|pm|A\\.M\\.|a\\.m\\.|P\\.M\\.|p\\.m\\.", + /* seconds */ S: "0\\d|\\d(?!\\d)|[1-5]\\d|60", + /* week number */ U: "0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53", + /* week number */ W: "0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53", + /* weekday number */ w: "[0-6]", + /* 2-digit year */ y: "\\d\\d", + /* 4-digit year */ Y: "\\d\\d\\d\\d", + /* whitespace */ t: " ", + /* time zone */ z: "Z|(?:[\\+\\-]\\d\\d:?(?:\\d\\d)?)", + }; + + var MONTH_NUMBERS = { + JAN: 0, + FEB: 1, + MAR: 2, + APR: 3, + MAY: 4, + JUN: 5, + JUL: 6, + AUG: 7, + SEP: 8, + OCT: 9, + NOV: 10, + DEC: 11, + }; + var DAY_NUMBERS_SUN_FIRST = { + SUN: 0, + MON: 1, + TUE: 2, + WED: 3, + THU: 4, + FRI: 5, + SAT: 6, + }; + var DAY_NUMBERS_MON_FIRST = { + MON: 0, + TUE: 1, + WED: 2, + THU: 3, + FRI: 4, + SAT: 5, + SUN: 6, + }; + + var capture = []; + var pattern_out = pattern + .replace(/%(.)/g, (m, c) => EQUIVALENT_MATCHERS[c] || m) + .replace(/%(.)/g, (_, c) => { + let pat = DATE_PATTERNS[c]; + if (pat) { + capture.push(c); + return `(${pat})`; + } else { + return c; + } + }) + .replace( + // any number of space or tab characters match zero or more spaces + /\s+/g, + "\\s*", + ); + + var matches = new RegExp("^" + pattern_out, "i").exec(UTF8ToString(buf)); + + function initDate() { + function fixup(value, min, max) { + return typeof value != "number" || isNaN(value) + ? min + : value >= min + ? value <= max + ? value + : max + : min; + } + return { + year: fixup(HEAP32[(tm + 20) >> 2] + 1900, 1970, 9999), + month: fixup(HEAP32[(tm + 16) >> 2], 0, 11), + day: fixup(HEAP32[(tm + 12) >> 2], 1, 31), + hour: fixup(HEAP32[(tm + 8) >> 2], 0, 23), + min: fixup(HEAP32[(tm + 4) >> 2], 0, 59), + sec: fixup(HEAP32[tm >> 2], 0, 59), + gmtoff: 0, + }; + } + + if (matches) { + var date = initDate(); + var value; + + var getMatch = (symbol) => { + var pos = capture.indexOf(symbol); + // check if symbol appears in regexp + if (pos >= 0) { + // return matched value or null (falsy!) for non-matches + return matches[pos + 1]; + } + return; + }; + + // seconds + if ((value = getMatch("S"))) { + date.sec = jstoi_q(value); + } + + // minutes + if ((value = getMatch("M"))) { + date.min = jstoi_q(value); + } + + // hours + if ((value = getMatch("H"))) { + // 24h clock + date.hour = jstoi_q(value); + } else if ((value = getMatch("I"))) { + // AM/PM clock + var hour = jstoi_q(value); + if ((value = getMatch("p"))) { + hour += value.toUpperCase()[0] === "P" ? 12 : 0; + } + date.hour = hour; + } + + // year + if ((value = getMatch("Y"))) { + // parse from four-digit year + date.year = jstoi_q(value); + } else if ((value = getMatch("y"))) { + // parse from two-digit year... + var year = jstoi_q(value); + if ((value = getMatch("C"))) { + // ...and century + year += jstoi_q(value) * 100; + } else { + // ...and rule-of-thumb + year += year < 69 ? 2000 : 1900; + } + date.year = year; + } + + // month + if ((value = getMatch("m"))) { + // parse from month number + date.month = jstoi_q(value) - 1; + } else if ((value = getMatch("b"))) { + // parse from month name + date.month = MONTH_NUMBERS[value.substring(0, 3).toUpperCase()] || 0; + // TODO: derive month from day in year+year, week number+day of week+year + } + + // day + if ((value = getMatch("d"))) { + // get day of month directly + date.day = jstoi_q(value); + } else if ((value = getMatch("j"))) { + // get day of month from day of year ... + var day = jstoi_q(value); + var leapYear = isLeapYear(date.year); + for (var month = 0; month < 12; ++month) { + var daysUntilMonth = arraySum( + leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, + month - 1, + ); + if ( + day <= + daysUntilMonth + + (leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[month] + ) { + date.day = day - daysUntilMonth; + } + } + } else if ((value = getMatch("a"))) { + // get day of month from weekday ... + var weekDay = value.substring(0, 3).toUpperCase(); + if ((value = getMatch("U"))) { + // ... and week number (Sunday being first day of week) + // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Sunday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay() === 0) { + // Jan 1st is a Sunday, and, hence in the 1st CW + endDate = addDays(janFirst, weekDayNumber + 7 * (weekNumber - 1)); + } else { + // Jan 1st is not a Sunday, and, hence still in the 0th CW + endDate = addDays( + janFirst, + 7 - janFirst.getDay() + weekDayNumber + 7 * (weekNumber - 1), + ); + } + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } else if ((value = getMatch("W"))) { + // ... and week number (Monday being first day of week) + // Week number of the year (Monday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Monday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay() === 1) { + // Jan 1st is a Monday, and, hence in the 1st CW + endDate = addDays(janFirst, weekDayNumber + 7 * (weekNumber - 1)); + } else { + // Jan 1st is not a Monday, and, hence still in the 0th CW + endDate = addDays( + janFirst, + 7 - + janFirst.getDay() + + 1 + + weekDayNumber + + 7 * (weekNumber - 1), + ); + } + + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } + } + + // time zone + if ((value = getMatch("z"))) { + // GMT offset as either 'Z' or +-HH:MM or +-HH or +-HHMM + if (value.toLowerCase() === "z") { + date.gmtoff = 0; + } else { + var match = value.match(/^((?:\-|\+)\d\d):?(\d\d)?/); + date.gmtoff = match[1] * 3600; + if (match[2]) { + date.gmtoff += date.gmtoff > 0 ? match[2] * 60 : -match[2] * 60; + } + } + } + + /* + tm_sec int seconds after the minute 0-61* + tm_min int minutes after the hour 0-59 + tm_hour int hours since midnight 0-23 + tm_mday int day of the month 1-31 + tm_mon int months since January 0-11 + tm_year int years since 1900 + tm_wday int days since Sunday 0-6 + tm_yday int days since January 1 0-365 + tm_isdst int Daylight Saving Time flag + tm_gmtoff long offset from GMT (seconds) + */ + + var fullDate = new Date( + date.year, + date.month, + date.day, + date.hour, + date.min, + date.sec, + 0, + ); + HEAP32[tm >> 2] = fullDate.getSeconds(); + HEAP32[(tm + 4) >> 2] = fullDate.getMinutes(); + HEAP32[(tm + 8) >> 2] = fullDate.getHours(); + HEAP32[(tm + 12) >> 2] = fullDate.getDate(); + HEAP32[(tm + 16) >> 2] = fullDate.getMonth(); + HEAP32[(tm + 20) >> 2] = fullDate.getFullYear() - 1900; + HEAP32[(tm + 24) >> 2] = fullDate.getDay(); + HEAP32[(tm + 28) >> 2] = + arraySum( + isLeapYear(fullDate.getFullYear()) + ? MONTH_DAYS_LEAP + : MONTH_DAYS_REGULAR, + fullDate.getMonth() - 1, + ) + + fullDate.getDate() - + 1; + HEAP32[(tm + 32) >> 2] = 0; + HEAP32[(tm + 36) >> 2] = date.gmtoff; + + // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F + // TODO: not sure that intArrayFromString handles all unicode characters correctly + return buf + intArrayFromString(matches[0]).length - 1; + } + + return 0; + }; + + /** @type {function(...*):?} */ + function _swapcontext() { + abort("missing function: swapcontext"); + } + _swapcontext.stub = true; + + var getCFunc = (ident) => { + var func = Module["_" + ident]; // closure exported function + assert( + func, + "Cannot call unknown function " + ident + ", make sure it is exported", + ); + return func; + }; + + var writeArrayToMemory = (array, buffer) => { + assert( + array.length >= 0, + "writeArrayToMemory array must have a length (should be an array or typed array)", + ); + HEAP8.set(array, buffer); + }; + + var stackAlloc = (sz) => __emscripten_stack_alloc(sz); + var stringToUTF8OnStack = (str) => { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8(str, ret, size); + return ret; + }; + + /** + * @param {string|null=} returnType + * @param {Array=} argTypes + * @param {Arguments|Array=} args + * @param {Object=} opts + */ + var ccall = (ident, returnType, argTypes, args, opts) => { + // For fast lookup of conversion functions + var toC = { + string: (str) => { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { + // null string + ret = stringToUTF8OnStack(str); + } + return ret; + }, + array: (arr) => { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + }, + }; + + function convertReturnValue(ret) { + if (returnType === "string") { + return UTF8ToString(ret); + } + if (returnType === "boolean") return Boolean(ret); + return ret; + } + + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== "array", 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func(...cArgs); + function onDone(ret) { + if (stack !== 0) stackRestore(stack); + return convertReturnValue(ret); + } + + ret = onDone(ret); + return ret; + }; + + FS.createPreloadedFile = FS_createPreloadedFile; + FS.staticInit(); + // Set module methods based on EXPORTED_RUNTIME_METHODS + function checkIncomingModuleAPI() { + ignoredModuleProp("fetchSettings"); + } + var wasmImports = { + /** @export */ + __assert_fail: ___assert_fail, + /** @export */ + __call_sighandler: ___call_sighandler, + /** @export */ + __syscall__newselect: ___syscall__newselect, + /** @export */ + __syscall_accept4: ___syscall_accept4, + /** @export */ + __syscall_bind: ___syscall_bind, + /** @export */ + __syscall_chdir: ___syscall_chdir, + /** @export */ + __syscall_chmod: ___syscall_chmod, + /** @export */ + __syscall_connect: ___syscall_connect, + /** @export */ + __syscall_dup: ___syscall_dup, + /** @export */ + __syscall_faccessat: ___syscall_faccessat, + /** @export */ + __syscall_fchownat: ___syscall_fchownat, + /** @export */ + __syscall_fcntl64: ___syscall_fcntl64, + /** @export */ + __syscall_fdatasync: ___syscall_fdatasync, + /** @export */ + __syscall_fstat64: ___syscall_fstat64, + /** @export */ + __syscall_ftruncate64: ___syscall_ftruncate64, + /** @export */ + __syscall_getcwd: ___syscall_getcwd, + /** @export */ + __syscall_getdents64: ___syscall_getdents64, + /** @export */ + __syscall_getpeername: ___syscall_getpeername, + /** @export */ + __syscall_getsockname: ___syscall_getsockname, + /** @export */ + __syscall_getsockopt: ___syscall_getsockopt, + /** @export */ + __syscall_ioctl: ___syscall_ioctl, + /** @export */ + __syscall_listen: ___syscall_listen, + /** @export */ + __syscall_lstat64: ___syscall_lstat64, + /** @export */ + __syscall_mkdirat: ___syscall_mkdirat, + /** @export */ + __syscall_newfstatat: ___syscall_newfstatat, + /** @export */ + __syscall_openat: ___syscall_openat, + /** @export */ + __syscall_pipe: ___syscall_pipe, + /** @export */ + __syscall_poll: ___syscall_poll, + /** @export */ + __syscall_readlinkat: ___syscall_readlinkat, + /** @export */ + __syscall_recvfrom: ___syscall_recvfrom, + /** @export */ + __syscall_renameat: ___syscall_renameat, + /** @export */ + __syscall_rmdir: ___syscall_rmdir, + /** @export */ + __syscall_sendto: ___syscall_sendto, + /** @export */ + __syscall_socket: ___syscall_socket, + /** @export */ + __syscall_stat64: ___syscall_stat64, + /** @export */ + __syscall_statfs64: ___syscall_statfs64, + /** @export */ + __syscall_symlinkat: ___syscall_symlinkat, + /** @export */ + __syscall_unlinkat: ___syscall_unlinkat, + /** @export */ + __syscall_utimensat: ___syscall_utimensat, + /** @export */ + _abort_js: __abort_js, + /** @export */ + _emscripten_lookup_name: __emscripten_lookup_name, + /** @export */ + _emscripten_memcpy_js: __emscripten_memcpy_js, + /** @export */ + _emscripten_runtime_keepalive_clear: __emscripten_runtime_keepalive_clear, + /** @export */ + _emscripten_throw_longjmp: __emscripten_throw_longjmp, + /** @export */ + _gmtime_js: __gmtime_js, + /** @export */ + _localtime_js: __localtime_js, + /** @export */ + _mktime_js: __mktime_js, + /** @export */ + _mmap_js: __mmap_js, + /** @export */ + _munmap_js: __munmap_js, + /** @export */ + _setitimer_js: __setitimer_js, + /** @export */ + _tzset_js: __tzset_js, + /** @export */ + clock_time_get: _clock_time_get, + /** @export */ + emscripten_date_now: _emscripten_date_now, + /** @export */ + emscripten_err: _emscripten_err, + /** @export */ + emscripten_get_heap_max: _emscripten_get_heap_max, + /** @export */ + emscripten_get_now: _emscripten_get_now, + /** @export */ + emscripten_resize_heap: _emscripten_resize_heap, + /** @export */ + environ_get: _environ_get, + /** @export */ + environ_sizes_get: _environ_sizes_get, + /** @export */ + exit: _exit, + /** @export */ + fd_close: _fd_close, + /** @export */ + fd_fdstat_get: _fd_fdstat_get, + /** @export */ + fd_read: _fd_read, + /** @export */ + fd_seek: _fd_seek, + /** @export */ + fd_sync: _fd_sync, + /** @export */ + fd_write: _fd_write, + /** @export */ + getaddrinfo: _getaddrinfo, + /** @export */ + getcontext: _getcontext, + /** @export */ + getdtablesize: _getdtablesize, + /** @export */ + getnameinfo: _getnameinfo, + /** @export */ + getprotobyname: _getprotobyname, + /** @export */ + getprotobynumber: _getprotobynumber, + /** @export */ + invoke_i, + /** @export */ + invoke_ii, + /** @export */ + invoke_iii, + /** @export */ + invoke_iiii, + /** @export */ + invoke_iiiii, + /** @export */ + invoke_iiiiii, + /** @export */ + invoke_iiiiiii, + /** @export */ + invoke_iiiiiiiiii, + /** @export */ + invoke_v, + /** @export */ + invoke_vi, + /** @export */ + invoke_vii, + /** @export */ + invoke_viidii, + /** @export */ + invoke_viii, + /** @export */ + invoke_viiii, + /** @export */ + invoke_viiiii, + /** @export */ + makecontext: _makecontext, + /** @export */ + posix_spawnp: _posix_spawnp, + /** @export */ + proc_exit: _proc_exit, + /** @export */ + strptime: _strptime, + /** @export */ + swapcontext: _swapcontext, + }; + var wasmExports; + createWasm(); + var ___wasm_call_ctors = createExportWrapper("__wasm_call_ctors", 0); + var _php_wasm_run = (Module["_php_wasm_run"] = createExportWrapper( + "php_wasm_run", + 1, + )); + var _fflush = createExportWrapper("fflush", 1); + var _malloc = createExportWrapper("malloc", 1); + var _strerror = createExportWrapper("strerror", 1); + var _htons = createExportWrapper("htons", 1); + var _ntohs = createExportWrapper("ntohs", 1); + var _htonl = createExportWrapper("htonl", 1); + var _emscripten_builtin_memalign = createExportWrapper( + "emscripten_builtin_memalign", + 2, + ); + var __emscripten_timeout = createExportWrapper("_emscripten_timeout", 2); + var _setThrew = createExportWrapper("setThrew", 2); + var __emscripten_tempret_set = createExportWrapper( + "_emscripten_tempret_set", + 1, + ); + var _emscripten_stack_init = () => + (_emscripten_stack_init = wasmExports["emscripten_stack_init"])(); + var _emscripten_stack_get_free = () => + (_emscripten_stack_get_free = wasmExports["emscripten_stack_get_free"])(); + var _emscripten_stack_get_base = () => + (_emscripten_stack_get_base = wasmExports["emscripten_stack_get_base"])(); + var _emscripten_stack_get_end = () => + (_emscripten_stack_get_end = wasmExports["emscripten_stack_get_end"])(); + var __emscripten_stack_restore = (a0) => + (__emscripten_stack_restore = wasmExports["_emscripten_stack_restore"])( + a0, + ); + var __emscripten_stack_alloc = (a0) => + (__emscripten_stack_alloc = wasmExports["_emscripten_stack_alloc"])(a0); + var _emscripten_stack_get_current = () => + (_emscripten_stack_get_current = + wasmExports["emscripten_stack_get_current"])(); + var dynCall_jiji = (Module["dynCall_jiji"] = createExportWrapper( + "dynCall_jiji", + 5, + )); + + function invoke_iii(index, a1, a2) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_iiiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_v(index) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_ii(index, a1) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_viii(index, a1, a2, a3) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_vii(index, a1, a2) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_vi(index, a1) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_i(index) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_iiii(index, a1, a2, a3) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_viiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_viiiii(index, a1, a2, a3, a4, a5) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4, a5); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_iiiiii(index, a1, a2, a3, a4, a5) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + function invoke_viidii(index, a1, a2, a3, a4, a5) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4, a5); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } + } + + // include: postamble.js + // === Auto-generated postamble setup entry stuff === + + Module["ccall"] = ccall; + var missingLibrarySymbols = [ + "writeI53ToI64", + "writeI53ToI64Clamped", + "writeI53ToI64Signaling", + "writeI53ToU64Clamped", + "writeI53ToU64Signaling", + "readI53FromU64", + "convertI32PairToI53", + "convertU32PairToI53", + "getTempRet0", + "growMemory", + "emscriptenLog", + "readEmAsmArgs", + "listenOnce", + "autoResumeAudioContext", + "dynCallLegacy", + "getDynCaller", + "dynCall", + "runtimeKeepalivePush", + "runtimeKeepalivePop", + "asmjsMangle", + "HandleAllocator", + "getNativeTypeSize", + "STACK_SIZE", + "STACK_ALIGN", + "POINTER_SIZE", + "ASSERTIONS", + "cwrap", + "uleb128Encode", + "sigToWasmTypes", + "generateFuncType", + "convertJsFunctionToWasm", + "getEmptyTableSlot", + "updateTableMap", + "getFunctionAddress", + "addFunction", + "removeFunction", + "reallyNegative", + "unSign", + "strLen", + "reSign", + "formatString", + "intArrayToString", + "AsciiToString", + "UTF16ToString", + "stringToUTF16", + "lengthBytesUTF16", + "UTF32ToString", + "stringToUTF32", + "lengthBytesUTF32", + "stringToNewUTF8", + "registerKeyEventCallback", + "maybeCStringToJsString", + "findEventTarget", + "getBoundingClientRect", + "fillMouseEventData", + "registerMouseEventCallback", + "registerWheelEventCallback", + "registerUiEventCallback", + "registerFocusEventCallback", + "fillDeviceOrientationEventData", + "registerDeviceOrientationEventCallback", + "fillDeviceMotionEventData", + "registerDeviceMotionEventCallback", + "screenOrientation", + "fillOrientationChangeEventData", + "registerOrientationChangeEventCallback", + "fillFullscreenChangeEventData", + "registerFullscreenChangeEventCallback", + "JSEvents_requestFullscreen", + "JSEvents_resizeCanvasForFullscreen", + "registerRestoreOldStyle", + "hideEverythingExceptGivenElement", + "restoreHiddenElements", + "setLetterbox", + "softFullscreenResizeWebGLRenderTarget", + "doRequestFullscreen", + "fillPointerlockChangeEventData", + "registerPointerlockChangeEventCallback", + "registerPointerlockErrorEventCallback", + "requestPointerLock", + "fillVisibilityChangeEventData", + "registerVisibilityChangeEventCallback", + "registerTouchEventCallback", + "fillGamepadEventData", + "registerGamepadEventCallback", + "registerBeforeUnloadEventCallback", + "fillBatteryEventData", + "battery", + "registerBatteryEventCallback", + "setCanvasElementSize", + "getCanvasElementSize", + "jsStackTrace", + "getCallstack", + "convertPCtoSourceLocation", + "wasiRightsToMuslOFlags", + "wasiOFlagsToMuslOFlags", + "safeSetTimeout", + "setImmediateWrapped", + "safeRequestAnimationFrame", + "clearImmediateWrapped", + "polyfillSetImmediate", + "registerPostMainLoop", + "registerPreMainLoop", + "getPromise", + "makePromise", + "idsToPromises", + "makePromiseCallback", + "ExceptionInfo", + "findMatchingCatch", + "Browser_asyncPrepareDataCounter", + "FS_unlink", + "FS_mkdirTree", + "_setNetworkCallback", + "heapObjectForWebGLType", + "toTypedArrayIndex", + "webgl_enable_ANGLE_instanced_arrays", + "webgl_enable_OES_vertex_array_object", + "webgl_enable_WEBGL_draw_buffers", + "webgl_enable_WEBGL_multi_draw", + "webgl_enable_EXT_polygon_offset_clamp", + "webgl_enable_EXT_clip_control", + "webgl_enable_WEBGL_polygon_mode", + "emscriptenWebGLGet", + "computeUnpackAlignedImageSize", + "colorChannelsInGlTextureFormat", + "emscriptenWebGLGetTexPixelData", + "emscriptenWebGLGetUniform", + "webglGetUniformLocation", + "webglPrepareUniformLocationsBeforeFirstUse", + "webglGetLeftBracePos", + "emscriptenWebGLGetVertexAttrib", + "__glGetActiveAttribOrUniform", + "writeGLArray", + "registerWebGlEventCallback", + "runAndAbortIfError", + "ALLOC_NORMAL", + "ALLOC_STACK", + "allocate", + "writeStringToMemory", + "writeAsciiToMemory", + "setErrNo", + "demangle", + "stackTrace", + ]; + missingLibrarySymbols.forEach(missingLibrarySymbol); + + var unexportedSymbols = [ + "run", + "addOnPreRun", + "addOnInit", + "addOnPreMain", + "addOnExit", + "addOnPostRun", + "addRunDependency", + "removeRunDependency", + "out", + "err", + "callMain", + "abort", + "wasmMemory", + "wasmExports", + "writeStackCookie", + "checkStackCookie", + "readI53FromI64", + "convertI32PairToI53Checked", + "stackSave", + "stackRestore", + "stackAlloc", + "setTempRet0", + "ptrToString", + "zeroMemory", + "exitJS", + "getHeapMax", + "abortOnCannotGrowMemory", + "ENV", + "ERRNO_CODES", + "strError", + "inetPton4", + "inetNtop4", + "inetPton6", + "inetNtop6", + "readSockaddr", + "writeSockaddr", + "DNS", + "Protocols", + "Sockets", + "timers", + "warnOnce", + "readEmAsmArgsArray", + "jstoi_q", + "jstoi_s", + "getExecutableName", + "handleException", + "keepRuntimeAlive", + "callUserCallback", + "maybeExit", + "asyncLoad", + "alignMemory", + "mmapAlloc", + "wasmTable", + "noExitRuntime", + "getCFunc", + "freeTableIndexes", + "functionsInTableMap", + "setValue", + "getValue", + "PATH", + "PATH_FS", + "UTF8Decoder", + "UTF8ArrayToString", + "UTF8ToString", + "stringToUTF8Array", + "stringToUTF8", + "lengthBytesUTF8", + "intArrayFromString", + "stringToAscii", + "UTF16Decoder", + "stringToUTF8OnStack", + "writeArrayToMemory", + "JSEvents", + "specialHTMLTargets", + "findCanvasEventTarget", + "currentFullscreenStrategy", + "restoreOldWindowedStyle", + "UNWIND_CACHE", + "ExitStatus", + "getEnvStrings", + "checkWasiClock", + "doReadv", + "doWritev", + "initRandomFill", + "randomFill", + "promiseMap", + "uncaughtExceptionCount", + "exceptionLast", + "exceptionCaught", + "Browser", + "getPreloadedImageData__data", + "wget", + "MONTH_DAYS_REGULAR", + "MONTH_DAYS_LEAP", + "MONTH_DAYS_REGULAR_CUMULATIVE", + "MONTH_DAYS_LEAP_CUMULATIVE", + "isLeapYear", + "ydayFromDate", + "arraySum", + "addDays", + "SYSCALLS", + "getSocketFromFD", + "getSocketAddress", + "preloadPlugins", + "FS_createPreloadedFile", + "FS_modeStringToFlags", + "FS_getMode", + "FS_stdin_getChar_buffer", + "FS_stdin_getChar", + "FS_createPath", + "FS_createDevice", + "FS_readFile", + "FS", + "FS_createDataFile", + "FS_createLazyFile", + "MEMFS", + "TTY", + "PIPEFS", + "SOCKFS", + "tempFixedLengthArray", + "miniTempWebGLFloatBuffers", + "miniTempWebGLIntBuffers", + "GL", + "AL", + "GLUT", + "EGL", + "GLEW", + "IDBStore", + "SDL", + "SDL_gfx", + "allocateUTF8", + "allocateUTF8OnStack", + "print", + "printErr", + ]; + unexportedSymbols.forEach(unexportedRuntimeSymbol); + + var calledRun; + + dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled + }; + + function stackCheckInit() { + // This is normally called automatically during __wasm_call_ctors but need to + // get these values before even running any of the ctors so we call it redundantly + // here. + _emscripten_stack_init(); + // TODO(sbc): Move writeStackCookie to native to to avoid this. + writeStackCookie(); + } + + function run() { + if (runDependencies > 0) { + return; + } + + stackCheckInit(); + + preRun(); + + // a preRun added a dependency, run will be called later + if (runDependencies > 0) { + return; + } + + function doRun() { + // run may have just been called through dependencies being fulfilled just in this very frame, + // or while the async setStatus time below was happening + if (calledRun) return; + calledRun = true; + Module["calledRun"] = true; + + if (ABORT) return; + + initRuntime(); + + readyPromiseResolve(Module); + Module["onRuntimeInitialized"]?.(); + + assert( + !Module["_main"], + 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]', + ); + + postRun(); + } + + if (Module["setStatus"]) { + Module["setStatus"]("Running..."); + setTimeout(() => { + setTimeout(() => Module["setStatus"](""), 1); + doRun(); + }, 1); + } else { + doRun(); + } + checkStackCookie(); + } + + function checkUnflushedContent() { + // Compiler settings do not allow exiting the runtime, so flushing + // the streams is not possible. but in ASSERTIONS mode we check + // if there was something to flush, and if so tell the user they + // should request that the runtime be exitable. + // Normally we would not even include flush() at all, but in ASSERTIONS + // builds we do so just for this check, and here we see if there is any + // content to flush, that is, we check if there would have been + // something a non-ASSERTIONS build would have not seen. + // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0 + // mode (which has its own special function for this; otherwise, all + // the code is inside libc) + var oldOut = out; + var oldErr = err; + var has = false; + out = err = (x) => { + has = true; + }; + try { + // it doesn't matter if it fails + _fflush(0); + // also flush in the JS FS layer + ["stdout", "stderr"].forEach((name) => { + var info = FS.analyzePath("/dev/" + name); + if (!info) return; + var stream = info.object; + var rdev = stream.rdev; + var tty = TTY.ttys[rdev]; + if (tty?.output?.length) { + has = true; + } + }); + } catch (e) {} + out = oldOut; + err = oldErr; + if (has) { + warnOnce( + "stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the Emscripten FAQ), or make sure to emit a newline when you printf etc.", + ); + } + } + + if (Module["preInit"]) { + if (typeof Module["preInit"] == "function") + Module["preInit"] = [Module["preInit"]]; + while (Module["preInit"].length > 0) { + Module["preInit"].pop()(); + } + } + + run(); + + // end include: postamble.js + + // include: postamble_modularize.js + // In MODULARIZE mode we wrap the generated code in a factory function + // and return either the Module itself, or a promise of the module. + // + // We assign to the `moduleRtn` global here and configure closure to see + // this as and extern so it won't get minified. + + moduleRtn = readyPromise; + + // Assertion for attempting to access module properties on the incoming + // moduleArg. In the past we used this object as the prototype of the module + // and assigned properties to it, but now we return a distinct object. This + // keeps the instance private until it is ready (i.e the promise has been + // resolved). + for (const prop of Object.keys(Module)) { + if (!(prop in moduleArg)) { + Object.defineProperty(moduleArg, prop, { + configurable: true, + get() { + abort( + `Access to module property ('${prop}') is no longer possible via the module constructor argument; Instead, use the result of the module constructor.`, + ); + }, + }); + } + } + // end include: postamble_modularize.js + + return moduleRtn; + }; +})(); +export default Module; |
