aboutsummaryrefslogtreecommitdiffhomepage
path: root/examples
diff options
context:
space:
mode:
Diffstat (limited to 'examples')
-rw-r--r--examples/php-on-wasm/php-wasm.mjs8308
-rw-r--r--examples/php-on-wasm/php-wasm.php956
-rwxr-xr-xexamples/php-on-wasm/php-wasm.wasmbin0 -> 4863136 bytes
3 files changed, 9264 insertions, 0 deletions
diff --git a/examples/php-on-wasm/php-wasm.mjs b/examples/php-on-wasm/php-wasm.mjs
new file mode 100644
index 0000000..8477416
--- /dev/null
+++ b/examples/php-on-wasm/php-wasm.mjs
@@ -0,0 +1,8308 @@
+
+import { createRequire } from 'module';
+const require = createRequire(import.meta.url);
+
+var Module = (() => {
+ var _scriptDir = import.meta.url;
+
+ return (
+function(moduleArg = {}) {
+
+// include: shell.js
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = moduleArg;
+
+// Set up the promise that indicates the Module is initialized
+var readyPromiseResolve, readyPromiseReject;
+Module['ready'] = new Promise((resolve, reject) => {
+ readyPromiseResolve = resolve;
+ readyPromiseReject = reject;
+});
+["_main","_memory","_php_wasm_run","_fflush","___indirect_function_table","onRuntimeInitialized"].forEach((prop) => {
+ if (!Object.getOwnPropertyDescriptor(Module['ready'], prop)) {
+ Object.defineProperty(Module['ready'], prop, {
+ get: () => abort('You are getting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
+ set: () => abort('You are setting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'),
+ });
+ }
+});
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = Object.assign({}, Module);
+
+var arguments_ = [];
+var thisProgram = './this.program';
+var quit_ = (status, toThrow) => {
+ throw toThrow;
+};
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = true;
+var ENVIRONMENT_IS_SHELL = false;
+
+if (Module['ENVIRONMENT']) {
+ throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)');
+}
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+ if (Module['locateFile']) {
+ return Module['locateFile'](path, scriptDirectory);
+ }
+ return scriptDirectory + path;
+}
+
+// Hooks that are implemented differently in different runtime environments.
+var read_,
+ readAsync,
+ readBinary;
+
+if (ENVIRONMENT_IS_NODE) {
+ if (typeof process == 'undefined' || !process.release || process.release.name !== 'node') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');
+
+ var nodeVersion = process.versions.node;
+ var numericVersion = nodeVersion.split('.').slice(0, 3);
+ numericVersion = (numericVersion[0] * 10000) + (numericVersion[1] * 100) + (numericVersion[2].split('-')[0] * 1);
+ var minVersion = 160000;
+ if (numericVersion < 160000) {
+ throw new Error('This emscripten-generated code requires node v16.0.0 (detected v' + nodeVersion + ')');
+ }
+
+ // `require()` is no-op in an ESM module, use `createRequire()` to construct
+ // the require()` function. This is only necessary for multi-environment
+ // builds, `-sENVIRONMENT=node` emits a static import declaration instead.
+ // TODO: Swap all `require()`'s with `import()`'s?
+ // These modules will usually be used on Node.js. Load them eagerly to avoid
+ // the complexity of lazy-loading.
+ var fs = require('fs');
+ var nodePath = require('path');
+
+ if (ENVIRONMENT_IS_WORKER) {
+ scriptDirectory = nodePath.dirname(scriptDirectory) + '/';
+ } else {
+ // EXPORT_ES6 + ENVIRONMENT_IS_NODE always requires use of import.meta.url,
+ // since there's no way getting the current absolute path of the module when
+ // support for that is not available.
+ scriptDirectory = require('url').fileURLToPath(new URL('./', import.meta.url)); // includes trailing slash
+ }
+
+// include: node_shell_read.js
+read_ = (filename, binary) => {
+ // We need to re-wrap `file://` strings to URLs. Normalizing isn't
+ // necessary in that case, the path should already be absolute.
+ filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+ return fs.readFileSync(filename, binary ? undefined : 'utf8');
+};
+
+readBinary = (filename) => {
+ var ret = read_(filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ assert(ret.buffer);
+ return ret;
+};
+
+readAsync = (filename, onload, onerror, binary = true) => {
+ // See the comment in the `read_` function.
+ filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+ fs.readFile(filename, binary ? undefined : 'utf8', (err, data) => {
+ if (err) onerror(err);
+ else onload(binary ? data.buffer : data);
+ });
+};
+// end include: node_shell_read.js
+ if (!Module['thisProgram'] && process.argv.length > 1) {
+ thisProgram = process.argv[1].replace(/\\/g, '/');
+ }
+
+ arguments_ = process.argv.slice(2);
+
+ // MODULARIZE will export the module in the proper place outside, we don't need to export here
+
+ quit_ = (status, toThrow) => {
+ process.exitCode = status;
+ throw toThrow;
+ };
+
+ Module['inspect'] = () => '[Emscripten Module object]';
+
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+ if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)');
+
+ if (typeof read != 'undefined') {
+ read_ = read;
+ }
+
+ readBinary = (f) => {
+ if (typeof readbuffer == 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ let data = read(f, 'binary');
+ assert(typeof data == 'object');
+ return data;
+ };
+
+ readAsync = (f, onload, onerror) => {
+ setTimeout(() => onload(readBinary(f)));
+ };
+
+ if (typeof clearTimeout == 'undefined') {
+ globalThis.clearTimeout = (id) => {};
+ }
+
+ if (typeof setTimeout == 'undefined') {
+ // spidermonkey lacks setTimeout but we use it above in readAsync.
+ globalThis.setTimeout = (f) => (typeof f == 'function') ? f() : abort();
+ }
+
+ if (typeof scriptArgs != 'undefined') {
+ arguments_ = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ arguments_ = arguments;
+ }
+
+ if (typeof quit == 'function') {
+ quit_ = (status, toThrow) => {
+ // Unlike node which has process.exitCode, d8 has no such mechanism. So we
+ // have no way to set the exit code and then let the program exit with
+ // that code when it naturally stops running (say, when all setTimeouts
+ // have completed). For that reason, we must call `quit` - the only way to
+ // set the exit code - but quit also halts immediately. To increase
+ // consistency with node (and the web) we schedule the actual quit call
+ // using a setTimeout to give the current stack and any exception handlers
+ // a chance to run. This enables features such as addOnPostRun (which
+ // expected to be able to run code after main returns).
+ setTimeout(() => {
+ if (!(toThrow instanceof ExitStatus)) {
+ let toLog = toThrow;
+ if (toThrow && typeof toThrow == 'object' && toThrow.stack) {
+ toLog = [toThrow, toThrow.stack];
+ }
+ err(`exiting due to exception: ${toLog}`);
+ }
+ quit(status);
+ });
+ throw toThrow;
+ };
+ }
+
+ if (typeof print != 'undefined') {
+ // Prefer to use print/printErr where they exist, as they usually work better.
+ if (typeof console == 'undefined') console = /** @type{!Console} */({});
+ console.log = /** @type{!function(this:Console, ...*): undefined} */ (print);
+ console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print);
+ }
+
+} else
+
+// Note that this includes Node.js workers when relevant (pthreads is enabled).
+// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
+// ENVIRONMENT_IS_NODE.
+{
+ throw new Error('environment detection error');
+}
+
+var out = Module['print'] || console.log.bind(console);
+var err = Module['printErr'] || console.error.bind(console);
+
+// Merge back in the overrides
+Object.assign(Module, moduleOverrides);
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = null;
+checkIncomingModuleAPI();
+
+// Emit code to handle expected values on the Module object. This applies Module.x
+// to the proper local x. This has two benefits: first, we only emit it if it is
+// expected to arrive, and second, by using a local everywhere else that can be
+// minified.
+
+if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_');
+
+if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram');
+
+if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_');
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+// Assertions on removed incoming Module JS APIs.
+assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)');
+assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)');
+assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)');
+assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify emscripten_set_window_title in JS)');
+assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY');
+legacyModuleProp('asm', 'wasmExports');
+legacyModuleProp('read', 'read_');
+legacyModuleProp('readAsync', 'readAsync');
+legacyModuleProp('readBinary', 'readBinary');
+legacyModuleProp('setWindowTitle', 'setWindowTitle');
+var IDBFS = 'IDBFS is no longer included by default; build with -lidbfs.js';
+var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js';
+var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js';
+var FETCHFS = 'FETCHFS is no longer included by default; build with -lfetchfs.js';
+var ICASEFS = 'ICASEFS is no longer included by default; build with -licasefs.js';
+var JSFILEFS = 'JSFILEFS is no longer included by default; build with -ljsfilefs.js';
+var OPFS = 'OPFS is no longer included by default; build with -lopfs.js';
+
+var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js';
+
+assert(!ENVIRONMENT_IS_WEB, "web environment detected but not enabled at build time. Add 'web' to `-sENVIRONMENT` to enable.");
+
+assert(!ENVIRONMENT_IS_WORKER, "worker environment detected but not enabled at build time. Add 'worker' to `-sENVIRONMENT` to enable.");
+
+assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-sENVIRONMENT` to enable.");
+
+
+// end include: shell.js
+// include: preamble.js
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+var wasmBinary;
+if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary');
+var noExitRuntime = Module['noExitRuntime'] || true;legacyModuleProp('noExitRuntime', 'noExitRuntime');
+
+if (typeof WebAssembly != 'object') {
+ abort('no native wasm support detected');
+}
+
+// Wasm globals
+
+var wasmMemory;
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort(). Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+ if (!condition) {
+ abort('Assertion failed' + (text ? ': ' + text : ''));
+ }
+}
+
+// We used to include malloc/free by default in the past. Show a helpful error in
+// builds with assertions.
+
+// Memory management
+
+var HEAP,
+/** @type {!Int8Array} */
+ HEAP8,
+/** @type {!Uint8Array} */
+ HEAPU8,
+/** @type {!Int16Array} */
+ HEAP16,
+/** @type {!Uint16Array} */
+ HEAPU16,
+/** @type {!Int32Array} */
+ HEAP32,
+/** @type {!Uint32Array} */
+ HEAPU32,
+/** @type {!Float32Array} */
+ HEAPF32,
+/** @type {!Float64Array} */
+ HEAPF64;
+
+function updateMemoryViews() {
+ var b = wasmMemory.buffer;
+ Module['HEAP8'] = HEAP8 = new Int8Array(b);
+ Module['HEAP16'] = HEAP16 = new Int16Array(b);
+ Module['HEAPU8'] = HEAPU8 = new Uint8Array(b);
+ Module['HEAPU16'] = HEAPU16 = new Uint16Array(b);
+ Module['HEAP32'] = HEAP32 = new Int32Array(b);
+ Module['HEAPU32'] = HEAPU32 = new Uint32Array(b);
+ Module['HEAPF32'] = HEAPF32 = new Float32Array(b);
+ Module['HEAPF64'] = HEAPF64 = new Float64Array(b);
+}
+
+assert(!Module['STACK_SIZE'], 'STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time')
+
+assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined,
+ 'JS engine does not provide full typed array support');
+
+// If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY
+assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected. Use -sIMPORTED_MEMORY to define wasmMemory externally');
+assert(!Module['INITIAL_MEMORY'], 'Detected runtime INITIAL_MEMORY setting. Use -sIMPORTED_MEMORY to define wasmMemory dynamically');
+
+// include: runtime_stack_check.js
+// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+function writeStackCookie() {
+ var max = _emscripten_stack_get_end();
+ assert((max & 3) == 0);
+ // If the stack ends at address zero we write our cookies 4 bytes into the
+ // stack. This prevents interference with SAFE_HEAP and ASAN which also
+ // monitor writes to address zero.
+ if (max == 0) {
+ max += 4;
+ }
+ // The stack grow downwards towards _emscripten_stack_get_end.
+ // We write cookies to the final two words in the stack and detect if they are
+ // ever overwritten.
+ HEAPU32[((max)>>2)] = 0x02135467;
+ HEAPU32[(((max)+(4))>>2)] = 0x89BACDFE;
+ // Also test the global address 0 for integrity.
+ HEAPU32[((0)>>2)] = 1668509029;
+}
+
+function checkStackCookie() {
+ if (ABORT) return;
+ var max = _emscripten_stack_get_end();
+ // See writeStackCookie().
+ if (max == 0) {
+ max += 4;
+ }
+ var cookie1 = HEAPU32[((max)>>2)];
+ var cookie2 = HEAPU32[(((max)+(4))>>2)];
+ if (cookie1 != 0x02135467 || cookie2 != 0x89BACDFE) {
+ abort(`Stack overflow! Stack cookie has been overwritten at ${ptrToString(max)}, expected hex dwords 0x89BACDFE and 0x2135467, but received ${ptrToString(cookie2)} ${ptrToString(cookie1)}`);
+ }
+ // Also test the global address 0 for integrity.
+ if (HEAPU32[((0)>>2)] != 0x63736d65 /* 'emsc' */) {
+ abort('Runtime error: The application has corrupted its heap memory area (address zero)!');
+ }
+}
+// end include: runtime_stack_check.js
+// include: runtime_assertions.js
+// Endianness check
+(function() {
+ var h16 = new Int16Array(1);
+ var h8 = new Int8Array(h16.buffer);
+ h16[0] = 0x6373;
+ if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)';
+})();
+
+// end include: runtime_assertions.js
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+
+var runtimeKeepaliveCounter = 0;
+
+function keepRuntimeAlive() {
+ return noExitRuntime || runtimeKeepaliveCounter > 0;
+}
+
+function preRun() {
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function initRuntime() {
+ assert(!runtimeInitialized);
+ runtimeInitialized = true;
+
+ checkStackCookie();
+
+
+if (!Module["noFSInit"] && !FS.init.initialized)
+ FS.init();
+FS.ignorePermissions = false;
+
+TTY.init();
+SOCKFS.root = FS.mount(SOCKFS, {}, null);
+PIPEFS.root = FS.mount(PIPEFS, {}, null);
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function postRun() {
+ checkStackCookie();
+
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnExit(cb) {
+}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+// include: runtime_math.js
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
+
+assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+// end include: runtime_math.js
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+ var orig = id;
+ while (1) {
+ if (!runDependencyTracking[id]) return id;
+ id = orig + Math.random();
+ }
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+
+ if (id) {
+ assert(!runDependencyTracking[id]);
+ runDependencyTracking[id] = 1;
+ if (runDependencyWatcher === null && typeof setInterval != 'undefined') {
+ // Check for missing dependencies every few seconds
+ runDependencyWatcher = setInterval(() => {
+ if (ABORT) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ return;
+ }
+ var shown = false;
+ for (var dep in runDependencyTracking) {
+ if (!shown) {
+ shown = true;
+ err('still waiting on run dependencies:');
+ }
+ err(`dependency: ${dep}`);
+ }
+ if (shown) {
+ err('(end of list)');
+ }
+ }, 10000);
+ }
+ } else {
+ err('warning: run dependency added without ID');
+ }
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+
+ if (id) {
+ assert(runDependencyTracking[id]);
+ delete runDependencyTracking[id];
+ } else {
+ err('warning: run dependency removed without ID');
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+
+/** @param {string|number=} what */
+function abort(what) {
+ if (Module['onAbort']) {
+ Module['onAbort'](what);
+ }
+
+ what = 'Aborted(' + what + ')';
+ // TODO(sbc): Should we remove printing and leave it up to whoever
+ // catches the exception?
+ err(what);
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ // Use a wasm runtime error, because a JS error might be seen as a foreign
+ // exception, which means we'd run destructors on it. We need the error to
+ // simply make the program stop.
+ // FIXME This approach does not work in Wasm EH because it currently does not assume
+ // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
+ // a trap or not based on a hidden field within the object. So at the moment
+ // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
+ // allows this in the wasm spec.
+
+ // Suppress closure compiler warning here. Closure compiler's builtin extern
+ // defintion for WebAssembly.RuntimeError claims it takes no arguments even
+ // though it can.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
+ /** @suppress {checkTypes} */
+ var e = new WebAssembly.RuntimeError(what);
+
+ readyPromiseReject(e);
+ // Throw the error whether or not MODULARIZE is set because abort is used
+ // in code paths apart from instantiation where an exception is expected
+ // to be thrown when abort is called.
+ throw e;
+}
+
+// include: memoryprofiler.js
+// end include: memoryprofiler.js
+// include: URIUtils.js
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+ // Prefix of data URIs emitted by SINGLE_FILE and related options.
+ return filename.startsWith(dataURIPrefix);
+}
+
+// Indicates whether filename is delivered via file protocol (as opposed to http/https)
+function isFileURI(filename) {
+ return filename.startsWith('file://');
+}
+// end include: URIUtils.js
+function createExportWrapper(name) {
+ return function() {
+ assert(runtimeInitialized, `native function \`${name}\` called before runtime initialization`);
+ var f = wasmExports[name];
+ assert(f, `exported native function \`${name}\` not found`);
+ return f.apply(null, arguments);
+ };
+}
+
+// include: runtime_exceptions.js
+// end include: runtime_exceptions.js
+var wasmBinaryFile;
+if (Module['locateFile']) {
+ wasmBinaryFile = 'php-wasm.wasm';
+ if (!isDataURI(wasmBinaryFile)) {
+ wasmBinaryFile = locateFile(wasmBinaryFile);
+ }
+} else {
+ // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too.
+ wasmBinaryFile = new URL('php-wasm.wasm', import.meta.url).href;
+}
+
+function getBinarySync(file) {
+ if (file == wasmBinaryFile && wasmBinary) {
+ return new Uint8Array(wasmBinary);
+ }
+ if (readBinary) {
+ return readBinary(file);
+ }
+ throw "both async and sync fetching of the wasm failed";
+}
+
+function getBinaryPromise(binaryFile) {
+ // If we don't have the binary yet, try to load it asynchronously.
+ // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
+ // See https://github.com/github/fetch/pull/92#issuecomment-140665932
+ // Cordova or Electron apps are typically loaded from a file:// url.
+ // So use fetch if it is available and the url is not a file, otherwise fall back to XHR.
+ if (!wasmBinary
+ && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
+ if (typeof fetch == 'function'
+ ) {
+ return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
+ if (!response['ok']) {
+ throw "failed to load wasm binary file at '" + binaryFile + "'";
+ }
+ return response['arrayBuffer']();
+ }).catch(() => getBinarySync(binaryFile));
+ }
+ }
+
+ // Otherwise, getBinarySync should be able to get it synchronously
+ return Promise.resolve().then(() => getBinarySync(binaryFile));
+}
+
+function instantiateArrayBuffer(binaryFile, imports, receiver) {
+ return getBinaryPromise(binaryFile).then((binary) => {
+ return WebAssembly.instantiate(binary, imports);
+ }).then((instance) => {
+ return instance;
+ }).then(receiver, (reason) => {
+ err(`failed to asynchronously prepare wasm: ${reason}`);
+
+ // Warn on some common problems.
+ if (isFileURI(wasmBinaryFile)) {
+ err(`warning: Loading from a file URI (${wasmBinaryFile}) is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing`);
+ }
+ abort(reason);
+ });
+}
+
+function instantiateAsync(binary, binaryFile, imports, callback) {
+ if (!binary &&
+ typeof WebAssembly.instantiateStreaming == 'function' &&
+ !isDataURI(binaryFile) &&
+ // Avoid instantiateStreaming() on Node.js environment for now, as while
+ // Node.js v18.1.0 implements it, it does not have a full fetch()
+ // implementation yet.
+ //
+ // Reference:
+ // https://github.com/emscripten-core/emscripten/pull/16917
+ !ENVIRONMENT_IS_NODE &&
+ typeof fetch == 'function') {
+ return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
+ // Suppress closure warning here since the upstream definition for
+ // instantiateStreaming only allows Promise<Repsponse> rather than
+ // an actual Response.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
+ /** @suppress {checkTypes} */
+ var result = WebAssembly.instantiateStreaming(response, imports);
+
+ return result.then(
+ callback,
+ function(reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err(`wasm streaming compile failed: ${reason}`);
+ err('falling back to ArrayBuffer instantiation');
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+ });
+ });
+ }
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+}
+
+// Create the wasm instance.
+// Receives the wasm imports, returns the exports.
+function createWasm() {
+ // prepare imports
+ var info = {
+ 'env': wasmImports,
+ 'wasi_snapshot_preview1': wasmImports,
+ };
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ /** @param {WebAssembly.Module=} module*/
+ function receiveInstance(instance, module) {
+ wasmExports = instance.exports;
+
+
+
+ wasmMemory = wasmExports['memory'];
+
+ assert(wasmMemory, "memory not found in wasm exports");
+ // This assertion doesn't hold when emscripten is run in --post-link
+ // mode.
+ // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode.
+ //assert(wasmMemory.buffer.byteLength === 16777216);
+ updateMemoryViews();
+
+ wasmTable = wasmExports['__indirect_function_table'];
+
+ assert(wasmTable, "table not found in wasm exports");
+
+ addOnInit(wasmExports['__wasm_call_ctors']);
+
+ removeRunDependency('wasm-instantiate');
+ return wasmExports;
+ }
+ // wait for the pthread pool (if any)
+ addRunDependency('wasm-instantiate');
+
+ // Prefer streaming instantiation if available.
+ // Async compilation can be confusing when an error on the page overwrites Module
+ // (for example, if the order of elements is wrong, and the one defining Module is
+ // later), so we save Module and check it later.
+ var trueModule = Module;
+ function receiveInstantiationResult(result) {
+ // 'result' is a ResultObject object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?');
+ trueModule = null;
+ // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
+ // When the regression is fixed, can restore the above PTHREADS-enabled path.
+ receiveInstance(result['instance']);
+ }
+
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to
+ // run the instantiation parallel to any other async startup actions they are
+ // performing.
+ // Also pthreads and wasm workers initialize the wasm instance through this
+ // path.
+ if (Module['instantiateWasm']) {
+
+ try {
+ return Module['instantiateWasm'](info, receiveInstance);
+ } catch(e) {
+ err(`Module.instantiateWasm callback failed with error: ${e}`);
+ // If instantiation fails, reject the module ready promise.
+ readyPromiseReject(e);
+ }
+ }
+
+ // If instantiation fails, reject the module ready promise.
+ instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject);
+ return {}; // no exports yet; we'll fill them in later
+}
+
+// Globals used by JS i64 conversions (see makeSetValue)
+var tempDouble;
+var tempI64;
+
+// include: runtime_debug.js
+function legacyModuleProp(prop, newName, incomming=true) {
+ if (!Object.getOwnPropertyDescriptor(Module, prop)) {
+ Object.defineProperty(Module, prop, {
+ configurable: true,
+ get() {
+ let extra = incomming ? ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)' : '';
+ abort(`\`Module.${prop}\` has been replaced by \`${newName}\`` + extra);
+
+ }
+ });
+ }
+}
+
+function ignoredModuleProp(prop) {
+ if (Object.getOwnPropertyDescriptor(Module, prop)) {
+ abort(`\`Module.${prop}\` was supplied but \`${prop}\` not included in INCOMING_MODULE_JS_API`);
+ }
+}
+
+// forcing the filesystem exports a few things by default
+function isExportedByForceFilesystem(name) {
+ return name === 'FS_createPath' ||
+ name === 'FS_createDataFile' ||
+ name === 'FS_createPreloadedFile' ||
+ name === 'FS_unlink' ||
+ name === 'addRunDependency' ||
+ // The old FS has some functionality that WasmFS lacks.
+ name === 'FS_createLazyFile' ||
+ name === 'FS_createDevice' ||
+ name === 'removeRunDependency';
+}
+
+function missingGlobal(sym, msg) {
+ if (typeof globalThis !== 'undefined') {
+ Object.defineProperty(globalThis, sym, {
+ configurable: true,
+ get() {
+ warnOnce('`' + sym + '` is not longer defined by emscripten. ' + msg);
+ return undefined;
+ }
+ });
+ }
+}
+
+missingGlobal('buffer', 'Please use HEAP8.buffer or wasmMemory.buffer');
+missingGlobal('asm', 'Please use wasmExports instead');
+
+function missingLibrarySymbol(sym) {
+ if (typeof globalThis !== 'undefined' && !Object.getOwnPropertyDescriptor(globalThis, sym)) {
+ Object.defineProperty(globalThis, sym, {
+ configurable: true,
+ get() {
+ // Can't `abort()` here because it would break code that does runtime
+ // checks. e.g. `if (typeof SDL === 'undefined')`.
+ var msg = '`' + sym + '` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line';
+ // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in
+ // library.js, which means $name for a JS name with no prefix, or name
+ // for a JS name like _name.
+ var librarySymbol = sym;
+ if (!librarySymbol.startsWith('_')) {
+ librarySymbol = '$' + sym;
+ }
+ msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE='" + librarySymbol + "')";
+ if (isExportedByForceFilesystem(sym)) {
+ msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
+ }
+ warnOnce(msg);
+ return undefined;
+ }
+ });
+ }
+ // Any symbol that is not included from the JS libary is also (by definition)
+ // not exported on the Module object.
+ unexportedRuntimeSymbol(sym);
+}
+
+function unexportedRuntimeSymbol(sym) {
+ if (!Object.getOwnPropertyDescriptor(Module, sym)) {
+ Object.defineProperty(Module, sym, {
+ configurable: true,
+ get() {
+ var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the Emscripten FAQ)";
+ if (isExportedByForceFilesystem(sym)) {
+ msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you';
+ }
+ abort(msg);
+ }
+ });
+ }
+}
+
+// Used by XXXXX_DEBUG settings to output debug messages.
+function dbg(text) {
+ // TODO(sbc): Make this configurable somehow. Its not always convenient for
+ // logging to show up as warnings.
+ console.warn.apply(console, arguments);
+}
+// end include: runtime_debug.js
+// === Body ===
+
+// end include: preamble.js
+
+ /** @constructor */
+ function ExitStatus(status) {
+ this.name = 'ExitStatus';
+ this.message = `Program terminated with exit(${status})`;
+ this.status = status;
+ }
+
+ var callRuntimeCallbacks = (callbacks) => {
+ while (callbacks.length > 0) {
+ // Pass the module as the first argument.
+ callbacks.shift()(Module);
+ }
+ };
+
+
+ /**
+ * @param {number} ptr
+ * @param {string} type
+ */
+ function getValue(ptr, type = 'i8') {
+ if (type.endsWith('*')) type = '*';
+ switch (type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': abort('to do getValue(i64) use WASM_BIGINT');
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return HEAPF64[((ptr)>>3)];
+ case '*': return HEAPU32[((ptr)>>2)];
+ default: abort(`invalid type for getValue: ${type}`);
+ }
+ }
+
+ var ptrToString = (ptr) => {
+ assert(typeof ptr === 'number');
+ // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+ ptr >>>= 0;
+ return '0x' + ptr.toString(16).padStart(8, '0');
+ };
+
+
+ /**
+ * @param {number} ptr
+ * @param {number} value
+ * @param {string} type
+ */
+ function setValue(ptr, value, type = 'i8') {
+ if (type.endsWith('*')) type = '*';
+ switch (type) {
+ case 'i1': HEAP8[((ptr)>>0)] = value; break;
+ case 'i8': HEAP8[((ptr)>>0)] = value; break;
+ case 'i16': HEAP16[((ptr)>>1)] = value; break;
+ case 'i32': HEAP32[((ptr)>>2)] = value; break;
+ case 'i64': abort('to do setValue(i64) use WASM_BIGINT');
+ case 'float': HEAPF32[((ptr)>>2)] = value; break;
+ case 'double': HEAPF64[((ptr)>>3)] = value; break;
+ case '*': HEAPU32[((ptr)>>2)] = value; break;
+ default: abort(`invalid type for setValue: ${type}`);
+ }
+ }
+
+ var warnOnce = (text) => {
+ if (!warnOnce.shown) warnOnce.shown = {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ if (ENVIRONMENT_IS_NODE) text = 'warning: ' + text;
+ err(text);
+ }
+ };
+
+ var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined;
+
+ /**
+ * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
+ * array that contains uint8 values, returns a copy of that string as a
+ * Javascript String object.
+ * heapOrArray is either a regular array, or a JavaScript typed array view.
+ * @param {number} idx
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+ var UTF8ArrayToString = (heapOrArray, idx, maxBytesToRead) => {
+ var endIdx = idx + maxBytesToRead;
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on
+ // null terminator by itself. Also, use the length info to avoid running tiny
+ // strings through TextDecoder, since .subarray() allocates garbage.
+ // (As a tiny code save trick, compare endPtr against endIdx using a negation,
+ // so that undefined means Infinity)
+ while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+
+ if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+ return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
+ }
+ var str = '';
+ // If building with TextDecoder, we have already computed the string length
+ // above, so test loop end condition against that
+ while (idx < endPtr) {
+ // For UTF8 byte structure, see:
+ // http://en.wikipedia.org/wiki/UTF-8#Description
+ // https://www.ietf.org/rfc/rfc2279.txt
+ // https://tools.ietf.org/html/rfc3629
+ var u0 = heapOrArray[idx++];
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ var u1 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ var u2 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte ' + ptrToString(u0) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!');
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
+ }
+
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+ return str;
+ };
+
+ /**
+ * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
+ * emscripten HEAP, returns a copy of that string as a Javascript String object.
+ *
+ * @param {number} ptr
+ * @param {number=} maxBytesToRead - An optional length that specifies the
+ * maximum number of bytes to read. You can omit this parameter to scan the
+ * string until the first 0 byte. If maxBytesToRead is passed, and the string
+ * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
+ * string will cut short at that byte index (i.e. maxBytesToRead will not
+ * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
+ * frequent uses of UTF8ToString() with and without maxBytesToRead may throw
+ * JS JIT optimizations off, so it is worth to consider consistently using one
+ * @return {string}
+ */
+ var UTF8ToString = (ptr, maxBytesToRead) => {
+ assert(typeof ptr == 'number');
+ return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
+ };
+ var ___assert_fail = (condition, filename, line, func) => {
+ abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
+ };
+
+ var wasmTableMirror = [];
+
+ var wasmTable;
+ var getWasmTableEntry = (funcPtr) => {
+ var func = wasmTableMirror[funcPtr];
+ if (!func) {
+ if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
+ wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+ }
+ assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!");
+ return func;
+ };
+ var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig);
+
+ var PATH = {
+ isAbs:(path) => path.charAt(0) === '/',
+ splitPath:(filename) => {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },
+ normalizeArray:(parts, allowAboveRoot) => {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up; up--) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },
+ normalize:(path) => {
+ var isAbsolute = PATH.isAbs(path),
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },
+ dirname:(path) => {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },
+ basename:(path) => {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ path = PATH.normalize(path);
+ path = path.replace(/\/$/, "");
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },
+ join:function() {
+ var paths = Array.prototype.slice.call(arguments);
+ return PATH.normalize(paths.join('/'));
+ },
+ join2:(l, r) => {
+ return PATH.normalize(l + '/' + r);
+ },
+ };
+
+ var initRandomFill = () => {
+ if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') {
+ // for modern web browsers
+ return (view) => crypto.getRandomValues(view);
+ } else
+ if (ENVIRONMENT_IS_NODE) {
+ // for nodejs with or without crypto support included
+ try {
+ var crypto_module = require('crypto');
+ var randomFillSync = crypto_module['randomFillSync'];
+ if (randomFillSync) {
+ // nodejs with LTS crypto support
+ return (view) => crypto_module['randomFillSync'](view);
+ }
+ // very old nodejs with the original crypto API
+ var randomBytes = crypto_module['randomBytes'];
+ return (view) => (
+ view.set(randomBytes(view.byteLength)),
+ // Return the original view to match modern native implementations.
+ view
+ );
+ } catch (e) {
+ // nodejs doesn't have crypto support
+ }
+ }
+ // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+ abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: (array) => { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };");
+ };
+ var randomFill = (view) => {
+ // Lazily init on the first invocation.
+ return (randomFill = initRandomFill())(view);
+ };
+
+
+
+ var PATH_FS = {
+ resolve:function() {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path != 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = PATH.isAbs(path);
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },
+ relative:(from, to) => {
+ from = PATH_FS.resolve(from).substr(1);
+ to = PATH_FS.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ },
+ };
+
+
+
+ var FS_stdin_getChar_buffer = [];
+
+ var lengthBytesUTF8 = (str) => {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var c = str.charCodeAt(i); // possibly a lead surrogate
+ if (c <= 0x7F) {
+ len++;
+ } else if (c <= 0x7FF) {
+ len += 2;
+ } else if (c >= 0xD800 && c <= 0xDFFF) {
+ len += 4; ++i;
+ } else {
+ len += 3;
+ }
+ }
+ return len;
+ };
+
+ var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
+ assert(typeof str === 'string');
+ // Parameter maxBytesToWrite is not optional. Negative values, 0, null,
+ // undefined and false each don't write out any bytes.
+ if (!(maxBytesToWrite > 0))
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
+ // and https://www.ietf.org/rfc/rfc2279.txt
+ // and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) {
+ var u1 = str.charCodeAt(++i);
+ u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+ }
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ heap[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ heap[outIdx++] = 0xC0 | (u >> 6);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ heap[outIdx++] = 0xE0 | (u >> 12);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 3 >= endIdx) break;
+ if (u > 0x10FFFF) warnOnce('Invalid Unicode code point ' + ptrToString(u) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).');
+ heap[outIdx++] = 0xF0 | (u >> 18);
+ heap[outIdx++] = 0x80 | ((u >> 12) & 63);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ heap[outIdx] = 0;
+ return outIdx - startIdx;
+ };
+ /** @type {function(string, boolean=, number=)} */
+ function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+ }
+ var FS_stdin_getChar = () => {
+ if (!FS_stdin_getChar_buffer.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = Buffer.alloc(BUFSIZE);
+ var bytesRead = 0;
+
+ // For some reason we must suppress a closure warning here, even though
+ // fd definitely exists on process.stdin, and is even the proper way to
+ // get the fd of stdin,
+ // https://github.com/nodejs/help/issues/2136#issuecomment-523649904
+ // This started to happen after moving this logic out of library_tty.js,
+ // so it is related to the surrounding code in some unclear manner.
+ /** @suppress {missingProperties} */
+ var fd = process.stdin.fd;
+
+ try {
+ bytesRead = fs.readSync(fd, buf);
+ } catch(e) {
+ // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+ // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+ if (e.toString().includes('EOF')) bytesRead = 0;
+ else throw e;
+ }
+
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+ } else
+ if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ FS_stdin_getChar_buffer = intArrayFromString(result, true);
+ }
+ return FS_stdin_getChar_buffer.shift();
+ };
+ var TTY = {
+ ttys:[],
+ init() {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process.stdin.setEncoding('utf8');
+ // }
+ },
+ shutdown() {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process.stdin.pause();
+ // }
+ },
+ register(dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },
+ stream_ops:{
+ open(stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(43);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ stream.tty.ops.fsync(stream.tty);
+ },
+ fsync(stream) {
+ stream.tty.ops.fsync(stream.tty);
+ },
+ read(stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(60);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(60);
+ }
+ try {
+ for (var i = 0; i < length; i++) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ },
+ },
+ default_tty_ops:{
+ get_char(tty) {
+ return FS_stdin_getChar();
+ },
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ },
+ ioctl_tcgets(tty) {
+ // typical setting
+ return {
+ c_iflag: 25856,
+ c_oflag: 5,
+ c_cflag: 191,
+ c_lflag: 35387,
+ c_cc: [
+ 0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, 0x00,
+ 0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ ]
+ };
+ },
+ ioctl_tcsets(tty, optional_actions, data) {
+ // currently just ignore
+ return 0;
+ },
+ ioctl_tiocgwinsz(tty) {
+ return [24, 80];
+ },
+ },
+ default_tty1_ops:{
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ },
+ },
+ };
+
+
+ var zeroMemory = (address, size) => {
+ HEAPU8.fill(0, address, address + size);
+ return address;
+ };
+
+ var alignMemory = (size, alignment) => {
+ assert(alignment, "alignment argument is required");
+ return Math.ceil(size / alignment) * alignment;
+ };
+ var mmapAlloc = (size) => {
+ size = alignMemory(size, 65536);
+ var ptr = _emscripten_builtin_memalign(65536, size);
+ if (!ptr) return 0;
+ return zeroMemory(ptr, size);
+ };
+ var MEMFS = {
+ ops_table:null,
+ mount(mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },
+ createNode(parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(63);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ parent.timestamp = node.timestamp;
+ }
+ return node;
+ },
+ getFileDataAsTypedArray(node) {
+ if (!node.contents) return new Uint8Array(0);
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },
+ expandFileStorage(node, newCapacity) {
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ },
+ resizeFileStorage(node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ } else {
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newSize); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ }
+ },
+ node_ops:{
+ getattr(node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },
+ setattr(node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },
+ lookup(parent, name) {
+ throw FS.genericErrors[44];
+ },
+ mknod(parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },
+ rename(old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.parent.timestamp = Date.now()
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ new_dir.timestamp = old_node.parent.timestamp;
+ old_node.parent = new_dir;
+ },
+ unlink(parent, name) {
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ rmdir(parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ readdir(node) {
+ var entries = ['.', '..'];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },
+ symlink(parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },
+ readlink(node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ return node.link;
+ },
+ },
+ stream_ops:{
+ read(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ // The data buffer should be a typed array view
+ assert(!(buffer instanceof ArrayBuffer));
+
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) {
+ assert(position === 0, 'canOwn must imply no weird position inside the file');
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = buffer.slice(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) {
+ // Use typed array write which is available.
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ } else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position + length);
+ return length;
+ },
+ llseek(stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) {
+ position += stream.position;
+ } else if (whence === 2) {
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ return position;
+ },
+ allocate(stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },
+ mmap(stream, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if (!(flags & 2) && contents.buffer === HEAP8.buffer) {
+ // We can't emulate MAP_SHARED when the file is not backed by the
+ // buffer we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < contents.length) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ HEAP8.set(contents, ptr);
+ }
+ return { ptr, allocated };
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ },
+ },
+ };
+
+ /** @param {boolean=} noRunDep */
+ var asyncLoad = (url, onload, onerror, noRunDep) => {
+ var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : '';
+ readAsync(url, (arrayBuffer) => {
+ assert(arrayBuffer, `Loading data file "${url}" failed (no arrayBuffer).`);
+ onload(new Uint8Array(arrayBuffer));
+ if (dep) removeRunDependency(dep);
+ }, (event) => {
+ if (onerror) {
+ onerror();
+ } else {
+ throw `Loading data file "${url}" failed.`;
+ }
+ });
+ if (dep) addRunDependency(dep);
+ };
+
+
+ var FS_createDataFile = (parent, name, fileData, canRead, canWrite, canOwn) => {
+ return FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn);
+ };
+
+ var preloadPlugins = Module['preloadPlugins'] || [];
+ var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => {
+ // Ensure plugins are ready.
+ if (typeof Browser != 'undefined') Browser.init();
+
+ var handled = false;
+ preloadPlugins.forEach((plugin) => {
+ if (handled) return;
+ if (plugin['canHandle'](fullname)) {
+ plugin['handle'](byteArray, fullname, finish, onerror);
+ handled = true;
+ }
+ });
+ return handled;
+ };
+ var FS_createPreloadedFile = (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => {
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS_createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ })) {
+ return;
+ }
+ finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ asyncLoad(url, (byteArray) => processData(byteArray), onerror);
+ } else {
+ processData(url);
+ }
+ };
+
+ var FS_modeStringToFlags = (str) => {
+ var flagModes = {
+ 'r': 0,
+ 'r+': 2,
+ 'w': 512 | 64 | 1,
+ 'w+': 512 | 64 | 2,
+ 'a': 1024 | 64 | 1,
+ 'a+': 1024 | 64 | 2,
+ };
+ var flags = flagModes[str];
+ if (typeof flags == 'undefined') {
+ throw new Error(`Unknown file open mode: ${str}`);
+ }
+ return flags;
+ };
+
+ var FS_getMode = (canRead, canWrite) => {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ };
+
+
+
+
+ var ERRNO_MESSAGES = {
+ 0:"Success",
+ 1:"Arg list too long",
+ 2:"Permission denied",
+ 3:"Address already in use",
+ 4:"Address not available",
+ 5:"Address family not supported by protocol family",
+ 6:"No more processes",
+ 7:"Socket already connected",
+ 8:"Bad file number",
+ 9:"Trying to read unreadable message",
+ 10:"Mount device busy",
+ 11:"Operation canceled",
+ 12:"No children",
+ 13:"Connection aborted",
+ 14:"Connection refused",
+ 15:"Connection reset by peer",
+ 16:"File locking deadlock error",
+ 17:"Destination address required",
+ 18:"Math arg out of domain of func",
+ 19:"Quota exceeded",
+ 20:"File exists",
+ 21:"Bad address",
+ 22:"File too large",
+ 23:"Host is unreachable",
+ 24:"Identifier removed",
+ 25:"Illegal byte sequence",
+ 26:"Connection already in progress",
+ 27:"Interrupted system call",
+ 28:"Invalid argument",
+ 29:"I/O error",
+ 30:"Socket is already connected",
+ 31:"Is a directory",
+ 32:"Too many symbolic links",
+ 33:"Too many open files",
+ 34:"Too many links",
+ 35:"Message too long",
+ 36:"Multihop attempted",
+ 37:"File or path name too long",
+ 38:"Network interface is not configured",
+ 39:"Connection reset by network",
+ 40:"Network is unreachable",
+ 41:"Too many open files in system",
+ 42:"No buffer space available",
+ 43:"No such device",
+ 44:"No such file or directory",
+ 45:"Exec format error",
+ 46:"No record locks available",
+ 47:"The link has been severed",
+ 48:"Not enough core",
+ 49:"No message of desired type",
+ 50:"Protocol not available",
+ 51:"No space left on device",
+ 52:"Function not implemented",
+ 53:"Socket is not connected",
+ 54:"Not a directory",
+ 55:"Directory not empty",
+ 56:"State not recoverable",
+ 57:"Socket operation on non-socket",
+ 59:"Not a typewriter",
+ 60:"No such device or address",
+ 61:"Value too large for defined data type",
+ 62:"Previous owner died",
+ 63:"Not super-user",
+ 64:"Broken pipe",
+ 65:"Protocol error",
+ 66:"Unknown protocol",
+ 67:"Protocol wrong type for socket",
+ 68:"Math result not representable",
+ 69:"Read only file system",
+ 70:"Illegal seek",
+ 71:"No such process",
+ 72:"Stale file handle",
+ 73:"Connection timed out",
+ 74:"Text file busy",
+ 75:"Cross-device link",
+ 100:"Device not a stream",
+ 101:"Bad font file fmt",
+ 102:"Invalid slot",
+ 103:"Invalid request code",
+ 104:"No anode",
+ 105:"Block device required",
+ 106:"Channel number out of range",
+ 107:"Level 3 halted",
+ 108:"Level 3 reset",
+ 109:"Link number out of range",
+ 110:"Protocol driver not attached",
+ 111:"No CSI structure available",
+ 112:"Level 2 halted",
+ 113:"Invalid exchange",
+ 114:"Invalid request descriptor",
+ 115:"Exchange full",
+ 116:"No data (for no delay io)",
+ 117:"Timer expired",
+ 118:"Out of streams resources",
+ 119:"Machine is not on the network",
+ 120:"Package not installed",
+ 121:"The object is remote",
+ 122:"Advertise error",
+ 123:"Srmount error",
+ 124:"Communication error on send",
+ 125:"Cross mount point (not really error)",
+ 126:"Given log. name not unique",
+ 127:"f.d. invalid for this operation",
+ 128:"Remote address changed",
+ 129:"Can access a needed shared lib",
+ 130:"Accessing a corrupted shared lib",
+ 131:".lib section in a.out corrupted",
+ 132:"Attempting to link in too many libs",
+ 133:"Attempting to exec a shared library",
+ 135:"Streams pipe error",
+ 136:"Too many users",
+ 137:"Socket type not supported",
+ 138:"Not supported",
+ 139:"Protocol family not supported",
+ 140:"Can't send after socket shutdown",
+ 141:"Too many references",
+ 142:"Host is down",
+ 148:"No medium (in tape drive)",
+ 156:"Level 2 not synchronized",
+ };
+
+ var ERRNO_CODES = {
+ };
+
+ var demangle = (func) => {
+ warnOnce('warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling');
+ return func;
+ };
+ var demangleAll = (text) => {
+ var regex =
+ /\b_Z[\w\d_]+/g;
+ return text.replace(regex,
+ function(x) {
+ var y = demangle(x);
+ return x === y ? x : (y + ' [' + x + ']');
+ });
+ };
+ var FS = {
+ root:null,
+ mounts:[],
+ devices:{
+ },
+ streams:[],
+ nextInode:1,
+ nameTable:null,
+ currentPath:"/",
+ initialized:false,
+ ignorePermissions:true,
+ ErrnoError:null,
+ genericErrors:{
+ },
+ filesystems:null,
+ syncFSRequests:0,
+ lookupPath(path, opts = {}) {
+ path = PATH_FS.resolve(path);
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ opts = Object.assign(defaults, opts)
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(32);
+ }
+
+ // split the absolute path
+ var parts = path.split('/').filter((p) => !!p);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(32);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },
+ getPath(node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? `${mount}/${path}` : mount + path;
+ }
+ path = path ? `${node.name}/${path}` : node.name;
+ node = node.parent;
+ }
+ },
+ hashName(parentid, name) {
+ var hash = 0;
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },
+ hashAddNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },
+ hashRemoveNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },
+ lookupNode(parent, name) {
+ var errCode = FS.mayLookup(parent);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },
+ createNode(parent, name, mode, rdev) {
+ assert(typeof parent == 'object')
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },
+ destroyNode(node) {
+ FS.hashRemoveNode(node);
+ },
+ isRoot(node) {
+ return node === node.parent;
+ },
+ isMountpoint(node) {
+ return !!node.mounted;
+ },
+ isFile(mode) {
+ return (mode & 61440) === 32768;
+ },
+ isDir(mode) {
+ return (mode & 61440) === 16384;
+ },
+ isLink(mode) {
+ return (mode & 61440) === 40960;
+ },
+ isChrdev(mode) {
+ return (mode & 61440) === 8192;
+ },
+ isBlkdev(mode) {
+ return (mode & 61440) === 24576;
+ },
+ isFIFO(mode) {
+ return (mode & 61440) === 4096;
+ },
+ isSocket(mode) {
+ return (mode & 49152) === 49152;
+ },
+ flagsToPermissionString(flag) {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },
+ nodePermissions(node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.includes('r') && !(node.mode & 292)) {
+ return 2;
+ } else if (perms.includes('w') && !(node.mode & 146)) {
+ return 2;
+ } else if (perms.includes('x') && !(node.mode & 73)) {
+ return 2;
+ }
+ return 0;
+ },
+ mayLookup(dir) {
+ var errCode = FS.nodePermissions(dir, 'x');
+ if (errCode) return errCode;
+ if (!dir.node_ops.lookup) return 2;
+ return 0;
+ },
+ mayCreate(dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return 20;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },
+ mayDelete(dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var errCode = FS.nodePermissions(dir, 'wx');
+ if (errCode) {
+ return errCode;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return 54;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return 10;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return 31;
+ }
+ }
+ return 0;
+ },
+ mayOpen(node, flags) {
+ if (!node) {
+ return 44;
+ }
+ if (FS.isLink(node.mode)) {
+ return 32;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+ (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+ return 31;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },
+ MAX_OPEN_FDS:4096,
+ nextfd() {
+ for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(33);
+ },
+ getStreamChecked(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ return stream;
+ },
+ getStream:(fd) => FS.streams[fd],
+ createStream(stream, fd = -1) {
+ if (!FS.FSStream) {
+ FS.FSStream = /** @constructor */ function() {
+ this.shared = { };
+ };
+ FS.FSStream.prototype = {};
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ /** @this {FS.FSStream} */
+ get() { return this.node; },
+ /** @this {FS.FSStream} */
+ set(val) { this.node = val; }
+ },
+ isRead: {
+ /** @this {FS.FSStream} */
+ get() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ /** @this {FS.FSStream} */
+ get() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ /** @this {FS.FSStream} */
+ get() { return (this.flags & 1024); }
+ },
+ flags: {
+ /** @this {FS.FSStream} */
+ get() { return this.shared.flags; },
+ /** @this {FS.FSStream} */
+ set(val) { this.shared.flags = val; },
+ },
+ position : {
+ /** @this {FS.FSStream} */
+ get() { return this.shared.position; },
+ /** @this {FS.FSStream} */
+ set(val) { this.shared.position = val; },
+ },
+ });
+ }
+ // clone it, so we can return an instance of FSStream
+ stream = Object.assign(new FS.FSStream(), stream);
+ if (fd == -1) {
+ fd = FS.nextfd();
+ }
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },
+ closeStream(fd) {
+ FS.streams[fd] = null;
+ },
+ chrdev_stream_ops:{
+ open(stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },
+ llseek() {
+ throw new FS.ErrnoError(70);
+ },
+ },
+ major:(dev) => ((dev) >> 8),
+ minor:(dev) => ((dev) & 0xff),
+ makedev:(ma, mi) => ((ma) << 8 | (mi)),
+ registerDevice(dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },
+ getDevice:(dev) => FS.devices[dev],
+ getMounts(mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },
+ syncfs(populate, callback) {
+ if (typeof populate == 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(errCode) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(errCode);
+ }
+
+ function done(errCode) {
+ if (errCode) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(errCode);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach((mount) => {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },
+ mount(type, opts, mountpoint) {
+ if (typeof type == 'string') {
+ // The filesystem was not included, and instead we have an error
+ // message stored in the variable.
+ throw type;
+ }
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(10);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ }
+
+ var mount = {
+ type,
+ opts,
+ mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },
+ unmount(mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(28);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach((hash) => {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.includes(current.mount)) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },
+ lookup(parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },
+ mknod(path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.mayCreate(parent, name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },
+ create(path, mode) {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdir(path, mode) {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdirTree(path, mode) {
+ var dirs = path.split('/');
+ var d = '';
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += '/' + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch(e) {
+ if (e.errno != 20) throw e;
+ }
+ }
+ },
+ mkdev(path, mode, dev) {
+ if (typeof dev == 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },
+ symlink(oldpath, newpath) {
+ if (!PATH_FS.resolve(oldpath)) {
+ throw new FS.ErrnoError(44);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var newname = PATH.basename(newpath);
+ var errCode = FS.mayCreate(parent, newname);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },
+ rename(old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+
+ // let the errors from non existant directories percolate up
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(75);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH_FS.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(28);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH_FS.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(55);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var errCode = FS.mayDelete(old_dir, old_name, isdir);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ errCode = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(10);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ errCode = FS.nodePermissions(old_dir, 'w');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ },
+ rmdir(path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, true);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ },
+ readdir(path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(54);
+ }
+ return node.node_ops.readdir(node);
+ },
+ unlink(path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, false);
+ if (errCode) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ },
+ readlink(path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(28);
+ }
+ return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },
+ stat(path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(63);
+ }
+ return node.node_ops.getattr(node);
+ },
+ lstat(path) {
+ return FS.stat(path, true);
+ },
+ chmod(path, mode, dontFollow) {
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },
+ lchmod(path, mode) {
+ FS.chmod(path, mode, true);
+ },
+ fchmod(fd, mode) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chmod(stream.node, mode);
+ },
+ chown(path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },
+ lchown(path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },
+ fchown(fd, uid, gid) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chown(stream.node, uid, gid);
+ },
+ truncate(path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.nodePermissions(node, 'w');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },
+ ftruncate(fd, len) {
+ var stream = FS.getStreamChecked(fd);
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(28);
+ }
+ FS.truncate(stream.node, len);
+ },
+ utime(path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },
+ open(path, flags, mode) {
+ if (path === "") {
+ throw new FS.ErrnoError(44);
+ }
+ flags = typeof flags == 'string' ? FS_modeStringToFlags(flags) : flags;
+ mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path == 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(20);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var errCode = FS.mayOpen(node, flags);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512) && !created) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512 | 131072);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ });
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ }
+ }
+ return stream;
+ },
+ close(stream) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },
+ isClosed(stream) {
+ return stream.fd === null;
+ },
+ llseek(stream, offset, whence) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(70);
+ }
+ if (whence != 0 && whence != 1 && whence != 2) {
+ throw new FS.ErrnoError(28);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },
+ read(stream, buffer, offset, length, position) {
+ assert(offset >= 0);
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(28);
+ }
+ var seeking = typeof position != 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ assert(offset >= 0);
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(28);
+ }
+ if (stream.seekable && stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position != 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ return bytesWritten;
+ },
+ allocate(stream, offset, length) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(138);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },
+ mmap(stream, length, position, prot, flags) {
+ // User requests writing to file (prot & PROT_WRITE != 0).
+ // Checking if we have permissions to write to the file unless
+ // MAP_PRIVATE flag is set. According to POSIX spec it is possible
+ // to write to file opened in read-only mode with MAP_PRIVATE flag,
+ // as all modifications will be visible only in the memory of
+ // the current process.
+ if ((prot & 2) !== 0
+ && (flags & 2) === 0
+ && (stream.flags & 2097155) !== 2) {
+ throw new FS.ErrnoError(2);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(2);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(43);
+ }
+ return stream.stream_ops.mmap(stream, length, position, prot, flags);
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ assert(offset >= 0);
+ if (!stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },
+ munmap:(stream) => 0,
+ ioctl(stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(59);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },
+ readFile(path, opts = {}) {
+ opts.flags = opts.flags || 0;
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error(`Invalid encoding type "${opts.encoding}"`);
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },
+ writeFile(path, data, opts = {}) {
+ opts.flags = opts.flags || 577;
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data == 'string') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error('Unsupported data type');
+ }
+ FS.close(stream);
+ },
+ cwd:() => FS.currentPath,
+ chdir(path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ var errCode = FS.nodePermissions(lookup.node, 'x');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ FS.currentPath = lookup.path;
+ },
+ createDefaultDirectories() {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },
+ createDefaultDevices() {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: () => 0,
+ write: (stream, buffer, offset, length, pos) => length,
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using err() rather than out()
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ // use a buffer to avoid overhead of individual crypto calls per byte
+ var randomBuffer = new Uint8Array(1024), randomLeft = 0;
+ var randomByte = () => {
+ if (randomLeft === 0) {
+ randomLeft = randomFill(randomBuffer).byteLength;
+ }
+ return randomBuffer[--randomLeft];
+ };
+ FS.createDevice('/dev', 'random', randomByte);
+ FS.createDevice('/dev', 'urandom', randomByte);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },
+ createSpecialDirectories() {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
+ // name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ var proc_self = FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount() {
+ var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73);
+ node.node_ops = {
+ lookup(parent, name) {
+ var fd = +name;
+ var stream = FS.getStreamChecked(fd);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: () => stream.path },
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },
+ createStandardStreams() {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 0);
+ var stdout = FS.open('/dev/stdout', 1);
+ var stderr = FS.open('/dev/stderr', 1);
+ assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`);
+ assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`);
+ assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`);
+ },
+ ensureErrnoError() {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) {
+ // We set the `name` property to be able to identify `FS.ErrnoError`
+ // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
+ // - when using PROXYFS, an error can come from an underlying FS
+ // as different FS objects have their own FS.ErrnoError each,
+ // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
+ // we'll use the reliable test `err.name == "ErrnoError"` instead
+ this.name = 'ErrnoError';
+ this.node = node;
+ this.setErrno = /** @this{Object} */ function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+
+ // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack
+ // now ensures it shows what we want.
+ if (this.stack) {
+ // Define the stack property for Node.js 4, which otherwise errors on the next line.
+ Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+ this.stack = demangleAll(this.stack);
+ }
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [44].forEach((code) => {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '<generic error, no stack>';
+ });
+ },
+ staticInit() {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ };
+ },
+ init(input, output, error) {
+ assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },
+ quit() {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ _fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },
+ findObject(path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (!ret.exists) {
+ return null;
+ }
+ return ret.object;
+ },
+ analyzePath(path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },
+ createPath(parent, path, canRead, canWrite) {
+ parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },
+ createFile(parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },
+ createDataFile(parent, name, data, canRead, canWrite, canOwn) {
+ var path = name;
+ if (parent) {
+ parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+ path = name ? PATH.join2(parent, name) : parent;
+ }
+ var mode = FS_getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data == 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 577);
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },
+ createDevice(parent, name, input, output) {
+ var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open(stream) {
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },
+ forceLoadFile(obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ if (typeof XMLHttpRequest != 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (read_) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(read_(obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ },
+ createLazyFile(parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ /** @constructor */
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ };
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ };
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (from, to) => {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(/** @type{Array<number>} */(xhr.response || []));
+ }
+ return intArrayFromString(xhr.responseText || '', true);
+ };
+ var lazyArray = this;
+ lazyArray.setDataGetter((chunkNum) => {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof lazyArray.chunks[chunkNum] == 'undefined') {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!');
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ out("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ };
+ if (typeof XMLHttpRequest != 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: /** @this{Object} */ function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: /** @this{Object} */ function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: /** @this {FSNode} */ function() { return this.contents.length; }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach((key) => {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ FS.forceLoadFile(node);
+ return fn.apply(null, arguments);
+ };
+ });
+ function writeChunks(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ }
+ // use a custom read function
+ stream_ops.read = (stream, buffer, offset, length, position) => {
+ FS.forceLoadFile(node);
+ return writeChunks(stream, buffer, offset, length, position)
+ };
+ // use a custom mmap function
+ stream_ops.mmap = (stream, length, position, prot, flags) => {
+ FS.forceLoadFile(node);
+ var ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ writeChunks(stream, HEAP8, ptr, length, position);
+ return { ptr, allocated: true };
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },
+ absolutePath() {
+ abort('FS.absolutePath has been removed; use PATH_FS.resolve instead');
+ },
+ createFolder() {
+ abort('FS.createFolder has been removed; use FS.mkdir instead');
+ },
+ createLink() {
+ abort('FS.createLink has been removed; use FS.symlink instead');
+ },
+ joinPath() {
+ abort('FS.joinPath has been removed; use PATH.join instead');
+ },
+ mmapAlloc() {
+ abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc');
+ },
+ standardizePath() {
+ abort('FS.standardizePath has been removed; use PATH.normalize instead');
+ },
+ };
+
+ var SYSCALLS = {
+ DEFAULT_POLLMASK:5,
+ calculateAt(dirfd, path, allowEmpty) {
+ if (PATH.isAbs(path)) {
+ return path;
+ }
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = SYSCALLS.getStreamFromFD(dirfd);
+ dir = dirstream.path;
+ }
+ if (path.length == 0) {
+ if (!allowEmpty) {
+ throw new FS.ErrnoError(44);;
+ }
+ return dir;
+ }
+ return PATH.join2(dir, path);
+ },
+ doStat(func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -54;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)] = stat.dev;
+ HEAP32[(((buf)+(4))>>2)] = stat.mode;
+ HEAPU32[(((buf)+(8))>>2)] = stat.nlink;
+ HEAP32[(((buf)+(12))>>2)] = stat.uid;
+ HEAP32[(((buf)+(16))>>2)] = stat.gid;
+ HEAP32[(((buf)+(20))>>2)] = stat.rdev;
+ (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(24))>>2)] = tempI64[0],HEAP32[(((buf)+(28))>>2)] = tempI64[1]);
+ HEAP32[(((buf)+(32))>>2)] = 4096;
+ HEAP32[(((buf)+(36))>>2)] = stat.blocks;
+ var atime = stat.atime.getTime();
+ var mtime = stat.mtime.getTime();
+ var ctime = stat.ctime.getTime();
+ (tempI64 = [Math.floor(atime / 1000)>>>0,(tempDouble=Math.floor(atime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]);
+ HEAPU32[(((buf)+(48))>>2)] = (atime % 1000) * 1000;
+ (tempI64 = [Math.floor(mtime / 1000)>>>0,(tempDouble=Math.floor(mtime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(56))>>2)] = tempI64[0],HEAP32[(((buf)+(60))>>2)] = tempI64[1]);
+ HEAPU32[(((buf)+(64))>>2)] = (mtime % 1000) * 1000;
+ (tempI64 = [Math.floor(ctime / 1000)>>>0,(tempDouble=Math.floor(ctime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(72))>>2)] = tempI64[0],HEAP32[(((buf)+(76))>>2)] = tempI64[1]);
+ HEAPU32[(((buf)+(80))>>2)] = (ctime % 1000) * 1000;
+ (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((buf)+(88))>>2)] = tempI64[0],HEAP32[(((buf)+(92))>>2)] = tempI64[1]);
+ return 0;
+ },
+ doMsync(addr, stream, len, flags, offset) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (flags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+ var buffer = HEAPU8.slice(addr, addr + len);
+ FS.msync(stream, buffer, offset, len, flags);
+ },
+ varargs:undefined,
+ get() {
+ assert(SYSCALLS.varargs != undefined);
+ // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number.
+ var ret = HEAP32[((+SYSCALLS.varargs)>>2)];
+ SYSCALLS.varargs += 4;
+ return ret;
+ },
+ getp() { return SYSCALLS.get() },
+ getStr(ptr) {
+ var ret = UTF8ToString(ptr);
+ return ret;
+ },
+ getStreamFromFD(fd) {
+ var stream = FS.getStreamChecked(fd);
+ return stream;
+ },
+ };
+ function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) {
+ try {
+
+ // readfds are supported,
+ // writefds checks socket open status
+ // exceptfds are supported, although on web, such exceptional conditions never arise in web sockets
+ // and so the exceptfds list will always return empty.
+ // timeout is supported, although on SOCKFS and PIPEFS these are ignored and always treated as 0 - fully async
+ assert(nfds <= 64, 'nfds must be less than or equal to 64'); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers
+
+ var total = 0;
+
+ var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0),
+ srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0);
+ var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0),
+ srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0);
+ var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0),
+ srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+
+ var dstReadLow = 0,
+ dstReadHigh = 0;
+ var dstWriteLow = 0,
+ dstWriteHigh = 0;
+ var dstExceptLow = 0,
+ dstExceptHigh = 0;
+
+ var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) |
+ (writefds ? HEAP32[((writefds)>>2)] : 0) |
+ (exceptfds ? HEAP32[((exceptfds)>>2)] : 0);
+ var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) |
+ (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) |
+ (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+
+ var check = function(fd, low, high, val) {
+ return (fd < 32 ? (low & val) : (high & val));
+ };
+
+ for (var fd = 0; fd < nfds; fd++) {
+ var mask = 1 << (fd % 32);
+ if (!(check(fd, allLow, allHigh, mask))) {
+ continue; // index isn't in the set
+ }
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+
+ var flags = SYSCALLS.DEFAULT_POLLMASK;
+
+ if (stream.stream_ops.poll) {
+ var timeoutInMillis = -1;
+ if (timeout) {
+ var tv_sec = (readfds ? HEAP32[((timeout)>>2)] : 0),
+ tv_usec = (readfds ? HEAP32[(((timeout)+(8))>>2)] : 0);
+ timeoutInMillis = (tv_sec + tv_usec / 1000000) * 1000;
+ }
+ flags = stream.stream_ops.poll(stream, timeoutInMillis);
+ }
+
+ if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) {
+ fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask);
+ total++;
+ }
+ if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) {
+ fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask);
+ total++;
+ }
+ if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) {
+ fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask);
+ total++;
+ }
+ }
+
+ if (readfds) {
+ HEAP32[((readfds)>>2)] = dstReadLow;
+ HEAP32[(((readfds)+(4))>>2)] = dstReadHigh;
+ }
+ if (writefds) {
+ HEAP32[((writefds)>>2)] = dstWriteLow;
+ HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh;
+ }
+ if (exceptfds) {
+ HEAP32[((exceptfds)>>2)] = dstExceptLow;
+ HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh;
+ }
+
+ return total;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ var SOCKFS = {
+ mount(mount) {
+ // If Module['websocket'] has already been defined (e.g. for configuring
+ // the subprotocol/url) use that, if not initialise it to a new object.
+ Module['websocket'] = (Module['websocket'] &&
+ ('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
+
+ // Add the Event registration mechanism to the exported websocket configuration
+ // object so we can register network callbacks from native JavaScript too.
+ // For more documentation see system/include/emscripten/emscripten.h
+ Module['websocket']._callbacks = {};
+ Module['websocket']['on'] = /** @this{Object} */ function(event, callback) {
+ if ('function' === typeof callback) {
+ this._callbacks[event] = callback;
+ }
+ return this;
+ };
+
+ Module['websocket'].emit = /** @this{Object} */ function(event, param) {
+ if ('function' === typeof this._callbacks[event]) {
+ this._callbacks[event].call(this, param);
+ }
+ };
+
+ // If debug is enabled register simple default logging callbacks for each Event.
+
+ return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },
+ createSocket(family, type, protocol) {
+ type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
+ var streaming = type == 1;
+ if (streaming && protocol && protocol != 6) {
+ throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
+ }
+
+ // create our internal socket structure
+ var sock = {
+ family,
+ type,
+ protocol,
+ server: null,
+ error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops
+ };
+
+ // create the filesystem node to store the socket structure
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+
+ // and the wrapping stream that enables library functions such
+ // as read and write to indirectly interact with the socket
+ var stream = FS.createStream({
+ path: name,
+ node,
+ flags: 2,
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops
+ });
+
+ // map the new stream to the socket structure (sockets have a 1:1
+ // relationship with a stream)
+ sock.stream = stream;
+
+ return sock;
+ },
+ getSocket(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },
+ stream_ops:{
+ poll(stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },
+ ioctl(stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },
+ read(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ // socket is closed
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },
+ write(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },
+ close(stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ },
+ },
+ nextname() {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return 'socket[' + (SOCKFS.nextname.current++) + ']';
+ },
+ websocket_sock_ops:{
+ createPeer(sock, addr, port) {
+ var ws;
+
+ if (typeof addr == 'object') {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+
+ if (ws) {
+ // for sockets that've already connected (e.g. we're the server)
+ // we can inspect the _socket property for the address
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ }
+ // if we're just now initializing a connection to the remote,
+ // inspect the url property
+ else {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error('WebSocket URL must be in the format ws(s)://address:port');
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ // create the actual websocket object and connect
+ try {
+ // runtimeConfig gets set to true if WebSocket runtime configuration is available.
+ var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
+
+ // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+ // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+ var url = 'ws:#'.replace('#', '//');
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['url']) {
+ url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
+ }
+ }
+
+ if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
+ var parts = addr.split('/');
+ url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
+ }
+
+ // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+ var subProtocols = 'binary'; // The default value is 'binary'
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['subprotocol']) {
+ subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
+ }
+ }
+
+ // The default WebSocket options
+ var opts = undefined;
+
+ if (subProtocols !== 'null') {
+ // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+ // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws.
+ subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
+
+ opts = subProtocols;
+ }
+
+ // some webservers (azure) does not support subprotocol header
+ if (runtimeConfig && null === Module['websocket']['subprotocol']) {
+ subProtocols = 'null';
+ opts = undefined;
+ }
+
+ // If node we use the ws library.
+ var WebSocketConstructor;
+ if (ENVIRONMENT_IS_NODE) {
+ WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws'));
+ } else
+ {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = 'arraybuffer';
+ } catch (e) {
+ throw new FS.ErrnoError(23);
+ }
+ }
+
+ var peer = {
+ addr,
+ port,
+ socket: ws,
+ dgram_send_queue: []
+ };
+
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+
+ // if this is a bound dgram socket, send the port number first to allow
+ // us to override the ephemeral port reported to us by remotePort on the
+ // remote end.
+ if (sock.type === 2 && typeof sock.sport != 'undefined') {
+ peer.dgram_send_queue.push(new Uint8Array([
+ 255, 255, 255, 255,
+ 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
+ ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
+ ]));
+ }
+
+ return peer;
+ },
+ getPeer(sock, addr, port) {
+ return sock.peers[addr + ':' + port];
+ },
+ addPeer(sock, peer) {
+ sock.peers[peer.addr + ':' + peer.port] = peer;
+ },
+ removePeer(sock, peer) {
+ delete sock.peers[peer.addr + ':' + peer.port];
+ },
+ handlePeerEvents(sock, peer) {
+ var first = true;
+
+ var handleOpen = function () {
+
+ Module['websocket'].emit('open', sock.stream.fd);
+
+ try {
+ var queued = peer.dgram_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.dgram_send_queue.shift();
+ }
+ } catch (e) {
+ // not much we can do here in the way of proper error handling as we've already
+ // lied and said this data was sent. shut it down.
+ peer.socket.close();
+ }
+ };
+
+ function handleMessage(data) {
+ if (typeof data == 'string') {
+ var encoder = new TextEncoder(); // should be utf-8
+ data = encoder.encode(data); // make a typed array from the string
+ } else {
+ assert(data.byteLength !== undefined); // must receive an ArrayBuffer
+ if (data.byteLength == 0) {
+ // An empty ArrayBuffer will emit a pseudo disconnect event
+ // as recv/recvmsg will return zero which indicates that a socket
+ // has performed a shutdown although the connection has not been disconnected yet.
+ return;
+ }
+ data = new Uint8Array(data); // make a typed array view on the array buffer
+ }
+
+ // if this is the port message, override the peer's port with it
+ var wasfirst = first;
+ first = false;
+ if (wasfirst &&
+ data.length === 10 &&
+ data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
+ data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
+ // update the peer's port and it's key in the peer map
+ var newport = ((data[8] << 8) | data[9]);
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+
+ sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
+ Module['websocket'].emit('message', sock.stream.fd);
+ };
+
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on('open', handleOpen);
+ peer.socket.on('message', function(data, isBinary) {
+ if (!isBinary) {
+ return;
+ }
+ handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
+ });
+ peer.socket.on('close', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ });
+ peer.socket.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+ // is still probably the most useful thing to do.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ // don't throw
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function(error) {
+ // The WebSocket spec only allows a 'simple event' to be thrown on error,
+ // so we only really know as much as ECONNREFUSED.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ };
+ }
+ },
+ poll(sock) {
+ if (sock.type === 1 && sock.server) {
+ // listen sockets should only say they're available for reading
+ // if there are pending clients.
+ return sock.pending.length ? (64 | 1) : 0;
+ }
+
+ var mask = 0;
+ var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets
+ SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
+ null;
+
+ if (sock.recv_queue.length ||
+ !dest || // connection-less sockets are always ready to read
+ (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed
+ mask |= (64 | 1);
+ }
+
+ if (!dest || // connection-less sockets are always ready to write
+ (dest && dest.socket.readyState === dest.socket.OPEN)) {
+ mask |= 4;
+ }
+
+ if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+ mask |= 16;
+ }
+
+ return mask;
+ },
+ ioctl(sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ HEAP32[((arg)>>2)] = bytes;
+ return 0;
+ default:
+ return 28;
+ }
+ },
+ close(sock) {
+ // if we've spawned a listen server, close it
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {
+ }
+ sock.server = null;
+ }
+ // close any peer connections
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {
+ }
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },
+ bind(sock, addr, port) {
+ if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') {
+ throw new FS.ErrnoError(28); // already bound
+ }
+ sock.saddr = addr;
+ sock.sport = port;
+ // in order to emulate dgram sockets, we need to launch a listen server when
+ // binding on a connection-less socket
+ // note: this is only required on the server side
+ if (sock.type === 2) {
+ // close the existing server if it exists
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ // swallow error operation not supported error that occurs when binding in the
+ // browser where this isn't supported
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e.name === 'ErrnoError')) throw e;
+ if (e.errno !== 138) throw e;
+ }
+ }
+ },
+ connect(sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(138);
+ }
+
+ // TODO autobind
+ // if (!sock.addr && sock.type == 2) {
+ // }
+
+ // early out if we're already connected / in the middle of connecting
+ if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(7);
+ } else {
+ throw new FS.ErrnoError(30);
+ }
+ }
+ }
+
+ // add the socket to our peer list and set our
+ // destination address / port to match
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+
+ // always "fail" in non-blocking mode
+ throw new FS.ErrnoError(26);
+ },
+ listen(sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(138);
+ }
+ if (sock.server) {
+ throw new FS.ErrnoError(28); // already listening
+ }
+ var WebSocketServer = require('ws').Server;
+ var host = sock.saddr;
+ sock.server = new WebSocketServer({
+ host,
+ port: sock.sport
+ // TODO support backlog
+ });
+ Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd.
+
+ sock.server.on('connection', function(ws) {
+ if (sock.type === 1) {
+ var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
+
+ // create a peer on the new socket
+ var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
+ newsock.daddr = peer.addr;
+ newsock.dport = peer.port;
+
+ // push to queue for accept to pick up
+ sock.pending.push(newsock);
+ Module['websocket'].emit('connection', newsock.stream.fd);
+ } else {
+ // create a peer on the listen socket so calling sendto
+ // with the listen socket and an address will resolve
+ // to the correct client
+ SOCKFS.websocket_sock_ops.createPeer(sock, ws);
+ Module['websocket'].emit('connection', sock.stream.fd);
+ }
+ });
+ sock.server.on('close', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ sock.server = null;
+ });
+ sock.server.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
+ // is still probably the most useful thing to do. This error shouldn't
+ // occur in a well written app as errors should get trapped in the compiled
+ // app's own getaddrinfo call.
+ sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']);
+ // don't throw
+ });
+ },
+ accept(listensock) {
+ if (!listensock.server || !listensock.pending.length) {
+ throw new FS.ErrnoError(28);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },
+ getname(sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(53);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+ // should we be returning for TCP sockets that've been connect()'d?
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return { addr, port };
+ },
+ sendmsg(sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ // connection-less sockets will honor the message address,
+ // and otherwise fall back to the bound destination address
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // if there was no address to fall back to, error out
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(17);
+ }
+ } else {
+ // connection-based sockets will only use the bound
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+
+ // find the peer for the destination address
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+
+ // early out if not connected with a connection-based socket
+ if (sock.type === 1) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ throw new FS.ErrnoError(53);
+ } else if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(6);
+ }
+ }
+
+ // create a copy of the incoming data to send, as the WebSocket API
+ // doesn't work entirely with an ArrayBufferView, it'll just send
+ // the entire underlying buffer
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+
+ var data;
+ data = buffer.slice(offset, offset + length);
+
+ // if we're emulating a connection-less dgram socket and don't have
+ // a cached connection, queue the buffer to send upon connect and
+ // lie, saying the data was sent now.
+ if (sock.type === 2) {
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ // if we're not connected, open a new connection
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ dest.dgram_send_queue.push(data);
+ return length;
+ }
+ }
+
+ try {
+ // send the actual data
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(28);
+ }
+ },
+ recvmsg(sock, length) {
+ // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+ if (sock.type === 1 && sock.server) {
+ // tcp servers should not be recv()'ing on the listen socket
+ throw new FS.ErrnoError(53);
+ }
+
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+
+ if (!dest) {
+ // if we have a destination address but are not connected, error out
+ throw new FS.ErrnoError(53);
+ }
+ if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ // return null if the socket has closed
+ return null;
+ }
+ // else, our socket is in a valid state but truly has nothing available
+ throw new FS.ErrnoError(6);
+ }
+ throw new FS.ErrnoError(6);
+ }
+
+ // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+ // requeued TCP data it'll be an ArrayBufferView
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port
+ };
+
+ // push back any unread data for TCP connections
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+ sock.recv_queue.unshift(queued);
+ }
+
+ return res;
+ },
+ },
+ };
+
+ var getSocketFromFD = (fd) => {
+ var socket = SOCKFS.getSocket(fd);
+ if (!socket) throw new FS.ErrnoError(8);
+ return socket;
+ };
+
+ var setErrNo = (value) => {
+ HEAP32[((___errno_location())>>2)] = value;
+ return value;
+ };
+ var Sockets = {
+ BUFFER_SIZE:10240,
+ MAX_BUFFER_SIZE:10485760,
+ nextFd:1,
+ fds:{
+ },
+ nextport:1,
+ maxport:65535,
+ peer:null,
+ connections:{
+ },
+ portmap:{
+ },
+ localAddr:4261412874,
+ addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034],
+ };
+
+ var inetPton4 = (str) => {
+ var b = str.split('.');
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+ };
+
+
+ /** @suppress {checkTypes} */
+ var jstoi_q = (str) => parseInt(str);
+ var inetPton6 = (str) => {
+ var words;
+ var w, offset, z, i;
+ /* http://home.deds.nl/~aeron/regex/ */
+ var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [0, 0, 0, 0, 0, 0, 0, 0];
+ }
+ // Z placeholder to keep track of zeros when splitting the string on ":"
+ if (str.startsWith("::")) {
+ str = str.replace("::", "Z:"); // leading zeros case
+ } else {
+ str = str.replace("::", ":Z:");
+ }
+
+ if (str.indexOf(".") > 0) {
+ // parse IPv4 embedded stress
+ str = str.replace(new RegExp('[.]', 'g'), ":");
+ words = str.split(":");
+ words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256;
+ words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256;
+ words = words.slice(0, words.length-2);
+ } else {
+ words = str.split(":");
+ }
+
+ offset = 0; z = 0;
+ for (w=0; w < words.length; w++) {
+ if (typeof words[w] == 'string') {
+ if (words[w] === 'Z') {
+ // compressed zeros - write appropriate number of zero words
+ for (z = 0; z < (8 - words.length+1); z++) {
+ parts[w+z] = 0;
+ }
+ offset = z-1;
+ } else {
+ // parse hex to field to 16-bit value and write it in network byte-order
+ parts[w+offset] = _htons(parseInt(words[w],16));
+ }
+ } else {
+ // parsed IPv4 words
+ parts[w+offset] = words[w];
+ }
+ }
+ return [
+ (parts[1] << 16) | parts[0],
+ (parts[3] << 16) | parts[2],
+ (parts[5] << 16) | parts[4],
+ (parts[7] << 16) | parts[6]
+ ];
+ };
+
+
+ /** @param {number=} addrlen */
+ var writeSockaddr = (sa, family, addr, port, addrlen) => {
+ switch (family) {
+ case 2:
+ addr = inetPton4(addr);
+ zeroMemory(sa, 16);
+ if (addrlen) {
+ HEAP32[((addrlen)>>2)] = 16;
+ }
+ HEAP16[((sa)>>1)] = family;
+ HEAP32[(((sa)+(4))>>2)] = addr;
+ HEAP16[(((sa)+(2))>>1)] = _htons(port);
+ break;
+ case 10:
+ addr = inetPton6(addr);
+ zeroMemory(sa, 28);
+ if (addrlen) {
+ HEAP32[((addrlen)>>2)] = 28;
+ }
+ HEAP32[((sa)>>2)] = family;
+ HEAP32[(((sa)+(8))>>2)] = addr[0];
+ HEAP32[(((sa)+(12))>>2)] = addr[1];
+ HEAP32[(((sa)+(16))>>2)] = addr[2];
+ HEAP32[(((sa)+(20))>>2)] = addr[3];
+ HEAP16[(((sa)+(2))>>1)] = _htons(port);
+ break;
+ default:
+ return 5;
+ }
+ return 0;
+ };
+
+
+ var DNS = {
+ address_map:{
+ id:1,
+ addrs:{
+ },
+ names:{
+ },
+ },
+ lookup_name(name) {
+ // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+ var res = inetPton4(name);
+ if (res !== null) {
+ return name;
+ }
+ res = inetPton6(name);
+ if (res !== null) {
+ return name;
+ }
+
+ // See if this name is already mapped.
+ var addr;
+
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, 'exceeded max address mappings of 65535');
+
+ addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
+
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+
+ return addr;
+ },
+ lookup_addr(addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+
+ return null;
+ },
+ };
+
+ function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var newsock = sock.sock_ops.accept(sock);
+ if (addr) {
+ var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen);
+ assert(!errno);
+ }
+ return newsock.stream.fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+ var inetNtop4 = (addr) => {
+ return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
+ };
+
+
+ var inetNtop6 = (ints) => {
+ // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+ // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
+ // 128-bits are split into eight 16-bit words
+ // stored in network byte order (big-endian)
+ // | 80 bits | 16 | 32 bits |
+ // +-----------------------------------------------------------------+
+ // | 10 bytes | 2 | 4 bytes |
+ // +--------------------------------------+--------------------------+
+ // + 5 words | 1 | 2 words |
+ // +--------------------------------------+--------------------------+
+ // |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
+ // +--------------------------------------+----+---------------------+
+ // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
+ // +--------------------------------------+----+---------------------+
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [
+ ints[0] & 0xffff,
+ (ints[0] >> 16),
+ ints[1] & 0xffff,
+ (ints[1] >> 16),
+ ints[2] & 0xffff,
+ (ints[2] >> 16),
+ ints[3] & 0xffff,
+ (ints[3] >> 16)
+ ];
+
+ // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+
+ var hasipv4 = true;
+ var v4part = "";
+ // check if the 10 high-order bytes are all zeros (first 5 words)
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) { hasipv4 = false; break; }
+ }
+
+ if (hasipv4) {
+ // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+ v4part = inetNtop4(parts[6] | (parts[7] << 16));
+ // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+ if (parts[5] === 0) {
+ str = "::";
+ //special case IPv6 addresses
+ if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
+ if (v4part === "0.0.0.1") v4part = "1";// loopback address
+ str += v4part;
+ return str;
+ }
+ }
+
+ // Handle all other IPv6 addresses
+
+ // first run to find the longest contiguous zero words
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ // compress contiguous zeros - to produce "::"
+ if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":"; //leading zeros case
+ }
+ continue;
+ }
+ }
+ // converts 16-bit words from big-endian to little-endian before converting to hex string
+ str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+ };
+
+ var readSockaddr = (sa, salen) => {
+ // family / port offsets are common to both sockaddr_in and sockaddr_in6
+ var family = HEAP16[((sa)>>1)];
+ var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]);
+ var addr;
+
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return { errno: 28 };
+ }
+ addr = HEAP32[(((sa)+(4))>>2)];
+ addr = inetNtop4(addr);
+ break;
+ case 10:
+ if (salen !== 28) {
+ return { errno: 28 };
+ }
+ addr = [
+ HEAP32[(((sa)+(8))>>2)],
+ HEAP32[(((sa)+(12))>>2)],
+ HEAP32[(((sa)+(16))>>2)],
+ HEAP32[(((sa)+(20))>>2)]
+ ];
+ addr = inetNtop6(addr);
+ break;
+ default:
+ return { errno: 5 };
+ }
+
+ return { family: family, addr: addr, port: port };
+ };
+
+
+ /** @param {boolean=} allowNull */
+ var getSocketAddress = (addrp, addrlen, allowNull) => {
+ if (allowNull && addrp === 0) return null;
+ var info = readSockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ };
+
+ function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.bind(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_chdir(path) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.chdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_chmod(path, mode) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.chmod(path, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+ function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.connect(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_dup(fd) {
+ try {
+
+ var old = SYSCALLS.getStreamFromFD(fd);
+ return FS.createStream(old).fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_dup3(fd, newfd, flags) {
+ try {
+
+ var old = SYSCALLS.getStreamFromFD(fd);
+ assert(!flags);
+ if (old.fd === newfd) return -28;
+ var existing = FS.getStream(newfd);
+ if (existing) FS.close(existing);
+ return FS.createStream(old, newfd).fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_faccessat(dirfd, path, amode, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (amode & ~7) {
+ // need a valid mode
+ return -28;
+ }
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node) {
+ return -44;
+ }
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -2;
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fchownat(dirfd, path, owner, group, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ flags = flags & (~256);
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ (nofollow ? FS.lchown : FS.chown)(path, owner, group);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ function ___syscall_fcntl64(fd, cmd, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -28;
+ }
+ while (FS.streams[arg]) {
+ arg++;
+ }
+ var newStream;
+ newStream = FS.createStream(stream, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 5: {
+ var arg = SYSCALLS.getp();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)] = 2;
+ return 0;
+ }
+ case 6:
+ case 7:
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -28; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves.
+ setErrNo(28);
+ return -1;
+ default: {
+ return -28;
+ }
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fdatasync(fd) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fstat64(fd, buf) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return SYSCALLS.doStat(FS.stat, stream.path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ var convertI32PairToI53Checked = (lo, hi) => {
+ assert(lo == (lo >>> 0) || lo == (lo|0)); // lo should either be a i32 or a u32
+ assert(hi === (hi|0)); // hi should be a i32
+ return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN;
+ };
+ function ___syscall_ftruncate64(fd,length_low, length_high) {
+ var length = convertI32PairToI53Checked(length_low, length_high);;
+
+
+ try {
+
+ if (isNaN(length)) return 61;
+ FS.ftruncate(fd, length);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ ;
+ }
+
+
+ var stringToUTF8 = (str, outPtr, maxBytesToWrite) => {
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
+ };
+
+ function ___syscall_getcwd(buf, size) {
+ try {
+
+ if (size === 0) return -28;
+ var cwd = FS.cwd();
+ var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
+ if (size < cwdLengthInBytes) return -68;
+ stringToUTF8(cwd, buf, size);
+ return cwdLengthInBytes;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ function ___syscall_getdents64(fd, dirp, count) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd)
+ if (!stream.getdents) {
+ stream.getdents = FS.readdir(stream.path);
+ }
+
+ var struct_size = 280;
+ var pos = 0;
+ var off = FS.llseek(stream, 0, 1);
+
+ var idx = Math.floor(off / struct_size);
+
+ while (idx < stream.getdents.length && pos + struct_size <= count) {
+ var id;
+ var type;
+ var name = stream.getdents[idx];
+ if (name === '.') {
+ id = stream.node.id;
+ type = 4; // DT_DIR
+ }
+ else if (name === '..') {
+ var lookup = FS.lookupPath(stream.path, { parent: true });
+ id = lookup.node.id;
+ type = 4; // DT_DIR
+ }
+ else {
+ var child = FS.lookupNode(stream.node, name);
+ id = child.id;
+ type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device.
+ FS.isDir(child.mode) ? 4 : // DT_DIR, directory.
+ FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link.
+ 8; // DT_REG, regular file.
+ }
+ assert(id);
+ (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]);
+ (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]);
+ HEAP16[(((dirp + pos)+(16))>>1)] = 280;
+ HEAP8[(((dirp + pos)+(18))>>0)] = type;
+ stringToUTF8(name, dirp + pos + 19, 256);
+ pos += struct_size;
+ idx += 1;
+ }
+ FS.llseek(stream, idx * struct_size, 0);
+ return pos;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+
+ function ___syscall_getpeername(fd, addr, addrlen, d1, d2, d3) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ if (!sock.daddr) {
+ return -53; // The socket is not connected.
+ }
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport, addrlen);
+ assert(!errno);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+
+ function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport, addrlen);
+ assert(!errno);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211
+ // so only supports SOL_SOCKET with SO_ERROR.
+ if (level === 1) {
+ if (optname === 4) {
+ HEAP32[((optval)>>2)] = sock.error;
+ HEAP32[((optlen)>>2)] = 4;
+ sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field).
+ return 0;
+ }
+ }
+ return -50; // The option is unknown at the level indicated.
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_ioctl(fd, op, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (op) {
+ case 21509: {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21505: {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcgets) {
+ var termios = stream.tty.ops.ioctl_tcgets(stream);
+ var argp = SYSCALLS.getp();
+ HEAP32[((argp)>>2)] = termios.c_iflag || 0;
+ HEAP32[(((argp)+(4))>>2)] = termios.c_oflag || 0;
+ HEAP32[(((argp)+(8))>>2)] = termios.c_cflag || 0;
+ HEAP32[(((argp)+(12))>>2)] = termios.c_lflag || 0;
+ for (var i = 0; i < 32; i++) {
+ HEAP8[(((argp + i)+(17))>>0)] = termios.c_cc[i] || 0;
+ }
+ return 0;
+ }
+ return 0;
+ }
+ case 21510:
+ case 21511:
+ case 21512: {
+ if (!stream.tty) return -59;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21506:
+ case 21507:
+ case 21508: {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcsets) {
+ var argp = SYSCALLS.getp();
+ var c_iflag = HEAP32[((argp)>>2)];
+ var c_oflag = HEAP32[(((argp)+(4))>>2)];
+ var c_cflag = HEAP32[(((argp)+(8))>>2)];
+ var c_lflag = HEAP32[(((argp)+(12))>>2)];
+ var c_cc = []
+ for (var i = 0; i < 32; i++) {
+ c_cc.push(HEAP8[(((argp + i)+(17))>>0)]);
+ }
+ return stream.tty.ops.ioctl_tcsets(stream.tty, op, { c_iflag, c_oflag, c_cflag, c_lflag, c_cc });
+ }
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -59;
+ var argp = SYSCALLS.getp();
+ HEAP32[((argp)>>2)] = 0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -59;
+ return -28; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.getp();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tiocgwinsz) {
+ var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
+ var argp = SYSCALLS.getp();
+ HEAP16[((argp)>>1)] = winsize[0];
+ HEAP16[(((argp)+(2))>>1)] = winsize[1];
+ }
+ return 0;
+ }
+ case 21524: {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21515: {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ default: return -28; // not supported
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ function ___syscall_listen(fd, backlog) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ sock.sock_ops.listen(sock, backlog);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_lstat64(path, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.lstat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_mkdirat(dirfd, path, mode) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_newfstatat(dirfd, path, buf, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ var allowEmpty = flags & 4096;
+ flags = flags & (~6400);
+ assert(!flags, `unknown flags in __syscall_newfstatat: ${flags}`);
+ path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+ return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_openat(dirfd, path, flags, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ var mode = varargs ? SYSCALLS.get() : 0;
+ return FS.open(path, flags, mode).fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ var PIPEFS = {
+ BUCKET_BUFFER_SIZE:8192,
+ mount(mount) {
+ // Do not pollute the real root directory or its child nodes with pipes
+ // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way
+ return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },
+ createPipe() {
+ var pipe = {
+ buckets: [],
+ // refcnt 2 because pipe has a read end and a write end. We need to be
+ // able to read from the read end after write end is closed.
+ refcnt : 2,
+ };
+
+ pipe.buckets.push({
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ });
+
+ var rName = PIPEFS.nextname();
+ var wName = PIPEFS.nextname();
+ var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
+ var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
+
+ rNode.pipe = pipe;
+ wNode.pipe = pipe;
+
+ var readableStream = FS.createStream({
+ path: rName,
+ node: rNode,
+ flags: 0,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ rNode.stream = readableStream;
+
+ var writableStream = FS.createStream({
+ path: wName,
+ node: wNode,
+ flags: 1,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ wNode.stream = writableStream;
+
+ return {
+ readable_fd: readableStream.fd,
+ writable_fd: writableStream.fd
+ };
+ },
+ stream_ops:{
+ poll(stream) {
+ var pipe = stream.node.pipe;
+
+ if ((stream.flags & 2097155) === 1) {
+ return (256 | 4);
+ }
+ if (pipe.buckets.length > 0) {
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ if (bucket.offset - bucket.roffset > 0) {
+ return (64 | 1);
+ }
+ }
+ }
+
+ return 0;
+ },
+ ioctl(stream, request, varargs) {
+ return 28;
+ },
+ fsync(stream) {
+ return 28;
+ },
+ read(stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+ var currentLength = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ currentLength += bucket.offset - bucket.roffset;
+ }
+
+ assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ if (length <= 0) {
+ return 0;
+ }
+ if (currentLength == 0) {
+ // Behave as if the read end is always non-blocking
+ throw new FS.ErrnoError(6);
+ }
+ var toRead = Math.min(currentLength, length);
+
+ var totalRead = toRead;
+ var toRemove = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var currBucket = pipe.buckets[i];
+ var bucketSize = currBucket.offset - currBucket.roffset;
+
+ if (toRead <= bucketSize) {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ if (toRead < bucketSize) {
+ tmpSlice = tmpSlice.subarray(0, toRead);
+ currBucket.roffset += toRead;
+ } else {
+ toRemove++;
+ }
+ data.set(tmpSlice);
+ break;
+ } else {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ data.set(tmpSlice);
+ data = data.subarray(tmpSlice.byteLength);
+ toRead -= tmpSlice.byteLength;
+ toRemove++;
+ }
+ }
+
+ if (toRemove && toRemove == pipe.buckets.length) {
+ // Do not generate excessive garbage in use cases such as
+ // write several bytes, read everything, write several bytes, read everything...
+ toRemove--;
+ pipe.buckets[toRemove].offset = 0;
+ pipe.buckets[toRemove].roffset = 0;
+ }
+
+ pipe.buckets.splice(0, toRemove);
+
+ return totalRead;
+ },
+ write(stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+
+ assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ var dataLen = data.byteLength;
+ if (dataLen <= 0) {
+ return 0;
+ }
+
+ var currBucket = null;
+
+ if (pipe.buckets.length == 0) {
+ currBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ };
+ pipe.buckets.push(currBucket);
+ } else {
+ currBucket = pipe.buckets[pipe.buckets.length - 1];
+ }
+
+ assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
+
+ var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
+ if (freeBytesInCurrBuffer >= dataLen) {
+ currBucket.buffer.set(data, currBucket.offset);
+ currBucket.offset += dataLen;
+ return dataLen;
+ } else if (freeBytesInCurrBuffer > 0) {
+ currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset);
+ currBucket.offset += freeBytesInCurrBuffer;
+ data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
+ }
+
+ var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
+ var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
+
+ for (var i = 0; i < numBuckets; i++) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: PIPEFS.BUCKET_BUFFER_SIZE,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
+ data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
+ }
+
+ if (remElements > 0) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: data.byteLength,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data);
+ }
+
+ return dataLen;
+ },
+ close(stream) {
+ var pipe = stream.node.pipe;
+ pipe.refcnt--;
+ if (pipe.refcnt === 0) {
+ pipe.buckets = null;
+ }
+ },
+ },
+ nextname() {
+ if (!PIPEFS.nextname.current) {
+ PIPEFS.nextname.current = 0;
+ }
+ return 'pipe[' + (PIPEFS.nextname.current++) + ']';
+ },
+ };
+
+ function ___syscall_pipe(fdPtr) {
+ try {
+
+ if (fdPtr == 0) {
+ throw new FS.ErrnoError(21);
+ }
+
+ var res = PIPEFS.createPipe();
+
+ HEAP32[((fdPtr)>>2)] = res.readable_fd;
+ HEAP32[(((fdPtr)+(4))>>2)] = res.writable_fd;
+
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_poll(fds, nfds, timeout) {
+ try {
+
+ var nonzero = 0;
+ for (var i = 0; i < nfds; i++) {
+ var pollfd = fds + 8 * i;
+ var fd = HEAP32[((pollfd)>>2)];
+ var events = HEAP16[(((pollfd)+(4))>>1)];
+ var mask = 32;
+ var stream = FS.getStream(fd);
+ if (stream) {
+ mask = SYSCALLS.DEFAULT_POLLMASK;
+ if (stream.stream_ops.poll) {
+ mask = stream.stream_ops.poll(stream, -1);
+ }
+ }
+ mask &= events | 8 | 16;
+ if (mask) nonzero++;
+ HEAP16[(((pollfd)+(6))>>1)] = mask;
+ }
+ return nonzero;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+ function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (bufsize <= 0) return -28;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf+len];
+ stringToUTF8(ret, buf, bufsize+1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf+len] = endChar;
+ return len;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+
+ function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0; // socket is closed
+ if (addr) {
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
+ assert(!errno);
+ }
+ HEAPU8.set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+ try {
+
+ oldpath = SYSCALLS.getStr(oldpath);
+ newpath = SYSCALLS.getStr(newpath);
+ oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+ newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+ FS.rename(oldpath, newpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_rmdir(path) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.rmdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+
+ function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var dest = getSocketAddress(addr, addr_len, true);
+ if (!dest) {
+ // send, no address provided
+ return FS.write(sock.stream, HEAP8, message, length);
+ }
+ // sendto an address
+ return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+
+ function ___syscall_socket(domain, type, protocol) {
+ try {
+
+ var sock = SOCKFS.createSocket(domain, type, protocol);
+ assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63
+ return sock.stream.fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_stat64(path, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_statfs64(path, size, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ assert(size === 64);
+ // NOTE: None of the constants here are true. We're just returning safe and
+ // sane values.
+ HEAP32[(((buf)+(4))>>2)] = 4096;
+ HEAP32[(((buf)+(40))>>2)] = 4096;
+ HEAP32[(((buf)+(8))>>2)] = 1000000;
+ HEAP32[(((buf)+(12))>>2)] = 500000;
+ HEAP32[(((buf)+(16))>>2)] = 500000;
+ HEAP32[(((buf)+(20))>>2)] = FS.nextInode;
+ HEAP32[(((buf)+(24))>>2)] = 1000000;
+ HEAP32[(((buf)+(28))>>2)] = 42;
+ HEAP32[(((buf)+(44))>>2)] = 2; // ST_NOSUID
+ HEAP32[(((buf)+(36))>>2)] = 255;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_symlink(target, linkpath) {
+ try {
+
+ target = SYSCALLS.getStr(target);
+ linkpath = SYSCALLS.getStr(linkpath);
+ FS.symlink(target, linkpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_unlinkat(dirfd, path, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (flags === 0) {
+ FS.unlink(path);
+ } else if (flags === 512) {
+ FS.rmdir(path);
+ } else {
+ abort('Invalid flags passed to unlinkat');
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ var readI53FromI64 = (ptr) => {
+ return HEAPU32[((ptr)>>2)] + HEAP32[(((ptr)+(4))>>2)] * 4294967296;
+ };
+
+ function ___syscall_utimensat(dirfd, path, times, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path, true);
+ if (!times) {
+ var atime = Date.now();
+ var mtime = atime;
+ } else {
+ var seconds = readI53FromI64(times);
+ var nanoseconds = HEAP32[(((times)+(8))>>2)];
+ atime = (seconds*1000) + (nanoseconds/(1000*1000));
+ times += 16;
+ seconds = readI53FromI64(times);
+ nanoseconds = HEAP32[(((times)+(8))>>2)];
+ mtime = (seconds*1000) + (nanoseconds/(1000*1000));
+ }
+ FS.utime(path, atime, mtime);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ }
+
+ var nowIsMonotonic = true;;
+ var __emscripten_get_now_is_monotonic = () => nowIsMonotonic;
+
+ var __emscripten_throw_longjmp = () => {
+ throw Infinity;
+ };
+
+ function __gmtime_js(time_low, time_high,tmPtr) {
+ var time = convertI32PairToI53Checked(time_low, time_high);;
+
+
+ var date = new Date(time * 1000);
+ HEAP32[((tmPtr)>>2)] = date.getUTCSeconds();
+ HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes();
+ HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours();
+ HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate();
+ HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth();
+ HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900;
+ HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay();
+ var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
+ var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0;
+ HEAP32[(((tmPtr)+(28))>>2)] = yday;
+ ;
+ }
+
+ var isLeapYear = (year) => {
+ return year%4 === 0 && (year%100 !== 0 || year%400 === 0);
+ };
+
+ var MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335];
+
+ var MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334];
+ var ydayFromDate = (date) => {
+ var leap = isLeapYear(date.getFullYear());
+ var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE);
+ var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1
+
+ return yday;
+ };
+
+ function __localtime_js(time_low, time_high,tmPtr) {
+ var time = convertI32PairToI53Checked(time_low, time_high);;
+
+
+ var date = new Date(time*1000);
+ HEAP32[((tmPtr)>>2)] = date.getSeconds();
+ HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
+ HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
+ HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
+ HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
+ HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900;
+ HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
+
+ var yday = ydayFromDate(date)|0;
+ HEAP32[(((tmPtr)+(28))>>2)] = yday;
+ HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60);
+
+ // Attention: DST is in December in South, and some regions don't have DST at all.
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0;
+ HEAP32[(((tmPtr)+(32))>>2)] = dst;
+ ;
+ }
+
+
+
+ var __mktime_js = function(tmPtr) {
+
+ var ret = (() => {
+ var date = new Date(HEAP32[(((tmPtr)+(20))>>2)] + 1900,
+ HEAP32[(((tmPtr)+(16))>>2)],
+ HEAP32[(((tmPtr)+(12))>>2)],
+ HEAP32[(((tmPtr)+(8))>>2)],
+ HEAP32[(((tmPtr)+(4))>>2)],
+ HEAP32[((tmPtr)>>2)],
+ 0);
+
+ // There's an ambiguous hour when the time goes back; the tm_isdst field is
+ // used to disambiguate it. Date() basically guesses, so we fix it up if it
+ // guessed wrong, or fill in tm_isdst with the guess if it's -1.
+ var dst = HEAP32[(((tmPtr)+(32))>>2)];
+ var guessedOffset = date.getTimezoneOffset();
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South
+ if (dst < 0) {
+ // Attention: some regions don't have DST at all.
+ HEAP32[(((tmPtr)+(32))>>2)] = Number(summerOffset != winterOffset && dstOffset == guessedOffset);
+ } else if ((dst > 0) != (dstOffset == guessedOffset)) {
+ var nonDstOffset = Math.max(winterOffset, summerOffset);
+ var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
+ // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up.
+ date.setTime(date.getTime() + (trueOffset - guessedOffset)*60000);
+ }
+
+ HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
+ var yday = ydayFromDate(date)|0;
+ HEAP32[(((tmPtr)+(28))>>2)] = yday;
+ // To match expected behavior, update fields from date
+ HEAP32[((tmPtr)>>2)] = date.getSeconds();
+ HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
+ HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
+ HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
+ HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
+ HEAP32[(((tmPtr)+(20))>>2)] = date.getYear();
+
+ return date.getTime() / 1000;
+ })();
+ return (setTempRet0((tempDouble=ret,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)), ret>>>0);
+ };
+
+
+
+
+
+
+ function __mmap_js(len,prot,flags,fd,offset_low, offset_high,allocated,addr) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+
+
+ try {
+
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var res = FS.mmap(stream, len, offset, prot, flags);
+ var ptr = res.ptr;
+ HEAP32[((allocated)>>2)] = res.allocated;
+ HEAPU32[((addr)>>2)] = ptr;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ ;
+ }
+
+
+
+
+ function __munmap_js(addr,len,prot,flags,fd,offset_low, offset_high) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+
+
+ try {
+
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (prot & 2) {
+ SYSCALLS.doMsync(addr, stream, len, flags, offset);
+ }
+ FS.munmap(stream);
+ // implicitly return 0
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return -e.errno;
+ }
+ ;
+ }
+
+ var timers = {
+ };
+
+ var handleException = (e) => {
+ // Certain exception types we do not treat as errors since they are used for
+ // internal control flow.
+ // 1. ExitStatus, which is thrown by exit()
+ // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
+ // that wish to return to JS event loop.
+ if (e instanceof ExitStatus || e == 'unwind') {
+ return EXITSTATUS;
+ }
+ checkStackCookie();
+ if (e instanceof WebAssembly.RuntimeError) {
+ if (_emscripten_stack_get_current() <= 0) {
+ err('Stack overflow detected. You can try increasing -sSTACK_SIZE (currently set to 65536)');
+ }
+ }
+ quit_(1, e);
+ };
+
+
+ var _proc_exit = (code) => {
+ EXITSTATUS = code;
+ if (!keepRuntimeAlive()) {
+ if (Module['onExit']) Module['onExit'](code);
+ ABORT = true;
+ }
+ quit_(code, new ExitStatus(code));
+ };
+ /** @suppress {duplicate } */
+ /** @param {boolean|number=} implicit */
+ var exitJS = (status, implicit) => {
+ EXITSTATUS = status;
+
+ checkUnflushedContent();
+
+ // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down
+ if (keepRuntimeAlive() && !implicit) {
+ var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`;
+ readyPromiseReject(msg);
+ err(msg);
+ }
+
+ _proc_exit(status);
+ };
+ var _exit = exitJS;
+
+ var maybeExit = () => {
+ if (!keepRuntimeAlive()) {
+ try {
+ _exit(EXITSTATUS);
+ } catch (e) {
+ handleException(e);
+ }
+ }
+ };
+ var callUserCallback = (func) => {
+ if (ABORT) {
+ err('user callback triggered after runtime exited or application aborted. Ignoring.');
+ return;
+ }
+ try {
+ func();
+ maybeExit();
+ } catch (e) {
+ handleException(e);
+ }
+ };
+
+
+ var _emscripten_get_now;
+ // Modern environment where performance.now() is supported:
+ // N.B. a shorter form "_emscripten_get_now = performance.now;" is
+ // unfortunately not allowed even in current browsers (e.g. FF Nightly 75).
+ _emscripten_get_now = () => performance.now();
+ ;
+ var __setitimer_js = (which, timeout_ms) => {
+ // First, clear any existing timer.
+ if (timers[which]) {
+ clearTimeout(timers[which].id);
+ delete timers[which];
+ }
+
+ // A timeout of zero simply cancels the current timeout so we have nothing
+ // more to do.
+ if (!timeout_ms) return 0;
+
+ var id = setTimeout(() => {
+ assert(which in timers);
+ delete timers[which];
+ callUserCallback(() => __emscripten_timeout(which, _emscripten_get_now()));
+ }, timeout_ms);
+ timers[which] = { id, timeout_ms };
+ return 0;
+ };
+
+
+
+ var stringToNewUTF8 = (str) => {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8(str, ret, size);
+ return ret;
+ };
+ var __tzset_js = (timezone, daylight, tzname) => {
+ // TODO: Use (malleable) environment variables instead of system settings.
+ var currentYear = new Date().getFullYear();
+ var winter = new Date(currentYear, 0, 1);
+ var summer = new Date(currentYear, 6, 1);
+ var winterOffset = winter.getTimezoneOffset();
+ var summerOffset = summer.getTimezoneOffset();
+
+ // Local standard timezone offset. Local standard time is not adjusted for daylight savings.
+ // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST).
+ // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST).
+ var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+
+ // timezone is specified as seconds west of UTC ("The external variable
+ // `timezone` shall be set to the difference, in seconds, between
+ // Coordinated Universal Time (UTC) and local standard time."), the same
+ // as returned by stdTimezoneOffset.
+ // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
+ HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60;
+
+ HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset);
+
+ function extractZone(date) {
+ var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
+ return match ? match[1] : "GMT";
+ };
+ var winterName = extractZone(winter);
+ var summerName = extractZone(summer);
+ var winterNamePtr = stringToNewUTF8(winterName);
+ var summerNamePtr = stringToNewUTF8(summerName);
+ if (summerOffset < winterOffset) {
+ // Northern hemisphere
+ HEAPU32[((tzname)>>2)] = winterNamePtr;
+ HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr;
+ } else {
+ HEAPU32[((tzname)>>2)] = summerNamePtr;
+ HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr;
+ }
+ };
+
+ var _abort = () => {
+ abort('native code called abort()');
+ };
+
+ var _emscripten_date_now = () => Date.now();
+
+ var _emscripten_err = (str) => err(UTF8ToString(str));
+
+ var getHeapMax = () =>
+ HEAPU8.length;
+ var _emscripten_get_heap_max = () => getHeapMax();
+
+
+ var _emscripten_memcpy_js = (dest, src, num) => HEAPU8.copyWithin(dest, src, src + num);
+
+
+ var abortOnCannotGrowMemory = (requestedSize) => {
+ abort(`Cannot enlarge memory arrays to size ${requestedSize} bytes (OOM). Either (1) compile with -sINITIAL_MEMORY=X with X higher than the current value ${HEAP8.length}, (2) compile with -sALLOW_MEMORY_GROWTH which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -sABORTING_MALLOC=0`);
+ };
+ var _emscripten_resize_heap = (requestedSize) => {
+ var oldSize = HEAPU8.length;
+ // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+ requestedSize >>>= 0;
+ abortOnCannotGrowMemory(requestedSize);
+ };
+
+ var ENV = {
+ };
+
+ var getExecutableName = () => {
+ return thisProgram || './this.program';
+ };
+ var getEnvStrings = () => {
+ if (!getEnvStrings.strings) {
+ // Default values.
+ // Browser language detection #8751
+ var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8';
+ var env = {
+ 'USER': 'web_user',
+ 'LOGNAME': 'web_user',
+ 'PATH': '/',
+ 'PWD': '/',
+ 'HOME': '/home/web_user',
+ 'LANG': lang,
+ '_': getExecutableName()
+ };
+ // Apply the user-provided values, if any.
+ for (var x in ENV) {
+ // x is a key in ENV; if ENV[x] is undefined, that means it was
+ // explicitly set to be so. We allow user code to do that to
+ // force variables with default values to remain unset.
+ if (ENV[x] === undefined) delete env[x];
+ else env[x] = ENV[x];
+ }
+ var strings = [];
+ for (var x in env) {
+ strings.push(`${x}=${env[x]}`);
+ }
+ getEnvStrings.strings = strings;
+ }
+ return getEnvStrings.strings;
+ };
+
+ var stringToAscii = (str, buffer) => {
+ for (var i = 0; i < str.length; ++i) {
+ assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff));
+ HEAP8[((buffer++)>>0)] = str.charCodeAt(i);
+ }
+ // Null-terminate the string
+ HEAP8[((buffer)>>0)] = 0;
+ };
+
+ var _environ_get = (__environ, environ_buf) => {
+ var bufSize = 0;
+ getEnvStrings().forEach((string, i) => {
+ var ptr = environ_buf + bufSize;
+ HEAPU32[(((__environ)+(i*4))>>2)] = ptr;
+ stringToAscii(string, ptr);
+ bufSize += string.length + 1;
+ });
+ return 0;
+ };
+
+
+ var _environ_sizes_get = (penviron_count, penviron_buf_size) => {
+ var strings = getEnvStrings();
+ HEAPU32[((penviron_count)>>2)] = strings.length;
+ var bufSize = 0;
+ strings.forEach((string) => bufSize += string.length + 1);
+ HEAPU32[((penviron_buf_size)>>2)] = bufSize;
+ return 0;
+ };
+
+
+ function _fd_close(fd) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_fdstat_get(fd, pbuf) {
+ try {
+
+ var rightsBase = 0;
+ var rightsInheriting = 0;
+ var flags = 0;
+ {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ // All character devices are terminals (other things a Linux system would
+ // assume is a character device, like the mouse, we have special APIs for).
+ var type = stream.tty ? 2 :
+ FS.isDir(stream.mode) ? 3 :
+ FS.isLink(stream.mode) ? 7 :
+ 4;
+ }
+ HEAP8[((pbuf)>>0)] = type;
+ HEAP16[(((pbuf)+(2))>>1)] = flags;
+ (tempI64 = [rightsBase>>>0,(tempDouble=rightsBase,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]);
+ (tempI64 = [rightsInheriting>>>0,(tempDouble=rightsInheriting,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ var doReadv = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[((iov)>>2)];
+ var len = HEAPU32[(((iov)+(4))>>2)];
+ iov += 8;
+ var curr = FS.read(stream, HEAP8, ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ if (typeof offset !== 'undefined') {
+ offset += curr;
+ }
+ }
+ return ret;
+ };
+
+ function _fd_read(fd, iov, iovcnt, pnum) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doReadv(stream, iov, iovcnt);
+ HEAPU32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ }
+
+
+ function _fd_seek(fd,offset_low, offset_high,whence,newOffset) {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);;
+
+
+ try {
+
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.llseek(stream, offset, whence);
+ (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? (+(Math.floor((tempDouble)/4294967296.0)))>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)], HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]);
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ ;
+ }
+
+ function _fd_sync(fd) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (stream.stream_ops && stream.stream_ops.fsync) {
+ return stream.stream_ops.fsync(stream);
+ }
+ return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ var doWritev = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[((iov)>>2)];
+ var len = HEAPU32[(((iov)+(4))>>2)];
+ iov += 8;
+ var curr = FS.write(stream, HEAP8, ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (typeof offset !== 'undefined') {
+ offset += curr;
+ }
+ }
+ return ret;
+ };
+
+ function _fd_write(fd, iov, iovcnt, pnum) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doWritev(stream, iov, iovcnt);
+ HEAPU32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
+ return e.errno;
+ }
+ }
+
+
+
+
+
+
+
+
+
+
+ var _getaddrinfo = (node, service, hint, out) => {
+ // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL
+ // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we
+ // really should provide a linked list of suitable addrinfo values.
+ var addrs = [];
+ var canon = null;
+ var addr = 0;
+ var port = 0;
+ var flags = 0;
+ var family = 0;
+ var type = 0;
+ var proto = 0;
+ var ai, last;
+
+ function allocaddrinfo(family, type, proto, canon, addr, port) {
+ var sa, salen, ai;
+ var errno;
+
+ salen = family === 10 ?
+ 28 :
+ 16;
+ addr = family === 10 ?
+ inetNtop6(addr) :
+ inetNtop4(addr);
+ sa = _malloc(salen);
+ errno = writeSockaddr(sa, family, addr, port);
+ assert(!errno);
+
+ ai = _malloc(32);
+ HEAP32[(((ai)+(4))>>2)] = family;
+ HEAP32[(((ai)+(8))>>2)] = type;
+ HEAP32[(((ai)+(12))>>2)] = proto;
+ HEAPU32[(((ai)+(24))>>2)] = canon;
+ HEAPU32[(((ai)+(20))>>2)] = sa;
+ if (family === 10) {
+ HEAP32[(((ai)+(16))>>2)] = 28;
+ } else {
+ HEAP32[(((ai)+(16))>>2)] = 16;
+ }
+ HEAP32[(((ai)+(28))>>2)] = 0;
+
+ return ai;
+ }
+
+ if (hint) {
+ flags = HEAP32[((hint)>>2)];
+ family = HEAP32[(((hint)+(4))>>2)];
+ type = HEAP32[(((hint)+(8))>>2)];
+ proto = HEAP32[(((hint)+(12))>>2)];
+ }
+ if (type && !proto) {
+ proto = type === 2 ? 17 : 6;
+ }
+ if (!type && proto) {
+ type = proto === 17 ? 2 : 1;
+ }
+
+ // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for
+ // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints.
+ if (proto === 0) {
+ proto = 6;
+ }
+ if (type === 0) {
+ type = 1;
+ }
+
+ if (!node && !service) {
+ return -2;
+ }
+ if (flags & ~(1|2|4|
+ 1024|8|16|32)) {
+ return -1;
+ }
+ if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) {
+ return -1;
+ }
+ if (flags & 32) {
+ // TODO
+ return -2;
+ }
+ if (type !== 0 && type !== 1 && type !== 2) {
+ return -7;
+ }
+ if (family !== 0 && family !== 2 && family !== 10) {
+ return -6;
+ }
+
+ if (service) {
+ service = UTF8ToString(service);
+ port = parseInt(service, 10);
+
+ if (isNaN(port)) {
+ if (flags & 1024) {
+ return -2;
+ }
+ // TODO support resolving well-known service names from:
+ // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt
+ return -8;
+ }
+ }
+
+ if (!node) {
+ if (family === 0) {
+ family = 2;
+ }
+ if ((flags & 1) === 0) {
+ if (family === 2) {
+ addr = _htonl(2130706433);
+ } else {
+ addr = [0, 0, 0, 1];
+ }
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAPU32[((out)>>2)] = ai;
+ return 0;
+ }
+
+ //
+ // try as a numeric address
+ //
+ node = UTF8ToString(node);
+ addr = inetPton4(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv4 address
+ if (family === 0 || family === 2) {
+ family = 2;
+ }
+ else if (family === 10 && (flags & 8)) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ family = 10;
+ } else {
+ return -2;
+ }
+ } else {
+ addr = inetPton6(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv6 address
+ if (family === 0 || family === 10) {
+ family = 10;
+ } else {
+ return -2;
+ }
+ }
+ }
+ if (addr != null) {
+ ai = allocaddrinfo(family, type, proto, node, addr, port);
+ HEAPU32[((out)>>2)] = ai;
+ return 0;
+ }
+ if (flags & 4) {
+ return -2;
+ }
+
+ //
+ // try as a hostname
+ //
+ // resolve the hostname to a temporary fake address
+ node = DNS.lookup_name(node);
+ addr = inetPton4(node);
+ if (family === 0) {
+ family = 2;
+ } else if (family === 10) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAPU32[((out)>>2)] = ai;
+ return 0;
+ };
+
+ /** @type {function(...*):?} */
+ function _getcontext(
+ ) {
+ abort('missing function: getcontext');
+ }
+ _getcontext.stub = true;
+
+ /** @type {function(...*):?} */
+ function _getdtablesize(
+ ) {
+ abort('missing function: getdtablesize');
+ }
+ _getdtablesize.stub = true;
+
+
+
+
+ var getHostByName = (name) => {
+ // generate hostent
+ var ret = _malloc(20); // XXX possibly leaked, as are others here
+ var nameBuf = stringToNewUTF8(name);
+ HEAPU32[((ret)>>2)] = nameBuf;
+ var aliasesBuf = _malloc(4);
+ HEAPU32[((aliasesBuf)>>2)] = 0;
+ HEAPU32[(((ret)+(4))>>2)] = aliasesBuf;
+ var afinet = 2;
+ HEAP32[(((ret)+(8))>>2)] = afinet;
+ HEAP32[(((ret)+(12))>>2)] = 4;
+ var addrListBuf = _malloc(12);
+ HEAPU32[((addrListBuf)>>2)] = addrListBuf+8;
+ HEAPU32[(((addrListBuf)+(4))>>2)] = 0;
+ HEAP32[(((addrListBuf)+(8))>>2)] = inetPton4(DNS.lookup_name(name));
+ HEAPU32[(((ret)+(16))>>2)] = addrListBuf;
+ return ret;
+ };
+
+ var _gethostbyname = (name) => {
+ return getHostByName(UTF8ToString(name));
+ };
+
+
+ var _gethostbyname_r = (name, ret, buf, buflen, out, err) => {
+ var data = _gethostbyname(name);
+ _memcpy(ret, data, 20);
+ _free(data);
+ HEAP32[((err)>>2)] = 0;
+ HEAPU32[((out)>>2)] = ret;
+ return 0;
+ };
+
+
+
+
+ var _getnameinfo = (sa, salen, node, nodelen, serv, servlen, flags) => {
+ var info = readSockaddr(sa, salen);
+ if (info.errno) {
+ return -6;
+ }
+ var port = info.port;
+ var addr = info.addr;
+
+ var overflowed = false;
+
+ if (node && nodelen) {
+ var lookup;
+ if ((flags & 1) || !(lookup = DNS.lookup_addr(addr))) {
+ if (flags & 8) {
+ return -2;
+ }
+ } else {
+ addr = lookup;
+ }
+ var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
+
+ if (numBytesWrittenExclNull+1 >= nodelen) {
+ overflowed = true;
+ }
+ }
+
+ if (serv && servlen) {
+ port = '' + port;
+ var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
+
+ if (numBytesWrittenExclNull+1 >= servlen) {
+ overflowed = true;
+ }
+ }
+
+ if (overflowed) {
+ // Note: even when we overflow, getnameinfo() is specced to write out the truncated results.
+ return -12;
+ }
+
+ return 0;
+ };
+
+ var Protocols = {
+ list:[],
+ map:{
+ },
+ };
+
+
+ var _setprotoent = (stayopen) => {
+ // void setprotoent(int stayopen);
+
+ // Allocate and populate a protoent structure given a name, protocol number and array of aliases
+ function allocprotoent(name, proto, aliases) {
+ // write name into buffer
+ var nameBuf = _malloc(name.length + 1);
+ stringToAscii(name, nameBuf);
+
+ // write aliases into buffer
+ var j = 0;
+ var length = aliases.length;
+ var aliasListBuf = _malloc((length + 1) * 4); // Use length + 1 so we have space for the terminating NULL ptr.
+
+ for (var i = 0; i < length; i++, j += 4) {
+ var alias = aliases[i];
+ var aliasBuf = _malloc(alias.length + 1);
+ stringToAscii(alias, aliasBuf);
+ HEAPU32[(((aliasListBuf)+(j))>>2)] = aliasBuf;
+ }
+ HEAPU32[(((aliasListBuf)+(j))>>2)] = 0; // Terminating NULL pointer.
+
+ // generate protoent
+ var pe = _malloc(12);
+ HEAPU32[((pe)>>2)] = nameBuf;
+ HEAPU32[(((pe)+(4))>>2)] = aliasListBuf;
+ HEAP32[(((pe)+(8))>>2)] = proto;
+ return pe;
+ };
+
+ // Populate the protocol 'database'. The entries are limited to tcp and udp, though it is fairly trivial
+ // to add extra entries from /etc/protocols if desired - though not sure if that'd actually be useful.
+ var list = Protocols.list;
+ var map = Protocols.map;
+ if (list.length === 0) {
+ var entry = allocprotoent('tcp', 6, ['TCP']);
+ list.push(entry);
+ map['tcp'] = map['6'] = entry;
+ entry = allocprotoent('udp', 17, ['UDP']);
+ list.push(entry);
+ map['udp'] = map['17'] = entry;
+ }
+
+ _setprotoent.index = 0;
+ };
+
+
+ var _getprotobyname = (name) => {
+ // struct protoent *getprotobyname(const char *);
+ name = UTF8ToString(name);
+ _setprotoent(true);
+ var result = Protocols.map[name];
+ return result;
+ };
+
+
+ var _getprotobynumber = (number) => {
+ // struct protoent *getprotobynumber(int proto);
+ _setprotoent(true);
+ var result = Protocols.map[number];
+ return result;
+ };
+
+ /** @type {function(...*):?} */
+ function _makecontext(
+ ) {
+ abort('missing function: makecontext');
+ }
+ _makecontext.stub = true;
+
+
+
+ var arraySum = (array, index) => {
+ var sum = 0;
+ for (var i = 0; i <= index; sum += array[i++]) {
+ // no-op
+ }
+ return sum;
+ };
+
+
+ var MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31];
+
+ var MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31];
+ var addDays = (date, days) => {
+ var newDate = new Date(date.getTime());
+ while (days > 0) {
+ var leap = isLeapYear(newDate.getFullYear());
+ var currentMonth = newDate.getMonth();
+ var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth];
+
+ if (days > daysInCurrentMonth-newDate.getDate()) {
+ // we spill over to next month
+ days -= (daysInCurrentMonth-newDate.getDate()+1);
+ newDate.setDate(1);
+ if (currentMonth < 11) {
+ newDate.setMonth(currentMonth+1)
+ } else {
+ newDate.setMonth(0);
+ newDate.setFullYear(newDate.getFullYear()+1);
+ }
+ } else {
+ // we stay in current month
+ newDate.setDate(newDate.getDate()+days);
+ return newDate;
+ }
+ }
+
+ return newDate;
+ };
+
+
+
+
+ var writeArrayToMemory = (array, buffer) => {
+ assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
+ HEAP8.set(array, buffer);
+ };
+
+ var _strftime = (s, maxsize, format, tm) => {
+ // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html
+
+ var tm_zone = HEAPU32[(((tm)+(40))>>2)];
+
+ var date = {
+ tm_sec: HEAP32[((tm)>>2)],
+ tm_min: HEAP32[(((tm)+(4))>>2)],
+ tm_hour: HEAP32[(((tm)+(8))>>2)],
+ tm_mday: HEAP32[(((tm)+(12))>>2)],
+ tm_mon: HEAP32[(((tm)+(16))>>2)],
+ tm_year: HEAP32[(((tm)+(20))>>2)],
+ tm_wday: HEAP32[(((tm)+(24))>>2)],
+ tm_yday: HEAP32[(((tm)+(28))>>2)],
+ tm_isdst: HEAP32[(((tm)+(32))>>2)],
+ tm_gmtoff: HEAP32[(((tm)+(36))>>2)],
+ tm_zone: tm_zone ? UTF8ToString(tm_zone) : ''
+ };
+
+ var pattern = UTF8ToString(format);
+
+ // expand format
+ var EXPANSION_RULES_1 = {
+ '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013
+ '%D': '%m/%d/%y', // Equivalent to %m / %d / %y
+ '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d
+ '%h': '%b', // Equivalent to %b
+ '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation
+ '%R': '%H:%M', // Replaced by the time in 24-hour notation
+ '%T': '%H:%M:%S', // Replaced by the time
+ '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation
+ '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation
+ // Modified Conversion Specifiers
+ '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation.
+ '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation.
+ '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation.
+ '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation.
+ '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation.
+ '%EY': '%Y', // Replaced by the full alternative year representation.
+ '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading <space> characters.
+ '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading <space> characters.
+ '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols.
+ '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols.
+ '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols.
+ '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols.
+ '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols.
+ '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1).
+ '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols.
+ '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols.
+ '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols.
+ '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols.
+ '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols.
+ };
+ for (var rule in EXPANSION_RULES_1) {
+ pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]);
+ }
+
+ var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
+ var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
+
+ function leadingSomething(value, digits, character) {
+ var str = typeof value == 'number' ? value.toString() : (value || '');
+ while (str.length < digits) {
+ str = character[0]+str;
+ }
+ return str;
+ }
+
+ function leadingNulls(value, digits) {
+ return leadingSomething(value, digits, '0');
+ }
+
+ function compareByDay(date1, date2) {
+ function sgn(value) {
+ return value < 0 ? -1 : (value > 0 ? 1 : 0);
+ }
+
+ var compare;
+ if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) {
+ if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) {
+ compare = sgn(date1.getDate()-date2.getDate());
+ }
+ }
+ return compare;
+ }
+
+ function getFirstWeekStartDate(janFourth) {
+ switch (janFourth.getDay()) {
+ case 0: // Sunday
+ return new Date(janFourth.getFullYear()-1, 11, 29);
+ case 1: // Monday
+ return janFourth;
+ case 2: // Tuesday
+ return new Date(janFourth.getFullYear(), 0, 3);
+ case 3: // Wednesday
+ return new Date(janFourth.getFullYear(), 0, 2);
+ case 4: // Thursday
+ return new Date(janFourth.getFullYear(), 0, 1);
+ case 5: // Friday
+ return new Date(janFourth.getFullYear()-1, 11, 31);
+ case 6: // Saturday
+ return new Date(janFourth.getFullYear()-1, 11, 30);
+ }
+ }
+
+ function getWeekBasedYear(date) {
+ var thisDate = addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday);
+
+ var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
+ var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4);
+
+ var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
+ var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
+
+ if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
+ // this date is after the start of the first week of this year
+ if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
+ return thisDate.getFullYear()+1;
+ }
+ return thisDate.getFullYear();
+ }
+ return thisDate.getFullYear()-1;
+ }
+
+ var EXPANSION_RULES_2 = {
+ '%a': (date) => WEEKDAYS[date.tm_wday].substring(0,3) ,
+ '%A': (date) => WEEKDAYS[date.tm_wday],
+ '%b': (date) => MONTHS[date.tm_mon].substring(0,3),
+ '%B': (date) => MONTHS[date.tm_mon],
+ '%C': (date) => {
+ var year = date.tm_year+1900;
+ return leadingNulls((year/100)|0,2);
+ },
+ '%d': (date) => leadingNulls(date.tm_mday, 2),
+ '%e': (date) => leadingSomething(date.tm_mday, 2, ' '),
+ '%g': (date) => {
+ // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year.
+ // In this system, weeks begin on a Monday and week 1 of the year is the week that includes
+ // January 4th, which is also the week that includes the first Thursday of the year, and
+ // is also the first week that contains at least four days in the year.
+ // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of
+ // the last week of the preceding year; thus, for Saturday 2nd January 1999,
+ // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th,
+ // or 31st is a Monday, it and any following days are part of week 1 of the following year.
+ // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01.
+
+ return getWeekBasedYear(date).toString().substring(2);
+ },
+ '%G': (date) => getWeekBasedYear(date),
+ '%H': (date) => leadingNulls(date.tm_hour, 2),
+ '%I': (date) => {
+ var twelveHour = date.tm_hour;
+ if (twelveHour == 0) twelveHour = 12;
+ else if (twelveHour > 12) twelveHour -= 12;
+ return leadingNulls(twelveHour, 2);
+ },
+ '%j': (date) => {
+ // Day of the year (001-366)
+ return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year+1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon-1), 3);
+ },
+ '%m': (date) => leadingNulls(date.tm_mon+1, 2),
+ '%M': (date) => leadingNulls(date.tm_min, 2),
+ '%n': () => '\n',
+ '%p': (date) => {
+ if (date.tm_hour >= 0 && date.tm_hour < 12) {
+ return 'AM';
+ }
+ return 'PM';
+ },
+ '%S': (date) => leadingNulls(date.tm_sec, 2),
+ '%t': () => '\t',
+ '%u': (date) => date.tm_wday || 7,
+ '%U': (date) => {
+ var days = date.tm_yday + 7 - date.tm_wday;
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ '%V': (date) => {
+ // Replaced by the week number of the year (Monday as the first day of the week)
+ // as a decimal number [01,53]. If the week containing 1 January has four
+ // or more days in the new year, then it is considered week 1.
+ // Otherwise, it is the last week of the previous year, and the next week is week 1.
+ // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday]
+ var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7);
+ // If 1 Jan is just 1-3 days past Monday, the previous week
+ // is also in this year.
+ if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
+ val++;
+ }
+ if (!val) {
+ val = 52;
+ // If 31 December of prev year a Thursday, or Friday of a
+ // leap year, then the prev year has 53 weeks.
+ var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
+ if (dec31 == 4 || (dec31 == 5 && isLeapYear(date.tm_year%400-1))) {
+ val++;
+ }
+ } else if (val == 53) {
+ // If 1 January is not a Thursday, and not a Wednesday of a
+ // leap year, then this year has only 52 weeks.
+ var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
+ if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year)))
+ val = 1;
+ }
+ return leadingNulls(val, 2);
+ },
+ '%w': (date) => date.tm_wday,
+ '%W': (date) => {
+ var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7);
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ '%y': (date) => {
+ // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year]
+ return (date.tm_year+1900).toString().substring(2);
+ },
+ // Replaced by the year as a decimal number (for example, 1997). [ tm_year]
+ '%Y': (date) => date.tm_year+1900,
+ '%z': (date) => {
+ // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ).
+ // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich).
+ var off = date.tm_gmtoff;
+ var ahead = off >= 0;
+ off = Math.abs(off) / 60;
+ // convert from minutes into hhmm format (which means 60 minutes = 100 units)
+ off = (off / 60)*100 + (off % 60);
+ return (ahead ? '+' : '-') + String("0000" + off).slice(-4);
+ },
+ '%Z': (date) => date.tm_zone,
+ '%%': () => '%'
+ };
+
+ // Replace %% with a pair of NULLs (which cannot occur in a C string), then
+ // re-inject them after processing.
+ pattern = pattern.replace(/%%/g, '\0\0')
+ for (var rule in EXPANSION_RULES_2) {
+ if (pattern.includes(rule)) {
+ pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date));
+ }
+ }
+ pattern = pattern.replace(/\0\0/g, '%')
+
+ var bytes = intArrayFromString(pattern, false);
+ if (bytes.length > maxsize) {
+ return 0;
+ }
+
+ writeArrayToMemory(bytes, s);
+ return bytes.length-1;
+ };
+
+
+
+
+
+
+
+
+ var _strptime = (buf, format, tm) => {
+ // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html
+ var pattern = UTF8ToString(format);
+
+ // escape special characters
+ // TODO: not sure we really need to escape all of these in JS regexps
+ var SPECIAL_CHARS = '\\!@#$^&*()+=-[]/{}|:<>?,.';
+ for (var i=0, ii=SPECIAL_CHARS.length; i<ii; ++i) {
+ pattern = pattern.replace(new RegExp('\\'+SPECIAL_CHARS[i], 'g'), '\\'+SPECIAL_CHARS[i]);
+ }
+
+ // reduce number of matchers
+ var EQUIVALENT_MATCHERS = {
+ '%A': '%a',
+ '%B': '%b',
+ '%c': '%a %b %d %H:%M:%S %Y',
+ '%D': '%m\\/%d\\/%y',
+ '%e': '%d',
+ '%F': '%Y-%m-%d',
+ '%h': '%b',
+ '%R': '%H\\:%M',
+ '%r': '%I\\:%M\\:%S\\s%p',
+ '%T': '%H\\:%M\\:%S',
+ '%x': '%m\\/%d\\/(?:%y|%Y)',
+ '%X': '%H\\:%M\\:%S'
+ };
+ for (var matcher in EQUIVALENT_MATCHERS) {
+ pattern = pattern.replace(matcher, EQUIVALENT_MATCHERS[matcher]);
+ }
+
+ // TODO: take care of locale
+
+ var DATE_PATTERNS = {
+ /* weeday name */ '%a': '(?:Sun(?:day)?)|(?:Mon(?:day)?)|(?:Tue(?:sday)?)|(?:Wed(?:nesday)?)|(?:Thu(?:rsday)?)|(?:Fri(?:day)?)|(?:Sat(?:urday)?)',
+ /* month name */ '%b': '(?:Jan(?:uary)?)|(?:Feb(?:ruary)?)|(?:Mar(?:ch)?)|(?:Apr(?:il)?)|May|(?:Jun(?:e)?)|(?:Jul(?:y)?)|(?:Aug(?:ust)?)|(?:Sep(?:tember)?)|(?:Oct(?:ober)?)|(?:Nov(?:ember)?)|(?:Dec(?:ember)?)',
+ /* century */ '%C': '\\d\\d',
+ /* day of month */ '%d': '0[1-9]|[1-9](?!\\d)|1\\d|2\\d|30|31',
+ /* hour (24hr) */ '%H': '\\d(?!\\d)|[0,1]\\d|20|21|22|23',
+ /* hour (12hr) */ '%I': '\\d(?!\\d)|0\\d|10|11|12',
+ /* day of year */ '%j': '00[1-9]|0?[1-9](?!\\d)|0?[1-9]\\d(?!\\d)|[1,2]\\d\\d|3[0-6]\\d',
+ /* month */ '%m': '0[1-9]|[1-9](?!\\d)|10|11|12',
+ /* minutes */ '%M': '0\\d|\\d(?!\\d)|[1-5]\\d',
+ /* whitespace */ '%n': '\\s',
+ /* AM/PM */ '%p': 'AM|am|PM|pm|A\\.M\\.|a\\.m\\.|P\\.M\\.|p\\.m\\.',
+ /* seconds */ '%S': '0\\d|\\d(?!\\d)|[1-5]\\d|60',
+ /* week number */ '%U': '0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53',
+ /* week number */ '%W': '0\\d|\\d(?!\\d)|[1-4]\\d|50|51|52|53',
+ /* weekday number */ '%w': '[0-6]',
+ /* 2-digit year */ '%y': '\\d\\d',
+ /* 4-digit year */ '%Y': '\\d\\d\\d\\d',
+ /* % */ '%%': '%',
+ /* whitespace */ '%t': '\\s',
+ };
+
+ var MONTH_NUMBERS = {JAN: 0, FEB: 1, MAR: 2, APR: 3, MAY: 4, JUN: 5, JUL: 6, AUG: 7, SEP: 8, OCT: 9, NOV: 10, DEC: 11};
+ var DAY_NUMBERS_SUN_FIRST = {SUN: 0, MON: 1, TUE: 2, WED: 3, THU: 4, FRI: 5, SAT: 6};
+ var DAY_NUMBERS_MON_FIRST = {MON: 0, TUE: 1, WED: 2, THU: 3, FRI: 4, SAT: 5, SUN: 6};
+
+ for (var datePattern in DATE_PATTERNS) {
+ pattern = pattern.replace(datePattern, '('+datePattern+DATE_PATTERNS[datePattern]+')');
+ }
+
+ // take care of capturing groups
+ var capture = [];
+ for (var i=pattern.indexOf('%'); i>=0; i=pattern.indexOf('%')) {
+ capture.push(pattern[i+1]);
+ pattern = pattern.replace(new RegExp('\\%'+pattern[i+1], 'g'), '');
+ }
+
+ var matches = new RegExp('^'+pattern, "i").exec(UTF8ToString(buf))
+ // out(UTF8ToString(buf)+ ' is matched by '+((new RegExp('^'+pattern)).source)+' into: '+JSON.stringify(matches));
+
+ function initDate() {
+ function fixup(value, min, max) {
+ return (typeof value != 'number' || isNaN(value)) ? min : (value>=min ? (value<=max ? value: max): min);
+ };
+ return {
+ year: fixup(HEAP32[(((tm)+(20))>>2)] + 1900 , 1970, 9999),
+ month: fixup(HEAP32[(((tm)+(16))>>2)], 0, 11),
+ day: fixup(HEAP32[(((tm)+(12))>>2)], 1, 31),
+ hour: fixup(HEAP32[(((tm)+(8))>>2)], 0, 23),
+ min: fixup(HEAP32[(((tm)+(4))>>2)], 0, 59),
+ sec: fixup(HEAP32[((tm)>>2)], 0, 59)
+ };
+ };
+
+ if (matches) {
+ var date = initDate();
+ var value;
+
+ var getMatch = (symbol) => {
+ var pos = capture.indexOf(symbol);
+ // check if symbol appears in regexp
+ if (pos >= 0) {
+ // return matched value or null (falsy!) for non-matches
+ return matches[pos+1];
+ }
+ return;
+ };
+
+ // seconds
+ if ((value=getMatch('S'))) {
+ date.sec = jstoi_q(value);
+ }
+
+ // minutes
+ if ((value=getMatch('M'))) {
+ date.min = jstoi_q(value);
+ }
+
+ // hours
+ if ((value=getMatch('H'))) {
+ // 24h clock
+ date.hour = jstoi_q(value);
+ } else if ((value = getMatch('I'))) {
+ // AM/PM clock
+ var hour = jstoi_q(value);
+ if ((value=getMatch('p'))) {
+ hour += value.toUpperCase()[0] === 'P' ? 12 : 0;
+ }
+ date.hour = hour;
+ }
+
+ // year
+ if ((value=getMatch('Y'))) {
+ // parse from four-digit year
+ date.year = jstoi_q(value);
+ } else if ((value=getMatch('y'))) {
+ // parse from two-digit year...
+ var year = jstoi_q(value);
+ if ((value=getMatch('C'))) {
+ // ...and century
+ year += jstoi_q(value)*100;
+ } else {
+ // ...and rule-of-thumb
+ year += year<69 ? 2000 : 1900;
+ }
+ date.year = year;
+ }
+
+ // month
+ if ((value=getMatch('m'))) {
+ // parse from month number
+ date.month = jstoi_q(value)-1;
+ } else if ((value=getMatch('b'))) {
+ // parse from month name
+ date.month = MONTH_NUMBERS[value.substring(0,3).toUpperCase()] || 0;
+ // TODO: derive month from day in year+year, week number+day of week+year
+ }
+
+ // day
+ if ((value=getMatch('d'))) {
+ // get day of month directly
+ date.day = jstoi_q(value);
+ } else if ((value=getMatch('j'))) {
+ // get day of month from day of year ...
+ var day = jstoi_q(value);
+ var leapYear = isLeapYear(date.year);
+ for (var month=0; month<12; ++month) {
+ var daysUntilMonth = arraySum(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, month-1);
+ if (day<=daysUntilMonth+(leapYear ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[month]) {
+ date.day = day-daysUntilMonth;
+ }
+ }
+ } else if ((value=getMatch('a'))) {
+ // get day of month from weekday ...
+ var weekDay = value.substring(0,3).toUpperCase();
+ if ((value=getMatch('U'))) {
+ // ... and week number (Sunday being first day of week)
+ // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53].
+ // All days in a new year preceding the first Sunday are considered to be in week 0.
+ var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay];
+ var weekNumber = jstoi_q(value);
+
+ // January 1st
+ var janFirst = new Date(date.year, 0, 1);
+ var endDate;
+ if (janFirst.getDay() === 0) {
+ // Jan 1st is a Sunday, and, hence in the 1st CW
+ endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1));
+ } else {
+ // Jan 1st is not a Sunday, and, hence still in the 0th CW
+ endDate = addDays(janFirst, 7-janFirst.getDay()+weekDayNumber+7*(weekNumber-1));
+ }
+ date.day = endDate.getDate();
+ date.month = endDate.getMonth();
+ } else if ((value=getMatch('W'))) {
+ // ... and week number (Monday being first day of week)
+ // Week number of the year (Monday as the first day of the week) as a decimal number [00,53].
+ // All days in a new year preceding the first Monday are considered to be in week 0.
+ var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay];
+ var weekNumber = jstoi_q(value);
+
+ // January 1st
+ var janFirst = new Date(date.year, 0, 1);
+ var endDate;
+ if (janFirst.getDay()===1) {
+ // Jan 1st is a Monday, and, hence in the 1st CW
+ endDate = addDays(janFirst, weekDayNumber+7*(weekNumber-1));
+ } else {
+ // Jan 1st is not a Monday, and, hence still in the 0th CW
+ endDate = addDays(janFirst, 7-janFirst.getDay()+1+weekDayNumber+7*(weekNumber-1));
+ }
+
+ date.day = endDate.getDate();
+ date.month = endDate.getMonth();
+ }
+ }
+
+ /*
+ tm_sec int seconds after the minute 0-61*
+ tm_min int minutes after the hour 0-59
+ tm_hour int hours since midnight 0-23
+ tm_mday int day of the month 1-31
+ tm_mon int months since January 0-11
+ tm_year int years since 1900
+ tm_wday int days since Sunday 0-6
+ tm_yday int days since January 1 0-365
+ tm_isdst int Daylight Saving Time flag
+ */
+
+ var fullDate = new Date(date.year, date.month, date.day, date.hour, date.min, date.sec, 0);
+ HEAP32[((tm)>>2)] = fullDate.getSeconds();
+ HEAP32[(((tm)+(4))>>2)] = fullDate.getMinutes();
+ HEAP32[(((tm)+(8))>>2)] = fullDate.getHours();
+ HEAP32[(((tm)+(12))>>2)] = fullDate.getDate();
+ HEAP32[(((tm)+(16))>>2)] = fullDate.getMonth();
+ HEAP32[(((tm)+(20))>>2)] = fullDate.getFullYear()-1900;
+ HEAP32[(((tm)+(24))>>2)] = fullDate.getDay();
+ HEAP32[(((tm)+(28))>>2)] = arraySum(isLeapYear(fullDate.getFullYear()) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, fullDate.getMonth()-1)+fullDate.getDate()-1;
+ HEAP32[(((tm)+(32))>>2)] = 0;
+
+ // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F
+ // TODO: not sure that intArrayFromString handles all unicode characters correctly
+ return buf+intArrayFromString(matches[0]).length-1;
+ }
+
+ return 0;
+ };
+
+ /** @type {function(...*):?} */
+ function _swapcontext(
+ ) {
+ abort('missing function: swapcontext');
+ }
+ _swapcontext.stub = true;
+
+
+ var getCFunc = (ident) => {
+ var func = Module['_' + ident]; // closure exported function
+ assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+ return func;
+ };
+
+
+
+ var stringToUTF8OnStack = (str) => {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8(str, ret, size);
+ return ret;
+ };
+
+
+ /**
+ * @param {string|null=} returnType
+ * @param {Array=} argTypes
+ * @param {Arguments|Array=} args
+ * @param {Object=} opts
+ */
+ var ccall = (ident, returnType, argTypes, args, opts) => {
+ // For fast lookup of conversion functions
+ var toC = {
+ 'string': (str) => {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ ret = stringToUTF8OnStack(str);
+ }
+ return ret;
+ },
+ 'array': (arr) => {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ }
+ };
+
+ function convertReturnValue(ret) {
+ if (returnType === 'string') {
+
+ return UTF8ToString(ret);
+ }
+ if (returnType === 'boolean') return Boolean(ret);
+ return ret;
+ }
+
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ assert(returnType !== 'array', 'Return type should not be "array".');
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ function onDone(ret) {
+ if (stack !== 0) stackRestore(stack);
+ return convertReturnValue(ret);
+ }
+
+ ret = onDone(ret);
+ return ret;
+ };
+
+ var FSNode = /** @constructor */ function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+ var readMode = 292/*292*/ | 73/*73*/;
+ var writeMode = 146/*146*/;
+ Object.defineProperties(FSNode.prototype, {
+ read: {
+ get: /** @this{FSNode} */function() {
+ return (this.mode & readMode) === readMode;
+ },
+ set: /** @this{FSNode} */function(val) {
+ val ? this.mode |= readMode : this.mode &= ~readMode;
+ }
+ },
+ write: {
+ get: /** @this{FSNode} */function() {
+ return (this.mode & writeMode) === writeMode;
+ },
+ set: /** @this{FSNode} */function(val) {
+ val ? this.mode |= writeMode : this.mode &= ~writeMode;
+ }
+ },
+ isFolder: {
+ get: /** @this{FSNode} */function() {
+ return FS.isDir(this.mode);
+ }
+ },
+ isDevice: {
+ get: /** @this{FSNode} */function() {
+ return FS.isChrdev(this.mode);
+ }
+ }
+ });
+ FS.FSNode = FSNode;
+ FS.createPreloadedFile = FS_createPreloadedFile;
+ FS.staticInit();;
+ERRNO_CODES = {
+ 'EPERM': 63,
+ 'ENOENT': 44,
+ 'ESRCH': 71,
+ 'EINTR': 27,
+ 'EIO': 29,
+ 'ENXIO': 60,
+ 'E2BIG': 1,
+ 'ENOEXEC': 45,
+ 'EBADF': 8,
+ 'ECHILD': 12,
+ 'EAGAIN': 6,
+ 'EWOULDBLOCK': 6,
+ 'ENOMEM': 48,
+ 'EACCES': 2,
+ 'EFAULT': 21,
+ 'ENOTBLK': 105,
+ 'EBUSY': 10,
+ 'EEXIST': 20,
+ 'EXDEV': 75,
+ 'ENODEV': 43,
+ 'ENOTDIR': 54,
+ 'EISDIR': 31,
+ 'EINVAL': 28,
+ 'ENFILE': 41,
+ 'EMFILE': 33,
+ 'ENOTTY': 59,
+ 'ETXTBSY': 74,
+ 'EFBIG': 22,
+ 'ENOSPC': 51,
+ 'ESPIPE': 70,
+ 'EROFS': 69,
+ 'EMLINK': 34,
+ 'EPIPE': 64,
+ 'EDOM': 18,
+ 'ERANGE': 68,
+ 'ENOMSG': 49,
+ 'EIDRM': 24,
+ 'ECHRNG': 106,
+ 'EL2NSYNC': 156,
+ 'EL3HLT': 107,
+ 'EL3RST': 108,
+ 'ELNRNG': 109,
+ 'EUNATCH': 110,
+ 'ENOCSI': 111,
+ 'EL2HLT': 112,
+ 'EDEADLK': 16,
+ 'ENOLCK': 46,
+ 'EBADE': 113,
+ 'EBADR': 114,
+ 'EXFULL': 115,
+ 'ENOANO': 104,
+ 'EBADRQC': 103,
+ 'EBADSLT': 102,
+ 'EDEADLOCK': 16,
+ 'EBFONT': 101,
+ 'ENOSTR': 100,
+ 'ENODATA': 116,
+ 'ETIME': 117,
+ 'ENOSR': 118,
+ 'ENONET': 119,
+ 'ENOPKG': 120,
+ 'EREMOTE': 121,
+ 'ENOLINK': 47,
+ 'EADV': 122,
+ 'ESRMNT': 123,
+ 'ECOMM': 124,
+ 'EPROTO': 65,
+ 'EMULTIHOP': 36,
+ 'EDOTDOT': 125,
+ 'EBADMSG': 9,
+ 'ENOTUNIQ': 126,
+ 'EBADFD': 127,
+ 'EREMCHG': 128,
+ 'ELIBACC': 129,
+ 'ELIBBAD': 130,
+ 'ELIBSCN': 131,
+ 'ELIBMAX': 132,
+ 'ELIBEXEC': 133,
+ 'ENOSYS': 52,
+ 'ENOTEMPTY': 55,
+ 'ENAMETOOLONG': 37,
+ 'ELOOP': 32,
+ 'EOPNOTSUPP': 138,
+ 'EPFNOSUPPORT': 139,
+ 'ECONNRESET': 15,
+ 'ENOBUFS': 42,
+ 'EAFNOSUPPORT': 5,
+ 'EPROTOTYPE': 67,
+ 'ENOTSOCK': 57,
+ 'ENOPROTOOPT': 50,
+ 'ESHUTDOWN': 140,
+ 'ECONNREFUSED': 14,
+ 'EADDRINUSE': 3,
+ 'ECONNABORTED': 13,
+ 'ENETUNREACH': 40,
+ 'ENETDOWN': 38,
+ 'ETIMEDOUT': 73,
+ 'EHOSTDOWN': 142,
+ 'EHOSTUNREACH': 23,
+ 'EINPROGRESS': 26,
+ 'EALREADY': 7,
+ 'EDESTADDRREQ': 17,
+ 'EMSGSIZE': 35,
+ 'EPROTONOSUPPORT': 66,
+ 'ESOCKTNOSUPPORT': 137,
+ 'EADDRNOTAVAIL': 4,
+ 'ENETRESET': 39,
+ 'EISCONN': 30,
+ 'ENOTCONN': 53,
+ 'ETOOMANYREFS': 141,
+ 'EUSERS': 136,
+ 'EDQUOT': 19,
+ 'ESTALE': 72,
+ 'ENOTSUP': 138,
+ 'ENOMEDIUM': 148,
+ 'EILSEQ': 25,
+ 'EOVERFLOW': 61,
+ 'ECANCELED': 11,
+ 'ENOTRECOVERABLE': 56,
+ 'EOWNERDEAD': 62,
+ 'ESTRPIPE': 135,
+ };;
+function checkIncomingModuleAPI() {
+ ignoredModuleProp('fetchSettings');
+}
+var wasmImports = {
+ /** @export */
+ __assert_fail: ___assert_fail,
+ /** @export */
+ __call_sighandler: ___call_sighandler,
+ /** @export */
+ __syscall__newselect: ___syscall__newselect,
+ /** @export */
+ __syscall_accept4: ___syscall_accept4,
+ /** @export */
+ __syscall_bind: ___syscall_bind,
+ /** @export */
+ __syscall_chdir: ___syscall_chdir,
+ /** @export */
+ __syscall_chmod: ___syscall_chmod,
+ /** @export */
+ __syscall_connect: ___syscall_connect,
+ /** @export */
+ __syscall_dup: ___syscall_dup,
+ /** @export */
+ __syscall_dup3: ___syscall_dup3,
+ /** @export */
+ __syscall_faccessat: ___syscall_faccessat,
+ /** @export */
+ __syscall_fchownat: ___syscall_fchownat,
+ /** @export */
+ __syscall_fcntl64: ___syscall_fcntl64,
+ /** @export */
+ __syscall_fdatasync: ___syscall_fdatasync,
+ /** @export */
+ __syscall_fstat64: ___syscall_fstat64,
+ /** @export */
+ __syscall_ftruncate64: ___syscall_ftruncate64,
+ /** @export */
+ __syscall_getcwd: ___syscall_getcwd,
+ /** @export */
+ __syscall_getdents64: ___syscall_getdents64,
+ /** @export */
+ __syscall_getpeername: ___syscall_getpeername,
+ /** @export */
+ __syscall_getsockname: ___syscall_getsockname,
+ /** @export */
+ __syscall_getsockopt: ___syscall_getsockopt,
+ /** @export */
+ __syscall_ioctl: ___syscall_ioctl,
+ /** @export */
+ __syscall_listen: ___syscall_listen,
+ /** @export */
+ __syscall_lstat64: ___syscall_lstat64,
+ /** @export */
+ __syscall_mkdirat: ___syscall_mkdirat,
+ /** @export */
+ __syscall_newfstatat: ___syscall_newfstatat,
+ /** @export */
+ __syscall_openat: ___syscall_openat,
+ /** @export */
+ __syscall_pipe: ___syscall_pipe,
+ /** @export */
+ __syscall_poll: ___syscall_poll,
+ /** @export */
+ __syscall_readlinkat: ___syscall_readlinkat,
+ /** @export */
+ __syscall_recvfrom: ___syscall_recvfrom,
+ /** @export */
+ __syscall_renameat: ___syscall_renameat,
+ /** @export */
+ __syscall_rmdir: ___syscall_rmdir,
+ /** @export */
+ __syscall_sendto: ___syscall_sendto,
+ /** @export */
+ __syscall_socket: ___syscall_socket,
+ /** @export */
+ __syscall_stat64: ___syscall_stat64,
+ /** @export */
+ __syscall_statfs64: ___syscall_statfs64,
+ /** @export */
+ __syscall_symlink: ___syscall_symlink,
+ /** @export */
+ __syscall_unlinkat: ___syscall_unlinkat,
+ /** @export */
+ __syscall_utimensat: ___syscall_utimensat,
+ /** @export */
+ _emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic,
+ /** @export */
+ _emscripten_throw_longjmp: __emscripten_throw_longjmp,
+ /** @export */
+ _gmtime_js: __gmtime_js,
+ /** @export */
+ _localtime_js: __localtime_js,
+ /** @export */
+ _mktime_js: __mktime_js,
+ /** @export */
+ _mmap_js: __mmap_js,
+ /** @export */
+ _munmap_js: __munmap_js,
+ /** @export */
+ _setitimer_js: __setitimer_js,
+ /** @export */
+ _tzset_js: __tzset_js,
+ /** @export */
+ abort: _abort,
+ /** @export */
+ emscripten_date_now: _emscripten_date_now,
+ /** @export */
+ emscripten_err: _emscripten_err,
+ /** @export */
+ emscripten_get_heap_max: _emscripten_get_heap_max,
+ /** @export */
+ emscripten_get_now: _emscripten_get_now,
+ /** @export */
+ emscripten_memcpy_js: _emscripten_memcpy_js,
+ /** @export */
+ emscripten_resize_heap: _emscripten_resize_heap,
+ /** @export */
+ environ_get: _environ_get,
+ /** @export */
+ environ_sizes_get: _environ_sizes_get,
+ /** @export */
+ exit: _exit,
+ /** @export */
+ fd_close: _fd_close,
+ /** @export */
+ fd_fdstat_get: _fd_fdstat_get,
+ /** @export */
+ fd_read: _fd_read,
+ /** @export */
+ fd_seek: _fd_seek,
+ /** @export */
+ fd_sync: _fd_sync,
+ /** @export */
+ fd_write: _fd_write,
+ /** @export */
+ getaddrinfo: _getaddrinfo,
+ /** @export */
+ getcontext: _getcontext,
+ /** @export */
+ getdtablesize: _getdtablesize,
+ /** @export */
+ gethostbyname_r: _gethostbyname_r,
+ /** @export */
+ getnameinfo: _getnameinfo,
+ /** @export */
+ getprotobyname: _getprotobyname,
+ /** @export */
+ getprotobynumber: _getprotobynumber,
+ /** @export */
+ invoke_i: invoke_i,
+ /** @export */
+ invoke_ii: invoke_ii,
+ /** @export */
+ invoke_iii: invoke_iii,
+ /** @export */
+ invoke_iiii: invoke_iiii,
+ /** @export */
+ invoke_iiiii: invoke_iiiii,
+ /** @export */
+ invoke_iiiiii: invoke_iiiiii,
+ /** @export */
+ invoke_iiiiiii: invoke_iiiiiii,
+ /** @export */
+ invoke_iiiiiiiiii: invoke_iiiiiiiiii,
+ /** @export */
+ invoke_v: invoke_v,
+ /** @export */
+ invoke_vi: invoke_vi,
+ /** @export */
+ invoke_vii: invoke_vii,
+ /** @export */
+ invoke_viidii: invoke_viidii,
+ /** @export */
+ invoke_viii: invoke_viii,
+ /** @export */
+ invoke_viiii: invoke_viiii,
+ /** @export */
+ invoke_viiiii: invoke_viiiii,
+ /** @export */
+ invoke_viiiiii: invoke_viiiiii,
+ /** @export */
+ makecontext: _makecontext,
+ /** @export */
+ proc_exit: _proc_exit,
+ /** @export */
+ strftime: _strftime,
+ /** @export */
+ strptime: _strptime,
+ /** @export */
+ swapcontext: _swapcontext
+};
+var wasmExports = createWasm();
+var ___wasm_call_ctors = createExportWrapper('__wasm_call_ctors');
+var _php_wasm_run = Module['_php_wasm_run'] = createExportWrapper('php_wasm_run');
+var _malloc = createExportWrapper('malloc');
+var setTempRet0 = createExportWrapper('setTempRet0');
+var _fflush = Module['_fflush'] = createExportWrapper('fflush');
+var _free = createExportWrapper('free');
+var ___errno_location = createExportWrapper('__errno_location');
+var _memcpy = createExportWrapper('memcpy');
+var _htons = createExportWrapper('htons');
+var _ntohs = createExportWrapper('ntohs');
+var _htonl = createExportWrapper('htonl');
+var _emscripten_builtin_memalign = createExportWrapper('emscripten_builtin_memalign');
+var __emscripten_timeout = createExportWrapper('_emscripten_timeout');
+var _setThrew = createExportWrapper('setThrew');
+var _emscripten_stack_init = () => (_emscripten_stack_init = wasmExports['emscripten_stack_init'])();
+var _emscripten_stack_get_free = () => (_emscripten_stack_get_free = wasmExports['emscripten_stack_get_free'])();
+var _emscripten_stack_get_base = () => (_emscripten_stack_get_base = wasmExports['emscripten_stack_get_base'])();
+var _emscripten_stack_get_end = () => (_emscripten_stack_get_end = wasmExports['emscripten_stack_get_end'])();
+var stackSave = createExportWrapper('stackSave');
+var stackRestore = createExportWrapper('stackRestore');
+var stackAlloc = createExportWrapper('stackAlloc');
+var _emscripten_stack_get_current = () => (_emscripten_stack_get_current = wasmExports['emscripten_stack_get_current'])();
+var dynCall_vij = Module['dynCall_vij'] = createExportWrapper('dynCall_vij');
+var dynCall_ji = Module['dynCall_ji'] = createExportWrapper('dynCall_ji');
+var dynCall_jiji = Module['dynCall_jiji'] = createExportWrapper('dynCall_jiji');
+
+function invoke_iii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_v(index) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)();
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_i(index) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)();
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viidii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+
+// include: postamble.js
+// === Auto-generated postamble setup entry stuff ===
+
+Module['ccall'] = ccall;
+var missingLibrarySymbols = [
+ 'writeI53ToI64',
+ 'writeI53ToI64Clamped',
+ 'writeI53ToI64Signaling',
+ 'writeI53ToU64Clamped',
+ 'writeI53ToU64Signaling',
+ 'readI53FromU64',
+ 'convertI32PairToI53',
+ 'convertU32PairToI53',
+ 'growMemory',
+ 'getCallstack',
+ 'emscriptenLog',
+ 'convertPCtoSourceLocation',
+ 'readEmAsmArgs',
+ 'jstoi_s',
+ 'listenOnce',
+ 'autoResumeAudioContext',
+ 'dynCallLegacy',
+ 'getDynCaller',
+ 'dynCall',
+ 'runtimeKeepalivePush',
+ 'runtimeKeepalivePop',
+ 'safeSetTimeout',
+ 'asmjsMangle',
+ 'handleAllocatorInit',
+ 'HandleAllocator',
+ 'getNativeTypeSize',
+ 'STACK_SIZE',
+ 'STACK_ALIGN',
+ 'POINTER_SIZE',
+ 'ASSERTIONS',
+ 'cwrap',
+ 'uleb128Encode',
+ 'sigToWasmTypes',
+ 'generateFuncType',
+ 'convertJsFunctionToWasm',
+ 'getEmptyTableSlot',
+ 'updateTableMap',
+ 'getFunctionAddress',
+ 'addFunction',
+ 'removeFunction',
+ 'reallyNegative',
+ 'unSign',
+ 'strLen',
+ 'reSign',
+ 'formatString',
+ 'intArrayToString',
+ 'AsciiToString',
+ 'UTF16ToString',
+ 'stringToUTF16',
+ 'lengthBytesUTF16',
+ 'UTF32ToString',
+ 'stringToUTF32',
+ 'lengthBytesUTF32',
+ 'registerKeyEventCallback',
+ 'maybeCStringToJsString',
+ 'findEventTarget',
+ 'findCanvasEventTarget',
+ 'getBoundingClientRect',
+ 'fillMouseEventData',
+ 'registerMouseEventCallback',
+ 'registerWheelEventCallback',
+ 'registerUiEventCallback',
+ 'registerFocusEventCallback',
+ 'fillDeviceOrientationEventData',
+ 'registerDeviceOrientationEventCallback',
+ 'fillDeviceMotionEventData',
+ 'registerDeviceMotionEventCallback',
+ 'screenOrientation',
+ 'fillOrientationChangeEventData',
+ 'registerOrientationChangeEventCallback',
+ 'fillFullscreenChangeEventData',
+ 'registerFullscreenChangeEventCallback',
+ 'JSEvents_requestFullscreen',
+ 'JSEvents_resizeCanvasForFullscreen',
+ 'registerRestoreOldStyle',
+ 'hideEverythingExceptGivenElement',
+ 'restoreHiddenElements',
+ 'setLetterbox',
+ 'softFullscreenResizeWebGLRenderTarget',
+ 'doRequestFullscreen',
+ 'fillPointerlockChangeEventData',
+ 'registerPointerlockChangeEventCallback',
+ 'registerPointerlockErrorEventCallback',
+ 'requestPointerLock',
+ 'fillVisibilityChangeEventData',
+ 'registerVisibilityChangeEventCallback',
+ 'registerTouchEventCallback',
+ 'fillGamepadEventData',
+ 'registerGamepadEventCallback',
+ 'registerBeforeUnloadEventCallback',
+ 'fillBatteryEventData',
+ 'battery',
+ 'registerBatteryEventCallback',
+ 'setCanvasElementSize',
+ 'getCanvasElementSize',
+ 'jsStackTrace',
+ 'stackTrace',
+ 'checkWasiClock',
+ 'wasiRightsToMuslOFlags',
+ 'wasiOFlagsToMuslOFlags',
+ 'createDyncallWrapper',
+ 'setImmediateWrapped',
+ 'clearImmediateWrapped',
+ 'polyfillSetImmediate',
+ 'getPromise',
+ 'makePromise',
+ 'idsToPromises',
+ 'makePromiseCallback',
+ 'ExceptionInfo',
+ 'findMatchingCatch',
+ 'setMainLoop',
+ 'FS_unlink',
+ 'FS_mkdirTree',
+ '_setNetworkCallback',
+ 'heapObjectForWebGLType',
+ 'heapAccessShiftForWebGLHeap',
+ 'webgl_enable_ANGLE_instanced_arrays',
+ 'webgl_enable_OES_vertex_array_object',
+ 'webgl_enable_WEBGL_draw_buffers',
+ 'webgl_enable_WEBGL_multi_draw',
+ 'emscriptenWebGLGet',
+ 'computeUnpackAlignedImageSize',
+ 'colorChannelsInGlTextureFormat',
+ 'emscriptenWebGLGetTexPixelData',
+ '__glGenObject',
+ 'emscriptenWebGLGetUniform',
+ 'webglGetUniformLocation',
+ 'webglPrepareUniformLocationsBeforeFirstUse',
+ 'webglGetLeftBracePos',
+ 'emscriptenWebGLGetVertexAttrib',
+ '__glGetActiveAttribOrUniform',
+ 'writeGLArray',
+ 'registerWebGlEventCallback',
+ 'runAndAbortIfError',
+ 'SDL_unicode',
+ 'SDL_ttfContext',
+ 'SDL_audio',
+ 'ALLOC_NORMAL',
+ 'ALLOC_STACK',
+ 'allocate',
+ 'writeStringToMemory',
+ 'writeAsciiToMemory',
+];
+missingLibrarySymbols.forEach(missingLibrarySymbol)
+
+var unexportedSymbols = [
+ 'run',
+ 'addOnPreRun',
+ 'addOnInit',
+ 'addOnPreMain',
+ 'addOnExit',
+ 'addOnPostRun',
+ 'addRunDependency',
+ 'removeRunDependency',
+ 'FS_createFolder',
+ 'FS_createPath',
+ 'FS_createLazyFile',
+ 'FS_createLink',
+ 'FS_createDevice',
+ 'FS_readFile',
+ 'out',
+ 'err',
+ 'callMain',
+ 'abort',
+ 'keepRuntimeAlive',
+ 'wasmMemory',
+ 'wasmExports',
+ 'stackAlloc',
+ 'stackSave',
+ 'stackRestore',
+ 'getTempRet0',
+ 'setTempRet0',
+ 'writeStackCookie',
+ 'checkStackCookie',
+ 'readI53FromI64',
+ 'convertI32PairToI53Checked',
+ 'ptrToString',
+ 'zeroMemory',
+ 'exitJS',
+ 'getHeapMax',
+ 'abortOnCannotGrowMemory',
+ 'ENV',
+ 'MONTH_DAYS_REGULAR',
+ 'MONTH_DAYS_LEAP',
+ 'MONTH_DAYS_REGULAR_CUMULATIVE',
+ 'MONTH_DAYS_LEAP_CUMULATIVE',
+ 'isLeapYear',
+ 'ydayFromDate',
+ 'arraySum',
+ 'addDays',
+ 'ERRNO_CODES',
+ 'ERRNO_MESSAGES',
+ 'setErrNo',
+ 'inetPton4',
+ 'inetNtop4',
+ 'inetPton6',
+ 'inetNtop6',
+ 'readSockaddr',
+ 'writeSockaddr',
+ 'DNS',
+ 'getHostByName',
+ 'Protocols',
+ 'Sockets',
+ 'initRandomFill',
+ 'randomFill',
+ 'timers',
+ 'warnOnce',
+ 'UNWIND_CACHE',
+ 'readEmAsmArgsArray',
+ 'jstoi_q',
+ 'getExecutableName',
+ 'handleException',
+ 'callUserCallback',
+ 'maybeExit',
+ 'asyncLoad',
+ 'alignMemory',
+ 'mmapAlloc',
+ 'wasmTable',
+ 'getCFunc',
+ 'freeTableIndexes',
+ 'functionsInTableMap',
+ 'setValue',
+ 'getValue',
+ 'PATH',
+ 'PATH_FS',
+ 'UTF8Decoder',
+ 'UTF8ArrayToString',
+ 'UTF8ToString',
+ 'stringToUTF8Array',
+ 'stringToUTF8',
+ 'lengthBytesUTF8',
+ 'intArrayFromString',
+ 'stringToAscii',
+ 'UTF16Decoder',
+ 'stringToNewUTF8',
+ 'stringToUTF8OnStack',
+ 'writeArrayToMemory',
+ 'JSEvents',
+ 'specialHTMLTargets',
+ 'currentFullscreenStrategy',
+ 'restoreOldWindowedStyle',
+ 'demangle',
+ 'demangleAll',
+ 'ExitStatus',
+ 'getEnvStrings',
+ 'doReadv',
+ 'doWritev',
+ 'promiseMap',
+ 'uncaughtExceptionCount',
+ 'exceptionLast',
+ 'exceptionCaught',
+ 'Browser',
+ 'wget',
+ 'SYSCALLS',
+ 'getSocketFromFD',
+ 'getSocketAddress',
+ 'preloadPlugins',
+ 'FS_createPreloadedFile',
+ 'FS_modeStringToFlags',
+ 'FS_getMode',
+ 'FS_stdin_getChar_buffer',
+ 'FS_stdin_getChar',
+ 'FS',
+ 'FS_createDataFile',
+ 'MEMFS',
+ 'TTY',
+ 'PIPEFS',
+ 'SOCKFS',
+ 'tempFixedLengthArray',
+ 'miniTempWebGLFloatBuffers',
+ 'miniTempWebGLIntBuffers',
+ 'GL',
+ 'emscripten_webgl_power_preferences',
+ 'AL',
+ 'GLUT',
+ 'EGL',
+ 'GLEW',
+ 'IDBStore',
+ 'SDL',
+ 'SDL_gfx',
+ 'allocateUTF8',
+ 'allocateUTF8OnStack',
+];
+unexportedSymbols.forEach(unexportedRuntimeSymbol);
+
+
+
+var calledRun;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!calledRun) run();
+ if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+};
+
+function stackCheckInit() {
+ // This is normally called automatically during __wasm_call_ctors but need to
+ // get these values before even running any of the ctors so we call it redundantly
+ // here.
+ _emscripten_stack_init();
+ // TODO(sbc): Move writeStackCookie to native to to avoid this.
+ writeStackCookie();
+}
+
+function run() {
+
+ if (runDependencies > 0) {
+ return;
+ }
+
+ stackCheckInit();
+
+ preRun();
+
+ // a preRun added a dependency, run will be called later
+ if (runDependencies > 0) {
+ return;
+ }
+
+ function doRun() {
+ // run may have just been called through dependencies being fulfilled just in this very frame,
+ // or while the async setStatus time below was happening
+ if (calledRun) return;
+ calledRun = true;
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ initRuntime();
+
+ readyPromiseResolve(Module);
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+ assert(!Module['_main'], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else
+ {
+ doRun();
+ }
+ checkStackCookie();
+}
+
+function checkUnflushedContent() {
+ // Compiler settings do not allow exiting the runtime, so flushing
+ // the streams is not possible. but in ASSERTIONS mode we check
+ // if there was something to flush, and if so tell the user they
+ // should request that the runtime be exitable.
+ // Normally we would not even include flush() at all, but in ASSERTIONS
+ // builds we do so just for this check, and here we see if there is any
+ // content to flush, that is, we check if there would have been
+ // something a non-ASSERTIONS build would have not seen.
+ // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0
+ // mode (which has its own special function for this; otherwise, all
+ // the code is inside libc)
+ var oldOut = out;
+ var oldErr = err;
+ var has = false;
+ out = err = (x) => {
+ has = true;
+ }
+ try { // it doesn't matter if it fails
+ _fflush(0);
+ // also flush in the JS FS layer
+ ['stdout', 'stderr'].forEach(function(name) {
+ var info = FS.analyzePath('/dev/' + name);
+ if (!info) return;
+ var stream = info.object;
+ var rdev = stream.rdev;
+ var tty = TTY.ttys[rdev];
+ if (tty && tty.output && tty.output.length) {
+ has = true;
+ }
+ });
+ } catch(e) {}
+ out = oldOut;
+ err = oldErr;
+ if (has) {
+ warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the Emscripten FAQ), or make sure to emit a newline when you printf etc.');
+ }
+}
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+run();
+
+
+// end include: postamble.js
+
+
+ return moduleArg.ready
+}
+
+);
+})();
+export default Module; \ No newline at end of file
diff --git a/examples/php-on-wasm/php-wasm.php b/examples/php-on-wasm/php-wasm.php
new file mode 100644
index 0000000..32c375e
--- /dev/null
+++ b/examples/php-on-wasm/php-wasm.php
@@ -0,0 +1,956 @@
+<?php
+
+declare(strict_types=1);
+
+require_once __DIR__ . '/../../vendor/autoload.php';
+
+$wasmBinary = file_get_contents(__DIR__ . '/php-wasm.wasm');
+
+use Nsfisis\Waddiwasi\BinaryFormat\Decoder;
+use Nsfisis\Waddiwasi\BinaryFormat\InvalidBinaryFormatException;
+use Nsfisis\Waddiwasi\Debug\Debug;
+use Nsfisis\Waddiwasi\Execution\ExternVal;
+use Nsfisis\Waddiwasi\Execution\FuncAddr;
+use Nsfisis\Waddiwasi\Execution\FuncInst;
+use Nsfisis\Waddiwasi\Execution\Nums;
+use Nsfisis\Waddiwasi\Execution\Refs;
+use Nsfisis\Waddiwasi\Execution\Runtime;
+use Nsfisis\Waddiwasi\Execution\Store;
+use Nsfisis\Waddiwasi\Execution\Val;
+use Nsfisis\Waddiwasi\Execution\Vals;
+use Nsfisis\Waddiwasi\Structure\Types\FuncType;
+use Nsfisis\Waddiwasi\Structure\Types\NumType;
+use Nsfisis\Waddiwasi\Structure\Types\ResultType;
+use Nsfisis\Waddiwasi\Structure\Types\ValType;
+
+const PHP_EMPTY = '';
+
+const PHP_HELLO_WORLD = <<<'EOS'
+echo "Hello, World!\n";
+EOS;
+
+echo "Decoding...\n";
+try {
+ $module = (new Decoder($wasmBinary))->decode();
+ // Debug::printImports($module);
+} catch (InvalidBinaryFormatException $e) {
+ echo $e->getMessage() . PHP_EOL;
+}
+
+echo "Instantiating...\n";
+$hostFuncs = [
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env__invoke_iii(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiii(...)),
+ makeHostFunc('(i32) -> ()', hostFunc__env__invoke_v(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiii(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env__invoke_ii(...)),
+ makeHostFunc('() -> ()', hostFunc__env__abort(...)),
+ makeHostFunc('(i32) -> ()', hostFunc__env__exit(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viii(...)),
+ makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env__invoke_vii(...)),
+ makeHostFunc('(i32, i32) -> ()', hostFunc__env__invoke_vi(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env__invoke_i(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiiii(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env____assert_fail(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiii(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiiii(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiii(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__invoke_iiiiiiiiii(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__strftime(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env__getaddrinfo(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__gethostbyname_r(...)),
+ makeHostFunc('() -> (i32)', hostFunc__env__getdtablesize(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env__getprotobyname(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env__getprotobynumber(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env__strptime(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env__getnameinfo(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> ()', hostFunc__env__invoke_viiiiii(...)),
+ makeHostFunc('(i32, i32, i32, f64, i32, i32) -> ()', hostFunc__env__invoke_viidii(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env__getcontext(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> ()', hostFunc__env__makecontext(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env__swapcontext(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__environ_sizes_get(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__environ_get(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_fcntl64(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_ioctl(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_close(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_read(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_write(...)),
+ makeHostFunc('(i32) -> ()', hostFunc__wasi_snapshot_preview1__proc_exit(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_faccessat(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_chdir(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_chmod(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_fchownat(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_dup(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_dup3(...)),
+ makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env__emscripten_memcpy_js(...)),
+ makeHostFunc('() -> (f64)', hostFunc__env__emscripten_date_now(...)),
+ makeHostFunc('() -> (i32)', hostFunc__env___emscripten_get_now_is_monotonic(...)),
+ makeHostFunc('() -> (f64)', hostFunc__env__emscripten_get_now(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_fdatasync(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_openat(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_fstat64(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_stat64(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_newfstatat(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_lstat64(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_sync(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_getcwd(...)),
+ makeHostFunc('(i32) -> ()', hostFunc__env__emscripten_err(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_fdstat_get(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_mkdirat(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_pipe(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_poll(...)),
+ makeHostFunc('(i32, i32) -> ()', hostFunc__env____call_sighandler(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_getdents64(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_readlinkat(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_renameat(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env____syscall_rmdir(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall__newselect(...)),
+ makeHostFunc('(i32, f64) -> (i32)', hostFunc__env___setitimer_js(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_statfs64(...)),
+ makeHostFunc('(i32, i32) -> (i32)', hostFunc__env____syscall_symlink(...)),
+ makeHostFunc('() -> (i32)', hostFunc__env__emscripten_get_heap_max(...)),
+ makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___tzset_js(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_unlinkat(...)),
+ makeHostFunc('(i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_utimensat(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env__emscripten_resize_heap(...)),
+ makeHostFunc('() -> ()', hostFunc__env___emscripten_throw_longjmp(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_accept4(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_bind(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_connect(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getpeername(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getsockname(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_getsockopt(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_listen(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_recvfrom(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_sendto(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env____syscall_socket(...)),
+ makeHostFunc('(i32, i32, i32) -> (i32)', hostFunc__env____syscall_ftruncate64(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32) -> (i32)', hostFunc__wasi_snapshot_preview1__fd_seek(...)),
+ makeHostFunc('(i32) -> (i32)', hostFunc__env___mktime_js(...)),
+ makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___localtime_js(...)),
+ makeHostFunc('(i32, i32, i32) -> ()', hostFunc__env___gmtime_js(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env___munmap_js(...)),
+ makeHostFunc('(i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)', hostFunc__env___mmap_js(...)),
+];
+$store = Store::empty();
+$externVals = [];
+foreach ($hostFuncs as $hostFunc) {
+ $store->funcs[] = $hostFunc;
+ $externVals[] = ExternVal::Func(new FuncAddr(count($store->funcs) - 1));
+}
+$runtime = Runtime::instantiate($store, $module, $externVals);
+$codePtr = allocateStringOnWasmMemory($runtime, PHP_HELLO_WORLD);
+
+echo "Executing...\n";
+$results = $runtime->invoke("php_wasm_run", [Val::NumI32($codePtr)]);
+assert(count($results) === 1);
+$result = $results[0];
+assert($result instanceof Vals\Num);
+assert($result->inner instanceof Nums\I32);
+$exitCode = $result->inner->value;
+
+echo "Exit code: $exitCode\n";
+
+function allocateStringOnWasmMemory(Runtime $runtime, string $str): int {
+ // Plus 1 for the null terminator in C.
+ $size = strlen($str) + 1;
+ $outPtr = wasm_stackAlloc($runtime, $size);
+ copyStringToWasmMemory($runtime, $outPtr, $str);
+ return $outPtr;
+}
+
+function wasm_stackAlloc(Runtime $runtime, int $size): int {
+ $results = $runtime->invoke("stackAlloc", [Val::NumI32($size)]);
+ assert(count($results) === 1);
+ $result = $results[0];
+ assert($result instanceof Vals\Num);
+ assert($result->inner instanceof Nums\I32);
+ return $result->inner->value;
+}
+
+function wasm_stackSave(Runtime $runtime): int {
+ $results = $runtime->invoke("stackSave", []);
+ assert(count($results) === 1);
+ $result = $results[0];
+ assert($result instanceof Vals\Num);
+ assert($result->inner instanceof Nums\I32);
+ return $result->inner->value;
+}
+
+function copyStringToWasmMemory(Runtime $runtime, int $dst, string $src): void {
+ $mem = $runtime->getExportedMemory('memory');
+ for ($i = 0; $i < strlen($src); $i++) {
+ $ok = $mem->storeByte($dst + $i, ord($src[$i]));
+ assert($ok);
+ }
+ // Terminate the string with a null byte for interoperation with C.
+ $ok = $mem->storeByte($dst + strlen($src), 0);
+ assert($ok);
+}
+
+function makeHostFunc(string $typeDef, callable $fn): FuncInst {
+ $stringToType = fn (string $s) => match ($s) {
+ 'i32' => ValType::NumType(NumType::I32),
+ 'i64' => ValType::NumType(NumType::I64),
+ 'f32' => ValType::NumType(NumType::F32),
+ 'f64' => ValType::NumType(NumType::F64),
+ default => throw new \RuntimeException('Invalid type: ' . $s),
+ };
+ preg_match('/^\(([^)]*)\) -> \(([^)]*)\)$/', $typeDef, $matches);
+ $paramsDef = $matches[1];
+ $resultsDef = $matches[2];
+ $params = array_map($stringToType, $paramsDef === '' ? [] : explode(', ', $paramsDef));
+ $results = array_map($stringToType, $resultsDef === '' ? [] : explode(', ', $resultsDef));
+ $type = new FuncType(new ResultType($params), new ResultType($results));
+ return FuncInst::Host($type, $fn);
+}
+
+function getWasmTableEntry(Runtime $runtime, int $funcPtr): FuncAddr {
+ static $wasmTable = null;
+
+ if ($wasmTable === null) {
+ $wasmTable = $runtime->getExportedTable('__indirect_function_table');
+ assert($wasmTable !== null);
+ }
+
+ $func = $wasmTable->elem[$funcPtr] ?? null;
+ assert($func instanceof Refs\RefFunc, "Expected RefFunc, but got " . get_class($func));
+ return $func->addr;
+}
+
+function syscallGetStr(Runtime $runtime, int $ptr): string {
+ $mem = $runtime->getExportedMemory('memory');
+ $str = '';
+ for ($i = $ptr; $mem->loadByte($i) !== 0; $i++) {
+ $str .= chr($mem->loadByte($i));
+ }
+ return $str;
+}
+
+function syscallCalculateAt(Runtime $runtime, int $dirfd, string $path): string {
+ if ($path[0] === '/') {
+ return $path;
+ }
+ if ($dirfd === -100) {
+ $dir = getcwd();
+ } else {
+ throw new \RuntimeException("syscallCalculateAt: not implemented ($dirfd)");
+ }
+ if ($path === '.') {
+ return $dir;
+ } else {
+ return $dir . '/' . $path;
+ }
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iii(Runtime $runtime): void {
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iiiii(Runtime $runtime): void {
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32) -> ()
+function hostFunc__env__invoke_v(Runtime $runtime): void {
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iiii(Runtime $runtime): void {
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env__invoke_ii(Runtime $runtime): void {
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: () -> ()
+function hostFunc__env__abort(Runtime $runtime): void {
+ throw new \RuntimeException('env::abort: not implemented');
+}
+
+// Type: (i32) -> ()
+function hostFunc__env__exit(Runtime $runtime): void {
+ throw new \RuntimeException('env::exit: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> ()
+function hostFunc__env__invoke_viii(Runtime $runtime): void {
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32) -> ()
+function hostFunc__env__invoke_vii(Runtime $runtime): void {
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32) -> ()
+function hostFunc__env__invoke_vi(Runtime $runtime): void {
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env__invoke_i(Runtime $runtime): void {
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iiiiiii(Runtime $runtime): void {
+ $a6 = $runtime->stack->popI32();
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->stack->pushI32($a6);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32) -> ()
+function hostFunc__env____assert_fail(Runtime $runtime): void {
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32) -> ()
+function hostFunc__env__invoke_viiii(Runtime $runtime): void {
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> ()
+function hostFunc__env__invoke_viiiii(Runtime $runtime): void {
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iiiiii(Runtime $runtime): void {
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__invoke_iiiiiiiiii(Runtime $runtime): void {
+ $a9 = $runtime->stack->popI32();
+ $a8 = $runtime->stack->popI32();
+ $a7 = $runtime->stack->popI32();
+ $a6 = $runtime->stack->popI32();
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->stack->pushI32($a6);
+ $runtime->stack->pushI32($a7);
+ $runtime->stack->pushI32($a8);
+ $runtime->stack->pushI32($a9);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env__strftime(Runtime $runtime): void {
+ throw new \RuntimeException('env::strftime: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env__getaddrinfo(Runtime $runtime): void {
+ throw new \RuntimeException('env::getaddrinfo: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__gethostbyname_r(Runtime $runtime): void {
+ throw new \RuntimeException('env::gethostbyname_r: not implemented');
+}
+
+// Type: () -> (i32)
+function hostFunc__env__getdtablesize(Runtime $runtime): void {
+ throw new \RuntimeException('env::getdtablesize: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env__getprotobyname(Runtime $runtime): void {
+ throw new \RuntimeException('env::getprotobyname: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env__getprotobynumber(Runtime $runtime): void {
+ throw new \RuntimeException('env::getprotobynumber: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env__strptime(Runtime $runtime): void {
+ throw new \RuntimeException('env::strptime: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env__getnameinfo(Runtime $runtime): void {
+ throw new \RuntimeException('env::getnameinfo: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32) -> ()
+function hostFunc__env__invoke_viiiiii(Runtime $runtime): void {
+ $a6 = $runtime->stack->popI32();
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popI32();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushI32($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->stack->pushI32($a6);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32, i32, i32, f64, i32, i32) -> ()
+function hostFunc__env__invoke_viidii(Runtime $runtime): void {
+ $a5 = $runtime->stack->popI32();
+ $a4 = $runtime->stack->popI32();
+ $a3 = $runtime->stack->popF64();
+ $a2 = $runtime->stack->popI32();
+ $a1 = $runtime->stack->popI32();
+ $index = $runtime->stack->popI32();
+ $sp = wasm_stackSave($runtime);
+ $func = getWasmTableEntry($runtime, $index);
+ $runtime->stack->pushI32($a1);
+ $runtime->stack->pushI32($a2);
+ $runtime->stack->pushF64($a3);
+ $runtime->stack->pushI32($a4);
+ $runtime->stack->pushI32($a5);
+ $runtime->invokeByFuncAddr($func);
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env__getcontext(Runtime $runtime): void {
+ throw new \RuntimeException('env::getcontext: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> ()
+function hostFunc__env__makecontext(Runtime $runtime): void {
+ throw new \RuntimeException('env::makecontext: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env__swapcontext(Runtime $runtime): void {
+ throw new \RuntimeException('env::swapcontext: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__environ_sizes_get(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::environ_sizes_get: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__environ_get(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::environ_get: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_fcntl64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_fcntl64: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_ioctl(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_ioctl: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_close(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::fd_close: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_read(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::fd_read: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_write(Runtime $runtime): void {
+ // Output pointer to the number of bytes written.
+ $pnum = $runtime->stack->popI32();
+ // Length of the array of iov structs.
+ $iovcnt = $runtime->stack->popI32();
+ // Pointer to the array of iov structs.
+ $iov = $runtime->stack->popI32();
+ // File descripter.
+ $fd = $runtime->stack->popI32();
+
+ // struct iov {
+ // ptr: u32, pointer to the data
+ // len: u32
+ // }
+ assert($fd === 1 || $fd === 2, "fd: $fd");
+
+ $mem = $runtime->getExportedMemory('memory');
+
+ $nWritten = 0;
+ for ($i = 0; $i < $iovcnt; $i++) {
+ $ptr = $mem->loadI32($iov + $i * 8, 4, true);
+ $len = $mem->loadI32($iov + $i * 8 + 4, 4, true);
+ $buf = '';
+ for ($j = 0; $j < $len; $j++) {
+ $buf .= chr($mem->loadByte($ptr + $j));
+ }
+ if ($fd === 1) {
+ fputs(STDOUT, $buf);
+ } else {
+ fputs(STDERR, $buf);
+ }
+ $nWritten += $len;
+ }
+ $mem->storeI32($pnum, $nWritten, 4);
+
+ $runtime->stack->pushI32(0);
+}
+
+// Type: (i32) -> ()
+function hostFunc__wasi_snapshot_preview1__proc_exit(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::proc_exit: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_faccessat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_faccessat: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env____syscall_chdir(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_chdir: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_chmod(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_chmod: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_fchownat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_fchownat: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env____syscall_dup(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_dup: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_dup3(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_dup3: not implemented');
+}
+
+// Type: (i32, i32, i32) -> ()
+function hostFunc__env__emscripten_memcpy_js(Runtime $runtime): void {
+ $num = $runtime->stack->popI32();
+ $src = $runtime->stack->popI32();
+ $dest = $runtime->stack->popI32();
+ $mem = $runtime->getExportedMemory('memory');
+ for ($i = 0; $i < $num; $i++) {
+ $byte = $mem->loadByte($src + $i);
+ $mem->storeByte($dest + $i, $byte);
+ }
+}
+
+// Type: () -> (f64)
+function hostFunc__env__emscripten_date_now(Runtime $runtime): void {
+ throw new \RuntimeException('env::emscripten_date_now: not implemented');
+}
+
+// Type: () -> (i32)
+function hostFunc__env___emscripten_get_now_is_monotonic(Runtime $runtime): void {
+ throw new \RuntimeException('env::_emscripten_get_now_is_monotonic: not implemented');
+}
+
+// Type: () -> (f64)
+function hostFunc__env__emscripten_get_now(Runtime $runtime): void {
+ throw new \RuntimeException('env::emscripten_get_now: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env____syscall_fdatasync(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_fdatasync: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_openat(Runtime $runtime): void {
+ $varargs = $runtime->stack->popI32();
+ $flags = $runtime->stack->popI32();
+ $path = $runtime->stack->popI32();
+ $dirfd = $runtime->stack->popI32();
+
+ $path = syscallGetStr($runtime, $path);
+ $path = syscallCalculateAt($runtime, $dirfd, $path);
+
+ $mem = $runtime->getExportedMemory('memory');
+
+ if ($varargs !== 0) {
+ $mode = $mem->loadI32($varargs, 4, true);
+ $varargs += 4;
+ } else {
+ $mode = 0;
+ }
+
+ // echo "syscall_openat: $path, $flags, $mode\n";
+
+ // no such file
+ $runtime->stack->pushI32(-44);
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_fstat64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_fstat64: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_stat64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_stat64: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_newfstatat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_newfstatat: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_lstat64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_lstat64: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_sync(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::fd_sync: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_getcwd(Runtime $runtime): void {
+ $size = $runtime->stack->popI32();
+ $bufPtr = $runtime->stack->popI32();
+ if ($size === 0) {
+ $runtime->stack->pushI32(-28);
+ return;
+ }
+ $cwd = getcwd();
+ $cwdLen = strlen($cwd) + 1;
+ if ($size < $cwdLen) {
+ $runtime->stack->pushI32(-68);
+ return;
+ }
+ copyStringToWasmMemory($runtime, $bufPtr, $cwd);
+ $runtime->stack->pushI32($cwdLen);
+}
+
+// Type: (i32) -> ()
+function hostFunc__env__emscripten_err(Runtime $runtime): void {
+ throw new \RuntimeException('env::emscripten_err: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_fdstat_get(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::fd_fdstat_get: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_mkdirat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_mkdirat: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env____syscall_pipe(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_pipe: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_poll(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_poll: not implemented');
+}
+
+// Type: (i32, i32) -> ()
+function hostFunc__env____call_sighandler(Runtime $runtime): void {
+ throw new \RuntimeException('env::__call_sighandler: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_getdents64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_getdents64: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_readlinkat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_readlinkat: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_renameat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_renameat: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env____syscall_rmdir(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_rmdir: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall__newselect(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall__newselect: not implemented');
+}
+
+// Type: (i32, f64) -> (i32)
+function hostFunc__env___setitimer_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_setitimer_js: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_statfs64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_statfs64: not implemented');
+}
+
+// Type: (i32, i32) -> (i32)
+function hostFunc__env____syscall_symlink(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_symlink: not implemented');
+}
+
+// Type: () -> (i32)
+function hostFunc__env__emscripten_get_heap_max(Runtime $runtime): void {
+ throw new \RuntimeException('env::emscripten_get_heap_max: not implemented');
+}
+
+// Type: (i32, i32, i32) -> ()
+function hostFunc__env___tzset_js(Runtime $runtime): void {
+ $tzname = $runtime->stack->popI32();
+ $daylight = $runtime->stack->popI32();
+ $timezone = $runtime->stack->popI32();
+ // Do nothing ;)
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_unlinkat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_unlinkat: not implemented');
+}
+
+// Type: (i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_utimensat(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_utimensat: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env__emscripten_resize_heap(Runtime $runtime): void {
+ throw new \RuntimeException('env::emscripten_resize_heap: not implemented');
+}
+
+// Type: () -> ()
+function hostFunc__env___emscripten_throw_longjmp(Runtime $runtime): void {
+ throw new \RuntimeException('env::_emscripten_throw_longjmp: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_accept4(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_accept4: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_bind(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_bind: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_connect(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_connect: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_getpeername(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_getpeername: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_getsockname(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_getsockname: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_getsockopt(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_getsockopt: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_listen(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_listen: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_recvfrom(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_recvfrom: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_sendto(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_sendto: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_socket(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_socket: not implemented');
+}
+
+// Type: (i32, i32, i32) -> (i32)
+function hostFunc__env____syscall_ftruncate64(Runtime $runtime): void {
+ throw new \RuntimeException('env::__syscall_ftruncate64: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__wasi_snapshot_preview1__fd_seek(Runtime $runtime): void {
+ throw new \RuntimeException('wasi_snapshot_preview1::fd_seek: not implemented');
+}
+
+// Type: (i32) -> (i32)
+function hostFunc__env___mktime_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_mktime_js: not implemented');
+}
+
+// Type: (i32, i32, i32) -> ()
+function hostFunc__env___localtime_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_localtime_js: not implemented');
+}
+
+// Type: (i32, i32, i32) -> ()
+function hostFunc__env___gmtime_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_gmtime_js: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env___munmap_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_munmap_js: not implemented');
+}
+
+// Type: (i32, i32, i32, i32, i32, i32, i32, i32) -> (i32)
+function hostFunc__env___mmap_js(Runtime $runtime): void {
+ throw new \RuntimeException('env::_mmap_js: not implemented');
+}
diff --git a/examples/php-on-wasm/php-wasm.wasm b/examples/php-on-wasm/php-wasm.wasm
new file mode 100755
index 0000000..8e91021
--- /dev/null
+++ b/examples/php-on-wasm/php-wasm.wasm
Binary files differ