aboutsummaryrefslogtreecommitdiffhomepage
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/components/App.tsx72
-rw-r--r--src/components/FuncExpectedAnswer.tsx59
-rw-r--r--src/components/FuncMyAnswer.tsx32
-rw-r--r--src/components/QuizGroupSection.tsx19
-rw-r--r--src/components/QuizSection.tsx19
-rw-r--r--src/exec_php.ts95
-rw-r--r--src/main.tsx11
-rw-r--r--src/php-wasm-bridge.js8366
-rw-r--r--src/quiz.ts10
-rw-r--r--src/quiz_data.ts74
-rw-r--r--src/styles.css73
-rw-r--r--src/vite-env.d.ts1
12 files changed, 8831 insertions, 0 deletions
diff --git a/src/components/App.tsx b/src/components/App.tsx
new file mode 100644
index 0000000..aa2a386
--- /dev/null
+++ b/src/components/App.tsx
@@ -0,0 +1,72 @@
+import type { QuizGroup } from "../quiz";
+import QuizGroupSection from "./QuizGroupSection";
+
+type Props = {
+ quizGroups: QuizGroup[];
+};
+
+function App({ quizGroups }: Props) {
+ return (
+ <table id="layout">
+ <tr>
+ <td id="header" colSpan={2} className="marquee">
+ <span>PHPerKaigi 2025 デジタルサーカス株式会社トークン問題</span>
+ </td>
+ </tr>
+ <tr>
+ <td id="sidebar">
+ <h2>メニュー</h2>
+ <ul>
+ <li>
+ <a href="">ホーム</a>
+ </li>
+ <li>
+ <a
+ href="https://github.com/nsfisis/PHPerKaigi2024-tokens"
+ target="_blank"
+ >
+ トークン問題2024
+ </a>
+ </li>
+ <li>
+ <a
+ href="https://github.com/nsfisis/PHPerKaigi2023-tokens"
+ target="_blank"
+ >
+ トークン問題2023
+ </a>
+ </li>
+ <li>
+ <a
+ href="https://github.com/nsfisis/PHPerKaigi2022-tokens"
+ target="_blank"
+ >
+ トークン問題2022
+ </a>
+ </li>
+ <li className="hidden">ここにトークンはないよ</li>
+ </ul>
+ </td>
+ <td id="content">
+ <main>
+ <p>
+ PHPerKaigi 2025 の PHPer チャレンジ企画において、
+ <a href="https://www.dgcircus.com/">デジタルサーカス株式会社</a>
+ から出題するトークン問題です (作問{" "}
+ <a href="https://x.com/nsfisis">@nsfisis</a>)。
+ </p>
+ <p>
+ それぞれの問題に、PHP の標準関数がひとつ設定されています。
+ 好きな引数を渡すと実行されます。その実行結果を見て、何の関数かを当ててください。
+ </p>
+ {quizGroups.map((group) => (
+ <QuizGroupSection key={group.label} quizGroup={group} />
+ ))}
+ </main>
+ </td>
+ </tr>
+ </table>
+ );
+}
+
+export default App;
diff --git a/src/components/FuncExpectedAnswer.tsx b/src/components/FuncExpectedAnswer.tsx
new file mode 100644
index 0000000..f412ba5
--- /dev/null
+++ b/src/components/FuncExpectedAnswer.tsx
@@ -0,0 +1,59 @@
+import type { Quiz } from "../quiz";
+import { execPHP } from "../exec_php";
+import React, { useState, useEffect } from "react";
+import { useDebounce } from "use-debounce";
+
+type Props = {
+ quiz: Quiz;
+};
+
+function FuncExpectedAnswer({ quiz }: Props) {
+ const [argument, setArgument] = useState<string>("123");
+ const [debouncedArgument] = useDebounce(argument, 1000);
+ const [result, setResult] = useState<string>("");
+ const [loading, setLoading] = useState<boolean>(true);
+
+ const handleArgumentChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ setArgument(e.target.value);
+ };
+
+ useEffect(() => {
+ if (debouncedArgument === "") {
+ setResult("<empty>");
+ return;
+ }
+
+ setLoading(true);
+ setResult("");
+
+ const code = `
+ function f($x) {
+ return ${quiz.func}($x);
+ }
+ try {
+ var_dump(f(${debouncedArgument}));
+ } catch (\\Throwable $e) {
+ echo $e->getMessage(), PHP_EOL;
+ }
+ `;
+
+ execPHP(code).then((result) => {
+ const output = result.stdout + result.stderr;
+ setResult(output.replaceAll(quiz.func, "<answer is masked>"));
+ setLoading(false);
+ });
+ }, [debouncedArgument, quiz.func]);
+
+ return (
+ <div>
+ <code>
+ {`f(`}
+ <input type="text" value={argument} onChange={handleArgumentChange} />
+ {`)`}
+ </code>
+ は <code>{loading ? "running..." : result}</code> を返す。
+ </div>
+ );
+}
+
+export default FuncExpectedAnswer;
diff --git a/src/components/FuncMyAnswer.tsx b/src/components/FuncMyAnswer.tsx
new file mode 100644
index 0000000..63cd427
--- /dev/null
+++ b/src/components/FuncMyAnswer.tsx
@@ -0,0 +1,32 @@
+import type { Quiz } from "../quiz";
+import React, { useState } from "react";
+import { useDebounce } from "use-debounce";
+
+type Props = {
+ quiz: Quiz;
+};
+
+const INITIAL_ANSWER = "your_answer";
+
+function FuncMyAnswer({ quiz }: Props) {
+ const [answer, setAnswer] = useState<string>(INITIAL_ANSWER);
+ const [debouncedAnswer] = useDebounce(answer, 500);
+ const hasAnyAnswer = debouncedAnswer !== INITIAL_ANSWER;
+ const isCorrectAnswer = debouncedAnswer === quiz.func;
+
+ const handleAnswerChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ setAnswer(e.target.value);
+ };
+
+ return (
+ <div>
+ この関数は?
+ <input type="text" value={answer} onChange={handleAnswerChange} />
+ <p>
+ {hasAnyAnswer && (isCorrectAnswer ? `正解!${quiz.message}` : "不正解")}
+ </p>
+ </div>
+ );
+}
+
+export default FuncMyAnswer;
diff --git a/src/components/QuizGroupSection.tsx b/src/components/QuizGroupSection.tsx
new file mode 100644
index 0000000..b2bbee7
--- /dev/null
+++ b/src/components/QuizGroupSection.tsx
@@ -0,0 +1,19 @@
+import type { QuizGroup } from "../quiz";
+import QuizSection from "./QuizSection";
+
+type Props = {
+ quizGroup: QuizGroup;
+};
+
+function QuizGroupSection({ quizGroup }: Props) {
+ return (
+ <section>
+ <h2>{quizGroup.label}</h2>
+ {quizGroup.quizzes.map((quiz) => (
+ <QuizSection key={quiz.label} quiz={quiz} />
+ ))}
+ </section>
+ );
+}
+
+export default QuizGroupSection;
diff --git a/src/components/QuizSection.tsx b/src/components/QuizSection.tsx
new file mode 100644
index 0000000..27dc384
--- /dev/null
+++ b/src/components/QuizSection.tsx
@@ -0,0 +1,19 @@
+import type { Quiz } from "../quiz";
+import FuncExpectedAnswer from "./FuncExpectedAnswer";
+import FuncMyAnswer from "./FuncMyAnswer";
+
+type Props = {
+ quiz: Quiz;
+};
+
+function QuizSection({ quiz }: Props) {
+ return (
+ <section>
+ <h3>{quiz.label}</h3>
+ <FuncExpectedAnswer quiz={quiz} />
+ <FuncMyAnswer quiz={quiz} />
+ </section>
+ );
+}
+
+export default QuizSection;
diff --git a/src/exec_php.ts b/src/exec_php.ts
new file mode 100644
index 0000000..3c38cf4
--- /dev/null
+++ b/src/exec_php.ts
@@ -0,0 +1,95 @@
+import phpWasmBridgeUrl from "./php-wasm-bridge.js?url";
+
+export type PHPExecResult = {
+ success: boolean;
+ stdout: string;
+ stderr: string;
+};
+
+const BUFFER_MAX = 1024;
+
+let fetchingWasmBinaryPromise: Promise<ArrayBuffer> | null = null;
+
+// Fetching is performed only once.
+async function fetchWasmBinary(): Promise<ArrayBuffer> {
+ if (!fetchingWasmBinaryPromise) {
+ fetchingWasmBinaryPromise = new Promise((resolve, reject) => {
+ fetch("/php-wasm.wasm")
+ .then((res) => {
+ if (!res.ok) {
+ reject(`Failed to fetch wasm binary: ${res.status} (${res.url})`);
+ }
+ return res;
+ })
+ .then((res) => res.arrayBuffer())
+ .then((buf) => resolve(buf));
+ });
+ }
+ return fetchingWasmBinaryPromise;
+}
+
+export async function execPHP(code: string): Promise<PHPExecResult> {
+ let stdinPos = 0; // bytewise
+ const stdinBuf = new TextEncoder().encode(code);
+ let stdoutPos = 0; // bytewise
+ const stdoutBuf = new Uint8Array(BUFFER_MAX);
+ let stderrPos = 0; // bytewise
+ const stderrBuf = new Uint8Array(BUFFER_MAX);
+
+ const { default: PHPWasm } = await import(
+ /* @vite-ignore */ phpWasmBridgeUrl
+ );
+ const { ccall } = await PHPWasm({
+ wasmBinary: await fetchWasmBinary(),
+ stdin: () => {
+ if (stdinBuf.length <= stdinPos) {
+ return null;
+ }
+ return stdinBuf[stdinPos++];
+ },
+ stdout: (asciiCode: number | null) => {
+ if (asciiCode === null) {
+ return; // flush
+ }
+ if (BUFFER_MAX <= stdoutPos) {
+ return; // ignore
+ }
+ if (asciiCode < 0) {
+ asciiCode += 256;
+ }
+ stdoutBuf[stdoutPos++] = asciiCode;
+ },
+ stderr: (asciiCode: number | null) => {
+ if (asciiCode === null) {
+ return; // flush
+ }
+ if (BUFFER_MAX <= stderrPos) {
+ return; // ignore
+ }
+ if (asciiCode < 0) {
+ asciiCode += 256;
+ }
+ stderrBuf[stderrPos++] = asciiCode;
+ },
+ });
+
+ let result;
+ let extraError = null;
+ try {
+ result = ccall("php_wasm_run", "number", ["string"], [code]);
+ } catch (e) {
+ if (e instanceof WebAssembly.RuntimeError) {
+ extraError = e.message;
+ } else {
+ throw e;
+ }
+ }
+ const stdout = new TextDecoder().decode(stdoutBuf.subarray(0, stdoutPos));
+ const stderr = new TextDecoder().decode(stderrBuf.subarray(0, stderrPos));
+
+ return {
+ success: result === 0,
+ stdout,
+ stderr: extraError == null ? stderr : `${stderr}\n${extraError}`,
+ };
+}
diff --git a/src/main.tsx b/src/main.tsx
new file mode 100644
index 0000000..6e65eda
--- /dev/null
+++ b/src/main.tsx
@@ -0,0 +1,11 @@
+import { StrictMode } from "react";
+import { createRoot } from "react-dom/client";
+import App from "./components/App.tsx";
+import { QUIZ_GROUPS } from "./quiz_data";
+import "./styles.css";
+
+createRoot(document.getElementById("root")!).render(
+ <StrictMode>
+ <App quizGroups={QUIZ_GROUPS} />
+ </StrictMode>,
+);
diff --git a/src/php-wasm-bridge.js b/src/php-wasm-bridge.js
new file mode 100644
index 0000000..fbf574b
--- /dev/null
+++ b/src/php-wasm-bridge.js
@@ -0,0 +1,8366 @@
+var Module = (() => {
+ var _scriptName = import.meta.url;
+
+ return function (moduleArg = {}) {
+ var moduleRtn;
+
+ // include: shell.js
+ // The Module object: Our interface to the outside world. We import
+ // and export values on it. There are various ways Module can be used:
+ // 1. Not defined. We create it here
+ // 2. A function parameter, function(moduleArg) => Promise<Module>
+ // 3. pre-run appended it, var Module = {}; ..generated code..
+ // 4. External script tag defines var Module.
+ // We need to check if Module already exists (e.g. case 3 above).
+ // Substitution will be replaced with actual code on later stage of the build,
+ // this way Closure Compiler will not mangle it (e.g. case 4. above).
+ // Note that if you want to run closure, and also to use Module
+ // after the generated code, you will need to define var Module = {};
+ // before the code. Then that object will be used in the code, and you
+ // can continue to use Module afterwards as well.
+ var Module = moduleArg;
+
+ // Set up the promise that indicates the Module is initialized
+ var readyPromiseResolve, readyPromiseReject;
+ var readyPromise = new Promise((resolve, reject) => {
+ readyPromiseResolve = resolve;
+ readyPromiseReject = reject;
+ });
+ [
+ "_memory",
+ "_php_wasm_run",
+ "___indirect_function_table",
+ "onRuntimeInitialized",
+ ].forEach((prop) => {
+ if (!Object.getOwnPropertyDescriptor(readyPromise, prop)) {
+ Object.defineProperty(readyPromise, prop, {
+ get: () =>
+ abort(
+ "You are getting " +
+ prop +
+ " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js",
+ ),
+ set: () =>
+ abort(
+ "You are setting " +
+ prop +
+ " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js",
+ ),
+ });
+ }
+ });
+
+ // Determine the runtime environment we are in. You can customize this by
+ // setting the ENVIRONMENT setting at compile time (see settings.js).
+
+ var ENVIRONMENT_IS_WEB = true;
+ var ENVIRONMENT_IS_WORKER = false;
+ var ENVIRONMENT_IS_NODE = false;
+ var ENVIRONMENT_IS_SHELL = false;
+
+ // --pre-jses are emitted after the Module integration code, so that they can
+ // refer to Module (if they choose; they can also define Module)
+
+ // Sometimes an existing Module object exists with properties
+ // meant to overwrite the default module functionality. Here
+ // we collect those properties and reapply _after_ we configure
+ // the current environment's defaults to avoid having to be so
+ // defensive during initialization.
+ var moduleOverrides = Object.assign({}, Module);
+
+ var arguments_ = [];
+ var thisProgram = "./this.program";
+ var quit_ = (status, toThrow) => {
+ throw toThrow;
+ };
+
+ // `/` should be present at the end if `scriptDirectory` is not empty
+ var scriptDirectory = "";
+ function locateFile(path) {
+ if (Module["locateFile"]) {
+ return Module["locateFile"](path, scriptDirectory);
+ }
+ return scriptDirectory + path;
+ }
+
+ // Hooks that are implemented differently in different runtime environments.
+ var readAsync, readBinary;
+
+ if (ENVIRONMENT_IS_SHELL) {
+ if (
+ (typeof process == "object" && typeof require === "function") ||
+ typeof window == "object" ||
+ typeof WorkerGlobalScope != "undefined"
+ )
+ throw new Error(
+ "not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)",
+ );
+ }
+
+ // Note that this includes Node.js workers when relevant (pthreads is enabled).
+ // Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
+ // ENVIRONMENT_IS_NODE.
+ else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WORKER) {
+ // Check worker, not web, since window could be polyfilled
+ scriptDirectory = self.location.href;
+ } else if (typeof document != "undefined" && document.currentScript) {
+ // web
+ scriptDirectory = document.currentScript.src;
+ }
+ // When MODULARIZE, this JS may be executed later, after document.currentScript
+ // is gone, so we saved it, and we use it here instead of any other info.
+ if (_scriptName) {
+ scriptDirectory = _scriptName;
+ }
+ // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+ // otherwise, slice off the final part of the url to find the script directory.
+ // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+ // and scriptDirectory will correctly be replaced with an empty string.
+ // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #),
+ // they are removed because they could contain a slash.
+ if (scriptDirectory.startsWith("blob:")) {
+ scriptDirectory = "";
+ } else {
+ scriptDirectory = scriptDirectory.substr(
+ 0,
+ scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1,
+ );
+ }
+
+ if (
+ !(typeof window == "object" || typeof WorkerGlobalScope != "undefined")
+ )
+ throw new Error(
+ "not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)",
+ );
+
+ {
+ // include: web_or_worker_shell_read.js
+ readAsync = async (url) => {
+ assert(!isFileURI(url), "readAsync does not work with file:// URLs");
+ var response = await fetch(url, { credentials: "same-origin" });
+ if (response.ok) {
+ return response.arrayBuffer();
+ }
+ throw new Error(response.status + " : " + response.url);
+ };
+ // end include: web_or_worker_shell_read.js
+ }
+ } else {
+ throw new Error("environment detection error");
+ }
+
+ var out = Module["print"] || console.log.bind(console);
+ var err = Module["printErr"] || console.error.bind(console);
+
+ // Merge back in the overrides
+ Object.assign(Module, moduleOverrides);
+ // Free the object hierarchy contained in the overrides, this lets the GC
+ // reclaim data used.
+ moduleOverrides = null;
+ checkIncomingModuleAPI();
+
+ // Emit code to handle expected values on the Module object. This applies Module.x
+ // to the proper local x. This has two benefits: first, we only emit it if it is
+ // expected to arrive, and second, by using a local everywhere else that can be
+ // minified.
+
+ if (Module["arguments"]) arguments_ = Module["arguments"];
+ legacyModuleProp("arguments", "arguments_");
+
+ if (Module["thisProgram"]) thisProgram = Module["thisProgram"];
+ legacyModuleProp("thisProgram", "thisProgram");
+
+ // perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+ // Assertions on removed incoming Module JS APIs.
+ assert(
+ typeof Module["memoryInitializerPrefixURL"] == "undefined",
+ "Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead",
+ );
+ assert(
+ typeof Module["pthreadMainPrefixURL"] == "undefined",
+ "Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead",
+ );
+ assert(
+ typeof Module["cdInitializerPrefixURL"] == "undefined",
+ "Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead",
+ );
+ assert(
+ typeof Module["filePackagePrefixURL"] == "undefined",
+ "Module.filePackagePrefixURL option was removed, use Module.locateFile instead",
+ );
+ assert(
+ typeof Module["read"] == "undefined",
+ "Module.read option was removed",
+ );
+ assert(
+ typeof Module["readAsync"] == "undefined",
+ "Module.readAsync option was removed (modify readAsync in JS)",
+ );
+ assert(
+ typeof Module["readBinary"] == "undefined",
+ "Module.readBinary option was removed (modify readBinary in JS)",
+ );
+ assert(
+ typeof Module["setWindowTitle"] == "undefined",
+ "Module.setWindowTitle option was removed (modify emscripten_set_window_title in JS)",
+ );
+ assert(
+ typeof Module["TOTAL_MEMORY"] == "undefined",
+ "Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY",
+ );
+ legacyModuleProp("asm", "wasmExports");
+ legacyModuleProp("readAsync", "readAsync");
+ legacyModuleProp("readBinary", "readBinary");
+ legacyModuleProp("setWindowTitle", "setWindowTitle");
+ var IDBFS = "IDBFS is no longer included by default; build with -lidbfs.js";
+ var PROXYFS =
+ "PROXYFS is no longer included by default; build with -lproxyfs.js";
+ var WORKERFS =
+ "WORKERFS is no longer included by default; build with -lworkerfs.js";
+ var FETCHFS =
+ "FETCHFS is no longer included by default; build with -lfetchfs.js";
+ var ICASEFS =
+ "ICASEFS is no longer included by default; build with -licasefs.js";
+ var JSFILEFS =
+ "JSFILEFS is no longer included by default; build with -ljsfilefs.js";
+ var OPFS = "OPFS is no longer included by default; build with -lopfs.js";
+
+ var NODEFS =
+ "NODEFS is no longer included by default; build with -lnodefs.js";
+
+ assert(
+ !ENVIRONMENT_IS_WORKER,
+ "worker environment detected but not enabled at build time. Add `worker` to `-sENVIRONMENT` to enable.",
+ );
+
+ assert(
+ !ENVIRONMENT_IS_NODE,
+ "node environment detected but not enabled at build time. Add `node` to `-sENVIRONMENT` to enable.",
+ );
+
+ assert(
+ !ENVIRONMENT_IS_SHELL,
+ "shell environment detected but not enabled at build time. Add `shell` to `-sENVIRONMENT` to enable.",
+ );
+
+ // end include: shell.js
+
+ // include: preamble.js
+ // === Preamble library stuff ===
+
+ // Documentation for the public APIs defined in this file must be updated in:
+ // site/source/docs/api_reference/preamble.js.rst
+ // A prebuilt local version of the documentation is available at:
+ // site/build/text/docs/api_reference/preamble.js.txt
+ // You can also build docs locally as HTML or other formats in site/
+ // An online HTML version (which may be of a different version of Emscripten)
+ // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+ var wasmBinary = Module["wasmBinary"];
+ legacyModuleProp("wasmBinary", "wasmBinary");
+
+ if (typeof WebAssembly != "object") {
+ err("no native wasm support detected");
+ }
+
+ // Wasm globals
+
+ var wasmMemory;
+
+ //========================================
+ // Runtime essentials
+ //========================================
+
+ // whether we are quitting the application. no code should run after this.
+ // set in exit() and abort()
+ var ABORT = false;
+
+ // set by exit() and abort(). Passed to 'onExit' handler.
+ // NOTE: This is also used as the process return code code in shell environments
+ // but only when noExitRuntime is false.
+ var EXITSTATUS;
+
+ // In STRICT mode, we only define assert() when ASSERTIONS is set. i.e. we
+ // don't define it at all in release modes. This matches the behaviour of
+ // MINIMAL_RUNTIME.
+ // TODO(sbc): Make this the default even without STRICT enabled.
+ /** @type {function(*, string=)} */
+ function assert(condition, text) {
+ if (!condition) {
+ abort("Assertion failed" + (text ? ": " + text : ""));
+ }
+ }
+
+ // We used to include malloc/free by default in the past. Show a helpful error in
+ // builds with assertions.
+ function _free() {
+ // Show a helpful error since we used to include free by default in the past.
+ abort(
+ "free() called but not included in the build - add `_free` to EXPORTED_FUNCTIONS",
+ );
+ }
+
+ // Memory management
+
+ var HEAP,
+ /** @type {!Int8Array} */
+ HEAP8,
+ /** @type {!Uint8Array} */
+ HEAPU8,
+ /** @type {!Int16Array} */
+ HEAP16,
+ /** @type {!Uint16Array} */
+ HEAPU16,
+ /** @type {!Int32Array} */
+ HEAP32,
+ /** @type {!Uint32Array} */
+ HEAPU32,
+ /** @type {!Float32Array} */
+ HEAPF32,
+ /** @type {!Float64Array} */
+ HEAPF64;
+
+ // include: runtime_shared.js
+ function updateMemoryViews() {
+ var b = wasmMemory.buffer;
+ Module["HEAP8"] = HEAP8 = new Int8Array(b);
+ Module["HEAP16"] = HEAP16 = new Int16Array(b);
+ Module["HEAPU8"] = HEAPU8 = new Uint8Array(b);
+ Module["HEAPU16"] = HEAPU16 = new Uint16Array(b);
+ Module["HEAP32"] = HEAP32 = new Int32Array(b);
+ Module["HEAPU32"] = HEAPU32 = new Uint32Array(b);
+ Module["HEAPF32"] = HEAPF32 = new Float32Array(b);
+ Module["HEAPF64"] = HEAPF64 = new Float64Array(b);
+ }
+
+ // end include: runtime_shared.js
+ assert(
+ !Module["STACK_SIZE"],
+ "STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time",
+ );
+
+ assert(
+ typeof Int32Array != "undefined" &&
+ typeof Float64Array !== "undefined" &&
+ Int32Array.prototype.subarray != undefined &&
+ Int32Array.prototype.set != undefined,
+ "JS engine does not provide full typed array support",
+ );
+
+ // If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY
+ assert(
+ !Module["wasmMemory"],
+ "Use of `wasmMemory` detected. Use -sIMPORTED_MEMORY to define wasmMemory externally",
+ );
+ assert(
+ !Module["INITIAL_MEMORY"],
+ "Detected runtime INITIAL_MEMORY setting. Use -sIMPORTED_MEMORY to define wasmMemory dynamically",
+ );
+
+ // include: runtime_stack_check.js
+ // Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+ function writeStackCookie() {
+ var max = _emscripten_stack_get_end();
+ assert((max & 3) == 0);
+ // If the stack ends at address zero we write our cookies 4 bytes into the
+ // stack. This prevents interference with SAFE_HEAP and ASAN which also
+ // monitor writes to address zero.
+ if (max == 0) {
+ max += 4;
+ }
+ // The stack grow downwards towards _emscripten_stack_get_end.
+ // We write cookies to the final two words in the stack and detect if they are
+ // ever overwritten.
+ HEAPU32[max >> 2] = 0x02135467;
+ HEAPU32[(max + 4) >> 2] = 0x89bacdfe;
+ // Also test the global address 0 for integrity.
+ HEAPU32[0 >> 2] = 1668509029;
+ }
+
+ function checkStackCookie() {
+ if (ABORT) return;
+ var max = _emscripten_stack_get_end();
+ // See writeStackCookie().
+ if (max == 0) {
+ max += 4;
+ }
+ var cookie1 = HEAPU32[max >> 2];
+ var cookie2 = HEAPU32[(max + 4) >> 2];
+ if (cookie1 != 0x02135467 || cookie2 != 0x89bacdfe) {
+ abort(
+ `Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`,
+ );
+ }
+ // Also test the global address 0 for integrity.
+ if (HEAPU32[0 >> 2] != 0x63736d65 /* 'emsc' */) {
+ abort(
+ "Runtime error: The application has corrupted its heap memory area (address zero)!",
+ );
+ }
+ }
+ // end include: runtime_stack_check.js
+ var __ATPRERUN__ = []; // functions called before the runtime is initialized
+ var __ATINIT__ = []; // functions called during startup
+ var __ATEXIT__ = []; // functions called during shutdown
+ var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+ var runtimeInitialized = false;
+
+ function preRun() {
+ if (Module["preRun"]) {
+ if (typeof Module["preRun"] == "function")
+ Module["preRun"] = [Module["preRun"]];
+ while (Module["preRun"].length) {
+ addOnPreRun(Module["preRun"].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+ }
+
+ function initRuntime() {
+ assert(!runtimeInitialized);
+ runtimeInitialized = true;
+
+ checkStackCookie();
+
+ if (!Module["noFSInit"] && !FS.initialized) FS.init();
+ FS.ignorePermissions = false;
+
+ TTY.init();
+ SOCKFS.root = FS.mount(SOCKFS, {}, null);
+ PIPEFS.root = FS.mount(PIPEFS, {}, null);
+ callRuntimeCallbacks(__ATINIT__);
+ }
+
+ function postRun() {
+ checkStackCookie();
+
+ if (Module["postRun"]) {
+ if (typeof Module["postRun"] == "function")
+ Module["postRun"] = [Module["postRun"]];
+ while (Module["postRun"].length) {
+ addOnPostRun(Module["postRun"].shift());
+ }
+ }
+
+ callRuntimeCallbacks(__ATPOSTRUN__);
+ }
+
+ function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+ }
+
+ function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+ }
+
+ function addOnExit(cb) {}
+
+ function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+ }
+
+ // include: runtime_math.js
+ // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
+
+ // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
+
+ // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
+
+ // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
+
+ assert(
+ Math.imul,
+ "This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill",
+ );
+ assert(
+ Math.fround,
+ "This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill",
+ );
+ assert(
+ Math.clz32,
+ "This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill",
+ );
+ assert(
+ Math.trunc,
+ "This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill",
+ );
+ // end include: runtime_math.js
+ // A counter of dependencies for calling run(). If we need to
+ // do asynchronous work before running, increment this and
+ // decrement it. Incrementing must happen in a place like
+ // Module.preRun (used by emcc to add file preloading).
+ // Note that you can add dependencies in preRun, even though
+ // it happens right before run - run will be postponed until
+ // the dependencies are met.
+ var runDependencies = 0;
+ var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+ var runDependencyTracking = {};
+ var runDependencyWatcher = null;
+
+ function getUniqueRunDependency(id) {
+ var orig = id;
+ while (1) {
+ if (!runDependencyTracking[id]) return id;
+ id = orig + Math.random();
+ }
+ }
+
+ function addRunDependency(id) {
+ runDependencies++;
+
+ Module["monitorRunDependencies"]?.(runDependencies);
+
+ if (id) {
+ assert(!runDependencyTracking[id]);
+ runDependencyTracking[id] = 1;
+ if (
+ runDependencyWatcher === null &&
+ typeof setInterval != "undefined"
+ ) {
+ // Check for missing dependencies every few seconds
+ runDependencyWatcher = setInterval(() => {
+ if (ABORT) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ return;
+ }
+ var shown = false;
+ for (var dep in runDependencyTracking) {
+ if (!shown) {
+ shown = true;
+ err("still waiting on run dependencies:");
+ }
+ err(`dependency: ${dep}`);
+ }
+ if (shown) {
+ err("(end of list)");
+ }
+ }, 10000);
+ }
+ } else {
+ err("warning: run dependency added without ID");
+ }
+ }
+
+ function removeRunDependency(id) {
+ runDependencies--;
+
+ Module["monitorRunDependencies"]?.(runDependencies);
+
+ if (id) {
+ assert(runDependencyTracking[id]);
+ delete runDependencyTracking[id];
+ } else {
+ err("warning: run dependency removed without ID");
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+ }
+
+ /** @param {string|number=} what */
+ function abort(what) {
+ Module["onAbort"]?.(what);
+
+ what = "Aborted(" + what + ")";
+ // TODO(sbc): Should we remove printing and leave it up to whoever
+ // catches the exception?
+ err(what);
+
+ ABORT = true;
+
+ // Use a wasm runtime error, because a JS error might be seen as a foreign
+ // exception, which means we'd run destructors on it. We need the error to
+ // simply make the program stop.
+ // FIXME This approach does not work in Wasm EH because it currently does not assume
+ // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
+ // a trap or not based on a hidden field within the object. So at the moment
+ // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
+ // allows this in the wasm spec.
+
+ // Suppress closure compiler warning here. Closure compiler's builtin extern
+ // definition for WebAssembly.RuntimeError claims it takes no arguments even
+ // though it can.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
+ /** @suppress {checkTypes} */
+ var e = new WebAssembly.RuntimeError(what);
+
+ readyPromiseReject(e);
+ // Throw the error whether or not MODULARIZE is set because abort is used
+ // in code paths apart from instantiation where an exception is expected
+ // to be thrown when abort is called.
+ throw e;
+ }
+
+ // include: memoryprofiler.js
+ // end include: memoryprofiler.js
+ // include: URIUtils.js
+ // Prefix of data URIs emitted by SINGLE_FILE and related options.
+ var dataURIPrefix = "data:application/octet-stream;base64,";
+
+ /**
+ * Indicates whether filename is a base64 data URI.
+ * @noinline
+ */
+ var isDataURI = (filename) => filename.startsWith(dataURIPrefix);
+
+ /**
+ * Indicates whether filename is delivered via file protocol (as opposed to http/https)
+ * @noinline
+ */
+ var isFileURI = (filename) => filename.startsWith("file://");
+ // end include: URIUtils.js
+ function createExportWrapper(name, nargs) {
+ return (...args) => {
+ assert(
+ runtimeInitialized,
+ `native function \`${name}\` called before runtime initialization`,
+ );
+ var f = wasmExports[name];
+ assert(f, `exported native function \`${name}\` not found`);
+ // Only assert for too many arguments. Too few can be valid since the missing arguments will be zero filled.
+ assert(
+ args.length <= nargs,
+ `native function \`${name}\` called with ${args.length} args but expects ${nargs}`,
+ );
+ return f(...args);
+ };
+ }
+
+ // include: runtime_exceptions.js
+ // end include: runtime_exceptions.js
+ function findWasmBinary() {
+ if (Module["locateFile"]) {
+ var f = "php-wasm.wasm";
+ if (!isDataURI(f)) {
+ return locateFile(f);
+ }
+ return f;
+ }
+ // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too.
+ return new URL("php-wasm.wasm", import.meta.url).href;
+ }
+
+ var wasmBinaryFile;
+
+ function getBinarySync(file) {
+ if (file == wasmBinaryFile && wasmBinary) {
+ return new Uint8Array(wasmBinary);
+ }
+ if (readBinary) {
+ return readBinary(file);
+ }
+ throw "both async and sync fetching of the wasm failed";
+ }
+
+ async function getWasmBinary(binaryFile) {
+ // If we don't have the binary yet, load it asynchronously using readAsync.
+ if (!wasmBinary) {
+ // Fetch the binary using readAsync
+ try {
+ var response = await readAsync(binaryFile);
+ return new Uint8Array(response);
+ } catch {
+ // Fall back to getBinarySync below;
+ }
+ }
+
+ // Otherwise, getBinarySync should be able to get it synchronously
+ return getBinarySync(binaryFile);
+ }
+
+ async function instantiateArrayBuffer(binaryFile, imports) {
+ try {
+ var binary = await getWasmBinary(binaryFile);
+ var instance = await WebAssembly.instantiate(binary, imports);
+ return instance;
+ } catch (reason) {
+ err(`failed to asynchronously prepare wasm: ${reason}`);
+
+ // Warn on some common problems.
+ if (isFileURI(wasmBinaryFile)) {
+ err(
+ `warning: Loading from a file URI (${wasmBinaryFile}) is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing`,
+ );
+ }
+ abort(reason);
+ }
+ }
+
+ async function instantiateAsync(binary, binaryFile, imports) {
+ if (
+ !binary &&
+ typeof WebAssembly.instantiateStreaming == "function" &&
+ !isDataURI(binaryFile) &&
+ typeof fetch == "function"
+ ) {
+ try {
+ var response = fetch(binaryFile, { credentials: "same-origin" });
+ var instantiationResult = await WebAssembly.instantiateStreaming(
+ response,
+ imports,
+ );
+ return instantiationResult;
+ } catch (reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err(`wasm streaming compile failed: ${reason}`);
+ err("falling back to ArrayBuffer instantiation");
+ // fall back of instantiateArrayBuffer below
+ }
+ }
+ return instantiateArrayBuffer(binaryFile, imports);
+ }
+
+ function getWasmImports() {
+ // prepare imports
+ return {
+ env: wasmImports,
+ wasi_snapshot_preview1: wasmImports,
+ };
+ }
+
+ // Create the wasm instance.
+ // Receives the wasm imports, returns the exports.
+ async function createWasm() {
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ /** @param {WebAssembly.Module=} module*/
+ function receiveInstance(instance, module) {
+ wasmExports = instance.exports;
+
+ wasmMemory = wasmExports["memory"];
+
+ assert(wasmMemory, "memory not found in wasm exports");
+ updateMemoryViews();
+
+ wasmTable = wasmExports["__indirect_function_table"];
+
+ assert(wasmTable, "table not found in wasm exports");
+
+ addOnInit(wasmExports["__wasm_call_ctors"]);
+
+ removeRunDependency("wasm-instantiate");
+ return wasmExports;
+ }
+ // wait for the pthread pool (if any)
+ addRunDependency("wasm-instantiate");
+
+ // Prefer streaming instantiation if available.
+ // Async compilation can be confusing when an error on the page overwrites Module
+ // (for example, if the order of elements is wrong, and the one defining Module is
+ // later), so we save Module and check it later.
+ var trueModule = Module;
+ function receiveInstantiationResult(result) {
+ // 'result' is a ResultObject object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ assert(
+ Module === trueModule,
+ "the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?",
+ );
+ trueModule = null;
+ // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
+ // When the regression is fixed, can restore the above PTHREADS-enabled path.
+ receiveInstance(result["instance"]);
+ }
+
+ var info = getWasmImports();
+
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to
+ // run the instantiation parallel to any other async startup actions they are
+ // performing.
+ // Also pthreads and wasm workers initialize the wasm instance through this
+ // path.
+ if (Module["instantiateWasm"]) {
+ try {
+ return Module["instantiateWasm"](info, receiveInstance);
+ } catch (e) {
+ err(`Module.instantiateWasm callback failed with error: ${e}`);
+ // If instantiation fails, reject the module ready promise.
+ readyPromiseReject(e);
+ }
+ }
+
+ wasmBinaryFile ??= findWasmBinary();
+
+ try {
+ var result = await instantiateAsync(wasmBinary, wasmBinaryFile, info);
+ receiveInstantiationResult(result);
+ return result;
+ } catch (e) {
+ // If instantiation fails, reject the module ready promise.
+ readyPromiseReject(e);
+ return;
+ }
+ }
+
+ // Globals used by JS i64 conversions (see makeSetValue)
+ var tempDouble;
+ var tempI64;
+
+ // include: runtime_debug.js
+ // Endianness check
+ (() => {
+ var h16 = new Int16Array(1);
+ var h8 = new Int8Array(h16.buffer);
+ h16[0] = 0x6373;
+ if (h8[0] !== 0x73 || h8[1] !== 0x63)
+ throw "Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)";
+ })();
+
+ if (Module["ENVIRONMENT"]) {
+ throw new Error(
+ "Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)",
+ );
+ }
+
+ function legacyModuleProp(prop, newName, incoming = true) {
+ if (!Object.getOwnPropertyDescriptor(Module, prop)) {
+ Object.defineProperty(Module, prop, {
+ configurable: true,
+ get() {
+ let extra = incoming
+ ? " (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)"
+ : "";
+ abort(
+ `\`Module.${prop}\` has been replaced by \`${newName}\`` + extra,
+ );
+ },
+ });
+ }
+ }
+
+ function ignoredModuleProp(prop) {
+ if (Object.getOwnPropertyDescriptor(Module, prop)) {
+ abort(
+ `\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`,
+ );
+ }
+ }
+
+ // forcing the filesystem exports a few things by default
+ function isExportedByForceFilesystem(name) {
+ return (
+ name === "FS_createPath" ||
+ name === "FS_createDataFile" ||
+ name === "FS_createPreloadedFile" ||
+ name === "FS_unlink" ||
+ name === "addRunDependency" ||
+ // The old FS has some functionality that WasmFS lacks.
+ name === "FS_createLazyFile" ||
+ name === "FS_createDevice" ||
+ name === "removeRunDependency"
+ );
+ }
+
+ /**
+ * Intercept access to a global symbol. This enables us to give informative
+ * warnings/errors when folks attempt to use symbols they did not include in
+ * their build, or no symbols that no longer exist.
+ */
+ function hookGlobalSymbolAccess(sym, func) {
+ if (
+ typeof globalThis != "undefined" &&
+ !Object.getOwnPropertyDescriptor(globalThis, sym)
+ ) {
+ Object.defineProperty(globalThis, sym, {
+ configurable: true,
+ get() {
+ func();
+ return undefined;
+ },
+ });
+ }
+ }
+
+ function missingGlobal(sym, msg) {
+ hookGlobalSymbolAccess(sym, () => {
+ warnOnce(`\`${sym}\` is not longer defined by emscripten. ${msg}`);
+ });
+ }
+
+ missingGlobal("buffer", "Please use HEAP8.buffer or wasmMemory.buffer");
+ missingGlobal("asm", "Please use wasmExports instead");
+
+ function missingLibrarySymbol(sym) {
+ hookGlobalSymbolAccess(sym, () => {
+ // Can't `abort()` here because it would break code that does runtime
+ // checks. e.g. `if (typeof SDL === 'undefined')`.
+ var msg = `\`${sym}\` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line`;
+ // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in
+ // library.js, which means $name for a JS name with no prefix, or name
+ // for a JS name like _name.
+ var librarySymbol = sym;
+ if (!librarySymbol.startsWith("_")) {
+ librarySymbol = "$" + sym;
+ }
+ msg += ` (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='${librarySymbol}')`;
+ if (isExportedByForceFilesystem(sym)) {
+ msg +=
+ ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you";
+ }
+ warnOnce(msg);
+ });
+
+ // Any symbol that is not included from the JS library is also (by definition)
+ // not exported on the Module object.
+ unexportedRuntimeSymbol(sym);
+ }
+
+ function unexportedRuntimeSymbol(sym) {
+ if (!Object.getOwnPropertyDescriptor(Module, sym)) {
+ Object.defineProperty(Module, sym, {
+ configurable: true,
+ get() {
+ var msg = `'${sym}' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)`;
+ if (isExportedByForceFilesystem(sym)) {
+ msg +=
+ ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you";
+ }
+ abort(msg);
+ },
+ });
+ }
+ }
+
+ // Used by XXXXX_DEBUG settings to output debug messages.
+ function dbg(...args) {
+ // TODO(sbc): Make this configurable somehow. Its not always convenient for
+ // logging to show up as warnings.
+ console.warn(...args);
+ }
+ // end include: runtime_debug.js
+ // === Body ===
+ // end include: preamble.js
+
+ class ExitStatus {
+ name = "ExitStatus";
+ constructor(status) {
+ this.message = `Program terminated with exit(${status})`;
+ this.status = status;
+ }
+ }
+
+ var callRuntimeCallbacks = (callbacks) => {
+ while (callbacks.length > 0) {
+ // Pass the module as the first argument.
+ callbacks.shift()(Module);
+ }
+ };
+
+ /**
+ * @param {number} ptr
+ * @param {string} type
+ */
+ function getValue(ptr, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ return HEAP8[ptr];
+ case "i8":
+ return HEAP8[ptr];
+ case "i16":
+ return HEAP16[ptr >> 1];
+ case "i32":
+ return HEAP32[ptr >> 2];
+ case "i64":
+ abort("to do getValue(i64) use WASM_BIGINT");
+ case "float":
+ return HEAPF32[ptr >> 2];
+ case "double":
+ return HEAPF64[ptr >> 3];
+ case "*":
+ return HEAPU32[ptr >> 2];
+ default:
+ abort(`invalid type for getValue: ${type}`);
+ }
+ }
+
+ var noExitRuntime = Module["noExitRuntime"] || true;
+
+ var ptrToString = (ptr) => {
+ assert(typeof ptr === "number");
+ // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+ ptr >>>= 0;
+ return "0x" + ptr.toString(16).padStart(8, "0");
+ };
+
+ /**
+ * @param {number} ptr
+ * @param {number} value
+ * @param {string} type
+ */
+ function setValue(ptr, value, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ HEAP8[ptr] = value;
+ break;
+ case "i8":
+ HEAP8[ptr] = value;
+ break;
+ case "i16":
+ HEAP16[ptr >> 1] = value;
+ break;
+ case "i32":
+ HEAP32[ptr >> 2] = value;
+ break;
+ case "i64":
+ abort("to do setValue(i64) use WASM_BIGINT");
+ case "float":
+ HEAPF32[ptr >> 2] = value;
+ break;
+ case "double":
+ HEAPF64[ptr >> 3] = value;
+ break;
+ case "*":
+ HEAPU32[ptr >> 2] = value;
+ break;
+ default:
+ abort(`invalid type for setValue: ${type}`);
+ }
+ }
+
+ var stackRestore = (val) => __emscripten_stack_restore(val);
+
+ var stackSave = () => _emscripten_stack_get_current();
+
+ var warnOnce = (text) => {
+ warnOnce.shown ||= {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ err(text);
+ }
+ };
+
+ var UTF8Decoder =
+ typeof TextDecoder != "undefined" ? new TextDecoder() : undefined;
+
+ /**
+ * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
+ * array that contains uint8 values, returns a copy of that string as a
+ * Javascript String object.
+ * heapOrArray is either a regular array, or a JavaScript typed array view.
+ * @param {number=} idx
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+ var UTF8ArrayToString = (heapOrArray, idx = 0, maxBytesToRead = NaN) => {
+ var endIdx = idx + maxBytesToRead;
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on
+ // null terminator by itself. Also, use the length info to avoid running tiny
+ // strings through TextDecoder, since .subarray() allocates garbage.
+ // (As a tiny code save trick, compare endPtr against endIdx using a negation,
+ // so that undefined/NaN means Infinity)
+ while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+
+ if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+ return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
+ }
+ var str = "";
+ // If building with TextDecoder, we have already computed the string length
+ // above, so test loop end condition against that
+ while (idx < endPtr) {
+ // For UTF8 byte structure, see:
+ // http://en.wikipedia.org/wiki/UTF-8#Description
+ // https://www.ietf.org/rfc/rfc2279.txt
+ // https://tools.ietf.org/html/rfc3629
+ var u0 = heapOrArray[idx++];
+ if (!(u0 & 0x80)) {
+ str += String.fromCharCode(u0);
+ continue;
+ }
+ var u1 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xe0) == 0xc0) {
+ str += String.fromCharCode(((u0 & 31) << 6) | u1);
+ continue;
+ }
+ var u2 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xf0) == 0xe0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ if ((u0 & 0xf8) != 0xf0)
+ warnOnce(
+ "Invalid UTF-8 leading byte " +
+ ptrToString(u0) +
+ " encountered when deserializing a UTF-8 string in wasm memory to a JS string!",
+ );
+ u0 =
+ ((u0 & 7) << 18) |
+ (u1 << 12) |
+ (u2 << 6) |
+ (heapOrArray[idx++] & 63);
+ }
+
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(
+ 0xd800 | (ch >> 10),
+ 0xdc00 | (ch & 0x3ff),
+ );
+ }
+ }
+ return str;
+ };
+
+ /**
+ * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
+ * emscripten HEAP, returns a copy of that string as a Javascript String object.
+ *
+ * @param {number} ptr
+ * @param {number=} maxBytesToRead - An optional length that specifies the
+ * maximum number of bytes to read. You can omit this parameter to scan the
+ * string until the first 0 byte. If maxBytesToRead is passed, and the string
+ * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
+ * string will cut short at that byte index (i.e. maxBytesToRead will not
+ * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
+ * frequent uses of UTF8ToString() with and without maxBytesToRead may throw
+ * JS JIT optimizations off, so it is worth to consider consistently using one
+ * @return {string}
+ */
+ var UTF8ToString = (ptr, maxBytesToRead) => {
+ assert(
+ typeof ptr == "number",
+ `UTF8ToString expects a number (got ${typeof ptr})`,
+ );
+ return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : "";
+ };
+ var ___assert_fail = (condition, filename, line, func) =>
+ abort(
+ `Assertion failed: ${UTF8ToString(condition)}, at: ` +
+ [
+ filename ? UTF8ToString(filename) : "unknown filename",
+ line,
+ func ? UTF8ToString(func) : "unknown function",
+ ],
+ );
+
+ var wasmTableMirror = [];
+
+ /** @type {WebAssembly.Table} */
+ var wasmTable;
+ var getWasmTableEntry = (funcPtr) => {
+ var func = wasmTableMirror[funcPtr];
+ if (!func) {
+ if (funcPtr >= wasmTableMirror.length)
+ wasmTableMirror.length = funcPtr + 1;
+ /** @suppress {checkTypes} */
+ wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+ }
+ /** @suppress {checkTypes} */
+ assert(
+ wasmTable.get(funcPtr) == func,
+ "JavaScript-side Wasm function table mirror is out of date!",
+ );
+ return func;
+ };
+ var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig);
+
+ var PATH = {
+ isAbs: (path) => path.charAt(0) === "/",
+ splitPath: (filename) => {
+ var splitPathRe =
+ /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },
+ normalizeArray: (parts, allowAboveRoot) => {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === ".") {
+ parts.splice(i, 1);
+ } else if (last === "..") {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up; up--) {
+ parts.unshift("..");
+ }
+ }
+ return parts;
+ },
+ normalize: (path) => {
+ var isAbsolute = PATH.isAbs(path),
+ trailingSlash = path.substr(-1) === "/";
+ // Normalize the path
+ path = PATH.normalizeArray(
+ path.split("/").filter((p) => !!p),
+ !isAbsolute,
+ ).join("/");
+ if (!path && !isAbsolute) {
+ path = ".";
+ }
+ if (path && trailingSlash) {
+ path += "/";
+ }
+ return (isAbsolute ? "/" : "") + path;
+ },
+ dirname: (path) => {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return ".";
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },
+ basename: (path) => {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === "/") return "/";
+ path = PATH.normalize(path);
+ path = path.replace(/\/$/, "");
+ var lastSlash = path.lastIndexOf("/");
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash + 1);
+ },
+ join: (...paths) => PATH.normalize(paths.join("/")),
+ join2: (l, r) => PATH.normalize(l + "/" + r),
+ };
+
+ var initRandomFill = () => {
+ if (
+ typeof crypto == "object" &&
+ typeof crypto["getRandomValues"] == "function"
+ ) {
+ // for modern web browsers
+ return (view) => crypto.getRandomValues(view);
+ }
+ // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+ else
+ abort(
+ "no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };",
+ );
+ };
+ var randomFill = (view) => {
+ // Lazily init on the first invocation.
+ return (randomFill = initRandomFill())(view);
+ };
+
+ var PATH_FS = {
+ resolve: (...args) => {
+ var resolvedPath = "",
+ resolvedAbsolute = false;
+ for (var i = args.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = i >= 0 ? args[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path != "string") {
+ throw new TypeError("Arguments to path.resolve must be strings");
+ } else if (!path) {
+ return ""; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + "/" + resolvedPath;
+ resolvedAbsolute = PATH.isAbs(path);
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(
+ resolvedPath.split("/").filter((p) => !!p),
+ !resolvedAbsolute,
+ ).join("/");
+ return (resolvedAbsolute ? "/" : "") + resolvedPath || ".";
+ },
+ relative: (from, to) => {
+ from = PATH_FS.resolve(from).substr(1);
+ to = PATH_FS.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== "") break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== "") break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split("/"));
+ var toParts = trim(to.split("/"));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push("..");
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join("/");
+ },
+ };
+
+ var FS_stdin_getChar_buffer = [];
+
+ var lengthBytesUTF8 = (str) => {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var c = str.charCodeAt(i); // possibly a lead surrogate
+ if (c <= 0x7f) {
+ len++;
+ } else if (c <= 0x7ff) {
+ len += 2;
+ } else if (c >= 0xd800 && c <= 0xdfff) {
+ len += 4;
+ ++i;
+ } else {
+ len += 3;
+ }
+ }
+ return len;
+ };
+
+ var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
+ assert(
+ typeof str === "string",
+ `stringToUTF8Array expects a string (got ${typeof str})`,
+ );
+ // Parameter maxBytesToWrite is not optional. Negative values, 0, null,
+ // undefined and false each don't write out any bytes.
+ if (!(maxBytesToWrite > 0)) return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
+ // and https://www.ietf.org/rfc/rfc2279.txt
+ // and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xd800 && u <= 0xdfff) {
+ var u1 = str.charCodeAt(++i);
+ u = (0x10000 + ((u & 0x3ff) << 10)) | (u1 & 0x3ff);
+ }
+ if (u <= 0x7f) {
+ if (outIdx >= endIdx) break;
+ heap[outIdx++] = u;
+ } else if (u <= 0x7ff) {
+ if (outIdx + 1 >= endIdx) break;
+ heap[outIdx++] = 0xc0 | (u >> 6);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xffff) {
+ if (outIdx + 2 >= endIdx) break;
+ heap[outIdx++] = 0xe0 | (u >> 12);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 3 >= endIdx) break;
+ if (u > 0x10ffff)
+ warnOnce(
+ "Invalid Unicode code point " +
+ ptrToString(u) +
+ " encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).",
+ );
+ heap[outIdx++] = 0xf0 | (u >> 18);
+ heap[outIdx++] = 0x80 | ((u >> 12) & 63);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ heap[outIdx] = 0;
+ return outIdx - startIdx;
+ };
+ /** @type {function(string, boolean=, number=)} */
+ function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(
+ stringy,
+ u8array,
+ 0,
+ u8array.length,
+ );
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+ }
+ var FS_stdin_getChar = () => {
+ if (!FS_stdin_getChar_buffer.length) {
+ var result = null;
+ if (
+ typeof window != "undefined" &&
+ typeof window.prompt == "function"
+ ) {
+ // Browser.
+ result = window.prompt("Input: "); // returns null on cancel
+ if (result !== null) {
+ result += "\n";
+ }
+ } else {
+ }
+ if (!result) {
+ return null;
+ }
+ FS_stdin_getChar_buffer = intArrayFromString(result, true);
+ }
+ return FS_stdin_getChar_buffer.shift();
+ };
+ var TTY = {
+ ttys: [],
+ init() {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process.stdin.setEncoding('utf8');
+ // }
+ },
+ shutdown() {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process.stdin.pause();
+ // }
+ },
+ register(dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },
+ stream_ops: {
+ open(stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(43);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ stream.tty.ops.fsync(stream.tty);
+ },
+ fsync(stream) {
+ stream.tty.ops.fsync(stream.tty);
+ },
+ read(stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(60);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.atime = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(60);
+ }
+ try {
+ for (var i = 0; i < length; i++) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset + i]);
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (length) {
+ stream.node.mtime = stream.node.ctime = Date.now();
+ }
+ return i;
+ },
+ },
+ default_tty_ops: {
+ get_char(tty) {
+ return FS_stdin_getChar();
+ },
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ }
+ },
+ ioctl_tcgets(tty) {
+ // typical setting
+ return {
+ c_iflag: 25856,
+ c_oflag: 5,
+ c_cflag: 191,
+ c_lflag: 35387,
+ c_cc: [
+ 0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a,
+ 0x00, 0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ ],
+ };
+ },
+ ioctl_tcsets(tty, optional_actions, data) {
+ // currently just ignore
+ return 0;
+ },
+ ioctl_tiocgwinsz(tty) {
+ return [24, 80];
+ },
+ },
+ default_tty1_ops: {
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ }
+ },
+ },
+ };
+
+ var zeroMemory = (address, size) => {
+ HEAPU8.fill(0, address, address + size);
+ };
+
+ var alignMemory = (size, alignment) => {
+ assert(alignment, "alignment argument is required");
+ return Math.ceil(size / alignment) * alignment;
+ };
+ var mmapAlloc = (size) => {
+ size = alignMemory(size, 65536);
+ var ptr = _emscripten_builtin_memalign(65536, size);
+ if (ptr) zeroMemory(ptr, size);
+ return ptr;
+ };
+ var MEMFS = {
+ ops_table: null,
+ mount(mount) {
+ return MEMFS.createNode(null, "/", 16895, 0);
+ },
+ createNode(parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(63);
+ }
+ MEMFS.ops_table ||= {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink,
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ },
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync,
+ },
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink,
+ },
+ stream: {},
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ },
+ stream: FS.chrdev_stream_ops,
+ },
+ };
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.atime = node.mtime = node.ctime = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ parent.atime = parent.mtime = parent.ctime = node.atime;
+ }
+ return node;
+ },
+ getFileDataAsTypedArray(node) {
+ if (!node.contents) return new Uint8Array(0);
+ if (node.contents.subarray)
+ return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },
+ expandFileStorage(node, newCapacity) {
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(
+ newCapacity,
+ (prevCapacity *
+ (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>>
+ 0,
+ );
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0)
+ node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ },
+ resizeFileStorage(node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ } else {
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newSize); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(
+ oldContents.subarray(0, Math.min(newSize, node.usedBytes)),
+ ); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ }
+ },
+ node_ops: {
+ getattr(node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.atime);
+ attr.mtime = new Date(node.mtime);
+ attr.ctime = new Date(node.ctime);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },
+ setattr(node, attr) {
+ for (const key of ["mode", "atime", "mtime", "ctime"]) {
+ if (attr[key]) {
+ node[key] = attr[key];
+ }
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },
+ lookup(parent, name) {
+ throw new FS.ErrnoError(44);
+ },
+ mknod(parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },
+ rename(old_node, new_dir, new_name) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {}
+ if (new_node) {
+ if (FS.isDir(old_node.mode)) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ }
+ FS.hashRemoveNode(new_node);
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ new_dir.contents[new_name] = old_node;
+ old_node.name = new_name;
+ new_dir.ctime =
+ new_dir.mtime =
+ old_node.parent.ctime =
+ old_node.parent.mtime =
+ Date.now();
+ },
+ unlink(parent, name) {
+ delete parent.contents[name];
+ parent.ctime = parent.mtime = Date.now();
+ },
+ rmdir(parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ delete parent.contents[name];
+ parent.ctime = parent.mtime = Date.now();
+ },
+ readdir(node) {
+ return [".", "..", ...Object.keys(node.contents)];
+ },
+ symlink(parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 0o777 | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },
+ readlink(node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ return node.link;
+ },
+ },
+ stream_ops: {
+ read(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) {
+ // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++)
+ buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ // The data buffer should be a typed array view
+ assert(!(buffer instanceof ArrayBuffer));
+
+ if (!length) return 0;
+ var node = stream.node;
+ node.mtime = node.ctime = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) {
+ // This write is from a typed array to a typed array?
+ if (canOwn) {
+ assert(
+ position === 0,
+ "canOwn must imply no weird position inside the file",
+ );
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) {
+ // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = buffer.slice(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) {
+ // Writing to an already allocated and used subrange of the file?
+ node.contents.set(
+ buffer.subarray(offset, offset + length),
+ position,
+ );
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position + length);
+ if (node.contents.subarray && buffer.subarray) {
+ // Use typed array write which is available.
+ node.contents.set(
+ buffer.subarray(offset, offset + length),
+ position,
+ );
+ } else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position + length);
+ return length;
+ },
+ llseek(stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) {
+ position += stream.position;
+ } else if (whence === 2) {
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ return position;
+ },
+ allocate(stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(
+ stream.node.usedBytes,
+ offset + length,
+ );
+ },
+ mmap(stream, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if (!(flags & 2) && contents && contents.buffer === HEAP8.buffer) {
+ // We can't emulate MAP_SHARED when the file is not backed by the
+ // buffer we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ allocated = true;
+ ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ if (contents) {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < contents.length) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(
+ contents,
+ position,
+ position + length,
+ );
+ }
+ }
+ HEAP8.set(contents, ptr);
+ }
+ }
+ return { ptr, allocated };
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ },
+ },
+ };
+
+ var asyncLoad = async (url) => {
+ var arrayBuffer = await readAsync(url);
+ assert(
+ arrayBuffer,
+ `Loading data file "${url}" failed (no arrayBuffer).`,
+ );
+ return new Uint8Array(arrayBuffer);
+ };
+
+ var FS_createDataFile = (
+ parent,
+ name,
+ fileData,
+ canRead,
+ canWrite,
+ canOwn,
+ ) => {
+ FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn);
+ };
+
+ var preloadPlugins = Module["preloadPlugins"] || [];
+ var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => {
+ // Ensure plugins are ready.
+ if (typeof Browser != "undefined") Browser.init();
+
+ var handled = false;
+ preloadPlugins.forEach((plugin) => {
+ if (handled) return;
+ if (plugin["canHandle"](fullname)) {
+ plugin["handle"](byteArray, fullname, finish, onerror);
+ handled = true;
+ }
+ });
+ return handled;
+ };
+ var FS_createPreloadedFile = (
+ parent,
+ name,
+ url,
+ canRead,
+ canWrite,
+ onload,
+ onerror,
+ dontCreateFile,
+ canOwn,
+ preFinish,
+ ) => {
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ preFinish?.();
+ if (!dontCreateFile) {
+ FS_createDataFile(
+ parent,
+ name,
+ byteArray,
+ canRead,
+ canWrite,
+ canOwn,
+ );
+ }
+ onload?.();
+ removeRunDependency(dep);
+ }
+ if (
+ FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
+ onerror?.();
+ removeRunDependency(dep);
+ })
+ ) {
+ return;
+ }
+ finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == "string") {
+ asyncLoad(url).then(processData, onerror);
+ } else {
+ processData(url);
+ }
+ };
+
+ var FS_modeStringToFlags = (str) => {
+ var flagModes = {
+ r: 0,
+ "r+": 2,
+ w: 512 | 64 | 1,
+ "w+": 512 | 64 | 2,
+ a: 1024 | 64 | 1,
+ "a+": 1024 | 64 | 2,
+ };
+ var flags = flagModes[str];
+ if (typeof flags == "undefined") {
+ throw new Error(`Unknown file open mode: ${str}`);
+ }
+ return flags;
+ };
+
+ var FS_getMode = (canRead, canWrite) => {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ };
+
+ var strError = (errno) => UTF8ToString(_strerror(errno));
+
+ var ERRNO_CODES = {
+ EPERM: 63,
+ ENOENT: 44,
+ ESRCH: 71,
+ EINTR: 27,
+ EIO: 29,
+ ENXIO: 60,
+ E2BIG: 1,
+ ENOEXEC: 45,
+ EBADF: 8,
+ ECHILD: 12,
+ EAGAIN: 6,
+ EWOULDBLOCK: 6,
+ ENOMEM: 48,
+ EACCES: 2,
+ EFAULT: 21,
+ ENOTBLK: 105,
+ EBUSY: 10,
+ EEXIST: 20,
+ EXDEV: 75,
+ ENODEV: 43,
+ ENOTDIR: 54,
+ EISDIR: 31,
+ EINVAL: 28,
+ ENFILE: 41,
+ EMFILE: 33,
+ ENOTTY: 59,
+ ETXTBSY: 74,
+ EFBIG: 22,
+ ENOSPC: 51,
+ ESPIPE: 70,
+ EROFS: 69,
+ EMLINK: 34,
+ EPIPE: 64,
+ EDOM: 18,
+ ERANGE: 68,
+ ENOMSG: 49,
+ EIDRM: 24,
+ ECHRNG: 106,
+ EL2NSYNC: 156,
+ EL3HLT: 107,
+ EL3RST: 108,
+ ELNRNG: 109,
+ EUNATCH: 110,
+ ENOCSI: 111,
+ EL2HLT: 112,
+ EDEADLK: 16,
+ ENOLCK: 46,
+ EBADE: 113,
+ EBADR: 114,
+ EXFULL: 115,
+ ENOANO: 104,
+ EBADRQC: 103,
+ EBADSLT: 102,
+ EDEADLOCK: 16,
+ EBFONT: 101,
+ ENOSTR: 100,
+ ENODATA: 116,
+ ETIME: 117,
+ ENOSR: 118,
+ ENONET: 119,
+ ENOPKG: 120,
+ EREMOTE: 121,
+ ENOLINK: 47,
+ EADV: 122,
+ ESRMNT: 123,
+ ECOMM: 124,
+ EPROTO: 65,
+ EMULTIHOP: 36,
+ EDOTDOT: 125,
+ EBADMSG: 9,
+ ENOTUNIQ: 126,
+ EBADFD: 127,
+ EREMCHG: 128,
+ ELIBACC: 129,
+ ELIBBAD: 130,
+ ELIBSCN: 131,
+ ELIBMAX: 132,
+ ELIBEXEC: 133,
+ ENOSYS: 52,
+ ENOTEMPTY: 55,
+ ENAMETOOLONG: 37,
+ ELOOP: 32,
+ EOPNOTSUPP: 138,
+ EPFNOSUPPORT: 139,
+ ECONNRESET: 15,
+ ENOBUFS: 42,
+ EAFNOSUPPORT: 5,
+ EPROTOTYPE: 67,
+ ENOTSOCK: 57,
+ ENOPROTOOPT: 50,
+ ESHUTDOWN: 140,
+ ECONNREFUSED: 14,
+ EADDRINUSE: 3,
+ ECONNABORTED: 13,
+ ENETUNREACH: 40,
+ ENETDOWN: 38,
+ ETIMEDOUT: 73,
+ EHOSTDOWN: 142,
+ EHOSTUNREACH: 23,
+ EINPROGRESS: 26,
+ EALREADY: 7,
+ EDESTADDRREQ: 17,
+ EMSGSIZE: 35,
+ EPROTONOSUPPORT: 66,
+ ESOCKTNOSUPPORT: 137,
+ EADDRNOTAVAIL: 4,
+ ENETRESET: 39,
+ EISCONN: 30,
+ ENOTCONN: 53,
+ ETOOMANYREFS: 141,
+ EUSERS: 136,
+ EDQUOT: 19,
+ ESTALE: 72,
+ ENOTSUP: 138,
+ ENOMEDIUM: 148,
+ EILSEQ: 25,
+ EOVERFLOW: 61,
+ ECANCELED: 11,
+ ENOTRECOVERABLE: 56,
+ EOWNERDEAD: 62,
+ ESTRPIPE: 135,
+ };
+ var FS = {
+ root: null,
+ mounts: [],
+ devices: {},
+ streams: [],
+ nextInode: 1,
+ nameTable: null,
+ currentPath: "/",
+ initialized: false,
+ ignorePermissions: true,
+ ErrnoError: class extends Error {
+ name = "ErrnoError";
+ // We set the `name` property to be able to identify `FS.ErrnoError`
+ // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
+ // - when using PROXYFS, an error can come from an underlying FS
+ // as different FS objects have their own FS.ErrnoError each,
+ // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
+ // we'll use the reliable test `err.name == "ErrnoError"` instead
+ constructor(errno) {
+ super(runtimeInitialized ? strError(errno) : "");
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ }
+ },
+ filesystems: null,
+ syncFSRequests: 0,
+ readFiles: {},
+ FSStream: class {
+ shared = {};
+ get object() {
+ return this.node;
+ }
+ set object(val) {
+ this.node = val;
+ }
+ get isRead() {
+ return (this.flags & 2097155) !== 1;
+ }
+ get isWrite() {
+ return (this.flags & 2097155) !== 0;
+ }
+ get isAppend() {
+ return this.flags & 1024;
+ }
+ get flags() {
+ return this.shared.flags;
+ }
+ set flags(val) {
+ this.shared.flags = val;
+ }
+ get position() {
+ return this.shared.position;
+ }
+ set position(val) {
+ this.shared.position = val;
+ }
+ },
+ FSNode: class {
+ node_ops = {};
+ stream_ops = {};
+ readMode = 292 | 73;
+ writeMode = 146;
+ mounted = null;
+ constructor(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.rdev = rdev;
+ this.atime = this.mtime = this.ctime = Date.now();
+ }
+ get read() {
+ return (this.mode & this.readMode) === this.readMode;
+ }
+ set read(val) {
+ val ? (this.mode |= this.readMode) : (this.mode &= ~this.readMode);
+ }
+ get write() {
+ return (this.mode & this.writeMode) === this.writeMode;
+ }
+ set write(val) {
+ val ? (this.mode |= this.writeMode) : (this.mode &= ~this.writeMode);
+ }
+ get isFolder() {
+ return FS.isDir(this.mode);
+ }
+ get isDevice() {
+ return FS.isChrdev(this.mode);
+ }
+ },
+ lookupPath(path, opts = {}) {
+ if (!path) return { path: "", node: null };
+ opts.follow_mount ??= true;
+
+ if (!PATH.isAbs(path)) {
+ path = FS.cwd() + "/" + path;
+ }
+
+ // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ linkloop: for (var nlinks = 0; nlinks < 40; nlinks++) {
+ // split the absolute path
+ var parts = path.split("/").filter((p) => !!p && p !== ".");
+
+ // start at the root
+ var current = FS.root;
+ var current_path = "/";
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = i === parts.length - 1;
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ if (parts[i] === "..") {
+ current_path = PATH.dirname(current_path);
+ current = current.parent;
+ continue;
+ }
+
+ current_path = PATH.join2(current_path, parts[i]);
+ try {
+ current = FS.lookupNode(current, parts[i]);
+ } catch (e) {
+ // if noent_okay is true, suppress a ENOENT in the last component
+ // and return an object with an undefined node. This is needed for
+ // resolving symlinks in the path when creating a file.
+ if (e?.errno === 44 && islast && opts.noent_okay) {
+ return { path: current_path };
+ }
+ throw e;
+ }
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current) && (!islast || opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (FS.isLink(current.mode) && (!islast || opts.follow)) {
+ if (!current.node_ops.readlink) {
+ throw new FS.ErrnoError(52);
+ }
+ var link = current.node_ops.readlink(current);
+ if (!PATH.isAbs(link)) {
+ link = PATH.dirname(current_path) + "/" + link;
+ }
+ path = link + "/" + parts.slice(i + 1).join("/");
+ continue linkloop;
+ }
+ }
+ return { path: current_path, node: current };
+ }
+ throw new FS.ErrnoError(32);
+ },
+ getPath(node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length - 1] !== "/"
+ ? `${mount}/${path}`
+ : mount + path;
+ }
+ path = path ? `${node.name}/${path}` : node.name;
+ node = node.parent;
+ }
+ },
+ hashName(parentid, name) {
+ var hash = 0;
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },
+ hashAddNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },
+ hashRemoveNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },
+ lookupNode(parent, name) {
+ var errCode = FS.mayLookup(parent);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },
+ createNode(parent, name, mode, rdev) {
+ assert(typeof parent == "object");
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },
+ destroyNode(node) {
+ FS.hashRemoveNode(node);
+ },
+ isRoot(node) {
+ return node === node.parent;
+ },
+ isMountpoint(node) {
+ return !!node.mounted;
+ },
+ isFile(mode) {
+ return (mode & 61440) === 32768;
+ },
+ isDir(mode) {
+ return (mode & 61440) === 16384;
+ },
+ isLink(mode) {
+ return (mode & 61440) === 40960;
+ },
+ isChrdev(mode) {
+ return (mode & 61440) === 8192;
+ },
+ isBlkdev(mode) {
+ return (mode & 61440) === 24576;
+ },
+ isFIFO(mode) {
+ return (mode & 61440) === 4096;
+ },
+ isSocket(mode) {
+ return (mode & 49152) === 49152;
+ },
+ flagsToPermissionString(flag) {
+ var perms = ["r", "w", "rw"][flag & 3];
+ if (flag & 512) {
+ perms += "w";
+ }
+ return perms;
+ },
+ nodePermissions(node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.includes("r") && !(node.mode & 292)) {
+ return 2;
+ } else if (perms.includes("w") && !(node.mode & 146)) {
+ return 2;
+ } else if (perms.includes("x") && !(node.mode & 73)) {
+ return 2;
+ }
+ return 0;
+ },
+ mayLookup(dir) {
+ if (!FS.isDir(dir.mode)) return 54;
+ var errCode = FS.nodePermissions(dir, "x");
+ if (errCode) return errCode;
+ if (!dir.node_ops.lookup) return 2;
+ return 0;
+ },
+ mayCreate(dir, name) {
+ if (!FS.isDir(dir.mode)) {
+ return 54;
+ }
+ try {
+ var node = FS.lookupNode(dir, name);
+ return 20;
+ } catch (e) {}
+ return FS.nodePermissions(dir, "wx");
+ },
+ mayDelete(dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var errCode = FS.nodePermissions(dir, "wx");
+ if (errCode) {
+ return errCode;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return 54;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return 10;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return 31;
+ }
+ }
+ return 0;
+ },
+ mayOpen(node, flags) {
+ if (!node) {
+ return 44;
+ }
+ if (FS.isLink(node.mode)) {
+ return 32;
+ } else if (FS.isDir(node.mode)) {
+ if (
+ FS.flagsToPermissionString(flags) !== "r" || // opening for write
+ flags & 512
+ ) {
+ // TODO: check for O_SEARCH? (== search for dir only)
+ return 31;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },
+ MAX_OPEN_FDS: 4096,
+ nextfd() {
+ for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(33);
+ },
+ getStreamChecked(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ return stream;
+ },
+ getStream: (fd) => FS.streams[fd],
+ createStream(stream, fd = -1) {
+ assert(fd >= -1);
+
+ // clone it, so we can return an instance of FSStream
+ stream = Object.assign(new FS.FSStream(), stream);
+ if (fd == -1) {
+ fd = FS.nextfd();
+ }
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },
+ closeStream(fd) {
+ FS.streams[fd] = null;
+ },
+ dupStream(origStream, fd = -1) {
+ var stream = FS.createStream(origStream, fd);
+ stream.stream_ops?.dup?.(stream);
+ return stream;
+ },
+ chrdev_stream_ops: {
+ open(stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ stream.stream_ops.open?.(stream);
+ },
+ llseek() {
+ throw new FS.ErrnoError(70);
+ },
+ },
+ major: (dev) => dev >> 8,
+ minor: (dev) => dev & 0xff,
+ makedev: (ma, mi) => (ma << 8) | mi,
+ registerDevice(dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },
+ getDevice: (dev) => FS.devices[dev],
+ getMounts(mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push(...m.mounts);
+ }
+
+ return mounts;
+ },
+ syncfs(populate, callback) {
+ if (typeof populate == "function") {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ err(
+ `warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`,
+ );
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(errCode) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(errCode);
+ }
+
+ function done(errCode) {
+ if (errCode) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(errCode);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ }
+
+ // sync all mounts
+ mounts.forEach((mount) => {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },
+ mount(type, opts, mountpoint) {
+ if (typeof type == "string") {
+ // The filesystem was not included, and instead we have an error
+ // message stored in the variable.
+ throw type;
+ }
+ var root = mountpoint === "/";
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(10);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ }
+
+ var mount = {
+ type,
+ opts,
+ mountpoint,
+ mounts: [],
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },
+ unmount(mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(28);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach((hash) => {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.includes(current.mount)) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },
+ lookup(parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },
+ mknod(path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === "." || name === "..") {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.mayCreate(parent, name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },
+ statfs(path) {
+ // NOTE: None of the defaults here are true. We're just returning safe and
+ // sane values.
+ var rtn = {
+ bsize: 4096,
+ frsize: 4096,
+ blocks: 1e6,
+ bfree: 5e5,
+ bavail: 5e5,
+ files: FS.nextInode,
+ ffree: FS.nextInode - 1,
+ fsid: 42,
+ flags: 2,
+ namelen: 255,
+ };
+
+ var parent = FS.lookupPath(path, { follow: true }).node;
+ if (parent?.node_ops.statfs) {
+ Object.assign(rtn, parent.node_ops.statfs(parent.mount.opts.root));
+ }
+ return rtn;
+ },
+ create(path, mode = 0o666) {
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdir(path, mode = 0o777) {
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdirTree(path, mode) {
+ var dirs = path.split("/");
+ var d = "";
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += "/" + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch (e) {
+ if (e.errno != 20) throw e;
+ }
+ }
+ },
+ mkdev(path, mode, dev) {
+ if (typeof dev == "undefined") {
+ dev = mode;
+ mode = 0o666;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },
+ symlink(oldpath, newpath) {
+ if (!PATH_FS.resolve(oldpath)) {
+ throw new FS.ErrnoError(44);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var newname = PATH.basename(newpath);
+ var errCode = FS.mayCreate(parent, newname);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },
+ rename(old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+
+ // let the errors from non existent directories percolate up
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(75);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH_FS.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(28);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH_FS.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(55);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var errCode = FS.mayDelete(old_dir, old_name, isdir);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ errCode = new_node
+ ? FS.mayDelete(new_dir, new_name, isdir)
+ : FS.mayCreate(new_dir, new_name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(63);
+ }
+ if (
+ FS.isMountpoint(old_node) ||
+ (new_node && FS.isMountpoint(new_node))
+ ) {
+ throw new FS.ErrnoError(10);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ errCode = FS.nodePermissions(old_dir, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ // update old node (we do this here to avoid each backend
+ // needing to)
+ old_node.parent = new_dir;
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ },
+ rmdir(path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, true);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ },
+ readdir(path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(54);
+ }
+ return node.node_ops.readdir(node);
+ },
+ unlink(path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, false);
+ if (errCode) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ },
+ readlink(path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(28);
+ }
+ return link.node_ops.readlink(link);
+ },
+ stat(path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(63);
+ }
+ return node.node_ops.getattr(node);
+ },
+ lstat(path) {
+ return FS.stat(path, true);
+ },
+ chmod(path, mode, dontFollow) {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ ctime: Date.now(),
+ });
+ },
+ lchmod(path, mode) {
+ FS.chmod(path, mode, true);
+ },
+ fchmod(fd, mode) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chmod(stream.node, mode);
+ },
+ chown(path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now(),
+ // we ignore the uid / gid for now
+ });
+ },
+ lchown(path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },
+ fchown(fd, uid, gid) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chown(stream.node, uid, gid);
+ },
+ truncate(path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.nodePermissions(node, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now(),
+ });
+ },
+ ftruncate(fd, len) {
+ var stream = FS.getStreamChecked(fd);
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(28);
+ }
+ FS.truncate(stream.node, len);
+ },
+ utime(path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ atime: atime,
+ mtime: mtime,
+ });
+ },
+ open(path, flags, mode = 0o666) {
+ if (path === "") {
+ throw new FS.ErrnoError(44);
+ }
+ flags = typeof flags == "string" ? FS_modeStringToFlags(flags) : flags;
+ if (flags & 64) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path == "object") {
+ node = path;
+ } else {
+ // noent_okay makes it so that if the final component of the path
+ // doesn't exist, lookupPath returns `node: undefined`. `path` will be
+ // updated to point to the target of all symlinks.
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072),
+ noent_okay: true,
+ });
+ node = lookup.node;
+ path = lookup.path;
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if (flags & 64) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if (flags & 128) {
+ throw new FS.ErrnoError(20);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if (flags & 65536 && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var errCode = FS.mayOpen(node, flags);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // do truncation if necessary
+ if (flags & 512 && !created) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512 | 131072);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false,
+ });
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module["logReadFiles"] && !(flags & 1)) {
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ }
+ }
+ return stream;
+ },
+ close(stream) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },
+ isClosed(stream) {
+ return stream.fd === null;
+ },
+ llseek(stream, offset, whence) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(70);
+ }
+ if (whence != 0 && whence != 1 && whence != 2) {
+ throw new FS.ErrnoError(28);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },
+ read(stream, buffer, offset, length, position) {
+ assert(offset >= 0);
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(28);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesRead = stream.stream_ops.read(
+ stream,
+ buffer,
+ offset,
+ length,
+ position,
+ );
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ assert(offset >= 0);
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(28);
+ }
+ if (stream.seekable && stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesWritten = stream.stream_ops.write(
+ stream,
+ buffer,
+ offset,
+ length,
+ position,
+ canOwn,
+ );
+ if (!seeking) stream.position += bytesWritten;
+ return bytesWritten;
+ },
+ allocate(stream, offset, length) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(138);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },
+ mmap(stream, length, position, prot, flags) {
+ // User requests writing to file (prot & PROT_WRITE != 0).
+ // Checking if we have permissions to write to the file unless
+ // MAP_PRIVATE flag is set. According to POSIX spec it is possible
+ // to write to file opened in read-only mode with MAP_PRIVATE flag,
+ // as all modifications will be visible only in the memory of
+ // the current process.
+ if (
+ (prot & 2) !== 0 &&
+ (flags & 2) === 0 &&
+ (stream.flags & 2097155) !== 2
+ ) {
+ throw new FS.ErrnoError(2);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(2);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!length) {
+ throw new FS.ErrnoError(28);
+ }
+ return stream.stream_ops.mmap(stream, length, position, prot, flags);
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ assert(offset >= 0);
+ if (!stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(
+ stream,
+ buffer,
+ offset,
+ length,
+ mmapFlags,
+ );
+ },
+ ioctl(stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(59);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },
+ readFile(path, opts = {}) {
+ opts.flags = opts.flags || 0;
+ opts.encoding = opts.encoding || "binary";
+ if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
+ throw new Error(`Invalid encoding type "${opts.encoding}"`);
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === "utf8") {
+ ret = UTF8ArrayToString(buf);
+ } else if (opts.encoding === "binary") {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },
+ writeFile(path, data, opts = {}) {
+ opts.flags = opts.flags || 577;
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data == "string") {
+ var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error("Unsupported data type");
+ }
+ FS.close(stream);
+ },
+ cwd: () => FS.currentPath,
+ chdir(path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ var errCode = FS.nodePermissions(lookup.node, "x");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ FS.currentPath = lookup.path;
+ },
+ createDefaultDirectories() {
+ FS.mkdir("/tmp");
+ FS.mkdir("/home");
+ FS.mkdir("/home/web_user");
+ },
+ createDefaultDevices() {
+ // create /dev
+ FS.mkdir("/dev");
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: () => 0,
+ write: (stream, buffer, offset, length, pos) => length,
+ llseek: () => 0,
+ });
+ FS.mkdev("/dev/null", FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using err() rather than out()
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev("/dev/tty", FS.makedev(5, 0));
+ FS.mkdev("/dev/tty1", FS.makedev(6, 0));
+ // setup /dev/[u]random
+ // use a buffer to avoid overhead of individual crypto calls per byte
+ var randomBuffer = new Uint8Array(1024),
+ randomLeft = 0;
+ var randomByte = () => {
+ if (randomLeft === 0) {
+ randomLeft = randomFill(randomBuffer).byteLength;
+ }
+ return randomBuffer[--randomLeft];
+ };
+ FS.createDevice("/dev", "random", randomByte);
+ FS.createDevice("/dev", "urandom", randomByte);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir("/dev/shm");
+ FS.mkdir("/dev/shm/tmp");
+ },
+ createSpecialDirectories() {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
+ // name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir("/proc");
+ var proc_self = FS.mkdir("/proc/self");
+ FS.mkdir("/proc/self/fd");
+ FS.mount(
+ {
+ mount() {
+ var node = FS.createNode(proc_self, "fd", 16895, 73);
+ node.stream_ops = {
+ llseek: MEMFS.stream_ops.llseek,
+ };
+ node.node_ops = {
+ lookup(parent, name) {
+ var fd = +name;
+ var stream = FS.getStreamChecked(fd);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: "fake" },
+ node_ops: { readlink: () => stream.path },
+ id: fd + 1,
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ },
+ readdir() {
+ return Array.from(FS.streams.entries())
+ .filter(([k, v]) => v)
+ .map(([k, v]) => k.toString());
+ },
+ };
+ return node;
+ },
+ },
+ {},
+ "/proc/self/fd",
+ );
+ },
+ createStandardStreams(input, output, error) {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (input) {
+ FS.createDevice("/dev", "stdin", input);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdin");
+ }
+ if (output) {
+ FS.createDevice("/dev", "stdout", null, output);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdout");
+ }
+ if (error) {
+ FS.createDevice("/dev", "stderr", null, error);
+ } else {
+ FS.symlink("/dev/tty1", "/dev/stderr");
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open("/dev/stdin", 0);
+ var stdout = FS.open("/dev/stdout", 1);
+ var stderr = FS.open("/dev/stderr", 1);
+ assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`);
+ assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`);
+ assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`);
+ },
+ staticInit() {
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, "/");
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ MEMFS: MEMFS,
+ };
+ },
+ init(input, output, error) {
+ assert(
+ !FS.initialized,
+ "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)",
+ );
+ FS.initialized = true;
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ input ??= Module["stdin"];
+ output ??= Module["stdout"];
+ error ??= Module["stderr"];
+
+ FS.createStandardStreams(input, output, error);
+ },
+ quit() {
+ FS.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ _fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },
+ findObject(path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (!ret.exists) {
+ return null;
+ }
+ return ret.object;
+ },
+ analyzePath(path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {}
+ var ret = {
+ isRoot: false,
+ exists: false,
+ error: 0,
+ name: null,
+ path: null,
+ object: null,
+ parentExists: false,
+ parentPath: null,
+ parentObject: null,
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === "/";
+ } catch (e) {
+ ret.error = e.errno;
+ }
+ return ret;
+ },
+ createPath(parent, path, canRead, canWrite) {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ var parts = path.split("/").reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },
+ createFile(parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(
+ typeof parent == "string" ? parent : FS.getPath(parent),
+ name,
+ );
+ var mode = FS_getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },
+ createDataFile(parent, name, data, canRead, canWrite, canOwn) {
+ var path = name;
+ if (parent) {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ path = name ? PATH.join2(parent, name) : parent;
+ }
+ var mode = FS_getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data == "string") {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i)
+ arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 577);
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ },
+ createDevice(parent, name, input, output) {
+ var path = PATH.join2(
+ typeof parent == "string" ? parent : FS.getPath(parent),
+ name,
+ );
+ var mode = FS_getMode(!!input, !!output);
+ FS.createDevice.major ??= 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open(stream) {
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ if (output?.buffer?.length) {
+ output(10);
+ }
+ },
+ read(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.atime = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset + i]);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ if (length) {
+ stream.node.mtime = stream.node.ctime = Date.now();
+ }
+ return i;
+ },
+ });
+ return FS.mkdev(path, mode, dev);
+ },
+ forceLoadFile(obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents)
+ return true;
+ if (typeof XMLHttpRequest != "undefined") {
+ throw new Error(
+ "Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.",
+ );
+ } else {
+ // Command-line.
+ try {
+ obj.contents = readBinary(obj.url);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ },
+ createLazyFile(parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array).
+ // Actual getting is abstracted away for eventual reuse.
+ class LazyUint8Array {
+ lengthKnown = false;
+ chunks = []; // Loaded chunks. Index is the chunk number
+ get(idx) {
+ if (idx > this.length - 1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize) | 0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ setDataGetter(getter) {
+ this.getter = getter;
+ }
+ cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open("HEAD", url, false);
+ xhr.send(null);
+ if (
+ !((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)
+ )
+ throw new Error(
+ "Couldn't load " + url + ". Status: " + xhr.status,
+ );
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing =
+ (header = xhr.getResponseHeader("Accept-Ranges")) &&
+ header === "bytes";
+ var usesGzip =
+ (header = xhr.getResponseHeader("Content-Encoding")) &&
+ header === "gzip";
+
+ var chunkSize = 1024 * 1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (from, to) => {
+ if (from > to)
+ throw new Error(
+ "invalid range (" +
+ from +
+ ", " +
+ to +
+ ") or no bytes requested!",
+ );
+ if (to > datalength - 1)
+ throw new Error(
+ "only " + datalength + " bytes available! programmer error!",
+ );
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open("GET", url, false);
+ if (datalength !== chunkSize)
+ xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ xhr.responseType = "arraybuffer";
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType("text/plain; charset=x-user-defined");
+ }
+
+ xhr.send(null);
+ if (
+ !((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)
+ )
+ throw new Error(
+ "Couldn't load " + url + ". Status: " + xhr.status,
+ );
+ if (xhr.response !== undefined) {
+ return new Uint8Array(
+ /** @type{Array<number>} */ (xhr.response || []),
+ );
+ }
+ return intArrayFromString(xhr.responseText || "", true);
+ };
+ var lazyArray = this;
+ lazyArray.setDataGetter((chunkNum) => {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum + 1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength - 1); // if datalength-1 is selected, this is the last block
+ if (typeof lazyArray.chunks[chunkNum] == "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof lazyArray.chunks[chunkNum] == "undefined")
+ throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ out(
+ "LazyFiles on gzip forces download of the whole file when length is accessed",
+ );
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ get length() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ get chunkSize() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+
+ if (typeof XMLHttpRequest != "undefined") {
+ if (!ENVIRONMENT_IS_WORKER)
+ throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
+ var lazyArray = new LazyUint8Array();
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function () {
+ return this.contents.length;
+ },
+ },
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach((key) => {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = (...args) => {
+ FS.forceLoadFile(node);
+ return fn(...args);
+ };
+ });
+ function writeChunks(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= contents.length) return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) {
+ // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) {
+ // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ }
+ // use a custom read function
+ stream_ops.read = (stream, buffer, offset, length, position) => {
+ FS.forceLoadFile(node);
+ return writeChunks(stream, buffer, offset, length, position);
+ };
+ // use a custom mmap function
+ stream_ops.mmap = (stream, length, position, prot, flags) => {
+ FS.forceLoadFile(node);
+ var ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ writeChunks(stream, HEAP8, ptr, length, position);
+ return { ptr, allocated: true };
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },
+ absolutePath() {
+ abort("FS.absolutePath has been removed; use PATH_FS.resolve instead");
+ },
+ createFolder() {
+ abort("FS.createFolder has been removed; use FS.mkdir instead");
+ },
+ createLink() {
+ abort("FS.createLink has been removed; use FS.symlink instead");
+ },
+ joinPath() {
+ abort("FS.joinPath has been removed; use PATH.join instead");
+ },
+ mmapAlloc() {
+ abort(
+ "FS.mmapAlloc has been replaced by the top level function mmapAlloc",
+ );
+ },
+ standardizePath() {
+ abort(
+ "FS.standardizePath has been removed; use PATH.normalize instead",
+ );
+ },
+ };
+
+ var SYSCALLS = {
+ DEFAULT_POLLMASK: 5,
+ calculateAt(dirfd, path, allowEmpty) {
+ if (PATH.isAbs(path)) {
+ return path;
+ }
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = SYSCALLS.getStreamFromFD(dirfd);
+ dir = dirstream.path;
+ }
+ if (path.length == 0) {
+ if (!allowEmpty) {
+ throw new FS.ErrnoError(44);
+ }
+ return dir;
+ }
+ return dir + "/" + path;
+ },
+ doStat(func, path, buf) {
+ var stat = func(path);
+ HEAP32[buf >> 2] = stat.dev;
+ HEAP32[(buf + 4) >> 2] = stat.mode;
+ HEAPU32[(buf + 8) >> 2] = stat.nlink;
+ HEAP32[(buf + 12) >> 2] = stat.uid;
+ HEAP32[(buf + 16) >> 2] = stat.gid;
+ HEAP32[(buf + 20) >> 2] = stat.rdev;
+ (tempI64 = [
+ stat.size >>> 0,
+ ((tempDouble = stat.size),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(buf + 24) >> 2] = tempI64[0]),
+ (HEAP32[(buf + 28) >> 2] = tempI64[1]);
+ HEAP32[(buf + 32) >> 2] = 4096;
+ HEAP32[(buf + 36) >> 2] = stat.blocks;
+ var atime = stat.atime.getTime();
+ var mtime = stat.mtime.getTime();
+ var ctime = stat.ctime.getTime();
+ (tempI64 = [
+ Math.floor(atime / 1000) >>> 0,
+ ((tempDouble = Math.floor(atime / 1000)),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(buf + 40) >> 2] = tempI64[0]),
+ (HEAP32[(buf + 44) >> 2] = tempI64[1]);
+ HEAPU32[(buf + 48) >> 2] = (atime % 1000) * 1000 * 1000;
+ (tempI64 = [
+ Math.floor(mtime / 1000) >>> 0,
+ ((tempDouble = Math.floor(mtime / 1000)),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(buf + 56) >> 2] = tempI64[0]),
+ (HEAP32[(buf + 60) >> 2] = tempI64[1]);
+ HEAPU32[(buf + 64) >> 2] = (mtime % 1000) * 1000 * 1000;
+ (tempI64 = [
+ Math.floor(ctime / 1000) >>> 0,
+ ((tempDouble = Math.floor(ctime / 1000)),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(buf + 72) >> 2] = tempI64[0]),
+ (HEAP32[(buf + 76) >> 2] = tempI64[1]);
+ HEAPU32[(buf + 80) >> 2] = (ctime % 1000) * 1000 * 1000;
+ (tempI64 = [
+ stat.ino >>> 0,
+ ((tempDouble = stat.ino),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(buf + 88) >> 2] = tempI64[0]),
+ (HEAP32[(buf + 92) >> 2] = tempI64[1]);
+ return 0;
+ },
+ doMsync(addr, stream, len, flags, offset) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (flags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+ var buffer = HEAPU8.slice(addr, addr + len);
+ FS.msync(stream, buffer, offset, len, flags);
+ },
+ getStreamFromFD(fd) {
+ var stream = FS.getStreamChecked(fd);
+ return stream;
+ },
+ varargs: undefined,
+ getStr(ptr) {
+ var ret = UTF8ToString(ptr);
+ return ret;
+ },
+ };
+ var ___syscall__newselect = function (
+ nfds,
+ readfds,
+ writefds,
+ exceptfds,
+ timeout,
+ ) {
+ try {
+ // readfds are supported,
+ // writefds checks socket open status
+ // exceptfds are supported, although on web, such exceptional conditions never arise in web sockets
+ // and so the exceptfds list will always return empty.
+ // timeout is supported, although on SOCKFS and PIPEFS these are ignored and always treated as 0 - fully async
+ assert(nfds <= 64, "nfds must be less than or equal to 64"); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers
+
+ var total = 0;
+
+ var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0,
+ srcReadHigh = readfds ? HEAP32[(readfds + 4) >> 2] : 0;
+ var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0,
+ srcWriteHigh = writefds ? HEAP32[(writefds + 4) >> 2] : 0;
+ var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0,
+ srcExceptHigh = exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0;
+
+ var dstReadLow = 0,
+ dstReadHigh = 0;
+ var dstWriteLow = 0,
+ dstWriteHigh = 0;
+ var dstExceptLow = 0,
+ dstExceptHigh = 0;
+
+ var allLow =
+ (readfds ? HEAP32[readfds >> 2] : 0) |
+ (writefds ? HEAP32[writefds >> 2] : 0) |
+ (exceptfds ? HEAP32[exceptfds >> 2] : 0);
+ var allHigh =
+ (readfds ? HEAP32[(readfds + 4) >> 2] : 0) |
+ (writefds ? HEAP32[(writefds + 4) >> 2] : 0) |
+ (exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0);
+
+ var check = (fd, low, high, val) => (fd < 32 ? low & val : high & val);
+
+ for (var fd = 0; fd < nfds; fd++) {
+ var mask = 1 << (fd % 32);
+ if (!check(fd, allLow, allHigh, mask)) {
+ continue; // index isn't in the set
+ }
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+
+ var flags = SYSCALLS.DEFAULT_POLLMASK;
+
+ if (stream.stream_ops.poll) {
+ var timeoutInMillis = -1;
+ if (timeout) {
+ // select(2) is declared to accept "struct timeval { time_t tv_sec; suseconds_t tv_usec; }".
+ // However, musl passes the two values to the syscall as an array of long values.
+ // Note that sizeof(time_t) != sizeof(long) in wasm32. The former is 8, while the latter is 4.
+ // This means using "C_STRUCTS.timeval.tv_usec" leads to a wrong offset.
+ // So, instead, we use POINTER_SIZE.
+ var tv_sec = readfds ? HEAP32[timeout >> 2] : 0,
+ tv_usec = readfds ? HEAP32[(timeout + 4) >> 2] : 0;
+ timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000;
+ }
+ flags = stream.stream_ops.poll(stream, timeoutInMillis);
+ }
+
+ if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) {
+ fd < 32
+ ? (dstReadLow = dstReadLow | mask)
+ : (dstReadHigh = dstReadHigh | mask);
+ total++;
+ }
+ if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) {
+ fd < 32
+ ? (dstWriteLow = dstWriteLow | mask)
+ : (dstWriteHigh = dstWriteHigh | mask);
+ total++;
+ }
+ if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) {
+ fd < 32
+ ? (dstExceptLow = dstExceptLow | mask)
+ : (dstExceptHigh = dstExceptHigh | mask);
+ total++;
+ }
+ }
+
+ if (readfds) {
+ HEAP32[readfds >> 2] = dstReadLow;
+ HEAP32[(readfds + 4) >> 2] = dstReadHigh;
+ }
+ if (writefds) {
+ HEAP32[writefds >> 2] = dstWriteLow;
+ HEAP32[(writefds + 4) >> 2] = dstWriteHigh;
+ }
+ if (exceptfds) {
+ HEAP32[exceptfds >> 2] = dstExceptLow;
+ HEAP32[(exceptfds + 4) >> 2] = dstExceptHigh;
+ }
+
+ return total;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ };
+
+ var SOCKFS = {
+ websocketArgs: {},
+ callbacks: {},
+ on(event, callback) {
+ SOCKFS.callbacks[event] = callback;
+ },
+ emit(event, param) {
+ SOCKFS.callbacks[event]?.(param);
+ },
+ mount(mount) {
+ // The incomming Module['websocket'] can be used for configuring
+ // configuring subprotocol/url, etc
+ SOCKFS.websocketArgs = Module["websocket"] || {};
+ // Add the Event registration mechanism to the exported websocket configuration
+ // object so we can register network callbacks from native JavaScript too.
+ // For more documentation see system/include/emscripten/emscripten.h
+ (Module["websocket"] ??= {})["on"] = SOCKFS.on;
+
+ return FS.createNode(null, "/", 16895, 0);
+ },
+ createSocket(family, type, protocol) {
+ type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
+ var streaming = type == 1;
+ if (streaming && protocol && protocol != 6) {
+ throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
+ }
+
+ // create our internal socket structure
+ var sock = {
+ family,
+ type,
+ protocol,
+ server: null,
+ error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops,
+ };
+
+ // create the filesystem node to store the socket structure
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+
+ // and the wrapping stream that enables library functions such
+ // as read and write to indirectly interact with the socket
+ var stream = FS.createStream({
+ path: name,
+ node,
+ flags: 2,
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops,
+ });
+
+ // map the new stream to the socket structure (sockets have a 1:1
+ // relationship with a stream)
+ sock.stream = stream;
+
+ return sock;
+ },
+ getSocket(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },
+ stream_ops: {
+ poll(stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },
+ ioctl(stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },
+ read(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ // socket is closed
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },
+ write(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },
+ close(stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ },
+ },
+ nextname() {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return `socket[${SOCKFS.nextname.current++}]`;
+ },
+ websocket_sock_ops: {
+ createPeer(sock, addr, port) {
+ var ws;
+
+ if (typeof addr == "object") {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+
+ if (ws) {
+ // for sockets that've already connected (e.g. we're the server)
+ // we can inspect the _socket property for the address
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ }
+ // if we're just now initializing a connection to the remote,
+ // inspect the url property
+ else {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error(
+ "WebSocket URL must be in the format ws(s)://address:port",
+ );
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ // create the actual websocket object and connect
+ try {
+ // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+ // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+ var url = "ws:#".replace("#", "//");
+ // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+ var subProtocols = "binary"; // The default value is 'binary'
+ // The default WebSocket options
+ var opts = undefined;
+
+ // Fetch runtime WebSocket URL config.
+ if (SOCKFS.websocketArgs["url"]) {
+ url = SOCKFS.websocketArgs["url"];
+ }
+ // Fetch runtime WebSocket subprotocol config.
+ if (SOCKFS.websocketArgs["subprotocol"]) {
+ subProtocols = SOCKFS.websocketArgs["subprotocol"];
+ } else if (SOCKFS.websocketArgs["subprotocol"] === null) {
+ subProtocols = "null";
+ }
+
+ if (url === "ws://" || url === "wss://") {
+ // Is the supplied URL config just a prefix, if so complete it.
+ var parts = addr.split("/");
+ url =
+ url + parts[0] + ":" + port + "/" + parts.slice(1).join("/");
+ }
+
+ if (subProtocols !== "null") {
+ // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+ // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws.
+ subProtocols = subProtocols
+ .replace(/^ +| +$/g, "")
+ .split(/ *, */);
+
+ opts = subProtocols;
+ }
+
+ // If node we use the ws library.
+ var WebSocketConstructor;
+ {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = "arraybuffer";
+ } catch (e) {
+ throw new FS.ErrnoError(23);
+ }
+ }
+
+ var peer = {
+ addr,
+ port,
+ socket: ws,
+ msg_send_queue: [],
+ };
+
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+
+ // if this is a bound dgram socket, send the port number first to allow
+ // us to override the ephemeral port reported to us by remotePort on the
+ // remote end.
+ if (sock.type === 2 && typeof sock.sport != "undefined") {
+ peer.msg_send_queue.push(
+ new Uint8Array([
+ 255,
+ 255,
+ 255,
+ 255,
+ "p".charCodeAt(0),
+ "o".charCodeAt(0),
+ "r".charCodeAt(0),
+ "t".charCodeAt(0),
+ (sock.sport & 0xff00) >> 8,
+ sock.sport & 0xff,
+ ]),
+ );
+ }
+
+ return peer;
+ },
+ getPeer(sock, addr, port) {
+ return sock.peers[addr + ":" + port];
+ },
+ addPeer(sock, peer) {
+ sock.peers[peer.addr + ":" + peer.port] = peer;
+ },
+ removePeer(sock, peer) {
+ delete sock.peers[peer.addr + ":" + peer.port];
+ },
+ handlePeerEvents(sock, peer) {
+ var first = true;
+
+ var handleOpen = function () {
+ sock.connecting = false;
+ SOCKFS.emit("open", sock.stream.fd);
+
+ try {
+ var queued = peer.msg_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.msg_send_queue.shift();
+ }
+ } catch (e) {
+ // not much we can do here in the way of proper error handling as we've already
+ // lied and said this data was sent. shut it down.
+ peer.socket.close();
+ }
+ };
+
+ function handleMessage(data) {
+ if (typeof data == "string") {
+ var encoder = new TextEncoder(); // should be utf-8
+ data = encoder.encode(data); // make a typed array from the string
+ } else {
+ assert(data.byteLength !== undefined); // must receive an ArrayBuffer
+ if (data.byteLength == 0) {
+ // An empty ArrayBuffer will emit a pseudo disconnect event
+ // as recv/recvmsg will return zero which indicates that a socket
+ // has performed a shutdown although the connection has not been disconnected yet.
+ return;
+ }
+ data = new Uint8Array(data); // make a typed array view on the array buffer
+ }
+
+ // if this is the port message, override the peer's port with it
+ var wasfirst = first;
+ first = false;
+ if (
+ wasfirst &&
+ data.length === 10 &&
+ data[0] === 255 &&
+ data[1] === 255 &&
+ data[2] === 255 &&
+ data[3] === 255 &&
+ data[4] === "p".charCodeAt(0) &&
+ data[5] === "o".charCodeAt(0) &&
+ data[6] === "r".charCodeAt(0) &&
+ data[7] === "t".charCodeAt(0)
+ ) {
+ // update the peer's port and it's key in the peer map
+ var newport = (data[8] << 8) | data[9];
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+
+ sock.recv_queue.push({
+ addr: peer.addr,
+ port: peer.port,
+ data: data,
+ });
+ SOCKFS.emit("message", sock.stream.fd);
+ }
+
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on("open", handleOpen);
+ peer.socket.on("message", function (data, isBinary) {
+ if (!isBinary) {
+ return;
+ }
+ handleMessage(new Uint8Array(data).buffer); // copy from node Buffer -> ArrayBuffer
+ });
+ peer.socket.on("close", function () {
+ SOCKFS.emit("close", sock.stream.fd);
+ });
+ peer.socket.on("error", function (error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+ // is still probably the most useful thing to do.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ SOCKFS.emit("error", [
+ sock.stream.fd,
+ sock.error,
+ "ECONNREFUSED: Connection refused",
+ ]);
+ // don't throw
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function () {
+ SOCKFS.emit("close", sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function (error) {
+ // The WebSocket spec only allows a 'simple event' to be thrown on error,
+ // so we only really know as much as ECONNREFUSED.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ SOCKFS.emit("error", [
+ sock.stream.fd,
+ sock.error,
+ "ECONNREFUSED: Connection refused",
+ ]);
+ };
+ }
+ },
+ poll(sock) {
+ if (sock.type === 1 && sock.server) {
+ // listen sockets should only say they're available for reading
+ // if there are pending clients.
+ return sock.pending.length ? 64 | 1 : 0;
+ }
+
+ var mask = 0;
+ var dest =
+ sock.type === 1
+ ? // we only care about the socket state for connection-based sockets
+ SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport)
+ : null;
+
+ if (
+ sock.recv_queue.length ||
+ !dest || // connection-less sockets are always ready to read
+ (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)
+ ) {
+ // let recv return 0 once closed
+ mask |= 64 | 1;
+ }
+
+ if (
+ !dest || // connection-less sockets are always ready to write
+ (dest && dest.socket.readyState === dest.socket.OPEN)
+ ) {
+ mask |= 4;
+ }
+
+ if (
+ (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)
+ ) {
+ // When an non-blocking connect fails mark the socket as writable.
+ // Its up to the calling code to then use getsockopt with SO_ERROR to
+ // retrieve the error.
+ // See https://man7.org/linux/man-pages/man2/connect.2.html
+ if (sock.connecting) {
+ mask |= 4;
+ } else {
+ mask |= 16;
+ }
+ }
+
+ return mask;
+ },
+ ioctl(sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ HEAP32[arg >> 2] = bytes;
+ return 0;
+ default:
+ return 28;
+ }
+ },
+ close(sock) {
+ // if we've spawned a listen server, close it
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {}
+ sock.server = null;
+ }
+ // close any peer connections
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {}
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },
+ bind(sock, addr, port) {
+ if (
+ typeof sock.saddr != "undefined" ||
+ typeof sock.sport != "undefined"
+ ) {
+ throw new FS.ErrnoError(28); // already bound
+ }
+ sock.saddr = addr;
+ sock.sport = port;
+ // in order to emulate dgram sockets, we need to launch a listen server when
+ // binding on a connection-less socket
+ // note: this is only required on the server side
+ if (sock.type === 2) {
+ // close the existing server if it exists
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ // swallow error operation not supported error that occurs when binding in the
+ // browser where this isn't supported
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e.name === "ErrnoError")) throw e;
+ if (e.errno !== 138) throw e;
+ }
+ }
+ },
+ connect(sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(138);
+ }
+
+ // TODO autobind
+ // if (!sock.addr && sock.type == 2) {
+ // }
+
+ // early out if we're already connected / in the middle of connecting
+ if (
+ typeof sock.daddr != "undefined" &&
+ typeof sock.dport != "undefined"
+ ) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(
+ sock,
+ sock.daddr,
+ sock.dport,
+ );
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(7);
+ } else {
+ throw new FS.ErrnoError(30);
+ }
+ }
+ }
+
+ // add the socket to our peer list and set our
+ // destination address / port to match
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+
+ // because we cannot synchronously block to wait for the WebSocket
+ // connection to complete, we return here pretending that the connection
+ // was a success.
+ sock.connecting = true;
+ },
+ listen(sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(138);
+ }
+ },
+ accept(listensock) {
+ if (!listensock.server || !listensock.pending.length) {
+ throw new FS.ErrnoError(28);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },
+ getname(sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(53);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+ // should we be returning for TCP sockets that've been connect()'d?
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return { addr, port };
+ },
+ sendmsg(sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ // connection-less sockets will honor the message address,
+ // and otherwise fall back to the bound destination address
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // if there was no address to fall back to, error out
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(17);
+ }
+ } else {
+ // connection-based sockets will only use the bound
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+
+ // find the peer for the destination address
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+
+ // early out if not connected with a connection-based socket
+ if (sock.type === 1) {
+ if (
+ !dest ||
+ dest.socket.readyState === dest.socket.CLOSING ||
+ dest.socket.readyState === dest.socket.CLOSED
+ ) {
+ throw new FS.ErrnoError(53);
+ }
+ }
+
+ // create a copy of the incoming data to send, as the WebSocket API
+ // doesn't work entirely with an ArrayBufferView, it'll just send
+ // the entire underlying buffer
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+
+ var data = buffer.slice(offset, offset + length);
+
+ // if we don't have a cached connectionless UDP datagram connection, or
+ // the TCP socket is still connecting, queue the message to be sent upon
+ // connect, and lie, saying the data was sent now.
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ // if we're not connected, open a new connection
+ if (sock.type === 2) {
+ if (
+ !dest ||
+ dest.socket.readyState === dest.socket.CLOSING ||
+ dest.socket.readyState === dest.socket.CLOSED
+ ) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ }
+ dest.msg_send_queue.push(data);
+ return length;
+ }
+
+ try {
+ // send the actual data
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(28);
+ }
+ },
+ recvmsg(sock, length) {
+ // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+ if (sock.type === 1 && sock.server) {
+ // tcp servers should not be recv()'ing on the listen socket
+ throw new FS.ErrnoError(53);
+ }
+
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(
+ sock,
+ sock.daddr,
+ sock.dport,
+ );
+
+ if (!dest) {
+ // if we have a destination address but are not connected, error out
+ throw new FS.ErrnoError(53);
+ }
+ if (
+ dest.socket.readyState === dest.socket.CLOSING ||
+ dest.socket.readyState === dest.socket.CLOSED
+ ) {
+ // return null if the socket has closed
+ return null;
+ }
+ // else, our socket is in a valid state but truly has nothing available
+ throw new FS.ErrnoError(6);
+ }
+ throw new FS.ErrnoError(6);
+ }
+
+ // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+ // requeued TCP data it'll be an ArrayBufferView
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port,
+ };
+
+ // push back any unread data for TCP connections
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(
+ queuedBuffer,
+ queuedOffset + bytesRead,
+ bytesRemaining,
+ );
+ sock.recv_queue.unshift(queued);
+ }
+
+ return res;
+ },
+ },
+ };
+
+ var getSocketFromFD = (fd) => {
+ var socket = SOCKFS.getSocket(fd);
+ if (!socket) throw new FS.ErrnoError(8);
+ return socket;
+ };
+
+ var Sockets = {
+ BUFFER_SIZE: 10240,
+ MAX_BUFFER_SIZE: 10485760,
+ nextFd: 1,
+ fds: {},
+ nextport: 1,
+ maxport: 65535,
+ peer: null,
+ connections: {},
+ portmap: {},
+ localAddr: 4261412874,
+ addrPool: [
+ 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738,
+ 150994954, 167772170, 184549386, 201326602, 218103818, 234881034,
+ ],
+ };
+
+ var inetPton4 = (str) => {
+ var b = str.split(".");
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+ };
+
+ /** @suppress {checkTypes} */
+ var jstoi_q = (str) => parseInt(str);
+ var inetPton6 = (str) => {
+ var words;
+ var w, offset, z, i;
+ /* http://home.deds.nl/~aeron/regex/ */
+ var valid6regx =
+ /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [0, 0, 0, 0, 0, 0, 0, 0];
+ }
+ // Z placeholder to keep track of zeros when splitting the string on ":"
+ if (str.startsWith("::")) {
+ str = str.replace("::", "Z:"); // leading zeros case
+ } else {
+ str = str.replace("::", ":Z:");
+ }
+
+ if (str.indexOf(".") > 0) {
+ // parse IPv4 embedded stress
+ str = str.replace(new RegExp("[.]", "g"), ":");
+ words = str.split(":");
+ words[words.length - 4] =
+ jstoi_q(words[words.length - 4]) +
+ jstoi_q(words[words.length - 3]) * 256;
+ words[words.length - 3] =
+ jstoi_q(words[words.length - 2]) +
+ jstoi_q(words[words.length - 1]) * 256;
+ words = words.slice(0, words.length - 2);
+ } else {
+ words = str.split(":");
+ }
+
+ offset = 0;
+ z = 0;
+ for (w = 0; w < words.length; w++) {
+ if (typeof words[w] == "string") {
+ if (words[w] === "Z") {
+ // compressed zeros - write appropriate number of zero words
+ for (z = 0; z < 8 - words.length + 1; z++) {
+ parts[w + z] = 0;
+ }
+ offset = z - 1;
+ } else {
+ // parse hex to field to 16-bit value and write it in network byte-order
+ parts[w + offset] = _htons(parseInt(words[w], 16));
+ }
+ } else {
+ // parsed IPv4 words
+ parts[w + offset] = words[w];
+ }
+ }
+ return [
+ (parts[1] << 16) | parts[0],
+ (parts[3] << 16) | parts[2],
+ (parts[5] << 16) | parts[4],
+ (parts[7] << 16) | parts[6],
+ ];
+ };
+
+ /** @param {number=} addrlen */
+ var writeSockaddr = (sa, family, addr, port, addrlen) => {
+ switch (family) {
+ case 2:
+ addr = inetPton4(addr);
+ zeroMemory(sa, 16);
+ if (addrlen) {
+ HEAP32[addrlen >> 2] = 16;
+ }
+ HEAP16[sa >> 1] = family;
+ HEAP32[(sa + 4) >> 2] = addr;
+ HEAP16[(sa + 2) >> 1] = _htons(port);
+ break;
+ case 10:
+ addr = inetPton6(addr);
+ zeroMemory(sa, 28);
+ if (addrlen) {
+ HEAP32[addrlen >> 2] = 28;
+ }
+ HEAP32[sa >> 2] = family;
+ HEAP32[(sa + 8) >> 2] = addr[0];
+ HEAP32[(sa + 12) >> 2] = addr[1];
+ HEAP32[(sa + 16) >> 2] = addr[2];
+ HEAP32[(sa + 20) >> 2] = addr[3];
+ HEAP16[(sa + 2) >> 1] = _htons(port);
+ break;
+ default:
+ return 5;
+ }
+ return 0;
+ };
+
+ var DNS = {
+ address_map: {
+ id: 1,
+ addrs: {},
+ names: {},
+ },
+ lookup_name(name) {
+ // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+ var res = inetPton4(name);
+ if (res !== null) {
+ return name;
+ }
+ res = inetPton6(name);
+ if (res !== null) {
+ return name;
+ }
+
+ // See if this name is already mapped.
+ var addr;
+
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, "exceeded max address mappings of 65535");
+
+ addr = "172.29." + (id & 0xff) + "." + (id & 0xff00);
+
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+
+ return addr;
+ },
+ lookup_addr(addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+
+ return null;
+ },
+ };
+ function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) {
+ try {
+ var sock = getSocketFromFD(fd);
+ var newsock = sock.sock_ops.accept(sock);
+ if (addr) {
+ var errno = writeSockaddr(
+ addr,
+ newsock.family,
+ DNS.lookup_name(newsock.daddr),
+ newsock.dport,
+ addrlen,
+ );
+ assert(!errno);
+ }
+ return newsock.stream.fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var inetNtop4 = (addr) =>
+ (addr & 0xff) +
+ "." +
+ ((addr >> 8) & 0xff) +
+ "." +
+ ((addr >> 16) & 0xff) +
+ "." +
+ ((addr >> 24) & 0xff);
+
+ var inetNtop6 = (ints) => {
+ // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+ // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
+ // 128-bits are split into eight 16-bit words
+ // stored in network byte order (big-endian)
+ // | 80 bits | 16 | 32 bits |
+ // +-----------------------------------------------------------------+
+ // | 10 bytes | 2 | 4 bytes |
+ // +--------------------------------------+--------------------------+
+ // + 5 words | 1 | 2 words |
+ // +--------------------------------------+--------------------------+
+ // |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
+ // +--------------------------------------+----+---------------------+
+ // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
+ // +--------------------------------------+----+---------------------+
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [
+ ints[0] & 0xffff,
+ ints[0] >> 16,
+ ints[1] & 0xffff,
+ ints[1] >> 16,
+ ints[2] & 0xffff,
+ ints[2] >> 16,
+ ints[3] & 0xffff,
+ ints[3] >> 16,
+ ];
+
+ // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+
+ var hasipv4 = true;
+ var v4part = "";
+ // check if the 10 high-order bytes are all zeros (first 5 words)
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) {
+ hasipv4 = false;
+ break;
+ }
+ }
+
+ if (hasipv4) {
+ // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+ v4part = inetNtop4(parts[6] | (parts[7] << 16));
+ // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+ if (parts[5] === 0) {
+ str = "::";
+ //special case IPv6 addresses
+ if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
+ if (v4part === "0.0.0.1") v4part = "1"; // loopback address
+ str += v4part;
+ return str;
+ }
+ }
+
+ // Handle all other IPv6 addresses
+
+ // first run to find the longest contiguous zero words
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ // compress contiguous zeros - to produce "::"
+ if (parts[word] === 0 && word >= zstart && word < zstart + longest) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":"; //leading zeros case
+ }
+ continue;
+ }
+ }
+ // converts 16-bit words from big-endian to little-endian before converting to hex string
+ str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+ };
+
+ var readSockaddr = (sa, salen) => {
+ // family / port offsets are common to both sockaddr_in and sockaddr_in6
+ var family = HEAP16[sa >> 1];
+ var port = _ntohs(HEAPU16[(sa + 2) >> 1]);
+ var addr;
+
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return { errno: 28 };
+ }
+ addr = HEAP32[(sa + 4) >> 2];
+ addr = inetNtop4(addr);
+ break;
+ case 10:
+ if (salen !== 28) {
+ return { errno: 28 };
+ }
+ addr = [
+ HEAP32[(sa + 8) >> 2],
+ HEAP32[(sa + 12) >> 2],
+ HEAP32[(sa + 16) >> 2],
+ HEAP32[(sa + 20) >> 2],
+ ];
+ addr = inetNtop6(addr);
+ break;
+ default:
+ return { errno: 5 };
+ }
+
+ return { family: family, addr: addr, port: port };
+ };
+
+ var getSocketAddress = (addrp, addrlen) => {
+ var info = readSockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ };
+ function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) {
+ try {
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.bind(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_chdir(path) {
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.chdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_chmod(path, mode) {
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.chmod(path, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
+ try {
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.connect(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_dup(fd) {
+ try {
+ var old = SYSCALLS.getStreamFromFD(fd);
+ return FS.dupStream(old).fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_faccessat(dirfd, path, amode, flags) {
+ try {
+ path = SYSCALLS.getStr(path);
+ assert(flags === 0 || flags == 512);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (amode & ~7) {
+ // need a valid mode
+ return -28;
+ }
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node) {
+ return -44;
+ }
+ var perms = "";
+ if (amode & 4) perms += "r";
+ if (amode & 2) perms += "w";
+ if (amode & 1) perms += "x";
+ if (
+ perms /* otherwise, they've just passed F_OK */ &&
+ FS.nodePermissions(node, perms)
+ ) {
+ return -2;
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fchownat(dirfd, path, owner, group, flags) {
+ try {
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ flags = flags & ~256;
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ (nofollow ? FS.lchown : FS.chown)(path, owner, group);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ /** @suppress {duplicate } */
+ var syscallGetVarargI = () => {
+ assert(SYSCALLS.varargs != undefined);
+ // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number.
+ var ret = HEAP32[+SYSCALLS.varargs >> 2];
+ SYSCALLS.varargs += 4;
+ return ret;
+ };
+ var syscallGetVarargP = syscallGetVarargI;
+
+ function ___syscall_fcntl64(fd, cmd, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (cmd) {
+ case 0: {
+ var arg = syscallGetVarargI();
+ if (arg < 0) {
+ return -28;
+ }
+ while (FS.streams[arg]) {
+ arg++;
+ }
+ var newStream;
+ newStream = FS.dupStream(stream, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = syscallGetVarargI();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 12: {
+ var arg = syscallGetVarargP();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(arg + offset) >> 1] = 2;
+ return 0;
+ }
+ case 13:
+ case 14:
+ return 0; // Pretend that the locking is successful.
+ }
+ return -28;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fdatasync(fd) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fstat64(fd, buf) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return SYSCALLS.doStat(FS.stat, stream.path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var convertI32PairToI53Checked = (lo, hi) => {
+ assert(lo == lo >>> 0 || lo == (lo | 0)); // lo should either be a i32 or a u32
+ assert(hi === (hi | 0)); // hi should be a i32
+ return (hi + 0x200000) >>> 0 < 0x400001 - !!lo
+ ? (lo >>> 0) + hi * 4294967296
+ : NaN;
+ };
+ function ___syscall_ftruncate64(fd, length_low, length_high) {
+ var length = convertI32PairToI53Checked(length_low, length_high);
+
+ try {
+ if (isNaN(length)) return 61;
+ FS.ftruncate(fd, length);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var stringToUTF8 = (str, outPtr, maxBytesToWrite) => {
+ assert(
+ typeof maxBytesToWrite == "number",
+ "stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!",
+ );
+ return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
+ };
+ function ___syscall_getcwd(buf, size) {
+ try {
+ if (size === 0) return -28;
+ var cwd = FS.cwd();
+ var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
+ if (size < cwdLengthInBytes) return -68;
+ stringToUTF8(cwd, buf, size);
+ return cwdLengthInBytes;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getdents64(fd, dirp, count) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ stream.getdents ||= FS.readdir(stream.path);
+
+ var struct_size = 280;
+ var pos = 0;
+ var off = FS.llseek(stream, 0, 1);
+
+ var startIdx = Math.floor(off / struct_size);
+ var endIdx = Math.min(
+ stream.getdents.length,
+ startIdx + Math.floor(count / struct_size),
+ );
+ for (var idx = startIdx; idx < endIdx; idx++) {
+ var id;
+ var type;
+ var name = stream.getdents[idx];
+ if (name === ".") {
+ id = stream.node.id;
+ type = 4; // DT_DIR
+ } else if (name === "..") {
+ var lookup = FS.lookupPath(stream.path, { parent: true });
+ id = lookup.node.id;
+ type = 4; // DT_DIR
+ } else {
+ var child;
+ try {
+ child = FS.lookupNode(stream.node, name);
+ } catch (e) {
+ // If the entry is not a directory, file, or symlink, nodefs
+ // lookupNode will raise EINVAL. Skip these and continue.
+ if (e?.errno === 28) {
+ continue;
+ }
+ throw e;
+ }
+ id = child.id;
+ type = FS.isChrdev(child.mode)
+ ? 2
+ : // DT_CHR, character device.
+ FS.isDir(child.mode)
+ ? 4
+ : // DT_DIR, directory.
+ FS.isLink(child.mode)
+ ? 10
+ : // DT_LNK, symbolic link.
+ 8; // DT_REG, regular file.
+ }
+ assert(id);
+ (tempI64 = [
+ id >>> 0,
+ ((tempDouble = id),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(dirp + pos) >> 2] = tempI64[0]),
+ (HEAP32[(dirp + pos + 4) >> 2] = tempI64[1]);
+ (tempI64 = [
+ ((idx + 1) * struct_size) >>> 0,
+ ((tempDouble = (idx + 1) * struct_size),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(dirp + pos + 8) >> 2] = tempI64[0]),
+ (HEAP32[(dirp + pos + 12) >> 2] = tempI64[1]);
+ HEAP16[(dirp + pos + 16) >> 1] = 280;
+ HEAP8[dirp + pos + 18] = type;
+ stringToUTF8(name, dirp + pos + 19, 256);
+ pos += struct_size;
+ }
+ FS.llseek(stream, idx * struct_size, 0);
+ return pos;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getpeername(fd, addr, addrlen, d1, d2, d3) {
+ try {
+ var sock = getSocketFromFD(fd);
+ if (!sock.daddr) {
+ return -53; // The socket is not connected.
+ }
+ var errno = writeSockaddr(
+ addr,
+ sock.family,
+ DNS.lookup_name(sock.daddr),
+ sock.dport,
+ addrlen,
+ );
+ assert(!errno);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) {
+ try {
+ var sock = getSocketFromFD(fd);
+ // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname
+ var errno = writeSockaddr(
+ addr,
+ sock.family,
+ DNS.lookup_name(sock.saddr || "0.0.0.0"),
+ sock.sport,
+ addrlen,
+ );
+ assert(!errno);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) {
+ try {
+ var sock = getSocketFromFD(fd);
+ // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211
+ // so only supports SOL_SOCKET with SO_ERROR.
+ if (level === 1) {
+ if (optname === 4) {
+ HEAP32[optval >> 2] = sock.error;
+ HEAP32[optlen >> 2] = 4;
+ sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field).
+ return 0;
+ }
+ }
+ return -50; // The option is unknown at the level indicated.
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_ioctl(fd, op, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (op) {
+ case 21509: {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21505: {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcgets) {
+ var termios = stream.tty.ops.ioctl_tcgets(stream);
+ var argp = syscallGetVarargP();
+ HEAP32[argp >> 2] = termios.c_iflag || 0;
+ HEAP32[(argp + 4) >> 2] = termios.c_oflag || 0;
+ HEAP32[(argp + 8) >> 2] = termios.c_cflag || 0;
+ HEAP32[(argp + 12) >> 2] = termios.c_lflag || 0;
+ for (var i = 0; i < 32; i++) {
+ HEAP8[argp + i + 17] = termios.c_cc[i] || 0;
+ }
+ return 0;
+ }
+ return 0;
+ }
+ case 21510:
+ case 21511:
+ case 21512: {
+ if (!stream.tty) return -59;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21506:
+ case 21507:
+ case 21508: {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcsets) {
+ var argp = syscallGetVarargP();
+ var c_iflag = HEAP32[argp >> 2];
+ var c_oflag = HEAP32[(argp + 4) >> 2];
+ var c_cflag = HEAP32[(argp + 8) >> 2];
+ var c_lflag = HEAP32[(argp + 12) >> 2];
+ var c_cc = [];
+ for (var i = 0; i < 32; i++) {
+ c_cc.push(HEAP8[argp + i + 17]);
+ }
+ return stream.tty.ops.ioctl_tcsets(stream.tty, op, {
+ c_iflag,
+ c_oflag,
+ c_cflag,
+ c_lflag,
+ c_cc,
+ });
+ }
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -59;
+ var argp = syscallGetVarargP();
+ HEAP32[argp >> 2] = 0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -59;
+ return -28; // not supported
+ }
+ case 21531: {
+ var argp = syscallGetVarargP();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tiocgwinsz) {
+ var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
+ var argp = syscallGetVarargP();
+ HEAP16[argp >> 1] = winsize[0];
+ HEAP16[(argp + 2) >> 1] = winsize[1];
+ }
+ return 0;
+ }
+ case 21524: {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21515: {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ default:
+ return -28; // not supported
+ }
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_listen(fd, backlog) {
+ try {
+ var sock = getSocketFromFD(fd);
+ sock.sock_ops.listen(sock, backlog);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_lstat64(path, buf) {
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.lstat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_mkdirat(dirfd, path, mode) {
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_newfstatat(dirfd, path, buf, flags) {
+ try {
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ var allowEmpty = flags & 4096;
+ flags = flags & ~6400;
+ assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`);
+ path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+ return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_openat(dirfd, path, flags, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ var mode = varargs ? syscallGetVarargI() : 0;
+ return FS.open(path, flags, mode).fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var PIPEFS = {
+ BUCKET_BUFFER_SIZE: 8192,
+ mount(mount) {
+ // Do not pollute the real root directory or its child nodes with pipes
+ // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way
+ return FS.createNode(null, "/", 16384 | 0o777, 0);
+ },
+ createPipe() {
+ var pipe = {
+ buckets: [],
+ // refcnt 2 because pipe has a read end and a write end. We need to be
+ // able to read from the read end after write end is closed.
+ refcnt: 2,
+ };
+
+ pipe.buckets.push({
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0,
+ });
+
+ var rName = PIPEFS.nextname();
+ var wName = PIPEFS.nextname();
+ var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
+ var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
+
+ rNode.pipe = pipe;
+ wNode.pipe = pipe;
+
+ var readableStream = FS.createStream({
+ path: rName,
+ node: rNode,
+ flags: 0,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops,
+ });
+ rNode.stream = readableStream;
+
+ var writableStream = FS.createStream({
+ path: wName,
+ node: wNode,
+ flags: 1,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops,
+ });
+ wNode.stream = writableStream;
+
+ return {
+ readable_fd: readableStream.fd,
+ writable_fd: writableStream.fd,
+ };
+ },
+ stream_ops: {
+ poll(stream) {
+ var pipe = stream.node.pipe;
+
+ if ((stream.flags & 2097155) === 1) {
+ return 256 | 4;
+ }
+ if (pipe.buckets.length > 0) {
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ if (bucket.offset - bucket.roffset > 0) {
+ return 64 | 1;
+ }
+ }
+ }
+
+ return 0;
+ },
+ ioctl(stream, request, varargs) {
+ return 28;
+ },
+ fsync(stream) {
+ return 28;
+ },
+ read(stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+ var currentLength = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ currentLength += bucket.offset - bucket.roffset;
+ }
+
+ assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ if (length <= 0) {
+ return 0;
+ }
+ if (currentLength == 0) {
+ // Behave as if the read end is always non-blocking
+ throw new FS.ErrnoError(6);
+ }
+ var toRead = Math.min(currentLength, length);
+
+ var totalRead = toRead;
+ var toRemove = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var currBucket = pipe.buckets[i];
+ var bucketSize = currBucket.offset - currBucket.roffset;
+
+ if (toRead <= bucketSize) {
+ var tmpSlice = currBucket.buffer.subarray(
+ currBucket.roffset,
+ currBucket.offset,
+ );
+ if (toRead < bucketSize) {
+ tmpSlice = tmpSlice.subarray(0, toRead);
+ currBucket.roffset += toRead;
+ } else {
+ toRemove++;
+ }
+ data.set(tmpSlice);
+ break;
+ } else {
+ var tmpSlice = currBucket.buffer.subarray(
+ currBucket.roffset,
+ currBucket.offset,
+ );
+ data.set(tmpSlice);
+ data = data.subarray(tmpSlice.byteLength);
+ toRead -= tmpSlice.byteLength;
+ toRemove++;
+ }
+ }
+
+ if (toRemove && toRemove == pipe.buckets.length) {
+ // Do not generate excessive garbage in use cases such as
+ // write several bytes, read everything, write several bytes, read everything...
+ toRemove--;
+ pipe.buckets[toRemove].offset = 0;
+ pipe.buckets[toRemove].roffset = 0;
+ }
+
+ pipe.buckets.splice(0, toRemove);
+
+ return totalRead;
+ },
+ write(stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+
+ assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ var dataLen = data.byteLength;
+ if (dataLen <= 0) {
+ return 0;
+ }
+
+ var currBucket = null;
+
+ if (pipe.buckets.length == 0) {
+ currBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0,
+ };
+ pipe.buckets.push(currBucket);
+ } else {
+ currBucket = pipe.buckets[pipe.buckets.length - 1];
+ }
+
+ assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
+
+ var freeBytesInCurrBuffer =
+ PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
+ if (freeBytesInCurrBuffer >= dataLen) {
+ currBucket.buffer.set(data, currBucket.offset);
+ currBucket.offset += dataLen;
+ return dataLen;
+ } else if (freeBytesInCurrBuffer > 0) {
+ currBucket.buffer.set(
+ data.subarray(0, freeBytesInCurrBuffer),
+ currBucket.offset,
+ );
+ currBucket.offset += freeBytesInCurrBuffer;
+ data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
+ }
+
+ var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
+ var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
+
+ for (var i = 0; i < numBuckets; i++) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: PIPEFS.BUCKET_BUFFER_SIZE,
+ roffset: 0,
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
+ data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
+ }
+
+ if (remElements > 0) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: data.byteLength,
+ roffset: 0,
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data);
+ }
+
+ return dataLen;
+ },
+ close(stream) {
+ var pipe = stream.node.pipe;
+ pipe.refcnt--;
+ if (pipe.refcnt === 0) {
+ pipe.buckets = null;
+ }
+ },
+ },
+ nextname() {
+ if (!PIPEFS.nextname.current) {
+ PIPEFS.nextname.current = 0;
+ }
+ return "pipe[" + PIPEFS.nextname.current++ + "]";
+ },
+ };
+ function ___syscall_pipe(fdPtr) {
+ try {
+ if (fdPtr == 0) {
+ throw new FS.ErrnoError(21);
+ }
+
+ var res = PIPEFS.createPipe();
+
+ HEAP32[fdPtr >> 2] = res.readable_fd;
+ HEAP32[(fdPtr + 4) >> 2] = res.writable_fd;
+
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_poll(fds, nfds, timeout) {
+ try {
+ var nonzero = 0;
+ for (var i = 0; i < nfds; i++) {
+ var pollfd = fds + 8 * i;
+ var fd = HEAP32[pollfd >> 2];
+ var events = HEAP16[(pollfd + 4) >> 1];
+ var mask = 32;
+ var stream = FS.getStream(fd);
+ if (stream) {
+ mask = SYSCALLS.DEFAULT_POLLMASK;
+ if (stream.stream_ops.poll) {
+ mask = stream.stream_ops.poll(stream, -1);
+ }
+ }
+ mask &= events | 8 | 16;
+ if (mask) nonzero++;
+ HEAP16[(pollfd + 6) >> 1] = mask;
+ }
+ return nonzero;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (bufsize <= 0) return -28;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf + len];
+ stringToUTF8(ret, buf, bufsize + 1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf + len] = endChar;
+ return len;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+ try {
+ var sock = getSocketFromFD(fd);
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0; // socket is closed
+ if (addr) {
+ var errno = writeSockaddr(
+ addr,
+ sock.family,
+ DNS.lookup_name(msg.addr),
+ msg.port,
+ addrlen,
+ );
+ assert(!errno);
+ }
+ HEAPU8.set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+ try {
+ oldpath = SYSCALLS.getStr(oldpath);
+ newpath = SYSCALLS.getStr(newpath);
+ oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+ newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+ FS.rename(oldpath, newpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_rmdir(path) {
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.rmdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+ try {
+ var sock = getSocketFromFD(fd);
+ if (!addr) {
+ // send, no address provided
+ return FS.write(sock.stream, HEAP8, message, length);
+ }
+ var dest = getSocketAddress(addr, addr_len);
+ // sendto an address
+ return sock.sock_ops.sendmsg(
+ sock,
+ HEAP8,
+ message,
+ length,
+ dest.addr,
+ dest.port,
+ );
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_socket(domain, type, protocol) {
+ try {
+ var sock = SOCKFS.createSocket(domain, type, protocol);
+ assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63
+ return sock.stream.fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_stat64(path, buf) {
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_statfs64(path, size, buf) {
+ try {
+ assert(size === 64);
+ var stats = FS.statfs(SYSCALLS.getStr(path));
+ HEAP32[(buf + 4) >> 2] = stats.bsize;
+ HEAP32[(buf + 40) >> 2] = stats.bsize;
+ HEAP32[(buf + 8) >> 2] = stats.blocks;
+ HEAP32[(buf + 12) >> 2] = stats.bfree;
+ HEAP32[(buf + 16) >> 2] = stats.bavail;
+ HEAP32[(buf + 20) >> 2] = stats.files;
+ HEAP32[(buf + 24) >> 2] = stats.ffree;
+ HEAP32[(buf + 28) >> 2] = stats.fsid;
+ HEAP32[(buf + 44) >> 2] = stats.flags; // ST_NOSUID
+ HEAP32[(buf + 36) >> 2] = stats.namelen;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_symlinkat(target, dirfd, linkpath) {
+ try {
+ target = SYSCALLS.getStr(target);
+ linkpath = SYSCALLS.getStr(linkpath);
+ linkpath = SYSCALLS.calculateAt(dirfd, linkpath);
+ FS.symlink(target, linkpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_unlinkat(dirfd, path, flags) {
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (flags === 0) {
+ FS.unlink(path);
+ } else if (flags === 512) {
+ FS.rmdir(path);
+ } else {
+ abort("Invalid flags passed to unlinkat");
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var readI53FromI64 = (ptr) => {
+ return HEAPU32[ptr >> 2] + HEAP32[(ptr + 4) >> 2] * 4294967296;
+ };
+
+ function ___syscall_utimensat(dirfd, path, times, flags) {
+ try {
+ path = SYSCALLS.getStr(path);
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path, true);
+ var now = Date.now(),
+ atime,
+ mtime;
+ if (!times) {
+ atime = now;
+ mtime = now;
+ } else {
+ var seconds = readI53FromI64(times);
+ var nanoseconds = HEAP32[(times + 8) >> 2];
+ if (nanoseconds == 1073741823) {
+ atime = now;
+ } else if (nanoseconds == 1073741822) {
+ atime = null;
+ } else {
+ atime = seconds * 1000 + nanoseconds / (1000 * 1000);
+ }
+ times += 16;
+ seconds = readI53FromI64(times);
+ nanoseconds = HEAP32[(times + 8) >> 2];
+ if (nanoseconds == 1073741823) {
+ mtime = now;
+ } else if (nanoseconds == 1073741822) {
+ mtime = null;
+ } else {
+ mtime = seconds * 1000 + nanoseconds / (1000 * 1000);
+ }
+ }
+ // null here means UTIME_OMIT was passed. If both were set to UTIME_OMIT then
+ // we can skip the call completely.
+ if ((mtime ?? atime) !== null) {
+ FS.utime(path, atime, mtime);
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var __abort_js = () => abort("native code called abort()");
+
+ var __emscripten_lookup_name = (name) => {
+ // uint32_t _emscripten_lookup_name(const char *name);
+ var nameString = UTF8ToString(name);
+ return inetPton4(DNS.lookup_name(nameString));
+ };
+
+ var __emscripten_memcpy_js = (dest, src, num) =>
+ HEAPU8.copyWithin(dest, src, src + num);
+
+ var runtimeKeepaliveCounter = 0;
+ var __emscripten_runtime_keepalive_clear = () => {
+ noExitRuntime = false;
+ runtimeKeepaliveCounter = 0;
+ };
+
+ var __emscripten_throw_longjmp = () => {
+ throw Infinity;
+ };
+
+ function __gmtime_js(time_low, time_high, tmPtr) {
+ var time = convertI32PairToI53Checked(time_low, time_high);
+
+ var date = new Date(time * 1000);
+ HEAP32[tmPtr >> 2] = date.getUTCSeconds();
+ HEAP32[(tmPtr + 4) >> 2] = date.getUTCMinutes();
+ HEAP32[(tmPtr + 8) >> 2] = date.getUTCHours();
+ HEAP32[(tmPtr + 12) >> 2] = date.getUTCDate();
+ HEAP32[(tmPtr + 16) >> 2] = date.getUTCMonth();
+ HEAP32[(tmPtr + 20) >> 2] = date.getUTCFullYear() - 1900;
+ HEAP32[(tmPtr + 24) >> 2] = date.getUTCDay();
+ var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
+ var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24)) | 0;
+ HEAP32[(tmPtr + 28) >> 2] = yday;
+ }
+
+ var isLeapYear = (year) =>
+ year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
+
+ var MONTH_DAYS_LEAP_CUMULATIVE = [
+ 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335,
+ ];
+
+ var MONTH_DAYS_REGULAR_CUMULATIVE = [
+ 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334,
+ ];
+ var ydayFromDate = (date) => {
+ var leap = isLeapYear(date.getFullYear());
+ var monthDaysCumulative = leap
+ ? MONTH_DAYS_LEAP_CUMULATIVE
+ : MONTH_DAYS_REGULAR_CUMULATIVE;
+ var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1
+
+ return yday;
+ };
+
+ function __localtime_js(time_low, time_high, tmPtr) {
+ var time = convertI32PairToI53Checked(time_low, time_high);
+
+ var date = new Date(time * 1000);
+ HEAP32[tmPtr >> 2] = date.getSeconds();
+ HEAP32[(tmPtr + 4) >> 2] = date.getMinutes();
+ HEAP32[(tmPtr + 8) >> 2] = date.getHours();
+ HEAP32[(tmPtr + 12) >> 2] = date.getDate();
+ HEAP32[(tmPtr + 16) >> 2] = date.getMonth();
+ HEAP32[(tmPtr + 20) >> 2] = date.getFullYear() - 1900;
+ HEAP32[(tmPtr + 24) >> 2] = date.getDay();
+
+ var yday = ydayFromDate(date) | 0;
+ HEAP32[(tmPtr + 28) >> 2] = yday;
+ HEAP32[(tmPtr + 36) >> 2] = -(date.getTimezoneOffset() * 60);
+
+ // Attention: DST is in December in South, and some regions don't have DST at all.
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dst =
+ (summerOffset != winterOffset &&
+ date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
+ HEAP32[(tmPtr + 32) >> 2] = dst;
+ }
+
+ /** @suppress {duplicate } */
+ var setTempRet0 = (val) => __emscripten_tempret_set(val);
+ var _setTempRet0 = setTempRet0;
+
+ var __mktime_js = function (tmPtr) {
+ var ret = (() => {
+ var date = new Date(
+ HEAP32[(tmPtr + 20) >> 2] + 1900,
+ HEAP32[(tmPtr + 16) >> 2],
+ HEAP32[(tmPtr + 12) >> 2],
+ HEAP32[(tmPtr + 8) >> 2],
+ HEAP32[(tmPtr + 4) >> 2],
+ HEAP32[tmPtr >> 2],
+ 0,
+ );
+
+ // There's an ambiguous hour when the time goes back; the tm_isdst field is
+ // used to disambiguate it. Date() basically guesses, so we fix it up if it
+ // guessed wrong, or fill in tm_isdst with the guess if it's -1.
+ var dst = HEAP32[(tmPtr + 32) >> 2];
+ var guessedOffset = date.getTimezoneOffset();
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(
+ date.getFullYear(),
+ 6,
+ 1,
+ ).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South
+ if (dst < 0) {
+ // Attention: some regions don't have DST at all.
+ HEAP32[(tmPtr + 32) >> 2] = Number(
+ summerOffset != winterOffset && dstOffset == guessedOffset,
+ );
+ } else if (dst > 0 != (dstOffset == guessedOffset)) {
+ var nonDstOffset = Math.max(winterOffset, summerOffset);
+ var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
+ // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up.
+ date.setTime(date.getTime() + (trueOffset - guessedOffset) * 60000);
+ }
+
+ HEAP32[(tmPtr + 24) >> 2] = date.getDay();
+ var yday = ydayFromDate(date) | 0;
+ HEAP32[(tmPtr + 28) >> 2] = yday;
+ // To match expected behavior, update fields from date
+ HEAP32[tmPtr >> 2] = date.getSeconds();
+ HEAP32[(tmPtr + 4) >> 2] = date.getMinutes();
+ HEAP32[(tmPtr + 8) >> 2] = date.getHours();
+ HEAP32[(tmPtr + 12) >> 2] = date.getDate();
+ HEAP32[(tmPtr + 16) >> 2] = date.getMonth();
+ HEAP32[(tmPtr + 20) >> 2] = date.getYear();
+
+ var timeMs = date.getTime();
+ if (isNaN(timeMs)) {
+ return -1;
+ }
+ // Return time in microseconds
+ return timeMs / 1000;
+ })();
+ return (
+ setTempRet0(
+ ((tempDouble = ret),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ),
+ ret >>> 0
+ );
+ };
+
+ function __mmap_js(
+ len,
+ prot,
+ flags,
+ fd,
+ offset_low,
+ offset_high,
+ allocated,
+ addr,
+ ) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+
+ try {
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var res = FS.mmap(stream, len, offset, prot, flags);
+ var ptr = res.ptr;
+ HEAP32[allocated >> 2] = res.allocated;
+ HEAPU32[addr >> 2] = ptr;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ function __munmap_js(addr, len, prot, flags, fd, offset_low, offset_high) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (prot & 2) {
+ SYSCALLS.doMsync(addr, stream, len, flags, offset);
+ }
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+ }
+
+ var timers = {};
+
+ var handleException = (e) => {
+ // Certain exception types we do not treat as errors since they are used for
+ // internal control flow.
+ // 1. ExitStatus, which is thrown by exit()
+ // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
+ // that wish to return to JS event loop.
+ if (e instanceof ExitStatus || e == "unwind") {
+ return EXITSTATUS;
+ }
+ checkStackCookie();
+ if (e instanceof WebAssembly.RuntimeError) {
+ if (_emscripten_stack_get_current() <= 0) {
+ err(
+ "Stack overflow detected. You can try increasing -sSTACK_SIZE (currently set to 65536)",
+ );
+ }
+ }
+ quit_(1, e);
+ };
+
+ var keepRuntimeAlive = () => noExitRuntime || runtimeKeepaliveCounter > 0;
+ var _proc_exit = (code) => {
+ EXITSTATUS = code;
+ if (!keepRuntimeAlive()) {
+ Module["onExit"]?.(code);
+ ABORT = true;
+ }
+ quit_(code, new ExitStatus(code));
+ };
+
+ /** @suppress {duplicate } */
+ /** @param {boolean|number=} implicit */
+ var exitJS = (status, implicit) => {
+ EXITSTATUS = status;
+
+ checkUnflushedContent();
+
+ // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down
+ if (keepRuntimeAlive() && !implicit) {
+ var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`;
+ readyPromiseReject(msg);
+ err(msg);
+ }
+
+ _proc_exit(status);
+ };
+ var _exit = exitJS;
+
+ var maybeExit = () => {
+ if (!keepRuntimeAlive()) {
+ try {
+ _exit(EXITSTATUS);
+ } catch (e) {
+ handleException(e);
+ }
+ }
+ };
+ var callUserCallback = (func) => {
+ if (ABORT) {
+ err(
+ "user callback triggered after runtime exited or application aborted. Ignoring.",
+ );
+ return;
+ }
+ try {
+ func();
+ maybeExit();
+ } catch (e) {
+ handleException(e);
+ }
+ };
+
+ var _emscripten_get_now = () => performance.now();
+ var __setitimer_js = (which, timeout_ms) => {
+ // First, clear any existing timer.
+ if (timers[which]) {
+ clearTimeout(timers[which].id);
+ delete timers[which];
+ }
+
+ // A timeout of zero simply cancels the current timeout so we have nothing
+ // more to do.
+ if (!timeout_ms) return 0;
+
+ var id = setTimeout(() => {
+ assert(which in timers);
+ delete timers[which];
+ callUserCallback(() =>
+ __emscripten_timeout(which, _emscripten_get_now()),
+ );
+ }, timeout_ms);
+ timers[which] = { id, timeout_ms };
+ return 0;
+ };
+
+ var __tzset_js = (timezone, daylight, std_name, dst_name) => {
+ // TODO: Use (malleable) environment variables instead of system settings.
+ var currentYear = new Date().getFullYear();
+ var winter = new Date(currentYear, 0, 1);
+ var summer = new Date(currentYear, 6, 1);
+ var winterOffset = winter.getTimezoneOffset();
+ var summerOffset = summer.getTimezoneOffset();
+
+ // Local standard timezone offset. Local standard time is not adjusted for
+ // daylight savings. This code uses the fact that getTimezoneOffset returns
+ // a greater value during Standard Time versus Daylight Saving Time (DST).
+ // Thus it determines the expected output during Standard Time, and it
+ // compares whether the output of the given date the same (Standard) or less
+ // (DST).
+ var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+
+ // timezone is specified as seconds west of UTC ("The external variable
+ // `timezone` shall be set to the difference, in seconds, between
+ // Coordinated Universal Time (UTC) and local standard time."), the same
+ // as returned by stdTimezoneOffset.
+ // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
+ HEAPU32[timezone >> 2] = stdTimezoneOffset * 60;
+
+ HEAP32[daylight >> 2] = Number(winterOffset != summerOffset);
+
+ var extractZone = (timezoneOffset) => {
+ // Why inverse sign?
+ // Read here https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/getTimezoneOffset
+ var sign = timezoneOffset >= 0 ? "-" : "+";
+
+ var absOffset = Math.abs(timezoneOffset);
+ var hours = String(Math.floor(absOffset / 60)).padStart(2, "0");
+ var minutes = String(absOffset % 60).padStart(2, "0");
+
+ return `UTC${sign}${hours}${minutes}`;
+ };
+
+ var winterName = extractZone(winterOffset);
+ var summerName = extractZone(summerOffset);
+ assert(winterName);
+ assert(summerName);
+ assert(
+ lengthBytesUTF8(winterName) <= 16,
+ `timezone name truncated to fit in TZNAME_MAX (${winterName})`,
+ );
+ assert(
+ lengthBytesUTF8(summerName) <= 16,
+ `timezone name truncated to fit in TZNAME_MAX (${summerName})`,
+ );
+ if (summerOffset < winterOffset) {
+ // Northern hemisphere
+ stringToUTF8(winterName, std_name, 17);
+ stringToUTF8(summerName, dst_name, 17);
+ } else {
+ stringToUTF8(winterName, dst_name, 17);
+ stringToUTF8(summerName, std_name, 17);
+ }
+ };
+
+ var _emscripten_date_now = () => Date.now();
+
+ var nowIsMonotonic = 1;
+
+ var checkWasiClock = (clock_id) => clock_id >= 0 && clock_id <= 3;
+
+ function _clock_time_get(
+ clk_id,
+ ignored_precision_low,
+ ignored_precision_high,
+ ptime,
+ ) {
+ var ignored_precision = convertI32PairToI53Checked(
+ ignored_precision_low,
+ ignored_precision_high,
+ );
+
+ if (!checkWasiClock(clk_id)) {
+ return 28;
+ }
+ var now;
+ // all wasi clocks but realtime are monotonic
+ if (clk_id === 0) {
+ now = _emscripten_date_now();
+ } else if (nowIsMonotonic) {
+ now = _emscripten_get_now();
+ } else {
+ return 52;
+ }
+ // "now" is in ms, and wasi times are in ns.
+ var nsec = Math.round(now * 1000 * 1000);
+ (tempI64 = [
+ nsec >>> 0,
+ ((tempDouble = nsec),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[ptime >> 2] = tempI64[0]),
+ (HEAP32[(ptime + 4) >> 2] = tempI64[1]);
+ return 0;
+ }
+
+ var _emscripten_err = (str) => err(UTF8ToString(str));
+
+ var getHeapMax = () => HEAPU8.length;
+ var _emscripten_get_heap_max = () => getHeapMax();
+
+ var abortOnCannotGrowMemory = (requestedSize) => {
+ abort(
+ `Cannot enlarge memory arrays to size ${requestedSize} bytes (OOM). Either (1) compile with -sINITIAL_MEMORY=X with X higher than the current value ${HEAP8.length}, (2) compile with -sALLOW_MEMORY_GROWTH which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -sABORTING_MALLOC=0`,
+ );
+ };
+ var _emscripten_resize_heap = (requestedSize) => {
+ var oldSize = HEAPU8.length;
+ // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+ requestedSize >>>= 0;
+ abortOnCannotGrowMemory(requestedSize);
+ };
+
+ var ENV = {};
+
+ var getExecutableName = () => thisProgram || "./this.program";
+ var getEnvStrings = () => {
+ if (!getEnvStrings.strings) {
+ // Default values.
+ // Browser language detection #8751
+ var lang =
+ (
+ (typeof navigator == "object" &&
+ navigator.languages &&
+ navigator.languages[0]) ||
+ "C"
+ ).replace("-", "_") + ".UTF-8";
+ var env = {
+ USER: "web_user",
+ LOGNAME: "web_user",
+ PATH: "/",
+ PWD: "/",
+ HOME: "/home/web_user",
+ LANG: lang,
+ _: getExecutableName(),
+ };
+ // Apply the user-provided values, if any.
+ for (var x in ENV) {
+ // x is a key in ENV; if ENV[x] is undefined, that means it was
+ // explicitly set to be so. We allow user code to do that to
+ // force variables with default values to remain unset.
+ if (ENV[x] === undefined) delete env[x];
+ else env[x] = ENV[x];
+ }
+ var strings = [];
+ for (var x in env) {
+ strings.push(`${x}=${env[x]}`);
+ }
+ getEnvStrings.strings = strings;
+ }
+ return getEnvStrings.strings;
+ };
+
+ var stringToAscii = (str, buffer) => {
+ for (var i = 0; i < str.length; ++i) {
+ assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff));
+ HEAP8[buffer++] = str.charCodeAt(i);
+ }
+ // Null-terminate the string
+ HEAP8[buffer] = 0;
+ };
+ var _environ_get = (__environ, environ_buf) => {
+ var bufSize = 0;
+ getEnvStrings().forEach((string, i) => {
+ var ptr = environ_buf + bufSize;
+ HEAPU32[(__environ + i * 4) >> 2] = ptr;
+ stringToAscii(string, ptr);
+ bufSize += string.length + 1;
+ });
+ return 0;
+ };
+
+ var _environ_sizes_get = (penviron_count, penviron_buf_size) => {
+ var strings = getEnvStrings();
+ HEAPU32[penviron_count >> 2] = strings.length;
+ var bufSize = 0;
+ strings.forEach((string) => (bufSize += string.length + 1));
+ HEAPU32[penviron_buf_size >> 2] = bufSize;
+ return 0;
+ };
+
+ function _fd_close(fd) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_fdstat_get(fd, pbuf) {
+ try {
+ var rightsBase = 0;
+ var rightsInheriting = 0;
+ var flags = 0;
+ {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ // All character devices are terminals (other things a Linux system would
+ // assume is a character device, like the mouse, we have special APIs for).
+ var type = stream.tty
+ ? 2
+ : FS.isDir(stream.mode)
+ ? 3
+ : FS.isLink(stream.mode)
+ ? 7
+ : 4;
+ }
+ HEAP8[pbuf] = type;
+ HEAP16[(pbuf + 2) >> 1] = flags;
+ (tempI64 = [
+ rightsBase >>> 0,
+ ((tempDouble = rightsBase),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(pbuf + 8) >> 2] = tempI64[0]),
+ (HEAP32[(pbuf + 12) >> 2] = tempI64[1]);
+ (tempI64 = [
+ rightsInheriting >>> 0,
+ ((tempDouble = rightsInheriting),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[(pbuf + 16) >> 2] = tempI64[0]),
+ (HEAP32[(pbuf + 20) >> 2] = tempI64[1]);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ var doReadv = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[iov >> 2];
+ var len = HEAPU32[(iov + 4) >> 2];
+ iov += 8;
+ var curr = FS.read(stream, HEAP8, ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ if (typeof offset != "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+ };
+
+ function _fd_read(fd, iov, iovcnt, pnum) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doReadv(stream, iov, iovcnt);
+ HEAPU32[pnum >> 2] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_seek(fd, offset_low, offset_high, whence, newOffset) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+
+ try {
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.llseek(stream, offset, whence);
+ (tempI64 = [
+ stream.position >>> 0,
+ ((tempDouble = stream.position),
+ +Math.abs(tempDouble) >= 1.0
+ ? tempDouble > 0.0
+ ? +Math.floor(tempDouble / 4294967296.0) >>> 0
+ : ~~+Math.ceil(
+ (tempDouble - +(~~tempDouble >>> 0)) / 4294967296.0,
+ ) >>> 0
+ : 0),
+ ]),
+ (HEAP32[newOffset >> 2] = tempI64[0]),
+ (HEAP32[(newOffset + 4) >> 2] = tempI64[1]);
+ if (stream.getdents && offset === 0 && whence === 0)
+ stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_sync(fd) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (stream.stream_ops?.fsync) {
+ return stream.stream_ops.fsync(stream);
+ }
+ return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ var doWritev = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[iov >> 2];
+ var len = HEAPU32[(iov + 4) >> 2];
+ iov += 8;
+ var curr = FS.write(stream, HEAP8, ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) {
+ // No more space to write.
+ break;
+ }
+ if (typeof offset != "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+ };
+
+ function _fd_write(fd, iov, iovcnt, pnum) {
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doWritev(stream, iov, iovcnt);
+ HEAPU32[pnum >> 2] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+ }
+
+ var _getaddrinfo = (node, service, hint, out) => {
+ // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL
+ // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we
+ // really should provide a linked list of suitable addrinfo values.
+ var addrs = [];
+ var canon = null;
+ var addr = 0;
+ var port = 0;
+ var flags = 0;
+ var family = 0;
+ var type = 0;
+ var proto = 0;
+ var ai, last;
+
+ function allocaddrinfo(family, type, proto, canon, addr, port) {
+ var sa, salen, ai;
+ var errno;
+
+ salen = family === 10 ? 28 : 16;
+ addr = family === 10 ? inetNtop6(addr) : inetNtop4(addr);
+ sa = _malloc(salen);
+ errno = writeSockaddr(sa, family, addr, port);
+ assert(!errno);
+
+ ai = _malloc(32);
+ HEAP32[(ai + 4) >> 2] = family;
+ HEAP32[(ai + 8) >> 2] = type;
+ HEAP32[(ai + 12) >> 2] = proto;
+ HEAPU32[(ai + 24) >> 2] = canon;
+ HEAPU32[(ai + 20) >> 2] = sa;
+ if (family === 10) {
+ HEAP32[(ai + 16) >> 2] = 28;
+ } else {
+ HEAP32[(ai + 16) >> 2] = 16;
+ }
+ HEAP32[(ai + 28) >> 2] = 0;
+
+ return ai;
+ }
+
+ if (hint) {
+ flags = HEAP32[hint >> 2];
+ family = HEAP32[(hint + 4) >> 2];
+ type = HEAP32[(hint + 8) >> 2];
+ proto = HEAP32[(hint + 12) >> 2];
+ }
+ if (type && !proto) {
+ proto = type === 2 ? 17 : 6;
+ }
+ if (!type && proto) {
+ type = proto === 17 ? 2 : 1;
+ }
+
+ // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for
+ // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints.
+ if (proto === 0) {
+ proto = 6;
+ }
+ if (type === 0) {
+ type = 1;
+ }
+
+ if (!node && !service) {
+ return -2;
+ }
+ if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) {
+ return -1;
+ }
+ if (hint !== 0 && HEAP32[hint >> 2] & 2 && !node) {
+ return -1;
+ }
+ if (flags & 32) {
+ // TODO
+ return -2;
+ }
+ if (type !== 0 && type !== 1 && type !== 2) {
+ return -7;
+ }
+ if (family !== 0 && family !== 2 && family !== 10) {
+ return -6;
+ }
+
+ if (service) {
+ service = UTF8ToString(service);
+ port = parseInt(service, 10);
+
+ if (isNaN(port)) {
+ if (flags & 1024) {
+ return -2;
+ }
+ // TODO support resolving well-known service names from:
+ // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt
+ return -8;
+ }
+ }
+
+ if (!node) {
+ if (family === 0) {
+ family = 2;
+ }
+ if ((flags & 1) === 0) {
+ if (family === 2) {
+ addr = _htonl(2130706433);
+ } else {
+ addr = [0, 0, 0, _htonl(1)];
+ }
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAPU32[out >> 2] = ai;
+ return 0;
+ }
+
+ //
+ // try as a numeric address
+ //
+ node = UTF8ToString(node);
+ addr = inetPton4(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv4 address
+ if (family === 0 || family === 2) {
+ family = 2;
+ } else if (family === 10 && flags & 8) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ family = 10;
+ } else {
+ return -2;
+ }
+ } else {
+ addr = inetPton6(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv6 address
+ if (family === 0 || family === 10) {
+ family = 10;
+ } else {
+ return -2;
+ }
+ }
+ }
+ if (addr != null) {
+ ai = allocaddrinfo(family, type, proto, node, addr, port);
+ HEAPU32[out >> 2] = ai;
+ return 0;
+ }
+ if (flags & 4) {
+ return -2;
+ }
+
+ //
+ // try as a hostname
+ //
+ // resolve the hostname to a temporary fake address
+ node = DNS.lookup_name(node);
+ addr = inetPton4(node);
+ if (family === 0) {
+ family = 2;
+ } else if (family === 10) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAPU32[out >> 2] = ai;
+ return 0;
+ };
+
+ /** @type {function(...*):?} */
+ function _getcontext() {
+ abort("missing function: getcontext");
+ }
+ _getcontext.stub = true;
+
+ /** @type {function(...*):?} */
+ function _getdtablesize() {
+ abort("missing function: getdtablesize");
+ }
+ _getdtablesize.stub = true;
+
+ var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => {
+ var info = readSockaddr(sa, salen);
+ if (info.errno) {
+ return -6;
+ }
+ var port = info.port;
+ var addr = info.addr;
+
+ var overflowed = false;
+
+ if (node && nodelen) {
+ var lookup;
+ if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) {
+ if (flags & 8) {
+ return -2;
+ }
+ } else {
+ addr = lookup;
+ }
+ var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
+
+ if (numBytesWrittenExclNull + 1 >= nodelen) {
+ overflowed = true;
+ }
+ }
+
+ if (serv && servlen) {
+ port = "" + port;
+ var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
+
+ if (numBytesWrittenExclNull + 1 >= servlen) {
+ overflowed = true;
+ }
+ }
+
+ if (overflowed) {
+ // Note: even when we overflow, getnameinfo() is specced to write out the truncated results.
+ return -12;
+ }
+
+ return 0;
+ };
+
+ var Protocols = {
+ list: [],
+ map: {},
+ };
+
+ var _setprotoent = (stayopen) => {
+ // void setprotoent(int stayopen);
+
+ // Allocate and populate a protoent structure given a name, protocol number and array of aliases
+ function allocprotoent(name, proto, aliases) {
+ // write name into buffer
+ var nameBuf = _malloc(name.length + 1);
+ stringToAscii(name, nameBuf);
+
+ // write aliases into buffer
+ var j = 0;
+ var length = aliases.length;
+ var aliasListBuf = _malloc((length + 1) * 4); // Use length + 1 so we have space for the terminating NULL ptr.
+
+ for (var i = 0; i < length; i++, j += 4) {
+ var alias = aliases[i];
+ var aliasBuf = _malloc(alias.length + 1);
+ stringToAscii(alias, aliasBuf);
+ HEAPU32[(aliasListBuf + j) >> 2] = aliasBuf;
+ }
+ HEAPU32[(aliasListBuf + j) >> 2] = 0; // Terminating NULL pointer.
+
+ // generate protoent
+ var pe = _malloc(12);
+ HEAPU32[pe >> 2] = nameBuf;
+ HEAPU32[(pe + 4) >> 2] = aliasListBuf;
+ HEAP32[(pe + 8) >> 2] = proto;
+ return pe;
+ }
+
+ // Populate the protocol 'database'. The entries are limited to tcp and udp, though it is fairly trivial
+ // to add extra entries from /etc/protocols if desired - though not sure if that'd actually be useful.
+ var list = Protocols.list;
+ var map = Protocols.map;
+ if (list.length === 0) {
+ var entry = allocprotoent("tcp", 6, ["TCP"]);
+ list.push(entry);
+ map["tcp"] = map["6"] = entry;
+ entry = allocprotoent("udp", 17, ["UDP"]);
+ list.push(entry);
+ map["udp"] = map["17"] = entry;
+ }
+
+ _setprotoent.index = 0;
+ };
+
+ var _getprotobyname = (name) => {
+ // struct protoent *getprotobyname(const char *);
+ name = UTF8ToString(name);
+ _setprotoent(true);
+ var result = Protocols.map[name];
+ return result;
+ };
+
+ var _getprotobynumber = (number) => {
+ // struct protoent *getprotobynumber(int proto);
+ _setprotoent(true);
+ var result = Protocols.map[number];
+ return result;
+ };
+
+ /** @type {function(...*):?} */
+ function _makecontext() {
+ abort("missing function: makecontext");
+ }
+ _makecontext.stub = true;
+
+ /** @type {function(...*):?} */
+ function _posix_spawnp() {
+ abort("missing function: posix_spawnp");
+ }
+ _posix_spawnp.stub = true;
+
+ var arraySum = (array, index) => {
+ var sum = 0;
+ for (var i = 0; i <= index; sum += array[i++]) {
+ // no-op
+ }
+ return sum;
+ };
+
+ var MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
+
+ var MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
+ var addDays = (date, days) => {
+ var newDate = new Date(date.getTime());
+ while (days > 0) {
+ var leap = isLeapYear(newDate.getFullYear());
+ var currentMonth = newDate.getMonth();
+ var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[
+ currentMonth
+ ];
+
+ if (days > daysInCurrentMonth - newDate.getDate()) {
+ // we spill over to next month
+ days -= daysInCurrentMonth - newDate.getDate() + 1;
+ newDate.setDate(1);
+ if (currentMonth < 11) {
+ newDate.setMonth(currentMonth + 1);
+ } else {
+ newDate.setMonth(0);
+ newDate.setFullYear(newDate.getFullYear() + 1);
+ }
+ } else {
+ // we stay in current month
+ newDate.setDate(newDate.getDate() + days);
+ return newDate;
+ }
+ }
+
+ return newDate;
+ };
+
+ var _strptime = (buf, format, tm) => {
+ // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html
+ var pattern = UTF8ToString(format);
+
+ // escape special characters
+ // TODO: not sure we really need to escape all of these in JS regexps
+ var SPECIAL_CHARS = "\\!@#$^&*()+=-[]/{}|:<>?,.";
+ for (var i = 0, ii = SPECIAL_CHARS.length; i < ii; ++i) {
+ pattern = pattern.replace(
+ new RegExp("\\" + SPECIAL_CHARS[i], "g"),
+ "\\" + SPECIAL_CHARS[i],
+ );
+ }
+
+ // reduce number of matchers
+ var EQUIVALENT_MATCHERS = {
+ A: "%a",
+ B: "%b",
+ c: "%a %b %d %H:%M:%S %Y",
+ D: "%m\\/%d\\/%y",
+ e: "%d",
+ F: "%Y-%m-%d",
+ h: "%b",
+ R: "%H\\:%M",
+ r: "%I\\:%M\\:%S\\s%p",
+ T: "%H\\:%M\\:%S",
+ x: "%m\\/%d\\/(?:%y|%Y)",
+ X: "%H\\:%M\\:%S",
+ };
+ // TODO: take care of locale
+
+ var DATE_PATTERNS = {
+ /* weekday name */ a: "(?:Sun(?:day)?)|(?:Mon(?:day)?)|(?:Tue(?:sday)?)|(?:Wed(?:nesday)?)|(?:Thu(?:rsday)?)|(?:Fri(?:day)?)|(?:Sat(?:urday)?)",
+ /* month name */ b: "(?:Jan(?:uary)?)|(?:Feb(?:ruary)?)|(?:Mar(?:ch)?)|(?:Apr(?:il)?)|May|(?:Jun(?:e)?)|(?:Jul(?:y)?)|(?:Aug(?:ust)?)|(?:Sep(?:tember)?)|(?:Oct(?:ober)?)|(?:Nov(?:ember)?)|(?:Dec(?:ember)?)",
+ /* century */ C: "\\d\\d",
+ /* day of month */ d: "0[1-9]|[1-9](?!\\d)|1\\d|2\\d|30|31",
+ /* hour (24hr) */ H: "\\d(?!\\d)|[0,1]\\d|20|21|22|23",
+ /* hour (12hr) */ I: "\\d(?!\\d)|0\\d|10|11|12",
+ /* day of year */ j: "00[1-9]|0?[1-9](?!\\d)|0?[1-9]\\d(?!\\d)|[1,2]\\d\\d|3[0-6]\\d",
+ /* month */ m: "0[1-9]|[1-9](?!\\d)|10|11|12",
+ /* minutes */ M: "0\\d|\\d(?!\\d)|[1-5]\\d",
+ /* whitespace */ n: " ",
+ /* AM/PM */ p: "AM|am|PM|pm|A\\.M\\.|a\\.m\\.|P\\.M\\.|p\\.m\\.",
+ /* seconds */ S: "0\\d|\\d(?!\\d)|[1-5]\\d|60",
+ /* week number */ U: "0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53",
+ /* week number */ W: "0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53",
+ /* weekday number */ w: "[0-6]",
+ /* 2-digit year */ y: "\\d\\d",
+ /* 4-digit year */ Y: "\\d\\d\\d\\d",
+ /* whitespace */ t: " ",
+ /* time zone */ z: "Z|(?:[\\+\\-]\\d\\d:?(?:\\d\\d)?)",
+ };
+
+ var MONTH_NUMBERS = {
+ JAN: 0,
+ FEB: 1,
+ MAR: 2,
+ APR: 3,
+ MAY: 4,
+ JUN: 5,
+ JUL: 6,
+ AUG: 7,
+ SEP: 8,
+ OCT: 9,
+ NOV: 10,
+ DEC: 11,
+ };
+ var DAY_NUMBERS_SUN_FIRST = {
+ SUN: 0,
+ MON: 1,
+ TUE: 2,
+ WED: 3,
+ THU: 4,
+ FRI: 5,
+ SAT: 6,
+ };
+ var DAY_NUMBERS_MON_FIRST = {
+ MON: 0,
+ TUE: 1,
+ WED: 2,
+ THU: 3,
+ FRI: 4,
+ SAT: 5,
+ SUN: 6,
+ };
+
+ var capture = [];
+ var pattern_out = pattern
+ .replace(/%(.)/g, (m, c) => EQUIVALENT_MATCHERS[c] || m)
+ .replace(/%(.)/g, (_, c) => {
+ let pat = DATE_PATTERNS[c];
+ if (pat) {
+ capture.push(c);
+ return `(${pat})`;
+ } else {
+ return c;
+ }
+ })
+ .replace(
+ // any number of space or tab characters match zero or more spaces
+ /\s+/g,
+ "\\s*",
+ );
+
+ var matches = new RegExp("^" + pattern_out, "i").exec(UTF8ToString(buf));
+
+ function initDate() {
+ function fixup(value, min, max) {
+ return typeof value != "number" || isNaN(value)
+ ? min
+ : value >= min
+ ? value <= max
+ ? value
+ : max
+ : min;
+ }
+ return {
+ year: fixup(HEAP32[(tm + 20) >> 2] + 1900, 1970, 9999),
+ month: fixup(HEAP32[(tm + 16) >> 2], 0, 11),
+ day: fixup(HEAP32[(tm + 12) >> 2], 1, 31),
+ hour: fixup(HEAP32[(tm + 8) >> 2], 0, 23),
+ min: fixup(HEAP32[(tm + 4) >> 2], 0, 59),
+ sec: fixup(HEAP32[tm >> 2], 0, 59),
+ gmtoff: 0,
+ };
+ }
+
+ if (matches) {
+ var date = initDate();
+ var value;
+
+ var getMatch = (symbol) => {
+ var pos = capture.indexOf(symbol);
+ // check if symbol appears in regexp
+ if (pos >= 0) {
+ // return matched value or null (falsy!) for non-matches
+ return matches[pos + 1];
+ }
+ return;
+ };
+
+ // seconds
+ if ((value = getMatch("S"))) {
+ date.sec = jstoi_q(value);
+ }
+
+ // minutes
+ if ((value = getMatch("M"))) {
+ date.min = jstoi_q(value);
+ }
+
+ // hours
+ if ((value = getMatch("H"))) {
+ // 24h clock
+ date.hour = jstoi_q(value);
+ } else if ((value = getMatch("I"))) {
+ // AM/PM clock
+ var hour = jstoi_q(value);
+ if ((value = getMatch("p"))) {
+ hour += value.toUpperCase()[0] === "P" ? 12 : 0;
+ }
+ date.hour = hour;
+ }
+
+ // year
+ if ((value = getMatch("Y"))) {
+ // parse from four-digit year
+ date.year = jstoi_q(value);
+ } else if ((value = getMatch("y"))) {
+ // parse from two-digit year...
+ var year = jstoi_q(value);
+ if ((value = getMatch("C"))) {
+ // ...and century
+ year += jstoi_q(value) * 100;
+ } else {
+ // ...and rule-of-thumb
+ year += year < 69 ? 2000 : 1900;
+ }
+ date.year = year;
+ }
+
+ // month
+ if ((value = getMatch("m"))) {
+ // parse from month number
+ date.month = jstoi_q(value) - 1;
+ } else if ((value = getMatch("b"))) {
+ // parse from month name
+ date.month = MONTH_NUMBERS[value.substring(0, 3).toUpperCase()] || 0;
+ // TODO: derive month from day in year+year, week number+day of week+year
+ }
+
+ // day
+ if ((value = getMatch("d"))) {
+ // get day of month directly
+ date.day = jstoi_q(value);
+ } else if ((value = getMatch("j"))) {
+ // get day of month from day of year ...
+ var day = jstoi_q(value);
+ var leapYear = isLeapYear(date.year);
+ for (var month = 0; month < 12; ++month) {
+ var daysUntilMonth = arraySum(
+ leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR,
+ month - 1,
+ );
+ if (
+ day <=
+ daysUntilMonth +
+ (leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[month]
+ ) {
+ date.day = day - daysUntilMonth;
+ }
+ }
+ } else if ((value = getMatch("a"))) {
+ // get day of month from weekday ...
+ var weekDay = value.substring(0, 3).toUpperCase();
+ if ((value = getMatch("U"))) {
+ // ... and week number (Sunday being first day of week)
+ // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53].
+ // All days in a new year preceding the first Sunday are considered to be in week 0.
+ var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay];
+ var weekNumber = jstoi_q(value);
+
+ // January 1st
+ var janFirst = new Date(date.year, 0, 1);
+ var endDate;
+ if (janFirst.getDay() === 0) {
+ // Jan 1st is a Sunday, and, hence in the 1st CW
+ endDate = addDays(janFirst, weekDayNumber + 7 * (weekNumber - 1));
+ } else {
+ // Jan 1st is not a Sunday, and, hence still in the 0th CW
+ endDate = addDays(
+ janFirst,
+ 7 - janFirst.getDay() + weekDayNumber + 7 * (weekNumber - 1),
+ );
+ }
+ date.day = endDate.getDate();
+ date.month = endDate.getMonth();
+ } else if ((value = getMatch("W"))) {
+ // ... and week number (Monday being first day of week)
+ // Week number of the year (Monday as the first day of the week) as a decimal number [00,53].
+ // All days in a new year preceding the first Monday are considered to be in week 0.
+ var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay];
+ var weekNumber = jstoi_q(value);
+
+ // January 1st
+ var janFirst = new Date(date.year, 0, 1);
+ var endDate;
+ if (janFirst.getDay() === 1) {
+ // Jan 1st is a Monday, and, hence in the 1st CW
+ endDate = addDays(janFirst, weekDayNumber + 7 * (weekNumber - 1));
+ } else {
+ // Jan 1st is not a Monday, and, hence still in the 0th CW
+ endDate = addDays(
+ janFirst,
+ 7 -
+ janFirst.getDay() +
+ 1 +
+ weekDayNumber +
+ 7 * (weekNumber - 1),
+ );
+ }
+
+ date.day = endDate.getDate();
+ date.month = endDate.getMonth();
+ }
+ }
+
+ // time zone
+ if ((value = getMatch("z"))) {
+ // GMT offset as either 'Z' or +-HH:MM or +-HH or +-HHMM
+ if (value.toLowerCase() === "z") {
+ date.gmtoff = 0;
+ } else {
+ var match = value.match(/^((?:\-|\+)\d\d):?(\d\d)?/);
+ date.gmtoff = match[1] * 3600;
+ if (match[2]) {
+ date.gmtoff += date.gmtoff > 0 ? match[2] * 60 : -match[2] * 60;
+ }
+ }
+ }
+
+ /*
+ tm_sec int seconds after the minute 0-61*
+ tm_min int minutes after the hour 0-59
+ tm_hour int hours since midnight 0-23
+ tm_mday int day of the month 1-31
+ tm_mon int months since January 0-11
+ tm_year int years since 1900
+ tm_wday int days since Sunday 0-6
+ tm_yday int days since January 1 0-365
+ tm_isdst int Daylight Saving Time flag
+ tm_gmtoff long offset from GMT (seconds)
+ */
+
+ var fullDate = new Date(
+ date.year,
+ date.month,
+ date.day,
+ date.hour,
+ date.min,
+ date.sec,
+ 0,
+ );
+ HEAP32[tm >> 2] = fullDate.getSeconds();
+ HEAP32[(tm + 4) >> 2] = fullDate.getMinutes();
+ HEAP32[(tm + 8) >> 2] = fullDate.getHours();
+ HEAP32[(tm + 12) >> 2] = fullDate.getDate();
+ HEAP32[(tm + 16) >> 2] = fullDate.getMonth();
+ HEAP32[(tm + 20) >> 2] = fullDate.getFullYear() - 1900;
+ HEAP32[(tm + 24) >> 2] = fullDate.getDay();
+ HEAP32[(tm + 28) >> 2] =
+ arraySum(
+ isLeapYear(fullDate.getFullYear())
+ ? MONTH_DAYS_LEAP
+ : MONTH_DAYS_REGULAR,
+ fullDate.getMonth() - 1,
+ ) +
+ fullDate.getDate() -
+ 1;
+ HEAP32[(tm + 32) >> 2] = 0;
+ HEAP32[(tm + 36) >> 2] = date.gmtoff;
+
+ // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F
+ // TODO: not sure that intArrayFromString handles all unicode characters correctly
+ return buf + intArrayFromString(matches[0]).length - 1;
+ }
+
+ return 0;
+ };
+
+ /** @type {function(...*):?} */
+ function _swapcontext() {
+ abort("missing function: swapcontext");
+ }
+ _swapcontext.stub = true;
+
+ var getCFunc = (ident) => {
+ var func = Module["_" + ident]; // closure exported function
+ assert(
+ func,
+ "Cannot call unknown function " + ident + ", make sure it is exported",
+ );
+ return func;
+ };
+
+ var writeArrayToMemory = (array, buffer) => {
+ assert(
+ array.length >= 0,
+ "writeArrayToMemory array must have a length (should be an array or typed array)",
+ );
+ HEAP8.set(array, buffer);
+ };
+
+ var stackAlloc = (sz) => __emscripten_stack_alloc(sz);
+ var stringToUTF8OnStack = (str) => {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8(str, ret, size);
+ return ret;
+ };
+
+ /**
+ * @param {string|null=} returnType
+ * @param {Array=} argTypes
+ * @param {Arguments|Array=} args
+ * @param {Object=} opts
+ */
+ var ccall = (ident, returnType, argTypes, args, opts) => {
+ // For fast lookup of conversion functions
+ var toC = {
+ string: (str) => {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) {
+ // null string
+ ret = stringToUTF8OnStack(str);
+ }
+ return ret;
+ },
+ array: (arr) => {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ },
+ };
+
+ function convertReturnValue(ret) {
+ if (returnType === "string") {
+ return UTF8ToString(ret);
+ }
+ if (returnType === "boolean") return Boolean(ret);
+ return ret;
+ }
+
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ assert(returnType !== "array", 'Return type should not be "array".');
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func(...cArgs);
+ function onDone(ret) {
+ if (stack !== 0) stackRestore(stack);
+ return convertReturnValue(ret);
+ }
+
+ ret = onDone(ret);
+ return ret;
+ };
+
+ FS.createPreloadedFile = FS_createPreloadedFile;
+ FS.staticInit();
+ // Set module methods based on EXPORTED_RUNTIME_METHODS
+ function checkIncomingModuleAPI() {
+ ignoredModuleProp("fetchSettings");
+ }
+ var wasmImports = {
+ /** @export */
+ __assert_fail: ___assert_fail,
+ /** @export */
+ __call_sighandler: ___call_sighandler,
+ /** @export */
+ __syscall__newselect: ___syscall__newselect,
+ /** @export */
+ __syscall_accept4: ___syscall_accept4,
+ /** @export */
+ __syscall_bind: ___syscall_bind,
+ /** @export */
+ __syscall_chdir: ___syscall_chdir,
+ /** @export */
+ __syscall_chmod: ___syscall_chmod,
+ /** @export */
+ __syscall_connect: ___syscall_connect,
+ /** @export */
+ __syscall_dup: ___syscall_dup,
+ /** @export */
+ __syscall_faccessat: ___syscall_faccessat,
+ /** @export */
+ __syscall_fchownat: ___syscall_fchownat,
+ /** @export */
+ __syscall_fcntl64: ___syscall_fcntl64,
+ /** @export */
+ __syscall_fdatasync: ___syscall_fdatasync,
+ /** @export */
+ __syscall_fstat64: ___syscall_fstat64,
+ /** @export */
+ __syscall_ftruncate64: ___syscall_ftruncate64,
+ /** @export */
+ __syscall_getcwd: ___syscall_getcwd,
+ /** @export */
+ __syscall_getdents64: ___syscall_getdents64,
+ /** @export */
+ __syscall_getpeername: ___syscall_getpeername,
+ /** @export */
+ __syscall_getsockname: ___syscall_getsockname,
+ /** @export */
+ __syscall_getsockopt: ___syscall_getsockopt,
+ /** @export */
+ __syscall_ioctl: ___syscall_ioctl,
+ /** @export */
+ __syscall_listen: ___syscall_listen,
+ /** @export */
+ __syscall_lstat64: ___syscall_lstat64,
+ /** @export */
+ __syscall_mkdirat: ___syscall_mkdirat,
+ /** @export */
+ __syscall_newfstatat: ___syscall_newfstatat,
+ /** @export */
+ __syscall_openat: ___syscall_openat,
+ /** @export */
+ __syscall_pipe: ___syscall_pipe,
+ /** @export */
+ __syscall_poll: ___syscall_poll,
+ /** @export */
+ __syscall_readlinkat: ___syscall_readlinkat,
+ /** @export */
+ __syscall_recvfrom: ___syscall_recvfrom,
+ /** @export */
+ __syscall_renameat: ___syscall_renameat,
+ /** @export */
+ __syscall_rmdir: ___syscall_rmdir,
+ /** @export */
+ __syscall_sendto: ___syscall_sendto,
+ /** @export */
+ __syscall_socket: ___syscall_socket,
+ /** @export */
+ __syscall_stat64: ___syscall_stat64,
+ /** @export */
+ __syscall_statfs64: ___syscall_statfs64,
+ /** @export */
+ __syscall_symlinkat: ___syscall_symlinkat,
+ /** @export */
+ __syscall_unlinkat: ___syscall_unlinkat,
+ /** @export */
+ __syscall_utimensat: ___syscall_utimensat,
+ /** @export */
+ _abort_js: __abort_js,
+ /** @export */
+ _emscripten_lookup_name: __emscripten_lookup_name,
+ /** @export */
+ _emscripten_memcpy_js: __emscripten_memcpy_js,
+ /** @export */
+ _emscripten_runtime_keepalive_clear: __emscripten_runtime_keepalive_clear,
+ /** @export */
+ _emscripten_throw_longjmp: __emscripten_throw_longjmp,
+ /** @export */
+ _gmtime_js: __gmtime_js,
+ /** @export */
+ _localtime_js: __localtime_js,
+ /** @export */
+ _mktime_js: __mktime_js,
+ /** @export */
+ _mmap_js: __mmap_js,
+ /** @export */
+ _munmap_js: __munmap_js,
+ /** @export */
+ _setitimer_js: __setitimer_js,
+ /** @export */
+ _tzset_js: __tzset_js,
+ /** @export */
+ clock_time_get: _clock_time_get,
+ /** @export */
+ emscripten_date_now: _emscripten_date_now,
+ /** @export */
+ emscripten_err: _emscripten_err,
+ /** @export */
+ emscripten_get_heap_max: _emscripten_get_heap_max,
+ /** @export */
+ emscripten_get_now: _emscripten_get_now,
+ /** @export */
+ emscripten_resize_heap: _emscripten_resize_heap,
+ /** @export */
+ environ_get: _environ_get,
+ /** @export */
+ environ_sizes_get: _environ_sizes_get,
+ /** @export */
+ exit: _exit,
+ /** @export */
+ fd_close: _fd_close,
+ /** @export */
+ fd_fdstat_get: _fd_fdstat_get,
+ /** @export */
+ fd_read: _fd_read,
+ /** @export */
+ fd_seek: _fd_seek,
+ /** @export */
+ fd_sync: _fd_sync,
+ /** @export */
+ fd_write: _fd_write,
+ /** @export */
+ getaddrinfo: _getaddrinfo,
+ /** @export */
+ getcontext: _getcontext,
+ /** @export */
+ getdtablesize: _getdtablesize,
+ /** @export */
+ getnameinfo: _getnameinfo,
+ /** @export */
+ getprotobyname: _getprotobyname,
+ /** @export */
+ getprotobynumber: _getprotobynumber,
+ /** @export */
+ invoke_i,
+ /** @export */
+ invoke_ii,
+ /** @export */
+ invoke_iii,
+ /** @export */
+ invoke_iiii,
+ /** @export */
+ invoke_iiiii,
+ /** @export */
+ invoke_iiiiii,
+ /** @export */
+ invoke_iiiiiii,
+ /** @export */
+ invoke_iiiiiiiiii,
+ /** @export */
+ invoke_v,
+ /** @export */
+ invoke_vi,
+ /** @export */
+ invoke_vii,
+ /** @export */
+ invoke_viidii,
+ /** @export */
+ invoke_viii,
+ /** @export */
+ invoke_viiii,
+ /** @export */
+ invoke_viiiii,
+ /** @export */
+ makecontext: _makecontext,
+ /** @export */
+ posix_spawnp: _posix_spawnp,
+ /** @export */
+ proc_exit: _proc_exit,
+ /** @export */
+ strptime: _strptime,
+ /** @export */
+ swapcontext: _swapcontext,
+ };
+ var wasmExports;
+ createWasm();
+ var ___wasm_call_ctors = createExportWrapper("__wasm_call_ctors", 0);
+ var _php_wasm_run = (Module["_php_wasm_run"] = createExportWrapper(
+ "php_wasm_run",
+ 1,
+ ));
+ var _fflush = createExportWrapper("fflush", 1);
+ var _malloc = createExportWrapper("malloc", 1);
+ var _strerror = createExportWrapper("strerror", 1);
+ var _htons = createExportWrapper("htons", 1);
+ var _ntohs = createExportWrapper("ntohs", 1);
+ var _htonl = createExportWrapper("htonl", 1);
+ var _emscripten_builtin_memalign = createExportWrapper(
+ "emscripten_builtin_memalign",
+ 2,
+ );
+ var __emscripten_timeout = createExportWrapper("_emscripten_timeout", 2);
+ var _setThrew = createExportWrapper("setThrew", 2);
+ var __emscripten_tempret_set = createExportWrapper(
+ "_emscripten_tempret_set",
+ 1,
+ );
+ var _emscripten_stack_init = () =>
+ (_emscripten_stack_init = wasmExports["emscripten_stack_init"])();
+ var _emscripten_stack_get_free = () =>
+ (_emscripten_stack_get_free = wasmExports["emscripten_stack_get_free"])();
+ var _emscripten_stack_get_base = () =>
+ (_emscripten_stack_get_base = wasmExports["emscripten_stack_get_base"])();
+ var _emscripten_stack_get_end = () =>
+ (_emscripten_stack_get_end = wasmExports["emscripten_stack_get_end"])();
+ var __emscripten_stack_restore = (a0) =>
+ (__emscripten_stack_restore = wasmExports["_emscripten_stack_restore"])(
+ a0,
+ );
+ var __emscripten_stack_alloc = (a0) =>
+ (__emscripten_stack_alloc = wasmExports["_emscripten_stack_alloc"])(a0);
+ var _emscripten_stack_get_current = () =>
+ (_emscripten_stack_get_current =
+ wasmExports["emscripten_stack_get_current"])();
+ var dynCall_jiji = (Module["dynCall_jiji"] = createExportWrapper(
+ "dynCall_jiji",
+ 5,
+ ));
+
+ function invoke_iii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_iiiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_v(index) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)();
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_ii(index, a1) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_viii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_vii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_vi(index, a1) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_i(index) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)();
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_iiii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_viiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_viiiii(index, a1, a2, a3, a4, a5) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4, a5);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ function invoke_viidii(index, a1, a2, a3, a4, a5) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4, a5);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+ }
+
+ // include: postamble.js
+ // === Auto-generated postamble setup entry stuff ===
+
+ Module["ccall"] = ccall;
+ var missingLibrarySymbols = [
+ "writeI53ToI64",
+ "writeI53ToI64Clamped",
+ "writeI53ToI64Signaling",
+ "writeI53ToU64Clamped",
+ "writeI53ToU64Signaling",
+ "readI53FromU64",
+ "convertI32PairToI53",
+ "convertU32PairToI53",
+ "getTempRet0",
+ "growMemory",
+ "emscriptenLog",
+ "readEmAsmArgs",
+ "listenOnce",
+ "autoResumeAudioContext",
+ "dynCallLegacy",
+ "getDynCaller",
+ "dynCall",
+ "runtimeKeepalivePush",
+ "runtimeKeepalivePop",
+ "asmjsMangle",
+ "HandleAllocator",
+ "getNativeTypeSize",
+ "STACK_SIZE",
+ "STACK_ALIGN",
+ "POINTER_SIZE",
+ "ASSERTIONS",
+ "cwrap",
+ "uleb128Encode",
+ "sigToWasmTypes",
+ "generateFuncType",
+ "convertJsFunctionToWasm",
+ "getEmptyTableSlot",
+ "updateTableMap",
+ "getFunctionAddress",
+ "addFunction",
+ "removeFunction",
+ "reallyNegative",
+ "unSign",
+ "strLen",
+ "reSign",
+ "formatString",
+ "intArrayToString",
+ "AsciiToString",
+ "UTF16ToString",
+ "stringToUTF16",
+ "lengthBytesUTF16",
+ "UTF32ToString",
+ "stringToUTF32",
+ "lengthBytesUTF32",
+ "stringToNewUTF8",
+ "registerKeyEventCallback",
+ "maybeCStringToJsString",
+ "findEventTarget",
+ "getBoundingClientRect",
+ "fillMouseEventData",
+ "registerMouseEventCallback",
+ "registerWheelEventCallback",
+ "registerUiEventCallback",
+ "registerFocusEventCallback",
+ "fillDeviceOrientationEventData",
+ "registerDeviceOrientationEventCallback",
+ "fillDeviceMotionEventData",
+ "registerDeviceMotionEventCallback",
+ "screenOrientation",
+ "fillOrientationChangeEventData",
+ "registerOrientationChangeEventCallback",
+ "fillFullscreenChangeEventData",
+ "registerFullscreenChangeEventCallback",
+ "JSEvents_requestFullscreen",
+ "JSEvents_resizeCanvasForFullscreen",
+ "registerRestoreOldStyle",
+ "hideEverythingExceptGivenElement",
+ "restoreHiddenElements",
+ "setLetterbox",
+ "softFullscreenResizeWebGLRenderTarget",
+ "doRequestFullscreen",
+ "fillPointerlockChangeEventData",
+ "registerPointerlockChangeEventCallback",
+ "registerPointerlockErrorEventCallback",
+ "requestPointerLock",
+ "fillVisibilityChangeEventData",
+ "registerVisibilityChangeEventCallback",
+ "registerTouchEventCallback",
+ "fillGamepadEventData",
+ "registerGamepadEventCallback",
+ "registerBeforeUnloadEventCallback",
+ "fillBatteryEventData",
+ "battery",
+ "registerBatteryEventCallback",
+ "setCanvasElementSize",
+ "getCanvasElementSize",
+ "jsStackTrace",
+ "getCallstack",
+ "convertPCtoSourceLocation",
+ "wasiRightsToMuslOFlags",
+ "wasiOFlagsToMuslOFlags",
+ "safeSetTimeout",
+ "setImmediateWrapped",
+ "safeRequestAnimationFrame",
+ "clearImmediateWrapped",
+ "polyfillSetImmediate",
+ "registerPostMainLoop",
+ "registerPreMainLoop",
+ "getPromise",
+ "makePromise",
+ "idsToPromises",
+ "makePromiseCallback",
+ "ExceptionInfo",
+ "findMatchingCatch",
+ "Browser_asyncPrepareDataCounter",
+ "FS_unlink",
+ "FS_mkdirTree",
+ "_setNetworkCallback",
+ "heapObjectForWebGLType",
+ "toTypedArrayIndex",
+ "webgl_enable_ANGLE_instanced_arrays",
+ "webgl_enable_OES_vertex_array_object",
+ "webgl_enable_WEBGL_draw_buffers",
+ "webgl_enable_WEBGL_multi_draw",
+ "webgl_enable_EXT_polygon_offset_clamp",
+ "webgl_enable_EXT_clip_control",
+ "webgl_enable_WEBGL_polygon_mode",
+ "emscriptenWebGLGet",
+ "computeUnpackAlignedImageSize",
+ "colorChannelsInGlTextureFormat",
+ "emscriptenWebGLGetTexPixelData",
+ "emscriptenWebGLGetUniform",
+ "webglGetUniformLocation",
+ "webglPrepareUniformLocationsBeforeFirstUse",
+ "webglGetLeftBracePos",
+ "emscriptenWebGLGetVertexAttrib",
+ "__glGetActiveAttribOrUniform",
+ "writeGLArray",
+ "registerWebGlEventCallback",
+ "runAndAbortIfError",
+ "ALLOC_NORMAL",
+ "ALLOC_STACK",
+ "allocate",
+ "writeStringToMemory",
+ "writeAsciiToMemory",
+ "setErrNo",
+ "demangle",
+ "stackTrace",
+ ];
+ missingLibrarySymbols.forEach(missingLibrarySymbol);
+
+ var unexportedSymbols = [
+ "run",
+ "addOnPreRun",
+ "addOnInit",
+ "addOnPreMain",
+ "addOnExit",
+ "addOnPostRun",
+ "addRunDependency",
+ "removeRunDependency",
+ "out",
+ "err",
+ "callMain",
+ "abort",
+ "wasmMemory",
+ "wasmExports",
+ "writeStackCookie",
+ "checkStackCookie",
+ "readI53FromI64",
+ "convertI32PairToI53Checked",
+ "stackSave",
+ "stackRestore",
+ "stackAlloc",
+ "setTempRet0",
+ "ptrToString",
+ "zeroMemory",
+ "exitJS",
+ "getHeapMax",
+ "abortOnCannotGrowMemory",
+ "ENV",
+ "ERRNO_CODES",
+ "strError",
+ "inetPton4",
+ "inetNtop4",
+ "inetPton6",
+ "inetNtop6",
+ "readSockaddr",
+ "writeSockaddr",
+ "DNS",
+ "Protocols",
+ "Sockets",
+ "timers",
+ "warnOnce",
+ "readEmAsmArgsArray",
+ "jstoi_q",
+ "jstoi_s",
+ "getExecutableName",
+ "handleException",
+ "keepRuntimeAlive",
+ "callUserCallback",
+ "maybeExit",
+ "asyncLoad",
+ "alignMemory",
+ "mmapAlloc",
+ "wasmTable",
+ "noExitRuntime",
+ "getCFunc",
+ "freeTableIndexes",
+ "functionsInTableMap",
+ "setValue",
+ "getValue",
+ "PATH",
+ "PATH_FS",
+ "UTF8Decoder",
+ "UTF8ArrayToString",
+ "UTF8ToString",
+ "stringToUTF8Array",
+ "stringToUTF8",
+ "lengthBytesUTF8",
+ "intArrayFromString",
+ "stringToAscii",
+ "UTF16Decoder",
+ "stringToUTF8OnStack",
+ "writeArrayToMemory",
+ "JSEvents",
+ "specialHTMLTargets",
+ "findCanvasEventTarget",
+ "currentFullscreenStrategy",
+ "restoreOldWindowedStyle",
+ "UNWIND_CACHE",
+ "ExitStatus",
+ "getEnvStrings",
+ "checkWasiClock",
+ "doReadv",
+ "doWritev",
+ "initRandomFill",
+ "randomFill",
+ "promiseMap",
+ "uncaughtExceptionCount",
+ "exceptionLast",
+ "exceptionCaught",
+ "Browser",
+ "getPreloadedImageData__data",
+ "wget",
+ "MONTH_DAYS_REGULAR",
+ "MONTH_DAYS_LEAP",
+ "MONTH_DAYS_REGULAR_CUMULATIVE",
+ "MONTH_DAYS_LEAP_CUMULATIVE",
+ "isLeapYear",
+ "ydayFromDate",
+ "arraySum",
+ "addDays",
+ "SYSCALLS",
+ "getSocketFromFD",
+ "getSocketAddress",
+ "preloadPlugins",
+ "FS_createPreloadedFile",
+ "FS_modeStringToFlags",
+ "FS_getMode",
+ "FS_stdin_getChar_buffer",
+ "FS_stdin_getChar",
+ "FS_createPath",
+ "FS_createDevice",
+ "FS_readFile",
+ "FS",
+ "FS_createDataFile",
+ "FS_createLazyFile",
+ "MEMFS",
+ "TTY",
+ "PIPEFS",
+ "SOCKFS",
+ "tempFixedLengthArray",
+ "miniTempWebGLFloatBuffers",
+ "miniTempWebGLIntBuffers",
+ "GL",
+ "AL",
+ "GLUT",
+ "EGL",
+ "GLEW",
+ "IDBStore",
+ "SDL",
+ "SDL_gfx",
+ "allocateUTF8",
+ "allocateUTF8OnStack",
+ "print",
+ "printErr",
+ ];
+ unexportedSymbols.forEach(unexportedRuntimeSymbol);
+
+ var calledRun;
+
+ dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!calledRun) run();
+ if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+ };
+
+ function stackCheckInit() {
+ // This is normally called automatically during __wasm_call_ctors but need to
+ // get these values before even running any of the ctors so we call it redundantly
+ // here.
+ _emscripten_stack_init();
+ // TODO(sbc): Move writeStackCookie to native to to avoid this.
+ writeStackCookie();
+ }
+
+ function run() {
+ if (runDependencies > 0) {
+ return;
+ }
+
+ stackCheckInit();
+
+ preRun();
+
+ // a preRun added a dependency, run will be called later
+ if (runDependencies > 0) {
+ return;
+ }
+
+ function doRun() {
+ // run may have just been called through dependencies being fulfilled just in this very frame,
+ // or while the async setStatus time below was happening
+ if (calledRun) return;
+ calledRun = true;
+ Module["calledRun"] = true;
+
+ if (ABORT) return;
+
+ initRuntime();
+
+ readyPromiseResolve(Module);
+ Module["onRuntimeInitialized"]?.();
+
+ assert(
+ !Module["_main"],
+ 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]',
+ );
+
+ postRun();
+ }
+
+ if (Module["setStatus"]) {
+ Module["setStatus"]("Running...");
+ setTimeout(() => {
+ setTimeout(() => Module["setStatus"](""), 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+ checkStackCookie();
+ }
+
+ function checkUnflushedContent() {
+ // Compiler settings do not allow exiting the runtime, so flushing
+ // the streams is not possible. but in ASSERTIONS mode we check
+ // if there was something to flush, and if so tell the user they
+ // should request that the runtime be exitable.
+ // Normally we would not even include flush() at all, but in ASSERTIONS
+ // builds we do so just for this check, and here we see if there is any
+ // content to flush, that is, we check if there would have been
+ // something a non-ASSERTIONS build would have not seen.
+ // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0
+ // mode (which has its own special function for this; otherwise, all
+ // the code is inside libc)
+ var oldOut = out;
+ var oldErr = err;
+ var has = false;
+ out = err = (x) => {
+ has = true;
+ };
+ try {
+ // it doesn't matter if it fails
+ _fflush(0);
+ // also flush in the JS FS layer
+ ["stdout", "stderr"].forEach((name) => {
+ var info = FS.analyzePath("/dev/" + name);
+ if (!info) return;
+ var stream = info.object;
+ var rdev = stream.rdev;
+ var tty = TTY.ttys[rdev];
+ if (tty?.output?.length) {
+ has = true;
+ }
+ });
+ } catch (e) {}
+ out = oldOut;
+ err = oldErr;
+ if (has) {
+ warnOnce(
+ "stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the Emscripten FAQ), or make sure to emit a newline when you printf etc.",
+ );
+ }
+ }
+
+ if (Module["preInit"]) {
+ if (typeof Module["preInit"] == "function")
+ Module["preInit"] = [Module["preInit"]];
+ while (Module["preInit"].length > 0) {
+ Module["preInit"].pop()();
+ }
+ }
+
+ run();
+
+ // end include: postamble.js
+
+ // include: postamble_modularize.js
+ // In MODULARIZE mode we wrap the generated code in a factory function
+ // and return either the Module itself, or a promise of the module.
+ //
+ // We assign to the `moduleRtn` global here and configure closure to see
+ // this as and extern so it won't get minified.
+
+ moduleRtn = readyPromise;
+
+ // Assertion for attempting to access module properties on the incoming
+ // moduleArg. In the past we used this object as the prototype of the module
+ // and assigned properties to it, but now we return a distinct object. This
+ // keeps the instance private until it is ready (i.e the promise has been
+ // resolved).
+ for (const prop of Object.keys(Module)) {
+ if (!(prop in moduleArg)) {
+ Object.defineProperty(moduleArg, prop, {
+ configurable: true,
+ get() {
+ abort(
+ `Access to module property ('${prop}') is no longer possible via the module constructor argument; Instead, use the result of the module constructor.`,
+ );
+ },
+ });
+ }
+ }
+ // end include: postamble_modularize.js
+
+ return moduleRtn;
+ };
+})();
+export default Module;
diff --git a/src/quiz.ts b/src/quiz.ts
new file mode 100644
index 0000000..43e9f49
--- /dev/null
+++ b/src/quiz.ts
@@ -0,0 +1,10 @@
+export type Quiz = {
+ label: string;
+ func: string;
+ message: string;
+};
+
+export type QuizGroup = {
+ label: string;
+ quizzes: Quiz[];
+};
diff --git a/src/quiz_data.ts b/src/quiz_data.ts
new file mode 100644
index 0000000..3c6f6dd
--- /dev/null
+++ b/src/quiz_data.ts
@@ -0,0 +1,74 @@
+import { QuizGroup } from "./quiz";
+
+export const QUIZ_GROUPS: QuizGroup[] = [
+ {
+ label: "チュートリアル",
+ quizzes: [
+ {
+ label: "Q1",
+ func: "abs",
+ message: "トークン1文字目「#」",
+ },
+ ],
+ },
+ {
+ label: "かんたん",
+ quizzes: [
+ {
+ label: "Q2",
+ func: "strlen",
+ message: "トークン2文字目「W」",
+ },
+ {
+ label: "Q3",
+ func: "gettype",
+ message: "トークン3文字目「E」",
+ },
+ {
+ label: "Q4",
+ func: "count",
+ message: "トークン4文字目「❤」",
+ },
+ ],
+ },
+ {
+ label: "ふつう",
+ quizzes: [
+ {
+ label: "Q5",
+ func: "md5",
+ message: "トークン5文字目「P」",
+ },
+ {
+ label: "Q6",
+ func: "strtoupper",
+ message: "トークン6文字目「H」",
+ },
+ {
+ label: "Q7",
+ func: "array_keys",
+ message: "トークン7文字目「P」。トークンはこれでおわり",
+ },
+ ],
+ },
+ {
+ label: "むずかしい",
+ quizzes: [
+ {
+ label: "Q8",
+ func: "str_rot13",
+ message: "すごい!",
+ },
+ {
+ label: "Q9",
+ func: "metaphone",
+ message: "すごい!",
+ },
+ {
+ label: "Q10",
+ func: "array_change_key_case",
+ message: "すごい!",
+ },
+ ],
+ },
+];
diff --git a/src/styles.css b/src/styles.css
new file mode 100644
index 0000000..b5d845e
--- /dev/null
+++ b/src/styles.css
@@ -0,0 +1,73 @@
+body {
+ margin: 0;
+ padding: 0;
+ font-size: 14px;
+ background-color: #ee0;
+}
+
+table#layout {
+ width: 800px;
+ margin: 0 auto;
+ border: 4px solid #000;
+}
+
+#layout td {
+ border: 2px solid #00e;
+ padding: 10px;
+ vertical-align: top;
+}
+
+#header {
+ text-align: center;
+ font-weight: bold;
+ font-size: 32px;
+ background-color: #e0e;
+ color: #fff;
+}
+
+#sidebar {
+ width: 200px;
+ background-color: #ec0;
+}
+
+#sidebar .hidden {
+ color: #ec0;
+}
+
+#content {
+ background-color: #ee0;
+}
+
+code {
+ background-color: #eee;
+ padding: 2px 4px;
+}
+
+input[type="text"] {
+ width: 180px;
+ background-color: #eee;
+ border: 1px solid #000;
+ padding: 2px 4px;
+}
+
+.marquee {
+ overflow: hidden;
+ white-space: nowrap;
+ box-sizing: border-box;
+ width: 300px;
+}
+
+.marquee span {
+ display: inline-block;
+ padding-left: 100%;
+ animation: marquee-scroll 10s linear infinite;
+}
+
+@keyframes marquee-scroll {
+ 0% {
+ transform: translateX(0);
+ }
+ 100% {
+ transform: translateX(-100%);
+ }
+}
diff --git a/src/vite-env.d.ts b/src/vite-env.d.ts
new file mode 100644
index 0000000..11f02fe
--- /dev/null
+++ b/src/vite-env.d.ts
@@ -0,0 +1 @@
+/// <reference types="vite/client" />